Dz.U.UE.L.2018.319.1

| Akt jednorazowy
Wersja od: 14 grudnia 2018 r.

ROZPORZĄDZENIE DELEGOWANE KOMISJI (UE) 2018/1922
z dnia 10 października 2018 r.
zmieniające rozporządzenie Rady (WE) nr 428/2009 ustanawiające wspólnotowy system kontroli wywozu, transferu, pośrednictwa i tranzytu w odniesieniu do produktów podwójnego zastosowania

KOMISJA EUROPEJSKA,

uwzględniając Traktat o funkcjonowaniu Unii Europejskiej,

uwzględniając rozporządzenie Rady (WE) nr 428/2009 z dnia 5 maja 2009 r. ustanawiające wspólnotowy system kontroli wywozu, transferu, pośrednictwa i tranzytu w odniesieniu do produktów podwójnego zastosowania 1 , w szczególności jego art. 15 ust. 3,

a także mając na uwadze, co następuje:

(1) Rozporządzenie (WE) nr 428/2009 wprowadziło wymóg skutecznej kontroli produktów podwójnego zastosowania podczas wywozu z Unii, tranzytu przez Unię lub dostawy do państwa trzeciego w wyniku usług pośrednictwa świadczonych przez pośrednika mającego miejsce pobytu lub siedzibę w Unii.

(2) W załączniku I do rozporządzenia (WE) nr 428/2009 określono wspólny wykaz produktów podwójnego zastosowania podlegających kontroli w Unii. Decyzje dotyczące produktów podlegających kontroli podejmowane są w ramach Grupy Australijskiej 2 , Reżimu Kontrolnego Technologii Rakietowych 3 , Grupy Dostawców Jądrowych 4 , porozumienia z Wassenaar 5  oraz Konwencji o zakazie prowadzenia badań, produkcji, składowania i użycia broni chemicznej oraz o zniszczeniu jej zapasów.

(3) Wykaz produktów podwójnego zastosowania określony w załączniku I do rozporządzenia (WE) nr 428/2009 należy regularnie aktualizować w celu zapewnienia pełnej zgodności z międzynarodowymi zobowiązaniami w dziedzinie bezpieczeństwa, zagwarantowania przejrzystości oraz utrzymania konkurencyjności podmiotów gospodarczych. Zmiany w wykazach kontrolnych przyjęte przez międzynarodowe reżimy nieproliferacji i porozumienia w sprawie kontroli wywozu w 2017 r. wymagają obecnie kolejnej zmiany załącznika I do rozporządzenia (WE) nr 428/2009. W celu ułatwienia stosowania odesłań przez organy kontroli wywozu i podmioty gospodarcze należy zastąpić załącznik I do tego rozporządzenia.

(4) Załączniki IIa-IIf do rozporządzenia (WE) nr 428/2009 ustanawiają generalne unijne zezwolenia na wywóz.

(5) W załączniku IIg do rozporządzenia (WE) nr 428/2009 ustanowiono wykaz produktów podwójnego zastosowania, które mają być wyłączone z zakresu generalnych krajowych zezwoleń na wywóz i generalnych unijnych zezwoleń na wywóz.

(6) Załącznik IV do rozporządzenia (WE) nr 428/2009 ustanawia wymogi dotyczące zezwoleń w odniesieniu do niektórych transferów wewnątrzwspólnotowych.

(7) Zmiany w wykazie produktów podwójnego zastosowania określonym w załączniku I wymagają wynikających z nich zmian w załącznikach IIa-IIg i załączniku IV w odniesieniu do produktów podwójnego zastosowania, które są wymienione również w załącznikach IIa-IIg i załączniku IV.

(8) Rozporządzenie (WE) nr 428/2009 upoważnia Komisję do aktualizowania wykazu produktów podwójnego zastosowania określonego w załączniku I oraz w załącznikach IIa-IIg i załączniku IV poprzez przyjmowanie aktów delegowanych zgodnie z odpowiednimi zobowiązaniami i obowiązkami oraz wszelkimi ich modyfikacjami, które państwa członkowskie przyjęły jako członkowie międzynarodowych systemów nieproliferacyjnych i porozumień w sprawie kontroli wywozu lub w drodze ratyfikacji stosownych traktatów międzynarodowych.

(9) Mając na uwadze znaczenie zapewnienia pełnej zgodności z międzynarodowymi zobowiązaniami w dziedzinie bezpieczeństwa tak szybko, jak to tylko praktycznie możliwe, niniejsze rozporządzenie powinno wejść w życie następnego dnia po jego opublikowaniu.

(10) Należy zatem odpowiednio zmienić rozporządzenie (WE) nr 428/2009,

PRZYJMUJE NINIEJSZE ROZPORZĄDZENIE:

Artykuł  1

W rozporządzeniu Rady (WE) nr 428/2009 wprowadza się następujące zmiany:

1) załącznik I zastępuje się tekstem znajdującym się w załączniku I do niniejszego rozporządzenia;
2) załączniki IIa-IIg zastępuje się tekstem znajdującym się w załączniku II do niniejszego rozporządzenia;
3) załącznik IV zastępuje się tekstem znajdującym się w załączniku III do niniejszego rozporządzenia.
Artykuł  2

Niniejsze rozporządzenie wchodzi w życie następnego dnia po jego opublikowaniu w Dzienniku Urzędowym Unii Europejskiej.

Niniejsze rozporządzenie wiąże w całości i jest bezpośrednio stosowane we wszystkich państwach członkowskich.
Sporządzono w Brukseli dnia 10 października 2018 r.
W imieniu Komisji
Jean-Claude JUNCKER
Przewodniczący

ZAŁĄCZNIKI

ZAŁĄCZNIK  I

"

ZAŁĄCZNIK  I

WYKAZ PRODUKTÓW PODWÓJNEGO-ZASTOSOWANIA

(o którym mowa w art. 3 niniejszego rozporządzenia)

Niniejszy wykaz wprowadza kontrolę podwójnego zastosowania uzgodnioną na szczeblu międzynarodowym, w tym w ramach porozumienia z Wassenaar 6 , Reżimu Kontrolnego Technologii Rakietowych 7 , Grupy Dostawców Jądrowych 8 , Grupy Australijskiej 9  oraz Konwencji o zakazie prowadzenia badań, produkcji, składowania i użycia broni chemicznej oraz o zniszczeniu jej zapasów.

SPIS TREŚCI

Uwagi

Akronimy i skróty

Definicje

Kategoria 0 Materiały, instalacje i urządzenia jądrowe

Kategoria 1 Materiały specjalne i związane z nimi urządzenia

Kategoria 2 Przetwarzanie materiałów

Kategoria 3 Elektronika

Kategoria 4 Komputery

Kategoria 5 Telekomunikacja i "ochrona informacji"

Kategoria 6 Czujniki i lasery

Kategoria 7 Nawigacja i awionika

Kategoria 8 Urządzenia okrętowe

Kategoria 9 Kosmonautyka, aeronautyka, napęd

UWAGI OGÓLNE DO ZAŁĄCZNIKA I

1. W przypadku towarów, które są zaprojektowane lub zmodyfikowane do zastosowań wojskowych, należy sprawdzić także odpowiedni wykaz kontrolny uzbrojenia publikowany w danym państwie członkowskim. Odsyłacz, który mówi "ZOB. TAKŻE WYKAZ UZBROJENIA", odnosi się do tych wykazów.

2. Cel kontroli przewidzianej w niniejszym załączniku nie może być omijany przez eksportowanie jakichkolwiek towarów niepodlegających kontroli (łącznie z instalacjami) zawierających jeden lub więcej składników podlegających kontroli, gdy kontrolowany składnik lub składniki są zasadniczymi elementami tych towarów i możliwe jest ich wydzielenie lub zastosowanie do innych celów

N.B. Przy rozstrzyganiu, czy kontrolowany składnik lub składniki mają być uważane za elementy zasadnicze, konieczne jest rozważenie czynników: ilości, wartości, zawartości technologicznego know-how i innych szczególnych okoliczności, które mogą zdecydować, że kontrolowany składnik lub składniki są zasadniczymi elementami dostarczanych towarów.

3. Towary wymienione w niniejszym załączniku obejmują zarówno towary nowe, jak i używane

4. W niektórych przypadkach podana jest nazwa i numer CAS chemikaliów. Wykaz ma zastosowanie do chemikaliów o tym samym wzorze strukturalnym (w tym do hydratów), niezależnie od nazwy i numeru CAS. Numery CAS są podane, by ułatwiać identyfikację danych chemikaliów lub mieszanin, bez względu na nomenklaturę. Numery CAS nie mogą być stosowane jako jedyne źródło informacji służące do identyfikacji chemikaliów, gdyż niektóre postacie wymienionych chemikaliów mają różne numery CAS, a mieszaniny zawierające chemikalia wymienione w wykazie mogą także mieć różne numery CAS.

UWAGA DO TECHNOLOGII JĄDROWEJ (UdTJ)

(Czytać łącznie z grupą E kategorii 0)

"Technologia" bezpośrednio związana z którymikolwiek towarami wymienionymi w kategorii 0 objęta jest kontrolą zgodnie z postanowieniami kategorii 0.

"Technologia" służąca "rozwojowi", "produkcji" lub "użytkowaniu" towarów objętych kontrolą pozostaje pod taką samą kontrolą nawet wtedy, gdy może być stosowana do towarów nieobjętych taką kontrolą.

Zgoda na wywóz określonych towarów upoważnia również do wywozu do tego samego użytkownika minimalnej "technologii" wymaganej dla zainstalowania, eksploatacji, utrzymania i naprawy tych towarów.

Kontrole transferu "technologii" nie mają zastosowania do informacji "będących własnością publiczną" lub związanych z "podstawowymi badaniami naukowymi".

UWAGA OGÓLNA DO TECHNOLOGII (UOdT)

(Czytać łącznie z grupą E kategorii od 1 do 9)

Wywóz "technologii", która jest "niezbędna" do "rozwoju", "produkcji" lub "użytkowania" towarów wymienionych w kategoriach od 1 do 9, podlega kontroli na warunkach podanych w każdej z tych kategorii.

"Technologia", która jest "niezbędna" do "rozwoju", "produkcji" lub "użytkowania" towarów objętych kontrolą pozostaje pod taką samą kontrolą nawet wtedy, gdy może być stosowana do towarów nieobjętych taką kontrolą.

Kontrolą nie obejmuje się minimalnej "technologii" wymaganej do zainstalowania, eksploatacji, utrzymania lub naprawy towarów niekontrolowanych lub takich, które uzyskały odrębnie zgodę na wywóz.

Uwaga: Powyższe nie zwalnia od kontroli "technologii" wymienionych w pozycjach 1E002.e, 1E002.f, 8E002.a i 8E002.b.

Kontrola transferu "technologii" nie ma zastosowania do informacji "będących własnością publiczną", związanych z "podstawowymi badaniami naukowymi" lub minimum informacji koniecznych przy składaniu wniosków patentowych.

UWAGA DO OPROGRAMOWANIA JĄDROWEGO (UdOJ)

(Niniejsza uwaga jest nadrzędna w stosunku do kontroli określonych w grupie D kategorii 0)

Grupa D kategorii 0 niniejszego wykazu nie obejmuje kontrolą "oprogramowania", które jest minimalnym "kodem obiektu" niezbędnym do zainstalowania, eksploatacji, utrzymania lub naprawy towarów, które uzyskały odrębnie zgodę na wywóz.

Zgoda na wywóz określonych towarów upoważnia również do wywozu do tego samego użytkownika minimalnego "kodu wynikowego" wymaganego dla zainstalowania, eksploatacji, utrzymania lub naprawy tych towarów.

Uwaga: Uwaga do oprogramowania jądrowego nie zwalnia z kontroli "oprogramowania" wymienionego w kategorii 5 - część 2 ("Ochrona informacji").

UWAGA OGÓLNA DO OPROGRAMOWANIA (UOdO)

(Niniejsza uwaga jest nadrzędna w stosunku do kontroli określonych w grupie D kategorii od 1 do 9)

Kategorie 1 do 9 niniejszego wykazu nie obejmują kontrolą "oprogramowania" będącego którymkolwiek z poniższych:

a. oprogramowanie jest ogólnie dostępne poprzez:

1. sprzedaż gotowego oprogramowania w punktach sprzedaży detalicznej bez żadnych ograniczeń w wyniku:

a. bezpośrednich transakcji sprzedaży;

b. transakcji realizowanych na zamówienie pocztowe;

c. transakcji zawieranych drogą elektroniczną; lub

d. transakcji zawieranych telefonicznie; oraz

2. przygotowanie do samodzielnej instalacji przez użytkownika bez konieczności dalszej znacznej pomocy ze strony sprzedawcy;

Uwaga: Punkt a uwagi ogólnej do oprogramowania nie zwalnia od kontroli "oprogramowania" wymienionego w kategorii 5 - część 2 ("Ochrona informacji").

b. oprogramowanie jest uznawane za "będące własnością publiczną"; lub

c. jest minimalnym "kodem wynikowym" wymaganym do zainstalowania, eksploatacji, utrzymania lub naprawy towarów, które uzyskały odrębnie zgodę na wywóz.

Uwaga: Punkt c uwagi ogólnej do oprogramowania nie zwalnia od kontroli "oprogramowania" wymienionego w kategorii 5 - część 2 ("Ochrona informacji").

UWAGA OGÓLNA DO "OCHRONY INFORMACJI" (UOdOI)

Elementy lub funkcje "ochrony informacji" należy rozpatrywać w kontekście postanowień kategorii 5 - część 2, nawet jeżeli stanowią one składniki, "oprogramowanie" lub funkcje innych obiektów.

PRAKTYKA REDAKCYJNA W DZIENNIKU URZĘDOWYM UNII EUROPEJSKIEJ

Zgodnie z zasadami określonymi w pkt 6.5 na str. 108 Międzyinstytucjonalnego przewodnika redakcyjnego (wydanie z 2015 r.) w tekstach w języku angielskim publikowanych w Dzienniku Urzędowym Unii Europejskiej:

- do oddzielenia liczby całkowitej od wartości dziesiętnych używa się przecinka,

- liczby całkowite przedstawione są w seriach po trzy cyfry, przy czym serie oddzielone są spacją. W tekście zamieszczonym w niniejszym załączniku stosowane są wyżej wymienione zasady.

AKRONIMY I SKRÓTY UŻYWANE W NINIEJSZYM ZAŁĄCZNIKU

Akronimy lub skróty użyte jako zdefiniowany termin znajdują się w "Definicjach terminów używanych w niniejszym załączniku".

AKRONIM LUB SKRÓT ZNACZENIE
ABECKomitet Inżynierów Łożysk Pierścieniowych
ADCprzetwornik analogowo-cyfrowy
AGMAAmerykańskie Stowarzyszenie Producentów Przekładni
AHRSukłady informujące o położeniu i kursie
AISIAmerykański Instytut Żelaza i Stali
ALEepitaksja warstw atomowych
ALUjednostka arytmetyczno-logiczna
ANSIAmerykański Narodowy Instytut Normalizacji
APPskorygowana wydajność szczytowa
APUpomocnicze źródło zasilania
ASTMAmerykańskie Towarzystwo Materiałoznawcze
ATCkontrola ruchu lotniczego
BJTbipolarne tranzystory mocy
BPPiloczyn parametrów wiązki
BSCsterownik stacji bazowych
CADprojektowanie wspomagane komputerowo
CASSerwis Dokumentacji Chemicznej
CCDmatryca CCD
CDUjednostka sterowania i wyświetlania
CEPkrąg równego prawdopodobieństwa
CMMurządzenie do pomiaru współrzędnych
CMOSuzupełniająca struktura metal-tlenek-półprzewodnik
CNTDrozkład termiczny z regulowanym zarodkowaniem
CPLDzłożone programowalne urządzenie logiczne
CPUjednostka centralna (procesor)
CVDosadzanie chemiczne z pary
CWwojna chemiczna
CW (dotyczy laserów)fala ciągła (w laserach)
DACprzetwornik cyfrowoanalogowy
DANLśredni wyświetlany poziom szumu
DBRNnawigacja oparta na informacjach z bazy danych
DDSbezpośredni syntezer cyfrowy
DMAdynamiczna analiza mechaniczna
DMEradiodalmierz
DMOSFETdyfuzyjny tranzystor polowy o strukturze metal-tlenek-półprzewodnik
DSukierunkowane krzepnięcie
EBeksplodujący zapłonnik mostkowy
EB-PVDfizyczne osadzanie pary z wiązką elektronów
EBWeksplodujące zapłonniki połączeń mostkowych
ECMelektromechaniczne techniki obróbki
EDMelektroiskrowe obrabiarki
EEPROMSelektronicznie wymazywalna programowana pamięć tylko do odczytu
EFIeksplodujące zapłonniki foliowe
EIRPefektywna moc wypromieniowana izotropowo
ERFelektroreologiczna obróbka wykańczająca
ERPskuteczna moc promieniowania
ETOtyrystor wyłączalny emiterem
ETTtyrystor wyzwalany elektrycznie
FADECcałkowicie autonomiczny system cyfrowego sterowania silnikami
FFTszybka transformata Fouriera
FPGAmacierz bramek programowalna przez użytkownika
FPICpołączenie wewnętrzne programowalne przez użytkownika
FPLAmatryca logiczna programowalna przez użytkownika
FPOoperacja zmiennoprzecinkowa
FWHMszerokość pliku w połowie jego wysokości
GSMglobalny system łączności ruchomej
GLONASSglobalny system nawigacji satelitarnej
GPSglobalny system lokalizacji
GNSSglobalny system nawigacji satelitarnej
GTOtyrystor wyłączalny prądem bramki
HBTtranzystory heterobipolarne
HEMTtranzystory o wysokiej ruchliwości elektronów
ICAOMiędzynarodowa Organizacja Lotnictwa Cywilnego
IECMiędzynarodowa Komisja Elektrotechniczna
IEDimprowizowane urządzenie wybuchowe
IEEEInstytut Inżynierów Elektryki i Elektroniki
IFOVchwilowe pole widzenia
IGBTtranzystor bipolarny z izolowaną bramką
IGCTtyrystor o komutowanej bramce
IHOMiędzynarodowa Organizacja Hydrograficzna
ILSsystem lądowania na przyrządy
IMUinercyjna jednostka pomiarowa
INSinercyjny system nawigacyjny
IPprotokół internetowy
IRSinercyjny system odniesienia
IRUinercyjna jednostka odniesienia
ISAmiędzynarodowa atmosfera wzorcowa
ISARradar z odwróconą syntezą apertury
ISOMiędzynarodowa Organizacja Normalizacyjna
ITUMiędzynarodowy Związek Telekomunikacyjny
JTJoule-Thomson
LIDARradar optyczny
LIDTpróg uszkodzeń wywołanych laserem
LOAdługość całkowita
LRUliniowy element wymienny
MLSmikrofalowe systemy lądowania
MMICmonolityczny mikrofalowy układ scalony
MOCVDosadzanie z par lotnych związków metaloorganicznych
MOSFETtranzystor polowy o strukturze metal-tlenek-półprzewodnik
MPMmikrofalowy moduł mocy
MRAMstatyczna pamięć o dostępie swobodnym
MRFmagnetoreologiczna obróbka wykańczająca
MRFrozmiar minimalnej rozdzielczości wymiarowej
MRItworzenie obrazów za pomocą rezonansu magnetycznego
MTBFśredni czas międzyawaryjny
MTTFśredni czas do awarii
NAapertura liczbowa
NDTbadanie nieniszczące
NEQzawartość materiałów wybuchowych netto
OAMeksploatacja, administrowanie lub utrzymywanie
OSIpołączenie systemów otwartych
PAIpoliamidoimidy
PARurządzenia radiolokacyjne dokładnego podejścia do lądowania
PCLpasywna koherentna lokacja
PINosobisty numer identyfikacyjny
PMRprywatne systemy radiowej łączności ruchomej
PVDnaparowywanie próżniowe
ppmczęści na milion
QAMmodulacja kwadraturowa
RAPplazmy atomów reaktywnych
RFczęstotliwość radiowa
RNCsterownik sieci radiowej
RNSSregionalny system nawigacji satelitarnej
S-FILnarzędzia do litografii "step-and-flash"
SARradar z syntezą apertury
SASsonar z syntezą apertury
SCmonokryształ
SCRprostownik tyrystorowy
SFDRzakres dynamiki wolny od zafałszowań
SHPLlaser o superwysokiej mocy
SLARradar pokładowy obserwacji bocznej
SOIkrzem na izolatorze
SQUIDnadprzewodzące urządzenie do interferencji kwantowej
SRAwarsztatowy zespół wymienny
SRAMstatyczna pamięć o dostępie swobodnym
SSBpojedyncza wstęga boczna
SSRradar wtórnego nadzorowania
SSSboczny sonar skanujący
TIRcałkowity wskazany odczyt
TVRodpowiedź na pobudzenie napięciowe
ujednostka masy atomowej
UPRjednokierunkowa powtarzalność pozycjonowania
UVnadfiolet
UTSwytrzymałość na rozciąganie
VJFETpionowy tranzystor polowy złączowy
VORradiolatarnia kierunkowa wysokiej częstotliwości
WLANlokalna sieć bezprzewodowa

DEFINICJE TERMINÓW UŻYWANYCH W NINIEJSZYM ZAŁĄCZNIKU

Definicje terminów w 'cudzysłowie pojedynczym' podano w uwadze technicznej do odpowiedniej pozycji.

Definicje terminów w "cudzysłowie podwójnym" są następujące:

N.B. Odnośniki do kategorii podano w nawiasach po zdefiniowanym terminie.

"Dokładność" (2, 3, 6, 7, 8), zazwyczaj określana w kategoriach niedokładności, oznacza maksymalne odchylenie, dodatnie lub ujemne, danej wartości od uznanej wartości standardowej lub prawdziwej.

"Układy aktywnego sterowania lotem" (7) oznaczają układy zapobiegające niepożądanym ruchom lub obciążeniom konstrukcyjnym "statku powietrznego" lub pocisku rakietowego przez autonomiczne przetwarzanie sygnałów z wielu czujników i wydawanie niezbędnych poleceń do realizacji sterowania automatycznego.

"Piksel aktywny" (6) oznacza najmniejszy (pojedynczy) element sieci elementów półprzewodnikowych mający możliwość realizacji funkcji fotoelektrycznych w odpowiedzi na promieniowanie świetlne (elektromagnetyczne).

"Skorygowana wydajność szczytowa" (4) oznacza skorygowaną największą prędkość, z jaką "komputery cyfrowe" wykonują zmiennoprzecinkowe operacje dodawania i mnożenia na liczbach 64-bitowych lub dłuższych; wyraża się w teraflopsach ważonych (WT), jednostkach wynoszących 1012 skorygowanych operacji zmiennoprzecinkowych na sekundę.

N.B. Zob. kategoria 4, uwaga techniczna.

"Statek powietrzny" (1, 6, 7, 9) oznacza stałopłat, statek z obrotowymi skrzydłami, wiropłat (helikopter), statek ze zmiennym wirnikiem lub zmiennopłat.

N.B. Zob. również "cywilne statki powietrzne".

"Pojazd powietrzny" (9) oznacza napędzany mechanicznie pojazd utrzymujący się w powietrzu dzięki korpusowi wypełnionemu gazem (zwykle helem, wcześniej wodorem), który jest lżejszy od powietrza.

"Wszystkie dostępne kompensacje" (2) - oznacza to, że uwzględniono wszystkie wykonalne środki, jakie może zastosować producent w celu zminimalizowania wszystkich systematycznych błędów pozycjonowania określonego modelu obrabiarki lub błędów pomiarowych określonego urządzenia do pomiaru współrzędnych.

"Przydzielone przez ITU" (3, 5) oznacza przydział pasm częstotliwości zgodnie z Przepisami Radiowymi ITU (International Telecommunication Union - Międzynarodowej Unii Telekomunikacyjnej) dla służb podstawowych, dopuszczonych i pomocniczych.

N.B. Nie obejmuje to przydziałów dodatkowych i alternatywnych.

"Odchylenie położenia kątowego" (2) oznacza maksymalną różnicę pomiędzy położeniem kątowym a rzeczywistym, bardzo dokładnie zmierzonym położeniem kątowym po obróceniu stołu montażowego w stosunku do jego położenia początkowego.

"Kąt błądzenia losowego" (7) oznacza narastanie błędu kątowego w czasie, spowodowane białym szumem w prędkości kątowej. (IEEE STD 528-2001)

"APP" (4) - zob. "Skorygowana wydajność szczytowa".

"Algorytm asymetryczny" (5) oznacza algorytm kryptograficzny, w którym stosuje się różne, powiązane matematycznie, klucze do szyfrowania i deszyfrowania.

N.B. Powszechnym zastosowaniem "algorytmu asymetrycznego" jest zarządzanie kluczami.

"Uwierzytelnienie" (5) oznacza sprawdzenie tożsamości użytkownika, procesu lub urządzenia, często jako warunek konieczny dla umożliwienia dostępu do zasobów w systemie informatycznym. Obejmuje to weryfikację źródła lub treści wiadomości lub innych informacji oraz wszystkie aspekty kontroli dostępu, gdzie nie występuje szyfrowanie plików lub fragmentów tekstów, z wyjątkiem tych bezpośrednio związanych z ochroną haseł, osobistych numerów identyfikacyjnych (PIN) lub podobnych danych stosowanych do ochrony przed nieuprawnionym dostępem.

"Przeciętna moc wyjściowa" (6) oznacza całkowitą energię wyjściową "lasera" wyrażoną w dżulach podzieloną przez czas emitowania pojedynczego impulsu lub serii kolejnych impulsów wyrażony w sekundach. Dla serii jednolicie rozmieszczonych impulsów jest ona równa całkowitej energii wyjściowej "lasera" w jednym impulsie wyrażonej w dżulach pomnożonej przez częstotliwość impulsów "lasera" wyrażonej w hercach.

"Opóźnienie sygnału bramki podstawowej" (3) oznacza wartość opóźnienia sygnału odpowiadającą bramce podstawowej, używanej w 'rodzinie' "monolitycznych układów scalonych". Można ją wyznaczyć dla danej 'rodziny' "monolitycznych układów scalonych" jako opóźnienie sygnału na bramkę typową w ramach danej 'rodziny' lub jako typowe opóźnienie na bramkę w ramach danej 'rodziny'.

N.B.1. Nie należy mylić "opóźnienia sygnału bramki podstawowej" z opóźnieniem wyjścia/wejścia złożonego "monolitycznego układu scalonego".

N.B.2. Do 'rodziny' zalicza się wszystkie układy scalone, których metody produkcji i specyfikacje techniczne, z wyjątkiem ich odpowiednich funkcji, spełniają wszystkie następujące kryteria:

a. wspólna architektura sprzętowa i oprogramowania;

b. wspólna technologia projektowania i przetwarzania; oraz

c. wspólne charakterystyki podstawowe.

"Podstawowe badania naukowe" (UOdT, UdTJ) oznaczają prace doświadczalne lub teoretyczne prowadzone głównie w celu uzyskania nowej wiedzy o podstawach danego zjawiska lub obserwowalnych jego efektach, nienakierowane bezpośrednio na konkretne cele lub zadania praktyczne.

"Wychylenie wstępne akcelerometru" (7) oznacza średnią wartość wskazywaną przez akcelerometr przez określony czas, mierzoną w określonych warunkach eksploatacyjnych i niewykazującą współzależności z przyspieszeniem wejściowym ani z wejściową prędkością obrotową. "Wychylenie wstępne akcelerometru" wyrażone jest w gramach lub w metrach na sekundę do kwadratu (g lub m/s2) (norma IEEE 528-2001) (mikrogram równy jest 1 × 10-6 g).

"Wychylenie wstępne żyroskopu" (7) oznacza średnią wartość wskazywaną przez żyroskop przez określony czas, mierzoną w określonych warunkach eksploatacyjnych i niewykazującą współzależności z wejściową prędkością obrotową ani z przyspieszeniem wejściowym. "Wychylenie wstępne żyroskopu" wyrażone jest z reguły w stopniach na godzinę (o/h). (Norma IEEE Std 528-2001).

"Czynniki biologiczne" (1) oznaczają patogeny lub toksyny, wybrane lub zmodyfikowane (np. poprzez zmianę czystości, dopuszczalnego okresu magazynowania, agresywności, charakterystyki propagacji lub odporności na promieniowanie nadfioletowe), by wywołać straty w ludności lub zwierzętach, unieszkodliwić sprzęt lub spowodować straty w uprawach rolnych lub środowisku.

"Bicie osiowe" (2) oznacza przemieszczenie osiowe wrzeciona głównego podczas jednego obrotu, mierzone w płaszczyźnie prostopadłej do czoła wrzeciona, w punkcie sąsiadującym z obwodem czoła wrzeciona (zob. ISO 230 część 1-1986, pkt 5.63).

"Laser chemiczny" (6) oznacza "laser", w którym wzbudzanie czynnika następuje za pomocą energii pochodzącej z reakcji chemicznej.

"Mieszanina chemiczna" (1) oznacza produkt stały, płynny lub gazowy składający się z dwóch lub więcej składników, które nie reagują ze sobą w warunkach, w których mieszanina jest przechowywana.

"Krąg Równego Prawdopodobieństwa" ("CEP") (7) oznacza w kołowym rozkładzie normalnym promień okręgu zawierającego 50 % poszczególnych wyników pomiarów lub promień okręgu, w którym występuje 50 % prawdopodobieństwo, że obiekt zostanie zlokalizowany.

"Cyrkulacyjne układy równoważenia momentu lub cyrkulacyjne układy sterowania kierunkiem" (7) oznaczają układy, w których przepływ powietrza wokół powierzchni aerodynamicznych jest wykorzystywany do zwiększenia powstających na nich sił lub do kierowania nimi.

"Cywilne statki powietrzne" (1, 3, 4, 7) oznaczają "statki powietrzne" wymienione i określone przez organy lotnictwa cywilnego co najmniej jednego państwa członkowskiego UE lub państwa uczestniczącego w porozumieniu z Wassenaar w podawanych do wiadomości publicznej wykazach świadectw zdatności do lotu jako zdatne do użytkowania do komercyjnych celów cywilnych na liniach wewnętrznych i zewnętrznych lub do legalnych celów cywilnych, prywatnych lub związanych z prowadzeniem działalności gospodarczej.

N.B. Zob. również "statek powietrzny".

"Sterownik toru telekomunikacyjnego" (4) oznacza interfejs fizyczny sterujący przepływem cyfrowych informacji synchronicznych lub asynchronicznych. Jest to zespół, który może być wbudowany w komputer lub urządzenie telekomunikacyjne z zadaniem zapewniania dostępu do łączy telekomunikacyjnych.

"Systemy kompensacji" (6) składają się z głównego czujnika skalarnego, co najmniej jednego czujnika odniesienia (np. "magnetometru" wektorowego) wraz z oprogramowaniem zezwalającym na zmniejszenie szumu ruchu obrotowego korpusu sztywnego platformy.

"Materiał kompozytowy" (1, 2, 6, 8, 9) oznacza "matrycę" oraz dodatkową fazę lub dodatkowe fazy, składające się z cząstek, włókienek, włókien lub dowolnej ich kombinacji, dodawanych w określonym celu lub celach.

"Związki III/V" (3, 6) oznaczają substancje polikrystaliczne, binarne lub złożone substancje monokrystaliczne składające się z pierwiastków grupy IIIA i VA układu okresowego pierwiastków (np. arsenek galu, arsenek galu i glinu, fosforek indu).

"Sterowanie kształtowe" (2) oznacza co najmniej dwa ruchy "sterowane numerycznie", realizowane zgodnie z instrukcjami określającymi następne położenie oraz potrzebne do osiągnięcia tego położenia prędkości posuwów. Prędkości posuwów nie są jednakowe, wskutek czego powstaje wymagany kształt (zob. ISO/DIS 2806 - 1980).

"Temperatura krytyczna" (1, 3, 5) (nazywana czasami "temperaturą przemiany") danego materiału "nadprzewodzącego" jest temperaturą, w której materiał całkowicie traci oporność dla przepływu elektrycznego prądu stałego.

"Aktywacja kryptograficzna" (5) oznacza dowolną technikę, która specjalnie aktywuje lub umożliwia funkcje kryptograficzne danego artykułu za pomocą mechanizmu zastosowanego przez producenta tego artykułu, jeżeli mechanizm ten jest w sposób niepowtarzalny związany z dowolnym z poniższych:

1. pojedynczą sztuką danego artykułu; lub

2. jednym klientem w przypadku wielu sztuk artykułu.

Uwagi techniczne:

1. Techniki i mechanizmy "aktywacji kryptograficznej" mogą być realizowane w postaci sprzętu, "oprogramowania" lub "technologii".

2. Mechanizmem "aktywacji kryptograficznej" mogą być, na przykład, klucz licencyjny powiązany z numerem seryjnym lub instrumenty uwierzytelniające, jak np. certyfikat z podpisem cyfrowym.

"Kryptografia" (5) to dziedzina wiedzy zajmująca się zasadami, narzędziami i metodami przekształcania danych w celu ukrycia zawartych w nich informacji, zapobiegania możliwości niepostrzeżonego ich modyfikowania lub uniemożliwienia dostępu do nich osobom niepowołanym. "Kryptografia" ogranicza się do przekształcania informacji za pomocą jednego lub większej liczby 'tajnych parametrów' (np. szyfrów) lub związanego z tym zarządzania kluczami.

Uwaga: "Kryptografia" nie obejmuje 'ustalonych' technik kompresji ani kodowania danych.

Uwagi techniczne:

1. 'Tajny parametr': wartość stała lub klucz trzymany w tajemnicy przed osobami postronnymi lub znany wyłącznie pewnej grupie osób.

2. 'Ustalony' oznacza algorytm kodowania lub kompresji, który nie może akceptować parametrów dostarczonych z zewnątrz (np. zmiennych do szyfrowania lub kluczy) i nie może być modyfikowany przez użytkownika.

"Laser o fali ciągłej" (6) oznacza "laser" dający nominalnie stałą energię wyjściową w czasie dłuższym niż 0,25 s.

"Nawigacja na bazie danych z wielu źródeł" ("DBRN") (7) oznacza systemy oparte na danych z wielu źródeł uprzednio zmierzonych danych geograficznych zintegrowanych w celu uzyskania dokładnych informacji nawigacyjnych w warunkach dynamicznych. Do źródeł danych należą mapy batymetryczne, mapy nieba, mapy grawitacji, mapy magnetyczne lub trójwymiarowe cyfrowe mapy terenowe.

"Uran zubożony" (0) oznacza uran, w którym zawartość izotopu 235 obniżono do ilości mniejszej niż w warunkach naturalnych.

"Rozwój" (wszystkie UOdT, UdTJ) odnosi się do wszystkich etapów poprzedzających produkcję seryjną, takich jak: projektowanie, badania projektowe, analiza projektowa, koncepcja projektowania, montaż i testowanie prototypów, plany produkcji pilotowej, dane projektowe, proces przetwarzania danych projektowych w produkt, projektowanie konfiguracji, projektowanie montażu całościowego, rozplanowanie.

"Zgrzewanie dyfuzyjne" (1, 2, 9) oznacza łączenie molekularne w stanie stałym co najmniej dwóch oddzielnych elementów metali w jeden element, przy czym wytrzymałość miejsca połączenia jest równa wytrzymałości najsłabszego z materiałów, a podstawowym mechanizmem jest interdyfuzja atomów na styku obu elementów.

"Komputer cyfrowy" (4, 5) oznacza urządzenie zdolne do wykonywania, w postaci jednej lub kilku zmiennych dyskretnych, wszystkich poniższych funkcji:

a. przyjmowanie danych;

b. zapamiętywanie danych lub instrukcji na trwałych lub nietrwałych (zapis usuwalny) urządzeniach pamięciowych;

c. przetwarzanie danych za pomocą zapamiętanej sekwencji instrukcji, którą można modyfikować; oraz

d. generowanie danych wyjściowych.

N.B. Modyfikacje zapamiętanej sekwencji instrukcji dotyczą wymiany trwałych urządzeń pamięciowych, ale nie fizycznych zmian przewodów lub połączeń.

"Szybkość transmisji danych cyfrowych" (def) oznacza całkowitą szybkość informacji w bitach, przesyłanych bezpośrednio na dowolnym typie nośnika.

N.B. Zob. także "całkowita szybkość transmisji danych cyfrowych".

"Współczynnik dryftu (żyroskopu)" (7) oznacza składową wyjściową rotacji żyroskopu funkcjonalnie niezależną od rotacji wejściowej. Jest wyrażany jako prędkość kątowa. (Norma IEEE STD 528-2001).

"Gram efektywny" (0, 1) "specjalnego materiału rozszczepialnego" oznacza:

a. dla izotopów plutonu i uranu-233 - masę izotopu w gramach;

b. dla uranu wzbogaconego do poziomu 1 % lub więcej izotopu uranu-235 - masę pierwiastka w gramach pomnożoną przez kwadrat jego wzbogacenia wyrażonego w postaci ułamka dziesiętnego udziału wagowego;

c. dla uranu wzbogaconego w izotop uranu-235 do poziomu poniżej 1 procenta - masę pierwiastka w gramach pomnożoną przez 0,0001.

"Zespół elektroniczny" (2, 3, 4) oznacza pewną liczbę elementów elektronicznych (tj. 'elementów obwodu', 'elementów dyskretnych', układów scalonych itp.) połączonych ze sobą w celu realizacji określonej(-ych) funkcji, wymienialną w całości, która zazwyczaj może być demontowana.

N.B.1. 'Element obwodu': pojedyncza czynna lub bierna funkcjonalna część układu elektronicznego, np. jedna dioda, jeden tranzystor, jeden rezystor, jeden kondensator itp.

N.B.2. 'Element dyskretny': oddzielnie obudowany 'element obwodu' z własnymi końcówkami wyjściowymi.

"Materiały energetyczne" (1) oznaczają substancje lub mieszanki wchodzące w reakcje chemiczne, by uwolnić energię potrzebną do ich zamierzonego zastosowania. Podklasami materiałów energetycznych są "materiały wybuchowe", "materiały pirotechniczne" i "paliwa".

"Manipulatory" (2) obejmują uchwyty, 'aktywne jednostki oprzyrządowania' lub wszelkie inne oprzyrządowanie zamontowane na podstawowej (bazowej) płycie na końcu ramienia manipulacyjnego "robota".

N.B. 'Aktywne jednostki oprzyrządowania': urządzenia do przyłożenia mocy napędowej, energii procesowej lub czujnika do przedmiotu obrabianego.

"Gęstość zastępcza" (6) oznacza masę elementu optycznego na jednostkę pola powierzchni optycznej rzutowanej na powierzchnię optyczną.

"Materiały wybuchowe" (1) oznaczają stałe, ciekłe lub gazowe substancje lub mieszaniny substancji, które mają za zadanie detonować w charakterze ładunku inicjującego, detonatora pośredniego lub ładunku głównego w głowicach bojowych, w robotach rozbiórkowych lub w innych zastosowaniach.

"Systemy FADEC" (9) oznaczają całkowicie autonomiczne systemy cyfrowego sterowania silnikami, czyli cyfrowe elektroniczne systemy sterowania silnikami turbospalinowymi, które są w stanie autonomicznie sterować tymi silnikami w całym zakresie ich pracy, od uruchamiania do wyłączania ich na żądanie, zarówno w warunkach ich normalnej, jak i nieprawidłowej pracy.

"Materiały włókniste lub włókienkowe" (0, 1, 8, 9) obejmują następujące pojęcia:

a. "włókna elementarne" o strukturze ciągłej;

b. "przędza" i "rowing" o strukturze ciągłej;

c. "taśmy", tkaniny, maty i oploty o strukturze bezładnej;

d. włókna cięte na drobne kawałki, włókna pocięte na dłuższe odcinki oraz spójne maty z włókien;

e. wiskery, monokrystaliczne lub polikrystaliczne, o dowolnej długości;

f. pulpa z poliamidu aromatycznego.

"Układ scalony warstwowy" (3) oznacza układ 'elementów obwodu' i metalowych łączników, wytworzony techniką osadzania grubej lub cienkiej warstwy na "podłożu" o właściwościach izolujących.

N.B. 'Element obwodu': pojedyncza czynna lub bierna funkcjonalna część układu elektronicznego, np. jedna dioda, jeden tranzystor, jeden rezystor, jeden kondensator itp.

"System Fly-by-light" (7) oznacza główny cyfrowy system kontroli lotu wykorzystujący informacje zwrotne do sterowania "statkiem powietrznym" w czasie lotu, w którym komendy do siłowników przekazywane są w formie sygnałów optycznych.

"System Fly-by-wire" (7) oznacza główny cyfrowy system kontroli lotu wykorzystujący informacje zwrotne do sterowania "statkiem powietrznym" w czasie lotu, w którym komendy do siłowników przekazywane są w formie sygnałów elektrycznych.

"Matryca detektorowa płaszczyzny ogniskowej" (6, 8) oznacza płaską warstwę o strukturze liniowej lub dwuwymiarowej lub połączenie takich płaskich warstw, złożonych z oddzielnych elementów detekcyjnych, z elektronicznym urządzeniem odczytującym lub bez, pracująca w płaszczyźnie ogniskowej.

N.B. Definicja ta nie obejmuje stosu pojedynczych elementów detekcyjnych ani detektorów dwu-, trzy- lub czteroelementowych, pod warunkiem że w elemencie nie są realizowane opóźnienie ani integracja.

"Ułamkowa szerokość pasma" (3, 5) oznacza "szerokość chwilową pasma" podzieloną przez częstotliwość środkową, wyrażoną w procentach.

"Rozrzucanie częstotliwości" (frequency hopping) (5, 6) oznacza formę "rozproszenia widma" polegającą na krokowo-dyskretnej zmianie częstotliwości nośnej pojedynczego kanału telekomunikacyjnego, w sposób losowy lub pseudolosowy.

"Czas przełączania częstotliwości" (3) oznacza czas (tj. opóźnienie), jakiego potrzebuje sygnał przy przełączaniu się z początkowej zgodnej ze specyfikacjami częstotliwości wyjściowej, by osiągnąć dowolną z poniższych wartości:

a. ± 100 Hz zgodnej ze specyfikacjami końcowej częstotliwości wyjściowej wynoszącej mniej niż 1 GHz; lub

b. ± 0,1 części na milion zgodnej ze specyfikacjami końcowej częstotliwości wyjściowej równej lub większej niż 1 GHz.

"Ogniwo paliwowe" (8) oznacza urządzenie elektrochemiczne, które zużywając paliwo ze źródła zewnętrznego, przetwarza energię chemiczną bezpośrednio w prąd stały.

"Topliwy" (1) oznacza taki, który może być dalej sieciowany lub polimeryzowany (utwardzany) przy użyciu ciepła, promieniowania, katalizatora itd. lub stopiony bez pirolizy (zwęglania).

"Instalacje do naprowadzania" (7) oznaczają systemy scalające proces pomiaru i obliczania położenia pojazdu i jego prędkości (tj. nawigację) z obliczeniami i wysyłaniem poleceń do systemów sterowania lotem pojazdu w celu skorygowania jego toru lotu.

"Hybrydowy układ scalony" (3) oznacza dowolne połączenie układu(-ów) scalonego(-ych) lub układu scalonego z 'elementami układu' lub 'składnikami dyskretnymi' połączonymi ze sobą w celu realizacji określonej(-ych) funkcji, mające wszystkie wymienione poniżej cechy:

a. posiada co najmniej jedno urządzenie nieobudowane;

b. zastosowano w nim typowe metody łączenia stosowane podczas produkcji układów scalonych;

c. można je wymieniać tylko w całości; oraz

d. w normalnych warunkach nie można go rozmontować.

N.B.1. 'Element obwodu': pojedyncza czynna lub bierna funkcjonalna część układu elektronicznego, np. jedna dioda, jeden tranzystor, jeden rezystor, jeden kondensator itp.

N.B.2. 'Element dyskretny': oddzielnie obudowany 'element obwodu' z własnymi końcówkami wyjściowymi.

"Wzmacnianie obrazu" (4) oznacza przetwarzanie obrazów zawierających informacje, uzyskanych ze źródeł zewnętrznych, za pomocą algorytmów, takich jak kompresja czasu, filtrowanie, ekstrahowanie, selekcja, korelacja, splatanie lub przemieszczanie pomiędzy domenami (np. za pomocą szybkiej transformacji Fouriera lub transformacji Walsha). Nie obejmuje kontrolą algorytmów, w których stosowane są wyłącznie przekształcenia liniowe lub obrotowe pojedynczego obrazu, takie jak przesunięcie, ekstrahowanie jakiejś cechy, rejestracja lub fałszywe barwienie.

"Immunotoksyna" (1) oznacza koniugat jednokomórkowego przeciwciała monoklonalnego i "toksyny" lub "podjednostki toksyny", który wpływa selektywnie na komórki chorobowo zmienione.

"Będące własnością publiczną" (UOdT UdTJ UOdO), w odniesieniu do niniejszego dokumentu, oznacza "technologię" lub "oprogramowanie" dostępne bez żadnych ograniczeń co do ich dalszego rozpowszechniania (ograniczenia wynikające z praw autorskich nie wykluczają uznania "technologii" lub "oprogramowania" za "będące własnością publiczną").

"Ochrona informacji" (UOdO UOdOI 5) oznacza wszystkie środki i funkcje zapewniające dostęp, poufność lub nienaruszalność informacji lub komunikacji, z wyłączeniem środków i funkcji mających zabezpieczać przed wadliwym działaniem. Obejmuje "kryptografię", "aktywację kryptograficzną", 'kryptoanalizę', ochronę przed przypadkowym przekazywaniem sygnałów odnoszących się do tajnych informacji oraz zabezpieczanie komputerów.

Uwaga techniczna:

'Kryptoanaliza': analiza systemów kryptograficznych lub ich wejść i wyjść w celu uzyskania tajnych informacji lub danych, włączając w to tajne teksty.

"Chwilowa szerokość pasma" (3, 5, 7) oznacza szerokość pasma, w którym moc wyjściowa pozostaje na stałym poziomie z dokładnością do 3 dB bez regulacji innych parametrów roboczych.

"Zasięg przyrządowy" (6) oznacza jednoznacznie określony zasięg radaru.

"Izolacja" (9) jest pojęciem stosowanym do podzespołów silnika rakietowego, tj. osłony, dyszy, wlotów, zamknięć osłon, obejmującym utrwalone lub półutrwalone maty kauczukowe zawierające materiał ogniotrwały lub izolacyjny. Można je również stosować na klatki lub klapy odprężające.

"Wykładzina wewnętrzna" (9) oznacza warstwę pośrednią pomiędzy paliwem stałym a obudową lub warstwą izolacyjną. Zazwyczaj jest to płynna polimerowa zawiesina materiału ogniotrwałego lub izolacyjnego, np. polibutadien z łańcuchami zakończonymi grupami hydroksylowymi (HTPB) wypełniony węglem lub inny polimer z dodatkiem środków utrwalających, rozpylonych lub rozsmarowanych na wewnętrznej powierzchni osłony.

"Przetworniki analogowo-cyfrowe (ADC) z przeplotem" (3) oznaczają urządzenia mające wiele jednostek ADC próbkujących ten sam wejściowy sygnał analogowy w różnych momentach, tak że po zagregowaniu sygnałów wyjściowych analogowy sygnał wejściowy jest skutecznie próbkowany i przekształcany z większą częstotliwością próbkowania.

"Miernik gradientu magnetycznego właściwego" (6) oznacza pojedynczy element do pomiaru gradientu pola magnetycznego oraz związane z nim urządzenia elektroniczne, służący do pomiaru gradientu pola magnetycznego.

N.B. Zob. również "Miernik gradientu magnetycznego".

"Złośliwe oprogramowanie" (4) oznacza "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane w celu uniknięcia wykrycia przez 'narzędzia monitorujące' lub złamania 'środków zabezpieczających' komputera lub urządzenia zdolnego do pracy w sieci, wykonujące następujące działania:

a. pobieranie danych i informacji z komputera lub urządzenia zdolnego do pracy w sieci lub modyfikacja systemu lub danych użytkownika; lub

b. modyfikacja standardowych ścieżek wykonywania programu lub procesu w celu umożliwienia wykonania instrukcji pochodzących z zewnątrz.

Uwagi:

1. "Złośliwe oprogramowanie" nie obejmuje żadnego z poniższych pojęć:

a. hiperwizorów, programów do usuwania błędów oraz narzędzi inżynierii wstecznej oprogramowania (Software Reverse Engineering - SRE);

b. "oprogramowania" dotyczącego zarządzania prawami cyfrowymi; lub

c. "oprogramowania" przeznaczonego do zainstalowania przez producentów, administratorów lub użytkowników do celów śledzenia lub znajdowania towarów.

2. Urządzenia zdolne do pracy w sieci obejmują urządzenia przenośne i inteligentne liczniki.

Uwagi techniczne:

1. 'Narzędzia monitorujące': "oprogramowanie" lub sprzęt monitorujące zachowanie systemu lub procesów wykonywanych na urządzeniu. Obejmuje to programy antywirusowe, produkty zapewniające bezpieczeństwo punktów końcowych, produkty bezpieczeństwa osobistego (Personal Security Products - PSP), systemy wykrywania wtargnięcia (Intrusion Detection Systems - IDS), systemy ochrony przed wtargnięciem (Intrusion Detection Systems - IPS) oraz zapory sieciowe.

2. 'Środki zabezpieczające': techniki opracowane w celu zapewnienia bezpiecznego wykonania kodu, takie jak Data Execution Prevention (DEP), Address Space Layout Randomisation (ASLR) lub sandboxing.

"Izolowane żywe kultury" (1) obejmują żywe kultury w postaci uśpionej i w postaci suchych preparatów.

"Prasy izostatyczne" (2) oznaczają urządzenia umożliwiające ciśnieniowanie zamkniętych komór za pomocą różnych czynników roboczych (gazu, cieczy, cząstek stałych itp.) w celu wytwarzania w komorze we wszystkich kierunkach równych ciśnień na obrabiany element lub materiał.

"Laser" (0, 1, 2, 3, 5, 6, 7, 8, 9) oznacza obiekt, który wytwarza wiązkę światła spójnego w przestrzeni i w czasie przez wzmocnienie za pomocą stymulowanej emisji promieniowania.

N.B. Zob. również "Laser chemiczny"

"Laser o fali ciągłej"

"Laser impulsowy"

"Laser o super wysokiej mocy".

"Biblioteka" (1) (parametryczna techniczna baza danych) oznacza zbiór informacji technicznych, do których odniesienie może zwiększyć wydajność odpowiednich systemów, urządzeń i części składowych.

"Pojazdy lżejsze od powietrza" (9) oznaczają balony i "pojazdy powietrzne", które są wypełniane gorącym powietrzem lub innymi gazami lżejszymi od powietrza, takimi jak hel lub wodór.

"Sieć lokalna" (4, 5) oznacza system przesyłania danych mający wszystkie następujące cechy:

a. umożliwiający bezpośrednie połączenie ze sobą dowolnej liczby niezależnych 'urządzeń do przetwarzania danych'; oraz

b. ograniczony w sensie geograficznym do pewnego obszaru o umiarkowanym zasięgu (np. biurowiec, zakład, miasteczko studenckie, magazyn).

N.B. 'Urządzenie do przetwarzania danych': urządzenie mające możliwość nadawania lub odbierania ciągów informacji cyfrowych.

"Mierniki gradientu magnetycznego" (6) oznaczają przyrządy do wykrywania zmian przestrzennych pól magnetycznych ze źródeł zewnętrznych w stosunku do przyrządu pomiarowego. Składają się z wielu "magnetometrów" i przynależnych układów elektronicznych, służących do pomiaru gradientu pola magnetycznego.

N.B. Zob. również "Miernik gradientu magnetycznego właściwego".

"Magnetometry" (6) oznaczają przyrządy do wykrywania pól magnetycznych źródeł zewnętrznych względem przyrządu pomiarowego. Składają się z pojedynczego czujnika pola magnetycznego i odpowiedniego układu elektronicznego, na którego wyjściu jest wartość mierzonego pola magnetycznego.

"Materiały odporne na korozyjne działanie UF6" (0) obejmują miedź, stopy miedzi, stal nierdzewną, glin, tlenek glinu, stopy glinu, nikiel lub stopy zawierające 60 % masy lub więcej niklu oraz fluorowane polimery węglowodorowe.

"Matryca" (1, 2, 8, 9) oznacza fazę o strukturze w zasadzie ciągłej wypełniającą przestrzeń pomiędzy cząstkami, wiskerami lub włóknami.

"Niepewność pomiarowa" (2) oznacza parametr charakterystyczny określający, na poziomie ufności 95 %, w jakiej odległości od wartości prawidłowej leży zmienna pomiarowa. W jego skład wchodzą niedające się skorygować odchylenia systematyczne, niedający się skorygować luz oraz odchylenia losowe (zob. ISO 10360-2).

"Układ mikrokomputerowy" (3) oznacza "monolityczny układ scalony" lub "wieloukład scalony", w którego skład wchodzi jednostka arytmetyczno-logiczna (ALU) zdolna do realizacji instrukcji ogólnych, zawartych w pamięci wewnętrznej, na danych znajdujących się w pamięci wewnętrznej.

N.B. Pamięć wewnętrzna może być wspomagana przez pamięć zewnętrzną.

"Układ mikroprocesorowy" (3) oznacza "monolityczny układ scalony" lub "wieloukład scalony", w którego skład wchodzi jednostka arytmetyczno-logiczna (ALU) zdolna do realizacji szeregu instrukcji ogólnych zawartych w pamięci zewnętrznej.

N.B.1. "Układ mikroprocesorowy" zazwyczaj nie jest wyposażony w integralną pamięć dostępną dla użytkownika, ale do realizacji jego funkcji logicznych może być wykorzystywana pamięć istniejąca w mikroukładzie.

N.B.2. Definicja ta obejmuje zespoły układów przeznaczone do pracy razem, w celu realizacji funkcji "układu mikroprocesorowego".

"Mikroorganizmy" (1, 2) oznaczają bakterie, wirusy, mikoplazmy, riketsje, chlamydie lub grzyby, naturalne, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub materiału zawierającego żywe organizmy, który rozmyślnie zaszczepiono lub zakażono takimi kulturami.

"Pociski rakietowe" (1, 3, 6, 7, 9) oznaczają kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych, zdolne do przenoszenia ładunku użytecznego o masie co najmniej 500 kg na odległość co najmniej 300 km.

"Włókno elementarne" (lub - włókno) (1) oznacza najmniejszy inkrement włókna, zazwyczaj mający średnicę kilku mikrometrów.

"Monolityczny układ scalony" (3) oznacza połączenie 'elementów obwodu' czynnych lub biernych lub obu rodzajów, o następujących cechach charakterystycznych:

a. jest uformowane techniką dyfuzyjną, technikami implantacyjnymi lub technikami osadzania w pojedynczym półprzewodzącym kawałku materiału, tzw. chipie, lub na nim;

b. można je traktować jak element niepodzielny; oraz

c. realizuje funkcję(-e) obwodu.

N.B. 'Element obwodu': pojedyncza czynna lub bierna funkcjonalna część układu elektronicznego, np. jedna dioda, jeden tranzystor, jeden rezystor, jeden kondensator itp.

"Monolityczny mikrofalowy układ scalony" ("MMIC") (3, 5) oznacza "monolityczny układ scalony" działający w częstotliwościach mikrofal i fal milimetrowych.

"Monospektralne czujniki obrazowe" (6) oznaczają czujniki pozwalające na zbieranie danych obrazowych z pojedynczego pasma widma dyskretnego.

"Wieloukład scalony" (3) oznacza dwa lub więcej "monolityczne układy scalone", spojone ze wspólnym "podłożem".

"Wielokanałowy przetwornik analogowo-cyfrowy (ADC)" (3) oznacza urządzenia zawierające więcej niż jeden przetwornik ADC, zaprojektowane w taki sposób, by każdy ADC miał odrębne wejście analogowe.

"Wielospektralne analizatory obrazowe" (6) umożliwiają równoczesne lub szeregowe odbieranie danych obrazowych z dwóch lub więcej dyskretnych pasm spektralnych. Analizatory o więcej niż dwudziestu dyskretnych pasmach spektralnych są czasami nazywane hiperspektralnymi analizatorami obrazowymi.

"Uran naturalny" (0) oznacza uran zawierający mieszaninę izotopów występujących w naturze.

"Sterownik dostępu do sieci" (4) oznacza interfejs fizyczny do sieci rozproszonej. Używa się w nim wspólnego nośnika działającego z taką samą "szybkością transmisji danych cyfrowych" w systemie transmisji z arbitrażem (np. w sensie znacznika lub nośnika). Niezależnie od innych wybiera on adresowane do niego pakiety z danymi lub grupami danych (np. IEEE 802). Jest to zespół, który może być wbudowany w komputer lub urządzenie telekomunikacyjne z zadaniem zapewniania dostępu do łączy telekomunikacyjnych.

"Reaktor jądrowy" (0) oznacza kompletny reaktor zdolny do pracy w taki sposób, żeby mogła w nim przebiegać kontrolowana, samopodtrzymująca się reakcja łańcuchowa rozszczepiania. "Reaktor jądrowy" obejmuje wszystkie obiekty znajdujące się wewnątrz zbiornika reaktora lub bezpośrednio przymocowane do niego, wyposażenie sterujące poziomem mocy w rdzeniu oraz elementy, które zazwyczaj zawierają chłodziwo pierwotne rdzenia reaktora lub wchodzą z nim w bezpośrednią styczność lub nim sterują.

"Sterowanie numeryczne" (2) oznacza automatyczne sterowanie procesem wykonywane przez urządzenie korzystające z danych numerycznych zazwyczaj wprowadzanych podczas realizacji operacji (zob. ISO 2382).

"Kod wynikowy" (UOdO) oznacza sprzętowo wykonywalną postać wygodnego wyrażenia jednego lub większej liczby procesów ("kod źródłowy" (język źródłowy)), które zostały skompilowane przez system programowania.

"Eksploatacja, administrowanie lub utrzymywanie" ("EAU") (5) oznacza wykonywanie co najmniej jednego z następujących zadań:

a. utworzenie dowolnego z następujących elementów lub zarządzanie nim:

1. konta lub uprawnienia użytkowników lub administratorów;

2. ustawienia danego przedmiotu; lub

3. dane uwierzytelniające wykorzystywane w przypadku zadań opisanych w pkt a.1. lub a.2.;

b. monitorowanie warunków pracy lub wydajności przedmiotu bądź zarządzanie nimi; lub

c. zarządzanie danymi logowania lub audytu wykorzystywane w przypadku dowolnych zadań opisanych w pkt a. lub b.;

Uwaga: "EAU" nie obejmuje żadnego z następujących zadań lub powiązanych z nimi kluczowych funkcji zarządzania:

a. udostępniania lub ulepszania jakiejkolwiek funkcji kryptograficznej, która nie jest bezpośrednio powiązana z tworzeniem danych uwierzytelniających wykorzystywanych w przypadku zadań opisanych w pkt a.1. lub a.2. powyżej lub z zarządzaniem nimi; lub

b. realizowania jakiejkolwiek funkcji kryptograficznej w ramach warstwy przesyłu danych produktu.

"Optyczny układ scalony" (3) oznacza "monolityczny układ scalony" lub "hybrydowy układ scalony", zaopatrzony w co najmniej jedną część przeznaczoną do działania jako fotoczujnik lub fotoemiter lub do wykonywania funkcji optycznych lub elektrooptycznych.

"Komutacja optyczna" (5) oznacza przekazywanie lub komutację sygnałów w postaci optycznej bez przetwarzania na sygnały elektryczne.

"Całkowita gęstość prądu" (3) oznacza całkowitą liczbę amperozwojów w cewce (tj. sumę liczby zwojów pomnożoną przez maksymalne natężenie prądu przenoszone przez każdy zwój) podzieloną przez całkowity przekrój poprzeczny cewki (składającej się z włókienek nadprzewodzących, matrycy metalowej, w której osadzone są włókienka nadprzewodzące, materiału stanowiącego obudowę, kanałów chłodzących itp.).

"Państwo uczestniczące" (7, 9) oznacza każde z państw uczestniczących w porozumieniu z Wassenaar (zob. www. wassenaar.org).

"Moc szczytowa" (6) oznacza najwyższy poziom mocy osiągany w "czasie trwania impulsu".

"Sieć osobista" (5) oznacza system przesyłania danych mający wszystkie następujące cechy:

a. umożliwiający bezpośrednie połączenie ze sobą dowolnej liczby niezależnych 'urządzeń do przetwarzania danych'; oraz

b. ograniczony do łączności między urządzeniami w bezpośrednim sąsiedztwie osoby fizycznej lub kontrolera urządzeń (np. pojedyncze pomieszczenie, biuro lub samochód oraz ich bezpośrednie otoczenie).

Uwaga techniczna:

'Urządzenie do przetwarzania danych': urządzenie mające możliwość nadawania lub odbierania ciągów informacji cyfrowych.

"Uprzednio separowany" (1) oznacza oddzielony dowolną techniką, której celem jest zwiększenie zawartości kontrolowanego izotopu.

"Element o podstawowym znaczeniu" (4) w odniesieniu do kategorii 4 jest "elementem o podstawowym znaczeniu", jeżeli wartość jego wymiany stanowi ponad 35 % całkowitej wartości systemu, w którego skład wchodzi. Wartość elementu jest ceną płaconą za element przez producenta systemu lub przez firmę montującą system. Wartość całkowita jest zwykłą ceną sprzedaży osobom postronnym w miejscu produkcji lub w miejscu przygotowywania wysyłek towarów.

"Produkcja" (Wszystkie UOdT, UdTJ) oznacza wszystkie etapy związane z produkcją, takie jak: prace konstrukcyjne, technologia produkcji, wytwarzanie, scalanie, montaż (składanie), kontrola, testowanie, zapewnienie jakości.

"Urządzenia produkcyjne" (1, 7, 9) oznaczają oprzyrządowanie, szablony, przyrządy obróbkowe, trzpienie, formy, matryce, uchwyty, mechanizmy synchronizujące, urządzenia testujące, inne maszyny i ich części składowe, z ograniczeniem do urządzeń specjalnie zaprojektowanych lub zmodyfikowanych z przeznaczeniem do "rozwoju" lub do jednej lub więcej faz "produkcji".

"Instalacje produkcyjne" (7, 9) oznaczają "urządzenia produkcyjne" i specjalnie do nich opracowane oprogramowanie, wbudowane w instalacje w celu "rozwoju" lub do jednej lub więcej faz "produkcji".

"Program" (2, 6) oznacza sekwencję instrukcji do realizacji procesu, mającą postać wykonywalną lub dającą się przekształcić na wykonywalną przez komputer elektroniczny.

"Kompresja impulsów" (6) oznacza kodowanie i przetwarzanie długiego impulsowego sygnału radarowego na krótki, przy zachowaniu korzyści wynikających z wysokiej energii impulsu.

"Czas trwania impulsu" (6) oznacza czas trwania impulsu "lasera" zdefiniowany jako czas upływający między momentami osiągnięcia połowy mocy przez zbocze narastające i zbocze opadające poszczególnego impulsu.

"Laser impulsowy" (6) oznacza "laser", w którym "czas trwania impulsu" jest równy lub mniejszy niż 0,25 s.

"Kryptografia kwantowa" (5) oznacza grupę technik pozwalających uzyskiwać wspólny klucz do celów "kryptografii" poprzez pomiar własności kwantowych układu fizycznego (w tym własności fizycznych jawnie zależnych od praw optyki kwantowej, kwantowej teorii pola lub elektrodynamiki kwantowej).

"Ruchliwość częstotliwości w radarach" (6) oznacza dowolną technikę zmiany, wg sekwencji pseudolosowej, częstotliwości nośnej impulsowego nadajnika radarowego pomiędzy impulsami lub pomiędzy grupami impulsów, o wartość równą lub większą od szerokości pasma impulsu.

"Rozproszone widmo radarowe" (6) oznacza dowolną technikę modulacji służącą do rozpraszania energii sygnału o stosunkowo wąskim paśmie częstotliwości na dużo szersze pasmo częstotliwości, za pomocą kodowania losowego lub pseudolosowego.

"Czułość promieniowania" (6) oznacza czułość promieniowania (mA/W) = 0,807 × (długość fali w nm) × sprawność kwantowa (QE).

Uwaga techniczna:

Sprawność kwantową wyraża się zwykle w postaci procentowej; jednakże do celów niniejszego wzoru sprawność kwantowa wyrażona jest jako liczba dziesiętna mniejsza niż jeden, np. 78 % to 0,78.

"Przetwarzanie w czasie rzeczywistym" (6) oznacza przetwarzanie danych przez system komputerowy, zapewniające żądany poziom realizacji zadań w funkcji dostępnych środków, w gwarantowanym czasie odpowiedzi, bez względu na obciążenie systemu, kiedy jest on stymulowany przez wydarzenia zewnętrzne.

"Powtarzalność" (7) oznacza stopień zgodności powtarzanych pomiarów tej samej zmiennej w tych samych warunkach operacyjnych w sytuacji, gdy pomiędzy pomiarami występują zmiany warunków lub przerwy w działaniu (zob. IEEE STD 528-2001 (odchylenie standardowe wielkości 1 sigma)).

"Niezbędne" (UOdT 5, 6, 7, 9) - w odniesieniu do "technologii" - dotyczy tylko tej części "technologii", która jest szczególnie odpowiedzialna za osiągnięcie lub przekroczenie wartości parametrów, właściwości lub funkcji objętych kontrolą. Taka "niezbędna" "technologia" może być wspólna dla różnych produktów.

"Rozdzielczość" (2) oznacza najmniejszą działkę urządzenia pomiarowego; w przyrządach cyfrowych jest to najmniej znaczący bit (zob. ANSI B-89.1.12).

"Środek rozpraszania tłumu" (1) oznacza substancje, które w warunkach użycia dla rozproszenia tłumu szybko wywołują u ludzi podrażnienie receptorów zmysłów lub psychiczny efekt unieszkodliwienia, znikający po krótkim czasie od usunięcia przyczyny.

Uwaga techniczna:

Gazy łzawiące stanowią podzbiór "środków rozpraszania tłumu".

"Robot" (2, 8) oznacza mechanizm manipulacyjny poruszający się po ścieżce ciągłej lub od punktu do punktu, mogący korzystać z "czujników" i mający wszystkie następujące cechy:

a. jest wielofunkcyjny;

b. ma możliwość ustawiania w odpowiednim położeniu lub orientowania przestrzennego materiałów, części, narzędzi lub urządzeń specjalnych poprzez wykonywanie zmiennych ruchów w przestrzeni trójwymiarowej;

c. jest wyposażony w trzy lub większą liczbę mechanizmów wspomagających, m.in. silników krokowych, pracujących w obwodzie zamkniętym lub otwartym; oraz

d. ma "możliwość programowania przez użytkownika" metodą uczenia/odtwarzania lub za pomocą komputera elektronicznego, który może być programowanym sterownikiem logicznym, tj. bez ingerencji mechanicznej.

N.B. Niniejsza definicja nie obejmuje kontrolą następujących urządzeń:

1. mechanizmów poruszanych wyłącznie ręcznie lub zdalnie przez operatora;

2. mechanizmów manipulacyjnych o ustalonej sekwencji ruchów, będących urządzeniami zautomatyzowanymi, realizującymi zaprogramowane mechanicznie, z góry ustalone ruchy. Program jest ograniczony mechanicznie za pomocą ustalonych ograniczników, np. sworzni lub krzywek. Kolejność ruchów oraz wybór drogi lub kątów nie są zmienne ani zmienialne za pomocą środków mechanicznych, elektronicznych lub elektrycznych;

3. mechanizmów manipulacyjnych o ustalonej sekwencji ruchów, będących urządzeniami zautomatyzowanymi, realizującymi zaprogramowane mechanicznie, z góry ustalone ruchy. Program jest ograniczony mechanicznie za pomocą ustalonych, choć nastawnych, ograniczników, np. sworzni lub krzywek. Kolejność ruchów oraz wybór drogi lub kątów są zmienne w ramach ustalonego schematu programowego. Zmian lub modyfikacji schematu programowego (np. zmiany kołków lub wymiany krzywek) w jednej lub kilku osiach współrzędnych dokonuje się wyłącznie na drodze działań mechanicznych;

4. mechanizmów manipulacyjnych bez wspomagania, o zmiennej sekwencji ruchów, będących urządzeniami zautomatyzowanymi, realizującymi zaprogramowane mechanicznie ruchy. Program jest zmienny, ale sekwencja jest realizowana wyłącznie za pomocą sygnału binarnego z elektrycznych urządzeń binarnych o ustalonym mechanicznie położeniu lub nastawnych ograniczników;

5. żurawi do stertowania, definiowanych jako systemy manipulatorów działające w kartezjańskim układzie współrzędnych, produkowanych jako integralne części pionowych zespołów do silosów, i służące do uzyskiwania dostępu do zawartości tych silosów w celu składowania lub wyjmowania.

"Rowing" (1) oznacza wiązkę (zazwyczaj 12-120 szt.) uporządkowanych w przybliżeniu równolegle 'skrętek'.

N.B. 'Skrętka' oznacza wiązkę "włókien elementarnych" (zazwyczaj ponad 200) uporządkowanych w przybliżeniu równolegle.

"Bicie promieniowe" (odchylenie od właściwego ruchu) (2) oznacza promieniowe przemieszczenie głównego wrzeciona w ciągu jednego obrotu, mierzone w płaszczyźnie prostopadłej do osi wrzeciona w punkcie znajdującym się na zewnętrznej lub wewnętrznej badanej powierzchni obrotowej (zob. ISO 230 część 1-1986, pkt 5.61).

"Częstotliwość próbkowania" (3) w odniesieniu do przetwornika analogowo-cyfrowego (ADC) oznacza maksymalną liczbę próbek, które są mierzone na wejściu analogowym w czasie jednej sekundy, z wyjątkiem nadpróbkowych ADC. W przypadku nadpróbkowych ADC "częstotliwość próbkowania" przyjmuje się za częstotliwość słowa wyjściowego. "Częstotliwość próbkowania" może być również częstotliwością próbkowania określaną zwykle w megapróbkach na sekundę (MSPS) lub gigapróbkach na sekundę (GSPS) lub współczynnikiem przekształcania określanym zwykle w hercach (Hz).

"Współczynnik skalowania (żyroskopu lub akcelerometru)" (7) oznacza stosunek zmiany wartości wyjściowej do zmiany wartości wejściowej, która ma być mierzona. Współczynnik skalowania jest na ogół szacowany jako nachylenie linii prostej, którą można poprowadzić metodą najmniejszych kwadratów pomiędzy punktami określającymi parametry wejściowe/wyjściowe, uzyskanymi poprzez cykliczną zmianę parametrów wejściowych w przedziale ich wartości.

"Analizatory sygnałów" (3) oznaczają urządzenia do pomiaru i pokazywania podstawowych parametrów sygnałów o jednej częstotliwości, będących składowymi sygnałów wieloczęstotliwościowych. "Przetwarzanie sygnałów" (3, 4, 5, 6) oznacza przetwarzanie sygnałów zawierających informacje, uzyskanych ze źródeł zewnętrznych, za pomocą algorytmów, takich jak kompresja czasu, filtrowanie, ekstrahowanie, selekcja, korelacja, splatanie lub przemieszczanie pomiędzy domenami (np. za pomocą szybkiej transformacji Fouriera lub transformacji Walsha).

"Oprogramowanie" (cała UOdO) oznacza zbiór jednego lub większej liczby "programów" lub 'mikroprogramów', utrwalony na dowolnym materialnym nośniku.

N.B. 'Mikroprogram' oznacza sekwencję elementarnych instrukcji, przechowywanych w specjalnej pamięci, realizowanych po wprowadzeniu do rejestru instrukcji specjalnej dla niej instrukcji odwołania.

"Kod źródłowy" (lub język źródłowy) (6, 7, 9) oznacza wygodny sposób wyrażenia jednego lub kilku procesów, który może być przekształcony przez system programowania w postać dającą się wykonać na urządzeniu ("kod wynikowy" (lub język wynikowy)).

"Statek kosmiczny" (9) oznacza czynne i bierne satelity i sondy kosmiczne.

"Moduł ładunkowy statku kosmicznego" (9) oznacza urządzenie, które stanowi strukturę nośną "statku kosmicznego" i zapewnia miejsce dla "ładunku użytecznego statku kosmicznego".

"Ładunek użyteczny statku kosmicznego" (9) oznacza urządzenia przymocowane do "modułu ładunkowego statku kosmicznego", zaprojektowane do przeprowadzania misji w kosmosie (np. wyposażenie komunikacyjne, obserwacyjne, naukowe).

"Klasy kosmicznej" (3, 6, 7) - odnosi się do produktów zaprojektowanych, wykonanych lub po pomyślnych testach zakwalifikowanych do użycia na wysokości powyżej 100 km nad powierzchnią Ziemi.

N.B. Stwierdzenie na podstawie testu, że konkretny przedmiot jest "klasy kosmicznej", nie oznacza, że inne przedmioty z tej samej partii produkcyjnej lub serii modelu są "klasy kosmicznej", jeżeli nie przeszły one indywidualnych testów.

"Specjalny materiał rozszczepialny" (0) oznacza pluton-239, uran-233, "uran wzbogacony w izotopy 235 lub 233" oraz dowolne zawierające je materiały.

"Moduł właściwy" (0, 1, 9) oznacza moduł Younga w paskalach (1 paskal = 1 N/m2) podzielony przez ciężar właściwy w N/m3, mierzony w temperaturze (296 ± 2) K ((23 ± 2) oC) i przy wilgotności względnej (50 ± 5) %.

"Wytrzymałość właściwa na rozciąganie" (0, 1, 9) oznacza wytrzymałość na rozciąganie w paskalach (1 paskal = 1 N/m2) podzieloną przez ciężar właściwy w N/m3, mierzoną w temperaturze (296 ± 2) K ((23 ± 2) oC) i przy wilgotności względnej (50 ± 5) %.

"Żyroskopy wirujące" (7) to żyroskopy wykorzystujące stale obracającą się masę do wykrywania ruchu obrotowego.

"Widmo rozproszone" (5) oznacza technikę służącą do rozpraszania energii sygnału o stosunkowo wąskim paśmie częstotliwości na dużo szersze widmo energii.

Radar o "widmie rozproszonym" (6) - zob. "Rozproszone widmo radarowe".

"Stabilność" (7) oznacza odchylenie standardowe (1 sigma) zmienności danego parametru od jego wartości wzorcowej zmierzonej w ustalonych warunkach temperaturowych. Można ją wyrażać w funkcji czasu.

"Państwa (nie)będące stronami konwencji o zakazie broni chemicznej" (1) są to te państwa, w których Konwencja o zakazie rozwijania, produkcji, składowania i stosowania broni chemicznej (nie) weszła w życie. (zob. www.opcw.org)

"Tryb stanu ustalonego" (9) oznacza warunki działania silnika, w których parametry silnika, takie jak ciąg/moc, liczba obrotów na minutę i inne, nie wykazują znaczących wahań, jeżeli temperatura powietrza i ciśnienie u wlotu silnika są stałe.

"Podłoże" (3) oznacza płytkę materiału głównego z naniesionymi połączeniami lub bez nich, na której lub wewnątrz której można umieszczać 'elementy dyskretne' lub układy scalone.

N.B.1. 'Element dyskretny': oddzielnie obudowany 'element obwodu' z własnymi końcówkami wyjściowymi.

N.B.2. 'Element obwodu': pojedyncza czynna lub bierna funkcjonalna część układu elektronicznego, np. jedna dioda, jeden tranzystor, jeden rezystor, jeden kondensator itp.

"Półprodukt podłoży" (3, 6) oznacza materiał monolityczny o wymiarach umożliwiających wytworzenie z niego elementów optycznych, takich jak zwierciadła lub okienka optyczne.

"Podjednostka toksyny" (1) oznacza strukturalnie i funkcjonalnie oddzielny składnik "toksyny".

"Nadstopy" (2, 9) oznaczają stopy na osnowie niklu, kobaltu lub żelaza o bardzo wysokiej wytrzymałości w porównaniu z innymi stopami serii AISI 300 w temperaturach powyżej 922 K (649 oC), w skrajnych warunkach środowiskowych i eksploatacyjnych.

"Nadprzewodniki" (1, 3, 5, 6, 8) oznaczają materiały, tj. metale, stopy lub związki, które mogą całkowicie stracić swoją oporność, tj. które mogą uzyskać nieskończoną przewodność elektryczną i przewodzić prąd elektryczny o bardzo wysokich natężeniach bez wytwarzania ciepła Joule'a.

N.B. "Nadprzewodzący" stan materiału jest indywidualnie scharakteryzowany "temperaturą krytyczną", krytycznym polem magnetycznym, będącym funkcją temperatury, oraz krytyczną gęstością prądu, która jest funkcją zarówno pola magnetycznego, jak i temperatury.

"Laser o super wysokiej mocy" ("SHPL") (6) oznacza "laser", który może dostarczyć energię wyjściową (całkowitą lub częściową) powyżej 1 kJ w ciągu 50 ms, lub taki, którego moc przeciętna lub moc w przypadku fali ciągłej wynosi powyżej 20 kW.

"Formowanie w stanie nadplastycznym" (1, 2) oznacza technikę odkształcania termicznego metali, których wydłużenie całkowite do zerwania, mierzone w temperaturze pokojowej tradycyjnymi technikami badania wytrzymałości na rozciąganie, w normalnych warunkach, jest bardzo małe (poniżej 20 %); jej celem jest co najmniej dwukrotne powiększenie tych wartości podczas obróbki.

"Algorytm symetryczny" (5) oznacza algorytm kryptograficzny, w którym stosuje się identyczne klucze do szyfrowania i deszyfrowania.

N.B. Powszechnym zastosowaniem "algorytmu symetrycznego" jest utajnianie danych.

"Taśma" (1) oznacza materiał zbudowany z przeplatanych lub jednakowo ukierunkowanych "włókien elementarnych", 'skrętek', "rowingów", "kabli" lub "przędz" itp., zazwyczaj impregnowany żywicą.

N.B. 'Skrętka' oznacza wiązkę "włókien elementarnych" (zazwyczaj ponad 200) uporządkowanych w przybliżeniu równolegle.

"Technologia" (wszystkie UOdT UdTJ) oznacza specyficzny rodzaj informacji, niezbędny do "rozwoju", "produkcji" lub "użytkowania" danego wyrobu. Informacja ta ma postać 'danych technologicznych' lub 'pomocy technicznej'.

N.B.1. 'Pomoc techniczna' może przybierać takie formy, jak: przekazanie instrukcji, umiejętności, szkolenie, przekazanie wiedzy na temat eksploatacji oraz usługi konsultacyjne i może obejmować transfer 'danych technologicznych'.

N.B.2. 'Dane technologiczne' mogą mieć formę odbitek, planów, wykresów, modeli, wzorów, tabel, projektów technicznych i opisów, podręczników i instrukcji w formie pisemnej lub zarejestrowanej na innych nośnikach lub urządzeniach, takich jak dyski, taśmy, pamięci wyłącznie do odczytu.

"Trójwymiarowy układ scalony" (3) oznacza zbiór płytek półprzewodnikowych lub aktywnych warstw urządzenia zintegrowanych ze sobą i mających kontakty połączeniowe przechodzące całkowicie przez rozdzielacz, podłoże, płytkę lub warstwę w celu utworzenia połączenia między warstwami urządzenia. Rozdzielacz to interfejs, który umożliwia utworzenie połączenia elektrycznego.

"Wrzeciono wahadłowe" (2) oznacza wrzeciono (uchwyt) do narzędzi, zmieniające podczas procesu obróbki położenie kątowe swojej osi względem dowolnej innej osi.

"Stała czasowa" (6) oznacza czas, który upływa od pojawienia się bodźca świetlnego do momentu, kiedy prąd wzrośnie do wartości równej wielkości końcowej pomnożonej przez 1-1/e (tj. 63 % wartości końcowej).

"Czas do ustalenia warunków rejestracji" (6) (nazywany również czasem reakcji grawimetru) oznacza czas, w którym zredukowane zostają zakłócające skutki przyspieszeń wywołanych przez platformę (szum o wysokiej częstotliwości).

"Bandaż" (9) oznacza element składowy pierścienia stacjonarnego (jednolity lub o budowie segmentowej) zamocowany na powierzchni wewnętrznej korpusu turbiny lub element znajdujący się na końcówce łopatki turbiny, który służy przede wszystkim jako uszczelnienie gazodynamiczne między elementami stacjonarnymi a wirującymi.

"Kompleksowe sterowanie lotem" (7) oznacza automatyczne sterowanie zmiennymi stanu "statku powietrznego" i toru lotu dla zrealizowania zadania bojowego odpowiednio do zmian w czasie rzeczywistym danych dotyczących celu, zagrożeń lub innych "statków powietrznych".

"Całkowita szybkość transmisji danych cyfrowych" (5) oznacza liczbę bitów, łącznie z bitami kodowymi linii, bitami nieinformacyjnymi i podobnymi, przepływających w jednostce czasu pomiędzy odpowiednimi urządzeniami w cyfrowym systemie transmisji.

N.B. Zob. także "szybkość transmisji danych cyfrowych".

"Kabel" (1) oznacza wiązkę "włókien elementarnych", zazwyczaj uporządkowanych w przybliżeniu równolegle.

"Toksyny" (1, 2) oznaczają toksyny w postaci celowo wyizolowanych preparatów lub mieszanek, bez względu na sposób produkcji, różne od toksyn istniejących jako zanieczyszczenia innych materiałów, takich jak próbki patogenne, plony, żywność lub posiewy "mikroorganizmów".

"Przestrajalność" (6) oznacza zdolność "lasera" do wytwarzania ciągłego sygnału wyjściowego we wszystkich długościach fal w przedziale kilku przejść "laserowych". "Laser" z selekcją liniową wytwarza dyskretne długości fal w ramach jednego przejścia "laserowego" i nie jest uważany za "przestrajalny".

"Jednokierunkowa powtarzalność pozycjonowania" (2) oznacza mniejszą z wartości R↑ i R↓ (do przodu i wstecz) pojedynczej osi obrabiarki, jak określono w pkt 3.21 normy ISO 230-2:2014 lub jej odpowiednika krajowego.

"Bezzałogowy statek powietrzny" ("UAV") (9) oznacza każdy statek powietrzny zdolny do wzniesienia się w powietrze i kontynuowania kontrolowanego lotu i nawigacji bez obecności ludzi na pokładzie.

"Uran wzbogacony w izotopy 235 lub 233" (0) oznacza uran zawierający izotopy 235 lub 233 w takich ilościach, że stosunek łącznej zawartości tych izotopów do izotopu 238 jest większy niż stosunek zawartości izotopu 235 do izotopu 238 występujący w naturze (stosunek izotopowy 0,71 procent).

"Użytkowanie" (wszystkie UOdT UdTJ) oznacza eksploatację, instalowanie (łącznie z instalowaniem na miejscu), konserwację (kontrolę), naprawę, remonty i modernizację.

"Możliwość programowania przez użytkownika" (6) oznacza możliwość wprowadzania, modyfikacji lub wymiany "programów" przez użytkownika na innej drodze niż poprzez:

a. fizyczną modyfikację okablowania lub połączeń; lub

b. ustawianie sterowania funkcjami, w tym wprowadzanie parametrów.

"Szczepionka" (1) oznacza produkt leczniczy w postaci wyrobu farmaceutycznego, w odniesieniu do którego władze kraju produkcji lub kraju stosowania wydały zezwolenie na wprowadzanie do obrotu lub na prowadzenie badań klinicznych, a który wprowadzony do ustroju ludzkiego lub zwierzęcego ma za zadanie wytworzenie w nim ochronnej odporności immunologicznej w celu zapobiegania chorobom.

"Przędza" (1) oznacza wiązkę skręconych 'skrętek'.

N.B. 'Skrętka' oznacza wiązkę "włókien elementarnych" (zazwyczaj ponad 200) uporządkowanych w przybliżeniu równolegle."

KATEGORIA 0 - MATERIAŁY, INSTALACJE I URZĄDZENIA JĄDROWE

0A Systemy, urządzenia i części składowe

0A001 Następujące "reaktory jądrowe" oraz specjalnie zaprojektowane lub przystosowane do użytkowania z nimi urządzenia i podzespoły:

a. "reaktory jądrowe";

b. metalowe zbiorniki lub główne prefabrykowane części do nich, w tym górne pokrywy zbiornika ciśnieniowego reaktora, specjalnie zaprojektowane lub przystosowane do umieszczania w nich rdzenia "reaktora jądrowego";

c. urządzenia manipulacyjne specjalnie zaprojektowane lub przystosowane do załadunku i wyładunku elementów paliwowych "reaktorów jądrowych";

d. pręty regulacyjne specjalnie zaprojektowane lub przystosowane do sterowania procesem rozszczepienia w "reaktorze jądrowym", odpowiednie elementy nośne lub zawieszenia, mechanizmy napędu oraz prowadnice rurowe do prętów regulacyjnych;

e. przewody ciśnieniowe reaktora specjalnie zaprojektowane lub wykonane z przeznaczeniem zarówno na elementy paliwowe, jak i chłodziwo w "reaktorze jądrowym";

f. rury (lub zespoły rur) z cyrkonu metalicznego lub jego stopów specjalnie zaprojektowane lub wykonane z przeznaczeniem do zastosowania jako okładzina paliwa w "reaktorach jądrowych", w ilościach przekraczających 10 kg;

N.B. W przypadku rur ciśnieniowych z cyrkonu zob. 0A001.e, zaś w przypadku rur calandrii zob. 0A001.h.

g. pompy pierwotnego obiegu lub pompy cyrkulacyjne specjalnie zaprojektowane lub wykonane z przeznaczeniem do przetaczania chłodziwa w "reaktorach jądrowych";

h. "zespoły wewnętrzne reaktora" specjalnie zaprojektowane lub wykonane z przeznaczeniem do pracy w "reaktorze jądrowym", w tym elementy nośne rdzenia, kanały paliwowe, rury calandrii, osłony termiczne, przegrody, siatki dystansujące rdzenia i płyty rozpraszające;

Uwaga techniczna:

W pozycji 0A001.h "zespoły wewnętrzne reaktora" oznaczają dowolną większą strukturę wewnątrz zbiornika reaktora wypełniającą jedną lub więcej funkcji, takich jak podtrzymywanie rdzenia, utrzymywanie osiowania elementów paliwowych, kierowanie przepływem chłodziwa w obiegu pierwotnym, zapewnienie osłon radiacyjnych zbiornika reaktora i oprzyrządowania wewnątrzrdzeniowego.

i. wymienniki ciepła, takie jak:

1. wytwornice pary specjalnie zaprojektowane lub przystosowane do obiegu pierwotnego lub pośredniego "reaktora jądrowego";

2. inne wymienniki ciepła specjalnie zaprojektowane lub przystosowane do stosowania w obiegu pierwotnym "reaktora jądrowego";

Uwaga: Pozycja 0A001.i nie obejmuje kontroli wymienników ciepła w systemach wspierających reaktora, np. systemie chłodzenia awaryjnego lub systemie odprowadzania ciepła powyłączeniowego.

j. detektory neutronów specjalnie zaprojektowane lub przystosowane do określania poziomu strumienia neutronów wewnątrz rdzenia "reaktora jądrowego";

k. 'zewnętrzne tarcze termiczne' specjalnie zaprojektowane lub przystosowane do użytku w "reaktorach jądrowych" w celu zmniejszenia strat ciepła oraz ochrony zbiornika.

Uwaga techniczna:

W pozycji 0A001.k "zewnętrzne tarcze termiczne" oznaczają dużego rozmiaru struktury umieszczone nad zbiornikiem reaktora, służące do ograniczania strat ciepła z reaktora i do zmniejszania temperatury wewnątrz zbiornika.

0B Urządzenia testujące, kontrolne i produkcyjne

0B001 Następujące instalacje do separacji izotopów z "uranu naturalnego", "uranu zubożonego" lub "specjalnych materiałów rozszczepialnych" oraz urządzenia specjalnie do nich zaprojektowane lub wykonane:

a. następujące instalacje specjalnie zaprojektowane do separacji izotopów "uranu naturalnego", "uranu zubożonego" lub "specjalnych materiałów rozszczepialnych":

1. instalacje do rozdzielania gazów metodą wirowania;

2. instalacje do dyfuzyjnego rozdzielania gazów;

3. instalacje do rozdzielania metodami aerodynamicznymi;

4. instalacje do rozdzielania metodami wymiany chemicznej;

5. instalacje do rozdzielania techniką wymiany jonów;

6. instalacje do rozdzielania izotopów w postaci par metalu za pomocą "laserów";

7. instalacje do rozdzielania izotopów w postaci molekularnej za pomocą "laserów";

8. instalacje do rozdzielania metodami plazmowymi;

9. instalacje do rozdzielania metodami elektromagnetycznymi;

b. następujące wirówki gazowe oraz zespoły i urządzenia, specjalnie zaprojektowane lub wykonane do stosowania w procesach wzbogacania metodą wirowania gazów:

Uwaga techniczna:

W pozycji 0B001.b 'materiał o wysokim stosunku wytrzymałości mechanicznej do gęstości' oznacza którekolwiek z poniższych:

1. stal maraging o wytrzymałości na rozciąganie równej 1,95 GPa lub większej;

2. stopy glinu o wytrzymałości na rozciąganie równej 0,46 GPa lub większej; lub

3. "materiały włókniste lub włókienkowe" o "module właściwym" powyżej 3,18 × 106 m i "wytrzymałości właściwej na rozciąganie" powyżej 7,62 × 104 m;

1. wirówki gazowe;

2. kompletne zespoły wirników;

3. cylindryczne zespoły wirników o grubości 12 mm lub mniejszej, średnicy od 75 do 650 mm, wykonane z 'materiałów o wysokim stosunku wytrzymałości mechanicznej do gęstości';

4. pierścienie lub mieszki ze ściankami o grubości 3 mm lub mniejszej i średnicy od 75 mm do 650 mm przeznaczone do lokalnego osadzenia cylindra wirnika lub do połączenia ze sobą wielu cylindrów wirników, wykonane z 'materiałów o wysokim stosunku wytrzymałości mechanicznej do gęstości';

5. deflektory o średnicy od 75 mm do 650 mm przeznaczone do instalowania wewnątrz cylindra wirnika odśrodkowego, wykonane z 'materiałów o wysokim stosunku wytrzymałości mechanicznej do gęstości';

6. pokrywy górne lub dolne o średnicy od 75 mm do 650 mm pasujące do końców cylindra wirnika, wykonane z 'materiałów o wysokim stosunku wytrzymałości mechanicznej do gęstości';

7. następujące łożyska na poduszce magnetycznej:

a. zespoły łożysk składające się z pierścieniowego magnesu zawieszonego w obudowie wykonanej z "materiałów odpornych na korozyjne działanie UF6" lub chronionej takimi materiałami, zawierającej wewnątrz czynnik tłumiący i posiadające magnes sprzężony z nabiegunnikiem lub drugim magnesem osadzonym w pokrywie górnej wirnika;

b. aktywne łożyska magnetyczne specjalnie zaprojektowane lub wykonane do stosowania w wirówkach gazowych;

8. specjalnie wykonane łożyska składające się z zespołu czop-panewka osadzonego na amortyzatorze;

9. pompy molekularne zawierające cylindry z wewnętrznymi, obrobionymi techniką skrawania lub wytłoczonymi, spiralnymi rowkami i wewnętrznymi wywierconymi otworami;

10. pierścieniowe stojany do wysokoobrotowych wielofazowych silników histerezowych (lub reluktancyjnych) do pracy synchronicznej w próżni z częstotliwością 600 Hz lub większą i mocą 40 woltoamperów lub większą;

11. obudowy (komory) wirówek, w których znajdują się zespoły wirników cylindrycznych wirówki gazowej, składające się ze sztywnego cylindra ze ściankami o grubości do 30 mm z precyzyjnie obrobionymi końcami, które są równoległe do siebie i prostopadłe do osi wzdłużnej cylindra w zakresie 0,05 stopnia lub mniej;

12. zbieraki składające się ze specjalnie zaprojektowanych lub przystosowanych rurek, przeznaczone do ekstrahowania gazowego UF6 z wirnika na zasadzie rurki Pitota, które mogą być zamocowane w centralnym układzie ekstrakcji gazu;

13. przemienniki częstotliwości (konwertery lub inwertery) specjalnie zaprojektowane lub wykonane z przeznaczeniem do zasilania stojanów silników wirówek gazowych do wzbogacania, posiadające wszystkie następujące cechy charakterystyczne i specjalnie do nich zaprojektowane podzespoły:

a. wyjście wielofazowe o częstotliwości 600 Hz lub większej; oraz

b. wysoka stabilność (z regulacją częstotliwości z dokładnością lepszą niż 0,2 %);

14. następujące zawory odcinające i sterujące:

a. zawory odcinające specjalnie zaprojektowane lub przystosowane do pracy z surowcem, produktem lub frakcjami końcowymi ze strumieni zawierających UF6 poszczególnych wirówek gazowych;

b. zawory mieszkowe odcinające lub sterujące o średnicy wewnętrznej od 10 do 160 mm wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami, specjalnie zaprojektowane lub przystosowane do użytku w głównych i pomocniczych układach zakładów wzbogacania stosujących wirówki gazowe;

c. następujące urządzenia i podzespoły, specjalnie zaprojektowane lub wykonane z przeznaczeniem do separacji metodą dyfuzji gazowej:

1. przegrody do dyfuzji gazowej wykonane z porowatych metalowych, polimerowych lub ceramicznych "materiałów odpornych na korozyjne działanie UF6", posiadające pory o średnicach od 10 do 100 nm, grubość 5 mm lub mniejszą oraz, w przypadku elementów cylindrycznych, średnicę 25 mm lub mniejszą;

2. obudowy dyfuzorów gazowych wykonane lub chronione "materiałami odpornymi na korozyjne działanie UF6";

3. sprężarki lub dmuchawy do gazów o objętościowej pojemności ssania UF6 wynoszącej 1 m3/min lub więcej, o ciśnieniu wylotowym do 500 kPa oraz stosunku ciśnienia 10:1 lub mniejszym, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami;

4. uszczelnienia wirujących wałów sprężarek lub dmuchaw wymienionych w pozycji 0B001.c.3., skonstruowane w taki sposób, żeby objętościowe natężenie przepływu gazu buforowego przez nieszczelności wynosiło poniżej 1 000 cm3/min;

5. wymienniki ciepła wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami, zaprojektowane do pracy z natężeniem przepływu przez nieszczelności na poziomie mniejszym niż 10 Pa na godzinę przy różnicy ciśnień rzędu 100 kPa;

6. zawory mieszkowe odcinające lub sterujące, obsługiwane ręcznie lub automatycznie, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami;

d. następujące urządzenia i podzespoły specjalnie zaprojektowane lub wykonane z przeznaczeniem do aerodynamicznego wzbogacania materiałów:

1. dysze separujące składające się ze szczelinowych zakrzywionych kanałów o promieniu krzywizny poniżej 1 mm, odporne na korozyjne działanie UF6, zawierające w środku ostre krawędzie rozdzielające gaz płynący w dyszach na dwa strumienie;

2. cylindryczne lub stożkowe rury (rurki wirowe) wykonane z "materiałów odpornych na korozyjne działanie UF6" lub też zabezpieczone takimi materiałami, mające co najmniej jeden wlot styczny;

3. sprężarki lub dmuchawy do gazów wykonane z "materiałów odpornych na korozyjne działanie UF6" lub zabezpieczone takimi materiałami oraz uszczelnienia wirujących wałów do nich;

4. wymienniki ciepła wykonane z "materiałów odpornych na korozyjne działanie UF6" lub zabezpieczone takimi materiałami;

5. obudowy elementów rozdzielających, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub zabezpieczone takimi materiałami, przeznaczone na rurki wirowe lub dysze rozdzielające;

6. zawory mieszkowe odcinające lub sterujące, obsługiwane ręcznie lub automatycznie, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami, mające średnicę 40 mm lub większą;

7. instalacje przetwórcze do oddzielania UF6 od gazu nośnego (wodoru lub helu) do zawartości 1 ppm UF6 lub mniejszej, w tym:

a. kriogeniczne wymienniki ciepła i separatory zdolne do pracy w temperaturach 153 K (- 120 °C) lub niższych;

b. zamrażarki kriogeniczne zdolne do wytwarzania temperatur 153 K (- 120 °C) lub niższych;

c. urządzenia z dyszami rozdzielającymi lub rurkami wirowymi do oddzielania UF6 od gazu nośnego;

d. wymrażarki UF6 zdolne do wymrażania UF6;

e. następujące urządzenia i podzespoły do nich, specjalnie zaprojektowane lub wykonane z przeznaczeniem do wzbogacania materiałów techniką wymiany chemicznej:

1. cieczowo-cieczowe kolumny impulsowe do szybkiej wymiany chemicznej z czasem przebywania czynnika w stopniu urządzenia wynoszącym 30 sekund lub krótszym oraz odporne na stężony kwas solny (np. wykonane z odpowiednich tworzyw sztucznych, takich jak polimery fluorowęglowodorowe lub szkło, lub pokryte takimi materiałami);

2. cieczowo-cieczowe kontaktory odśrodkowe do szybkiej wymiany chemicznej z czasem przebywania czynnika w stopniu urządzenia wynoszącym 30 sekund lub krótszym oraz odporne na stężony kwas solny (np. wykonane z odpowiednich tworzyw sztucznych, takich jak polimery fluorowęglowodorowe lub szkło, lub pokryte takimi materiałami);

3. elektrochemiczne ogniwa redukcyjne, odporne na działanie roztworów kwasu solnego, do obniżania wartościowości uranu;

4. urządzenia do zasilania elektrochemicznych ogniw redukcyjnych, pobierające U+4 ze strumieni substancji organicznych, wykonane w strefach kontaktu z przetwarzanym strumieniem z odpowiednich materiałów lub chronione takimi materiałami (na przykład szkło, polimery fluorowęglowe, polisiarczan fenylu, polisulfon eteru i grafit nasycany żywicą);

5. urządzenia do przygotowywania półproduktów do wytwarzania roztworu chlorku uranu o wysokiej czystości, składające się z zespołów do rozpuszczania, ekstrakcji rozpuszczalnikowej i/lub wymiany jonowej, przeznaczone do oczyszczania, oraz ogniwa elektrolityczne do redukowania uranu U+6 lub U+4 do U+3;

6. urządzenia do utleniania uranu ze stanu U+3 do U+4;

f. następujące urządzenia i podzespoły specjalnie zaprojektowane lub wykonane z przeznaczeniem do wzbogacania materiałów techniką wymiany jonów:

1. szybko reagujące żywice jonowymienne, żywice błonkowate lub porowate makrosiatkowe, w których grupy chemiczne biorące aktywny udział w wymianie znajdują się wyłącznie w powłoce na powierzchni nieaktywnej porowatej struktury nośnej, oraz inne materiały kompozytowe w dowolnej stosownej formie, w tym w postaci cząstek lub włókien, ze średnicami wynoszącymi 0,2 mm lub mniej, odporne na stężony kwas solny i wykonane w taki sposób, że ich półczas wymiany wynosi poniżej 10 sekund, oraz zdolne do pracy w temperaturach w zakresie od 373 K (100 °C) do 473 K (200 °C);

2. kolumny jonitowe (cylindryczne) o średnicy powyżej 1 000 mm, wykonane z materiałów odpornych na stężony kwas solny lub chronione takimi materiałami (np. tytan lub tworzywa fluorowęglowe) i zdolne do pracy w temperaturach w zakresie od 373 K (100 °C) do 473 K (200 °C) i przy ciśnieniach powyżej 0,7 MPa;

3. jonitowe urządzenia zwrotne (urządzenia do chemicznego lub elektrochemicznego utleniania lub redukcji) przeznaczone do regeneracji substancji do chemicznej redukcji lub utleniania, stosowane w jonitowych kaskadach do wzbogacania materiałów;

g. następujące urządzenia i podzespoły, specjalnie zaprojektowane lub wykonane z przeznaczeniem do zastosowania w procesach rozdzielania z wykorzystaniem lasera przy zastosowaniu rozdzielania izotopów w postaci par metalu za pomocą laserów:

1. urządzenia do przeprowadzania uranu w stan pary przeznaczone do uzyskiwania docelowej mocy wyjściowej 1 kW lub większej do zastosowania w technologii wzbogacania za pomocą laserów;

2. systemy operowania uranem metalicznym w stanie cieczy lub pary, specjalnie zaprojektowane lub wykonane z przeznaczeniem do operowania stopionym uranem, stopami uranu stopionego lub uranem metalicznym w stanie pary do zastosowania w technologii wzbogacania za pomocą laserów, jak również specjalnie do nich zaprojektowane podzespoły;

N.B. ZOB. TAKŻE POZYCJA 2A225.

3. zespoły do gromadzenia produktów lub frakcji końcowych uranu metalicznego w postaci ciekłej lub stałej, wykonane z materiałów odpornych na działanie cieplne i korozyjne uranu metalicznego w postaci pary lub cieczy, takich jak grafit powlekany tlenkiem itru lub tantal, lub chronione takimi materiałami;

4. obudowy modułów urządzeń rozdzielających (zbiorniki cylindryczne lub prostopadłościenne) przeznaczone na źródła par uranu metalicznego, działa elektronowe oraz urządzenia do gromadzenia produktu i frakcji końcowych;

5. "lasery" lub systemy "laserów" specjalnie zaprojektowane lub wykonane z przeznaczeniem do rozdzielania izotopów uranu, wyposażone w stabilizatory częstotliwości przystosowane do pracy przez dłuższe okresy;

N.B. ZOB. TAKŻE POZYCJE 6A005 I 6A205.

h. następujące urządzenia i podzespoły, specjalnie zaprojektowane lub wykonane z przeznaczeniem do zastosowania w procesach rozdzielania z wykorzystaniem lasera przy zastosowaniu rozdzielania izotopów w postaci molekularnej za pomocą laserów:

1. naddźwiękowe dysze rozprężne do chłodzenia mieszanin UF6 z gazem nośnym do temperatur 150 K (- 123 °C) lub niższych, wykonane z "materiałów odpornych na korozyjne działanie UF6";

2. podzespoły lub urządzenia do gromadzenia produktów lub frakcji końcowych, specjalnie zaprojektowane lub wykonane z przeznaczeniem do gromadzenia materiału uranowego i materiału frakcji końcowych uranu po naświetleniu światłem lasera, wykonane z "materiałów odpornych na korozyjne działanie UF6";

3. sprężarki wykonane z "materiałów odpornych na korozyjne działanie UF6" lub zabezpieczone takimi materiałami oraz uszczelnienia wirujących wałów do nich;

4. urządzenia do fluorowania UF5 (stałego) do UF6 (gazowego);

5. urządzenia przetwórcze do oddzielania UF6 od gazu nośnego (np. azotu, argonu lub innego gazu), w tym:

a. kriogeniczne wymienniki ciepła i separatory zdolne do pracy w temperaturach 153 K (- 120 °C) lub niższych;

b. zamrażarki kriogeniczne zdolne do wytwarzania temperatur 153 K (- 120 °C) lub niższych;

c. wymrażarki UF6 zdolne do wymrażania UF6;

6. "lasery" lub systemy "laserów" specjalnie zaprojektowane lub wykonane z przeznaczeniem do rozdzielania izotopów uranu, wyposażone w stabilizatory częstotliwości przystosowane do pracy przez dłuższe okresy;

N.B. ZOB. TAKŻE POZYCJE 6A005 I 6A205.

i. następujące urządzenia i podzespoły specjalnie zaprojektowane lub wykonane z przeznaczeniem do plazmowego rozdzielania materiałów:

1. źródła mikrofal i anteny do wytwarzania lub przyspieszania jonów, o częstotliwości wyjściowej powyżej 30 GHz i średniej mocy wyjściowej powyżej 50 kW;

2. wysokoczęstotliwościowe cewki do wzbudzania jonów pracujące w zakresie częstotliwości powyżej 100 kHz i zdolne do pracy w warunkach średniej mocy powyżej 40 kW;

3. urządzenia do wytwarzania plazmy uranowej;

4. nieużywane;

5. zespoły do gromadzenia produktów lub frakcji końcowych uranu metalicznego w postaci stałej, wykonane z materiałów odpornych na działanie cieplne i korozyjne uranu w postaci pary, takich jak grafit powlekany tlenkiem itru lub tantal, lub chronione takimi materiałami;

6. obudowy modułów separatorów (cylindryczne) na źródło plazmy uranowej, cewki na prądy wysokiej częstotliwości oraz kolektory do produktu i frakcji końcowych, wykonane z odpowiednich materiałów niemagnetycznych (np. ze stali nierdzewnej);

j. następujące urządzenia i podzespoły, specjalnie zaprojektowane lub wykonane z przeznaczeniem do wzbogacania materiałów metodami elektromagnetycznymi:

1. źródła jonów, pojedyncze lub wielokrotne, składające się ze źródła pary, jonizatora oraz akceleratora wiązki wykonane z odpowiednich materiałów niemagnetycznych (np. grafitu, stali nierdzewnej lub miedzi) i zdolne do wytwarzania wiązki jonów o całkowitym natężeniu 50 mA lub większym;

2. płytkowe kolektory jonów do gromadzenia wzbogaconych lub zubożonych wiązek jonów uranu, składające się z dwóch lub więcej szczelin i kieszeni i wykonane z odpowiednich materiałów niemagnetycznych (np. grafitu lub stali nierdzewnej);

3. obudowy próżniowe do elektromagnetycznych separatorów uranu wykonane z materiałów niemagnetycznych (np. ze stali nierdzewnej) i skonstruowane z przeznaczeniem do pracy przy ciśnieniach 0,1 Pa lub niższych;

4. elementy biegunów magnesów o średnicy powyżej 2 m;

5. wysokonapięciowe zasilacze do źródeł jonów, posiadające wszystkie następujące cechy:

a. zdolność do pracy w trybie ciągłym;

b. napięcie wyjściowe 20 000 V lub większe;

c. natężenie prądu na wyjściu 1 A lub większe; oraz

d. regulacja napięcia z dokładnością lepszą niż 0,01 % w ciągu 8 godzin;

N.B. ZOB. TAKŻE POZYCJA 3A227.

6. zasilacze magnesów (wysokiej mocy, prądu stałego), posiadające wszystkie następujące cechy:

a. zdolność do pracy w trybie ciągłym z prądem wyjściowym o natężeniu 500 A lub większym i napięciu 100 V lub większym; oraz

b. regulacja natężenia lub napięcia prądu z dokładnością lepszą niż 0,01 % w ciągu 8 godzin.

N.B. ZOB. TAKŻE POZYCJA 3A226.

0B002 Następujące specjalnie zaprojektowane lub wykonane pomocnicze instalacje, urządzenia i podzespoły do instalacji separacji izotopów wymienionych w pozycji 0B001, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub chronione takimi materiałami:

a. autoklawy, piece lub instalacje do doprowadzania UF6 do instalacji do wzbogacania;

b. desublimatory lub wymrażarki do odprowadzania UF6 z instalacji przetwórczych i dalszego jego transportu po ogrzaniu;

c. instalacje do produktu lub frakcji końcowych do transportu UF6 do zbiorników;

d. instalacje do skraplania lub zestalania stosowane do usuwania UF6 z procesu wzbogacania drogą sprężania, chłodzenia i przetwarzania UF6 w ciecz lub ciało stałe;

e. instalacje rurociągowe i zbiorniki specjalnie zaprojektowane lub wykonane do transportu i manipulowania UF6 w procesach rozdzielania izotopów metodą dyfuzji, ultrawirowania lub kaskady aerodynamicznej;

f. następujące układy próżniowe i pompy:

1. próżniowe instalacje rur rozgałęźnych lub zbiorników lub pompy próżniowe o wydajności ssania wynoszącej 5 m3 na minutę lub więcej;

2. pompy próżniowe specjalnie zaprojektowane do pracy w atmosferze zawierającej UF6, wykonane z "materiałów odpornych na korozyjne działanie UF6" lub zabezpieczone takimi materiałami; lub

3. układy próżniowe składające się z próżniowych instalacji rur rozgałęźnych lub zbiorników i pomp próżniowych, zaprojektowane do pracy w atmosferze zawierającej UF6;

g. spektrometry masowe (źródła jonów) UF6 zdolne do bieżącego (on-line) pobierania próbek ze strumieni zawierających UF6, posiadające wszystkie wymienione poniżej cechy:

1. zdolność do pomiaru mas jonów o wartości 320 mas atomowych lub większa i rozdzielczość lepsza niż 1 część na 320;

2. źródła jonów wykonane z niklu, stopu niklu i miedzi o zawartości niklu 60 % masy lub większej lub stopów niklu i chromu lub nimi zabezpieczone;

3. elektronowe źródła jonizacyjne; oraz

4. wyposażenie w kolektory umożliwiające analizę izotopową.

0B003 Następujące instalacje do przetwarzania uranu i urządzenia specjalnie zaprojektowane lub wykonane z przeznaczeniem do nich:

a. instalacje do przetwarzania koncentratów rudy uranowej na UO3;

b. instalacje do przetwarzania UO3 na UF6;

c. instalacje do przetwarzania UO3 na UO2;

d. instalacje do przetwarzania UO2 na UF4;

e. instalacje do przetwarzania UF4 na UF6;

f. instalacje do przetwarzania UF4 na uran metaliczny;

g. instalacje do przetwarzania UF6 na UO2;

h. instalacje do przetwarzania UF6 na UF4;

i. instalacje do przetwarzania UO2 na UCl4.

0B004 Następujące instalacje do produkcji lub stężania ciężkiej wody, deuteru i związków deuteru oraz specjalnie do nich zaprojektowane i wykonane urządzenia i podzespoły:

a. następujące instalacje do produkcji ciężkiej wody, deuteru i związków deuteru:

1. instalacje do produkcji metodą wymiany woda-siarkowodór;

2. instalacje do produkcji metodą wymiany amoniak-wodór;

b. następujące urządzenia i podzespoły:

1. kolumnowe wymienniki typu woda-siarkowodór mające średnicę 1,5 m lub większą i zdolność do pracy przy ciśnieniach równych lub większych niż 2 MPa;

2. jednostopniowe, niskociśnieniowe (np. 0,2 MPa), odśrodkowe dmuchawy lub kompresory wymuszające cyrkulację gazowego siarkowodoru (tj. gazu zawierającego więcej niż 70 % H2S), o przepustowości równej lub większej niż 56 m3/s podczas pracy przy ciśnieniach zasysania równych lub większych niż 1,8 MPa, posiadające uszczelnienia umożliwiające pracę w środowisku wilgotnego H2S;

3. kolumnowe wymienniki typu amoniak-wodór o wysokości równej lub większej niż 35 m i średnicy od 1,5 m do 2,5 m, zdolne do pracy przy ciśnieniach większych niż 15 MPa;

4. konstrukcje wewnętrzne kolumn łącznie z kontaktorami stopniowymi i pompami stopniowymi, w tym zanurzeniowymi, do produkcji ciężkiej wody w procesie wymiany amoniak-wodór;

5. instalacje do krakowania amoniaku zdolne do pracy przy ciśnieniach równych lub większych niż 3 MPa przy produkcji ciężkiej wody w procesie wymiany amoniak-wodór;

6. podczerwone analizatory absorpcyjne zdolne do bieżącej (on-line) analizy stosunku wodoru do deuteru w warunkach, w których stężenia deuteru są równe lub większe niż 90 %;

7. palniki katalityczne do konwersji wzbogaconego deuteru w ciężką wodę przy użyciu procesu wymiany amoniak-wodór;

8. kompletne systemy wzbogacania ciężkiej wody lub przeznaczone dla nich kolumny, przeznaczone do zwiększania koncentracji deuteru w ciężkiej wodzie do poziomu reaktorowego;

9. konwertery do syntezy amoniaku lub urządzenia do syntezy amoniaku specjalnie zaprojektowane lub wykonane z przeznaczeniem do produkcji ciężkiej wody w procesie wymiany amoniak-wodór.

0B005 Instalacje specjalnie zaprojektowane do wytwarzania elementów paliwowych do "reaktorów jądrowych" oraz specjalnie dla nich zaprojektowane lub przystosowane urządzenia.

Uwaga techniczna:

Specjalnie zaprojektowane lub przystosowane urządzenia do wytwarzania elementów paliwowych do "reaktorów jądrowych" obejmują urządzenia, które:

1. pozostają w bezpośrednim kontakcie z materiałami jądrowymi lub bezpośrednio je przetwarzają lub sterują procesem ich produkcji;

2. uszczelniają materiały jądrowe wewnątrz ich koszulek;

3. kontrolują szczelność koszulek;

4. kontrolują końcową obróbkę paliwa stałego; lub

5. są wykorzystywane do montażu elementów reaktora.

0B006 Instalacje do przerobu napromieniowanych (wypalonych w różnym stopniu) elementów paliwowych "reaktorów jądrowych" oraz specjalnie dla nich zaprojektowane lub wykonane urządzenia i podzespoły.

Uwaga: Pozycja 0B006 obejmuje:

a. instalacje do przerobu napromieniowanych (wypalonych w różnym stopniu) elementów paliwowych "reaktorów jądrowych", w tym urządzenia i podzespoły, które zazwyczaj wchodzą w bezpośredni kontakt z materiałami jądrowymi, służą do ich bezpośredniego przetwarzania lub sterowania ich przepływem;

b. maszyny do rozdrabniania lub kruszenia elementów paliwowych, tj. zdalnie sterowane urządzenia do cięcia lub krojenia napromieniowanych (wypalonych w różnym stopniu) zespołów, wiązek lub prętów paliwowych "reaktorów jądrowych";

c. urządzenia do rozpuszczania, zbiorniki podkrytyczne (np. zbiorniki o małych średnicach, pierścieniowe lub płaskie), specjalnie zaprojektowane lub wykonane z przeznaczeniem do rozpuszczania napromieniowanego (wypalonego w różnym stopniu) paliwa do "reaktorów jądrowych", odporne na działanie gorących, silnie żrących płynów oraz przystosowane do zdalnego załadunku i obsługi;

d. ekstraktory rozpuszczalnikowe, takie jak kolumny z wypełnieniem lub impulsowe, mieszalniki odstojniki lub kontaktory odśrodkowe odporne na żrące działanie kwasu azotowego, specjalnie zaprojektowane lub wykonane z przeznaczeniem do wykorzystania w instalacjach do przerobu napromieniowanego (wypalonego w różnym stopniu) "uranu naturalnego", "uranu zubożonego" lub "specjalnego materiału rozszczepialnego";

e. zbiorniki technologiczne lub magazynowe, specjalnie zaprojektowane w taki sposób, że są podkrytyczne i odporne na żrące działanie kwasu azotowego;

Uwaga techniczna:

Zbiorniki technologiczne lub magazynowe mogą mieć następujące właściwości:

1. ścianki lub struktury wewnętrzne z co najmniej dwuprocentowym ekwiwalentem borowym (obliczonym dla wszystkich składowych pierwiastków w sposób zdefiniowany w uwadze do pozycji 0C004);

2. maksymalną średnicę 175 mm w przypadku zbiorników cylindrycznych; lub

3. maksymalną szerokość 75 mm w przypadku zbiorników płytowych lub pierścieniowych;

f. neutronowe systemy pomiaru specjalnie zaprojektowane lub wykonane z przeznaczeniem do zamontowania i zastosowania wraz automatycznymi systemami sterowania procesami w instalacjach do przerobu napromieniowanego (wypalonego w różnym stopniu) "uranu naturalnego", "uranu zubożonego" lub "specjalnego materiału rozszczepialnego".

0B007 Instalacje do przetwarzania plutonu oraz specjalnie dla nich zaprojektowane lub wykonane urządzenia i podzespoły:

a. instalacje do przetwarzania azotanu plutonu na tlenek plutonu;

b. instalacje do wytwarzania plutonu metalicznego.

0C Materiały

0C001 "Uran naturalny" lub "uran zubożony" lub tor w postaci metalu, stopu, związku chemicznego lub koncentratu i dowolny inny materiał zawierający jeden lub więcej z powyższych materiałów.

Uwaga: Pozycja 0C001 nie obejmuje kontrolą:

a. czterech gramów lub mniejszej ilości "uranu naturalnego" lub "uranu zubożonego", jeżeli znajduje się on w czujnikach instrumentów pomiarowych;

b. "uranu zubożonego" specjalnie wyprodukowanego z przeznaczeniem do wyrobu następujących produktów cywilnych spoza dziedziny jądrowej:

1. osłon;

2. wypełnień;

3. balastów o masie nieprzekraczającej 100 kg;

4. przeciwwag o masie nieprzekraczającej 100 kg;

c. stopów zawierających mniej niż 5 % toru;

d. produktów ceramicznych zawierających tor, ale wykonanych do zastosowań poza dziedziną jądrową.

0C002 "Specjalne materiały rozszczepialne"

Uwaga: Pozycja 0C002 nie obejmuje kontrolą czterech "gramów efektywnych" lub mniejszej ilości w przypadku ich stosowania w czujnikach instrumentów pomiarowych.

0C003 Deuter, ciężka woda (tlenek deuteru) i inne związki deuteru oraz ich mieszaniny i roztwory, w których stosunek liczby atomów deuteru do atomów wodoru jest większy niż 1:5 000.

0C004 Grafit o stopniu zanieczyszczenia poniżej 5 części na milion "ekwiwalentu boru" oraz gęstości większej niż 1,50 g/cm3 przeznaczony do zastosowania w "reaktorach jądrowych", w ilościach przekraczających 1 kg.

N.B. ZOB. TAKŻE POZYCJA 1C107.

Uwaga 1: Dla celów kontroli wywozu właściwe organy państwa członkowskiego, w którym eksporter ma swoją siedzibę, stwierdzą, czy wywóz grafitu spełniającego powyższe specyfikacje ma na celu zastosowanie w "reaktorach jądrowych".

Uwaga 2: W pozycji 0C004 "ekwiwalent boru" (BE) zdefiniowany jest jako suma BEZ dla domieszek (z pominięciem BEcarbon dla węgla, ponieważ węgiel nie jest uważany za domieszkę) z uwzględnieniem boru, gdzie:

BEZ (ppm) = CF × stężenie pierwiastka Z określane w ppm (częściach na milion)

gdzie CF jest współczynnikiem przeliczeniowym =

zaś σB i σZ są przekrojami czynnymi na wychwyt neutronów termicznych (w barnach) odpowiednio dla boru pochodzenia naturalnego i pierwiastka Z; a AB i AZ są masami atomowymi odpowiednio boru naturalnego i pierwiastka Z.

0C005 Specjalnie wzbogacone związki lub proszki do wyrobu przegród do dyfuzji gazowej, odporne na korozyjne działanie UF6 (np. nikiel lub stop zawierający 60 % wagowych lub więcej niklu, tlenek glinu i całkowicie fluorowane polimery węglowodorowe) o procentowym stopniu czystości w proporcji wagowej 99,9 % lub więcej i średniej wielkości cząstek poniżej 10 μm, mierzonej według normy Amerykańskiego Towarzystwa Materiałoznawczego (ASTM) B330 i wysokim stopniu jednorodności wymiarowej cząstek.

0D Oprogramowanie

0D001 "Oprogramowanie" specjalnie opracowane lub zmodyfikowane z przeznaczeniem do "rozwoju", "produkcji" lub "użytkowania" towarów wymienionych w tej kategorii.

0E Technologia

0E001 "Technologie" zgodnie z uwagą do technologii jądrowej służące do "rozwoju", "produkcji" lub "użytkowania" towarów wymienionych w tej kategorii.

KATEGORIA 1 - MATERIAŁY SPECJALNE I ZWIĄZANE Z NIMI URZĄDZENIA

1A Systemy, urządzenia i części składowe

1A001 Następujące elementy wykonane ze związków fluorowych:

a. uszczelnienia, uszczelki, masy uszczelniające lub przepony w układach paliwowych, które są specjalnie zaprojektowane do "statków powietrznych" lub rakiet kosmicznych i w których ponad 50 % zawartości wagowej stanowi jeden z materiałów objętych kontrolą według pozycji 1.C009.b lub 1C009.c;

b. nieużywane;

c. nieużywane.

1A002 Następujące wyroby lub laminaty "kompozytowe":

N.B. ZOB. TAKŻE POZYCJE 1A202, 9A010 i 9A110.

a. wykonane z któregokolwiek z poniższych:

1. organiczne "matryce" i "materiały włókniste lub włókienkowe" określone w pozycji 1C010.c. lub 1C010.d.: lub

2. prepregi lub preformy określone w pozycji 1C010.e.;

b. wykonane z "matrycy" metalowej lub węglowej i z któregokolwiek spośród niżej wymienionych materiałów:

1. węglowych "materiałów włóknistych lub włókienkowych", które spełniają wszystkie z poniższych kryteriów:

a. "moduł właściwy" większy niż 10,15 × 106 m; oraz

b. "wytrzymałość właściwa na rozciąganie" większa niż 17,7 × 104 m; lub

2. materiałów wymienionych w pozycji 1C010.c.

Uwaga 1: Pozycja 1A002 nie dotyczy wyrobów "kompozytowych" ani laminatów wykonanych z żywic epoksydowych impregnowanych węglowymi "materiałami włóknistymi lub włókienkowymi", przeznaczonych do naprawy elementów lub laminatów "cywilnych statków powietrznych" i spełniających wszystkie z poniższych kryteriów:

a. mają powierzchnię nieprzekraczającą 1 m2;

b. mają długość nieprzekraczającą 2,5 m; oraz

c. mają szerokość przekraczającą 15 mm.

Uwaga 2: Pozycja 1A002 nie obejmuje kontrolą produktów półgotowych, specjalnie zaprojektowanych do następujących, wyłącznie cywilnych, zastosowań:

a. sprzęt sportowy;

b. przemysł motoryzacyjny;

c. przemysł obrabiarkowy;

d. zastosowania medyczne.

Uwaga 3: Pozycja 1A002.b.1 nie obejmuje kontrolą produktów półgotowych zawierających maksymalnie dwie warstwy plecionych włókien, specjalnie zaprojektowanych do następujących zastosowań:

a. piec do obróbki cieplnej metali służący do odpuszczania metalu;

b. urządzenia do produkcji monokryształu krzemu.

Uwaga 4: Pozycja 1A002 nie obejmuje kontrolą produktów gotowych, specjalnie zaprojektowanych do konkretnych zastosowań.

1A003 Wyroby z innych niż "topliwe" poliimidów aromatycznych, w postaci folii, arkuszy, taśm lub wstęg, które spełniają którekolwiek z poniższych kryteriów:

a. o grubości większej niż 0,254 mm; lub

b. są powlekane lub laminowane węglem, grafitem, metalami lub substancjami magnetycznymi.

Uwaga: Pozycja 1A003 nie obejmuje kontrolą wyrobów powlekanych lub laminowanych miedzią, przeznaczonych do produkcji elektronicznych płytek drukowanych.

N.B. "Topliwe" poliimidy aromatyczne w każdej postaci, zob. pozycja 1C008.a.3.

1A004 Następujące urządzenia, wyposażenie i części ochronne i detekcyjne, inne niż specjalnie zaprojektowane do zastosowania wojskowego:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA, POZYCJE 2B351 I 2B352.

a. maski przeciwgazowe, pochłaniacze i wyposażenie dekontaminacyjne do nich, zaprojektowane lub zmodyfikowane dla ochrony przed którymkolwiek z poniższych czynników, a także części specjalnie do nich zaprojektowane:

Uwaga: Pozycja 1A004.a. obejmuje respiratory oczyszczające powietrze z własnym zasilaniem (PARP), zaprojektowane lub zmodyfikowane do celów ochrony przed środkami i materiałami wymienionymi w pozycji 1A004.a.

Uwaga techniczna:

Do celów pozycji 1A004.a.:

1. Maski przeciwgazowe są również nazywane maskami gazowymi.

2. Pochłaniacze obejmują również wkłady do filtrów.

1. "czynniki biologiczne";

2. 'materiały promieniotwórcze';

3. chemiczne środki bojowe; lub

4. "środki rozpraszania tłumu", w tym:

a. α-bromobenzenoacetonitryl (cyjanek bromobenzylu) (CA) (CAS 5798-79-8);

b. dinitryl [(2-chlorofenylo)metyleno]propanu, (o-chlorobenzylidenomalanonitryl) (CS) (CAS 2698-41-1);

c. 2-chloro-1-fenyloetanon, chlorek fenylacylu (ω-chloroacetofenon) (CN) (CAS 532-27-4);

d. dibenzo-(b,f)-1,4-oksazepina (CR) (CAS 257-07-8);

e. 10-chloro-5,10-dihydrofenarsazyna, (chlorek fenarsazyny), (adamsyt), (DM) (CAS 578-94-9);

f. N-nonanoilomorfolina (MPA) (CAS 5299-64-9);

b. ubrania, rękawice i obuwie ochronne specjalnie zaprojektowane lub zmodyfikowane dla ochrony przed którymkolwiek z poniższych:

1. "czynniki biologiczne";

2. 'materiały promieniotwórcze'; lub

3. chemiczne środki bojowe;

c. systemy detekcji, specjalnie zaprojektowane lub zmodyfikowane dla wykrywania lub identyfikacji którychkolwiek z poniższych czynników, a także części specjalnie do nich zaprojektowane:

1. "czynniki biologiczne";

2. 'materiały promieniotwórcze'; lub

3. chemiczne środki bojowe.

d. urządzenia elektroniczne zaprojektowane do automatycznego wykrywania lub określania obecności pozostałości "materiałów wybuchowych" przy użyciu technik 'wykrywania substancji śladowych' (np. powierzchniowa fala akustyczna, spektrometria w oparciu o ruchliwość jonów, spektrometria w oparciu o rozkład ruchliwości, spektrometria masowa).

Uwaga techniczna:

'Wykrywanie substancji śladowych' oznacza zdolność do wykrywania poniżej 1 ppm gazu lub 1 mg substancji stałej lub cieczy.

Uwaga 1: Pozycja 1A004.d nie obejmuje kontrolą urządzeń specjalnie zaprojektowanych do użytku laboratoryjnego.

Uwaga 2: Pozycja 1A004.d nie obejmuje kontrolą stacjonarnych bezstykowych bramek bezpieczeństwa.

Uwaga: Pozycja 1A004 nie obejmuje kontrolą:

a. osobistych monitorujących dozymetrów promieniowania jądrowego;

b. urządzeń BHP ograniczonych projektowo lub funkcjonalnie do spełniania ochrony przed zagrożeniami typowymi dla bezpieczeństwa mieszkańców i domostw lub przemysłu cywilnego, w tym w:

1. górnictwie;

2. eksploatacji kamieniołomów;

3. rolnictwie;

4. przemyśle farmaceutycznym;

5. medycynie;

6. weterynarii;

7. ochronie środowiska;

8. gospodarowaniu odpadami;

9. przemyśle spożywczym.

Uwagi techniczne:

1. Pozycja 1A004 obejmuje urządzenia i części, które uznano za skuteczne, przetestowano z wynikiem pozytywnym według norm krajowych lub w inny sposób dowiedziono ich skuteczności w zakresie wykrywania 'materiałów promieniotwórczych' "czynników biologicznych", chemicznych środków bojowych, 'nietoksycznych substancji zastępczych' lub "środków rozpraszania tłumu", a także obrony przed wymienionymi materiałami, czynnikami i środkami, także wtedy, gdy takie wyposażenie lub części stosowane są w cywilnych gałęziach działalności, takich jak: górnictwo, przemysł wydobywczy, rolnictwo, przemysł farmaceutyczny, medycyna, weterynaria, ochrona środowiska, gospodarka odpadami lub przemysł spożywczy.

2. 'Nietoksyczna substancja zastępcza' oznacza substancję lub materiał stosowany zamiast środków toksycznych (chemicznych lub biologicznych) w ramach szkoleń, badań naukowych, testów lub ocen.

3. Do celów pozycji 1A004 'materiały promieniotwórcze' oznaczają materiały wybrane lub zmodyfikowane w celu zwiększenia ich skuteczności w wywoływaniu strat w ludności lub zwierzętach, unieszkodliwianiu sprzętu lub powodowaniu strat w uprawach rolnych lub środowisku.

1A005 Następujące kamizelki i okrycia kuloodporne oraz elementy do nich:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

a. miękkie pancerze osobiste lub odzież ochronna, niewyprodukowane zgodnie z normami lub wymaganiami wojskowymi albo normami lub wymaganiami równoważnymi oraz specjalnie zaprojektowane do nich elementy składowe;

b. twarde płyty opancerzone do pancerzy osobistych dające ochronę balistyczną na poziomie IIIA lub niższym (NIJ 0101.06, lipiec 2008) lub odpowiedniki krajowe.

N.B. W odniesieniu do "materiałów włóknistych lub włókienkowych", stosowanych do produkcji kamizelek kuloodpornych zob. 1C010.

Uwaga 1: Pozycja 1A005 nie obejmuje kontrolą indywidualnych okryć kuloodpornych, gdy służą one ich użytkownikowi do osobistej ochrony.

Uwaga 2: Pozycja 1A005 nie obejmuje kontrolą kamizelek kuloodpornych zaprojektowanych wyłącznie do ochrony czołowej zarówno przed odłamkami, jak i siłą podmuchu z niewojskowych urządzeń wybuchowych.

Uwaga 3: Pozycja 1A005 nie obejmuje pancerzy osobistych zaprojektowanych wyłącznie do ochrony przed urazami na skutek pchnięcia nożem, szpikulcem, igłą lub tępym narzędziem.

1A006 Wyposażenie specjalnie zaprojektowane lub zmodyfikowane do celów unieszkodliwiania następujących improwizowanych urządzeń wybuchowych oraz specjalnie zaprojektowanych części i akcesoriów do nich:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

a. pojazdy zdalnie sterowane;

b. 'neutralizatory'.

Uwaga techniczna:

'Neutralizatory' to urządzenia specjalnie zaprojektowane, by uniemożliwić działanie urządzenia wybuchowego przez wyrzucenie pocisku płynnego, stałego lub kruchego.

Uwaga: Pozycja 1A006 nie obejmuje kontrolą wyposażenia obsługiwanego przez operatora.

1A007 Następujące wyposażenie i urządzenia specjalnie zaprojektowane w celu inicjowania ładunków oraz urządzeń zawierających "materiały energetyczne" za pomocą środków elektrycznych:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA, POZYCJE 3A229 I 3A232.

a. zestawy zapłonowe do detonatorów, zaprojektowane do detonatorów wymienionych w pozycji 1A007.b;

b. następujące zapłonniki elektryczne:

1. eksplodujące zapłonniki mostkowe (EB);

2. eksplodujące zapłonniki połączeń mostkowych (EBW);

3. zapłonniki udarowe;

4. eksplodujące zapłonniki foliowe (EFI).

Uwagi techniczne:

1. Zamiast słowa detonator używa się czasami słowa inicjator lub zapłonnik.

2. Do celów pozycji 1A007.b. wszystkie przedmiotowe detonatory wykorzystują małe przewodniki elektryczne (mostki, połączenia mostkowe lub folie) gwałtownie odparowujące po przepuszczeniu przez nie szybkich, wysokoprądowych impulsów elektrycznych. W przypadku zapłonników nieudarowych wybuchający przewodnik inicjuje eksplozję chemiczną w zetknięciu się z kruszącym materiałem wybuchowym, takim jak PETN (czteroazotan pentaerytrytu). W zapłonnikach udarowych wybuchowe odparowanie przewodnika elektrycznego zwalnia przeskok bijnika przez szczelinę, a jego uderzenie w materiał wybuchowy inicjuje eksplozję chemiczną. W niektórych przypadkach bijnik napędzany jest siłami magnetycznymi. Termin detonator w postaci folii eksplodującej może odnosić się zarówno do detonatorów typu EB, jak i udarowych.

1A008 Następujące ładunki, urządzenia i części:

a. 'ładunki kumulacyjne' spełniające którekolwiek z poniższych kryteriów:

1. zawartość materiałów wybuchowych netto (NEQ) większa niż 90 g; oraz

2. zewnętrzna średnica obudowy równa lub większa niż 75 mm;

b. ładunki tnące o kształcie liniowym spełniające wszystkie poniższe kryteria i specjalnie zaprojektowane do nich części:

1. zawartość materiałów wybuchowych większa niż 40 g/m; oraz

2. szerokość równa lub większa niż 10 mm;

c. lont detonujący o zawartości materiałów wybuchowych większej niż 64 g/m;

d. urządzenia tnące, inne niż wyszczególnione w 1A008.b, oraz narzędzia odcinające o zawartości materiałów wybuchowych netto (NEQ) większej niż 3,5 kg.

Uwaga techniczna:

'Ładunki kumulacyjne' to ładunki wybuchowe ukształtowane tak, by ukierunkować siłę wybuchu.

1A102 Elementy z przesyconego pirolizowanego materiału typu węgiel-węgiel przeznaczone do kosmicznych pojazdów nośnych określonych w pozycji 9A004 lub do rakiet meteorologicznych określonych w pozycji 9A104.

1A202 Elementy kompozytowe, inne niż wymienione w pozycji 1A002, w postaci rur i mające obie z następujących cech:

N.B. ZOB. TAKŻE POZYCJE 9A010 I 9A110.

a. średnicę wewnętrzną od 75 mm do 400 mm; oraz

b. są wykonane z jednego z "materiałów włóknistych lub włókienkowych" wymienionych w pozycji 1C010.a, 1C010.b lub 1C210.a lub z materiałów węglowych wyspecyfikowanych w pozycji 1C210.c.

1A225 Katalizatory platynowe specjalnie opracowane lub przygotowane do wspomagania reakcji wymiany izotopów wodoru pomiędzy wodorem a wodą w celu separacji trytu z ciężkiej wody lub w celu produkcji ciężkiej wody.

1A226 Wyspecjalizowane wkłady do oddzielania ciężkiej wody od wody zwykłej, mające obydwie z następujących cech:

a. są wykonane z siatek z brązu fosforowego obrabianych chemicznie dla zwiększenia nasiąkliwości; oraz

b. są przeznaczone do stosowania w próżniowych wieżach destylacyjnych.

1A227 Przeciwradiacyjne okna ochronne o wysokiej gęstości (ze szkła ołowiowego lub podobnych materiałów), mające wszystkie z następujących cech, oraz specjalnie do nich zaprojektowane ramy:

a. powierzchnię w obszarze nieradioaktywnym powyżej 0,09 m2;

b. gęstość powyżej 3 g/cm3; oraz

c. grubość 100 mm lub większą.

Uwaga techniczna:

Na użytek pozycji 1A227 termin 'obszar nieradioaktywny' oznacza pole widzenia okna wystawionego na promieniowanie o poziomie najniższym w danym zastosowaniu.

1B Urządzenia testujące, kontrolne i produkcyjne

1B001 Następujące urządzenia do produkcji lub kontroli wyrobów lub laminatów "kompozytowych" wyszczególnionych w pozycji 1A002 lub "materiałów włóknistych lub włókienkowych" wyszczególnionych w pozycji 1C010 oraz specjalnie do nich skonstruowane elementy i akcesoria:

N.B. ZOB. TAKŻE POZYCJE 1B101 I 1B201.

a. maszyny nawojowe do włókien, z koordynowanymi i programowanymi w trzech lub więcej 'głównych osiach serwosterowania' ruchami związanymi z ustawianiem, owijaniem i nawijaniem włókien, specjalnie zaprojektowane z przeznaczeniem do produkcji wyrobów "kompozytowych" lub laminatów, z "materiałów włóknistych lub włókienkowych";

b. 'maszyny do układania taśm', z koordynowanymi i programowanymi w co najmniej pięciu 'głównych osiach serwosterowania' ruchami związanymi z ustawianiem w odpowiednim położeniu i układaniem taśm, specjalnie zaprojektowane do produkcji "kompozytowych" elementów konstrukcyjnych płatowca lub 'pocisku rakietowego';

Uwaga: W pozycji 1B001.b 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych.

Uwaga techniczna:

Na użytek pozycji 1B001.b 'maszyny do układania taśm' są zdolne do układania jednego lub więcej 'pasm włókien' ograniczonych do szerokości większej niż 25,4 mm, lecz mniejszej lub równej 304,8 mm oraz do cięcia i ponownego rozpoczynania pojedynczych 'pasm włókien' podczas procesu układania.

c. wielokierunkowe, wielowymiarowe maszyny tkackie lub maszyny do przeplatania, łącznie z zestawami adaptacyjnymi i modyfikacyjnymi, zaprojektowane lub zmodyfikowane specjalnie do tkania, przeplatania lub splatania włókien na potrzeby elementów "kompozytowych";

Uwaga techniczna:

Na użytek pozycji 1B001.c technika przeplatania obejmuje również dzianie.

d. następujące urządzenia specjalnie zaprojektowane lub przystosowane do produkcji włókien wzmocnionych:

1. urządzenia do przetwarzania włókien polimerowych (takich jak poliakrylonitryl, włókno z celulozy regenerowanej, paku lub polikarbosilanu) we włókna węglowe lub włókna węglika krzemu, łącznie ze specjalnymi urządzeniami do naprężania włókien podczas ogrzewania;

2. urządzenia do chemicznego osadzania par pierwiastków lub związków chemicznych na ogrzanych podłożach włóknistych w celu wyprodukowania włókien z węglika krzemu;

3. urządzenia do mokrego przędzenia ogniotrwałych materiałów ceramicznych (takich jak tlenek glinu);

4. urządzenia do przetwarzania za pomocą obróbki cieplnej włókien macierzystych zawierających aluminium we włókna tlenku glinu;

e. urządzenia do produkcji prepregów, wyszczególnionych w pozycji 1C010.e, metodą topienia termicznego (hot melt);

f. następujące urządzenia do badań nieniszczących specjalnie zaprojektowane do materiałów "kompozytowych":

1. systemy tomografii rentgenowskiej do kontroli wad w trzech wymiarach;

2. sterowane numerycznie ultradźwiękowe urządzenia badawcze, w których ruchy nadajników lub odbiorników do pozycjonowania są równocześnie sterowane i programowane w co najmniej czterech osiach w celu śledzenia trójwymiarowych kształtów badanych elementów;

g. 'maszyny do układania kabli' z włókien, z koordynowanymi i programowanymi w co najmniej dwóch 'głównych osiach serwosterowania' ruchami związanymi z ustawianiem w odpowiednim położeniu i układaniem kabli, specjalnie zaprojektowane do produkcji "kompozytowych" elementów konstrukcyjnych płatowca lub 'pocisku rakietowego';

Uwaga techniczna:

Do celów pozycji 1B001.g 'maszyny do układania kabli' są zdolne do układania jednego lub więcej 'pasm włókien' o szerokości mniejszej lub równej 25,4 mm oraz do cięcia i ponownego rozpoczynania pojedynczych 'pasm włókien' podczas procesu układania.

Uwagi techniczne:

1. Do celów pozycji 1B001 'główne osie serwosterowania' sterują pod kontrolą programu komputerowego pozycją manipulatora (tj. głowicą) w przestrzeni w odniesieniu do obrabianego elementu, nadając mu właściwe położenie i kierunek, by osiągnąć pożądany wynik.

2. Do celów pozycji 1B001 'pasmo włókna' oznacza pojedynczą ciągłą szerokość taśmy, kabla lub włókna częściowo impregnowanych żywicą. 'Pasma włókna' całkowicie lub częściowo impregnowane żywicą obejmują pasma pokryte suchym proszkiem, który przywiera po podgrzaniu.

1B002 Urządzenia do produkcji stopów metali, proszków ze stopów metali lub materiałów stopowych specjalnie zaprojektowane w celu zabezpieczenia przed zanieczyszczeniem i specjalnie zaprojektowane do wykorzystania w jednym z procesów wyszczególnionych w pozycji 1C002.c.2.

N.B. ZOB. TAKŻE POZYCJA 1B102.

1B003 Narzędzia, matryce, formy lub osprzęt o specjalnej konstrukcji do przetwarzania tytanu, glinu lub ich stopów w "stanie nadplastycznym" lub metodą "zgrzewania dyfuzyjnego" z przeznaczeniem do produkcji którychkolwiek z poniższych:

a. konstrukcji lotniczych lub kosmicznych;

b. silników do "statków powietrznych" i rakiet kosmicznych; lub

c. specjalnie zaprojektowanych zespołów do konstrukcji wyszczególnionych w pozycji 1B003.a lub silników wyszczególnionych w pozycji 1B003.b.

1B101 Następujące urządzenia, inne niż wyszczególnione w pozycji 1B001, do "produkcji" kompozytów konstrukcyjnych oraz specjalnie do nich skonstruowane elementy i akcesoria:

N.B. ZOB. TAKŻE POZYCJA 1B201.

Uwaga: Do wyszczególnionych w pozycji 1B101 elementów i akcesoriów należą formy, trzpienie, matryce, uchwyty i oprzyrządowanie do wstępnego prasowania, utrwalania, odlewania, spiekania lub spajania elementów kompozytowych, laminatów i wytworzonych z nich wyrobów.

a. maszyny nawojowe do włókien lub maszyny do zbrojenia włóknami, z koordynowanymi i programowanymi w trzech lub więcej osiach ruchami związanymi z ustawianiem, owijaniem i nawijaniem włókien, specjalnie zaprojektowane z przeznaczeniem do produkcji wyrobów kompozytowych lub laminatów z materiałów włóknistych lub włókienkowych;

b. maszyny do układania taśm z koordynowanymi i programowanymi w co najmniej dwóch osiach ruchami związanymi z ustawianiem w odpowiednim położeniu i układaniem taśm i arkuszy, specjalnie zaprojektowane z przeznaczeniem do kompozytowych elementów konstrukcyjnych płatowca lub "pocisku rakietowego";

c. następujące urządzenia zaprojektowane lub przystosowane do "produkcji" "materiałów włóknistych lub włókienkowych":

1. urządzenia do przetwarzania włókien polimerowych (takich jak poliakrylonitryl, włókno z celulozy regenerowanej lub polikarbosilan) łącznie ze specjalnymi urządzeniami do naprężania włókien podczas ogrzewania;

2. urządzenia do chemicznego osadzania par pierwiastków lub związków chemicznych na ogrzanych podłożach włóknistych;

3. urządzenia do mokrego przędzenia ogniotrwałych materiałów ceramicznych (takich jak tlenek glinu);

d. urządzenia skonstruowane lub zmodyfikowane z przeznaczeniem do specjalnej obróbki powierzchniowej włókien lub do wytwarzania prepregów i preform wyszczególnionych w pozycji 9C110.

Uwaga: Do urządzeń ujętych w pozycji 1B101.d zalicza się rolki, naprężacze, zespoły powlekające, urządzenia do cięcia i formy zatrzaskowe.

1B102 "Urządzenia produkcyjne" do wytwarzania proszków metali, inne niż wyszczególnione w poz. 1B002, oraz następujące elementy:

N.B. ZOB. TAKŻE POZYCJA 1B115.b.

a. "urządzenia produkcyjne" do wytwarzania proszków metali umożliwiające "produkcję", w kontrolowanej atmosferze, sferycznych, sferoidalnych lub pylistych materiałów wyszczególnionych w pozycjach 1C011.a, 1C011.b, 1C111.a.1, 1C111.a.2 lub w wykazie uzbrojenia;

b. specjalnie zaprojektowane elementy do "urządzeń produkcyjnych" wyszczególnionych w poz. 1B002 lub 1B102.a.

Uwaga: Pozycja 1B102 obejmuje:

a. generatory plazmowe (na zasadzie łuku elektrycznego wysokiej częstotliwości) nadające się do otrzymywania pylistych lub sferycznych proszków metali, z organizacją procesu w środowisku argon-woda;

b. urządzenia elektroimpulsowe umożliwiające otrzymywanie pylistych lub sferycznych proszków metali, z organizacją procesu w środowisku argon-woda;

c. urządzenia umożliwiające "produkcję" sferycznych proszków aluminiowych przez rozpylanie roztopionego metalu w atmosferze obojętnej (np. azocie).

1B115 Urządzenia, inne niż wyszczególnione w pozycjach 1B002 lub 1B102, do produkcji paliw i składników paliw oraz specjalnie do nich skonstruowane podzespoły:

a. "urządzenia produkcyjne" do "produkcji", manipulowania i testowania odbiorczego paliw płynnych i składników paliw wyszczególnionych w pozycjach 1C011.a, 1C011.b i 1C111 lub w wykazie uzbrojenia;

b. "urządzenia produkcyjne" do "produkcji", manipulowania, mieszania, utrwalania, odlewania, prasowania, obrabiania, wytłaczania lub testowania odbiorczego paliw stałych i składników paliw wyszczególnionych w pozycjach 1C011.a, 1C011.b i 1C111 lub w wykazie uzbrojenia.

Uwaga: Pozycja 1B115.b nie obejmuje kontrolą mieszarek okresowych, mieszarek ciągłych lub młynów wykorzystujących energię płynów. W sprawie kontroli mieszarek okresowych, mieszarek ciągłych lub młynów wykorzystujących energię płynów zob. pozycje 1B117, 1B118 i 1B119.

Uwaga 1: Urządzenia specjalnie zaprojektowane do produkcji wyrobów militarnych wymagają każdorazowo sprawdzenia wykazu uzbrojenia.

Uwaga 2: Pozycja 1B115 nie obejmuje kontrolą urządzeń do "produkcji", manipulowania i testowania odbiorczego węgliku boru.

1B116 Dysze o specjalnej konstrukcji, przeznaczone do wytwarzania materiałów pochodzenia pirolitycznego, formowanych w matrycy, na trzpieniu lub innym podłożu, z gazów macierzystych rozkładających się w zakresie temperatur od 1 573 K (1 300 °C) do 3 173 K (2 900 °C) przy ciśnieniach w zakresie od 130 Pa do 20 kPa.

1B117 Mieszarki okresowe spełniające wszystkie poniższe kryteria i specjalnie zaprojektowane do nich elementy:

a. zaprojektowane lub zmodyfikowane do mieszania próżniowego w zakresie od zera do 13,326 kPa,

b. zdolne do kontrolowania temperatury komory mieszania;

c. całkowita wydajność objętościowa 110 litrów lub większa; oraz

d. co najmniej jeden 'wał mieszający/ugniatający' osadzony mimośrodowo.

Uwaga: W pozycji 1B117.d 'wał mieszający/ugniatający' nie obejmuje rozdrabniaczy i głowic nożowych.

1B118 Mieszarki ciągłe spełniające wszystkie poniższe kryteria i specjalnie zaprojektowane do nich elementy:

a. zaprojektowane lub zmodyfikowane do mieszania próżniowego w zakresie od zera do 13,326 kPa,

b. zdolne do kontrolowania temperatury komory mieszania;

c. spełniające którekolwiek z poniższych kryteriów:

1. dwa lub więcej wałów mieszających/ugniatających; lub

2. spełniające którekolwiek z poniższych kryteriów:

a. jeden oscylujący wał obrotowy z zębami/kołkami ugniatającymi, oraz

b. zęby/kołki ugniatające wewnątrz obudowy komory mieszalniczej.

1B119 Młyny wykorzystujące energię płynów, nadające się do rozdrabniania i mielenia substancji wyszczególnionych w pozycjach 1C011.a, 1C011.b i 1C111 lub w wykazie uzbrojenia, i specjalnie zaprojektowane do nich elementy.

1B201 Następujące maszyny do nawijania włókien i związane z nimi wyposażenie, inne niż wyszczególnione w pozycji 1B001 lub 1B101:

a. maszyny do nawijania włókien, mające wszystkie z następujących cech:

1. koordynację i programowanie ruchów związanych z ustawianiem, owijaniem i nawijaniem włókien, w dwóch lub więcej osiach;

2. są specjalnie zaprojektowane z przeznaczeniem do produkcji wyrobów kompozytowych lub laminatów z "materiałów włóknistych lub włókienkowych"; oraz

3. są zdolne do nawijania cylindrycznych rurek o średnicy od 75 mm do 650 mm i długości 300 mm lub większej;

b. sterowniki koordynujące i programujące do maszyn do nawijania włókien wyszczególnionych w 1B201.a;

c. trzpienie precyzyjne do maszyn do nawijania włókien wyszczególnionych w 1B201.a.

1B225 Ogniwa elektrolityczne do produkcji fluoru o wydajności większej niż 250 gramów fluoru na godzinę.

1B226 Elektromagnetyczne separatory izotopów, skonstruowane z przeznaczeniem do współpracy z jednym lub wieloma źródłami jonów zdolnymi do uzyskania wiązki jonów o całkowitym natężeniu rzędu 50 mA lub więcej.

Uwaga: Pozycja 1B226 obejmuje następujące separatory:

a. zdolne do wzbogacania izotopów trwałych;

b. ze źródłami i kolektorami jonów zarówno w polu magnetycznym, jak i w takich instalacjach, w których zespoły te znajdują się na zewnątrz pola.

1B228 Kolumny do kriogenicznej destylacji wodoru posiadające wszystkie wymienione poniżej cechy:

a. zaprojektowane z przeznaczeniem do pracy przy temperaturach wewnętrznych 35 K (- 238 °C) lub niższych;

b. zaprojektowane z przeznaczeniem do pracy przy ciśnieniach wewnętrznych od 0,5 do 5 MPa;

c. skonstruowane:

1. z drobnoziarnistych stali nierdzewnych klasy 300 Międzynarodowego Stowarzyszenia Inżynierów Motoryzacji (Society of Automotive Engineers International - SAE) o niskiej zawartości siarki i o wielkości ziarna austenitu 5 lub większym według norm ASTM (lub równoważnych); lub

2. z materiałów równoważnych nadających się zarówno do działań w warunkach kriogenicznych, jak i w atmosferze wodorowej (H2); oraz

d. o średnicach wewnętrznych 30 cm lub większych i 'długościach efektywnych' 4 m lub większych.

Uwaga techniczna:

W pozycji 1B228 'długość efektywna' oznacza aktywną wysokość materiału wypełniającego w kolumnach z wypełnieniem lub aktywną wysokość płyt kontaktora wewnętrznego w kolumnach płytowych.

1B230 Pompy do przetłaczania roztworów katalizatora z amidku potasu rozcieńczonego lub stężonego w ciekłym amoniaku (KNH2/NH3), posiadające wszystkie wymienione poniżej cechy:

a. szczelność dla powietrza (tj. hermetycznie zamknięte);

b. wydajność powyżej 8,5 m3/h; oraz

c. nadające się do:

1. stężonych roztworów amidku potasu (1 % lub powyżej) - ciśnienie robocze 1,5-60 MPa; lub

2. rozcieńczonych roztworów amidku potasu (poniżej 1 %) - ciśnienie robocze 20-60 MPa.

1B231 Następujące urządzenia i instalacje do obróbki trytu lub ich podzespoły:

a. urządzenia lub instalacje do produkcji, odzyskiwania, ekstrakcji, stężania trytu lub manipulowania trytem;

b. następujące urządzenia dla instalacji lub fabryk trytu:

1. urządzenia do chłodzenia wodoru lub helu zdolne do chłodzenia do temperatury 23 K (- 250 °C) lub poniżej, o wydajności odprowadzania ciepła powyżej 150 watów;

2. instalacje do magazynowania i oczyszczania izotopów wodoru za pomocą wodorków metali jako środków do magazynowania lub oczyszczania.

1B232 Turborozprężarki lub zestawy turborozprężarka-sprężarka mające obie z wymienionych niżej cech:

a. zaprojektowane do działania przy temperaturze wylotowej poniżej 35 K (- 238 °C) lub niższej; oraz

b. posiadające przepustowość wodoru większą lub równą 1 000 kg/h.

1B233 Następujące urządzenia i instalacje do separacji izotopów litu oraz ich układy i podzespoły do nich:

a. urządzenia i instalacje do separacji izotopów litu;

b. następujące podzespoły do separacji izotopów litu w oparciu o proces amalgamacji litu i rtęci:

1. kolumny z wypełnieniem do wymiany cieczowo-cieczowej specjalnie zaprojektowane do amalgamatów litu;

2. pompy do pompowania rtęci lub amalgamatu litu;

3. ogniwa do elektrolizy amalgamatu litu;

4. aparaty wyparne do zagęszczonych roztworów wodorotlenku litu;

c. układy wymiany jonowej specjalnie zaprojektowane do separacji izotopów litu oraz specjalnie do nich zaprojektowane elementy;

d. układy wymiany chemicznej (wykorzystujące etery kronowe, kryptandy lub etery lariatowe) specjalnie zaprojektowane do separacji izotopów litu oraz specjalnie do nich zaprojektowane elementy.

1B234 Pojemniki do materiałów wybuchowych, komory, kontenery i inne podobne urządzenia zaprojektowane do testowania materiałów wybuchowych lub urządzeń wybuchowych, mające obie poniższe cechy:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

a. są zaprojektowane do całkowitego przyjęcia wybuchu równoważnego 2 kg trotylu (TNT) lub więcej: oraz

b. mają elementy konstrukcyjne lub cechy, które umożliwiają przekazywanie danych diagnostycznych lub pomiarowych w czasie rzeczywistym lub z opóźnieniem.

1B235 Następujące zespoły docelowe i elementy do produkcji trytu:

a. Zespoły docelowe wykonane z litu wzbogaconego izotopem litu-6 lub zawierające taki lit, specjalnie zaprojektowane do produkcji trytu poprzez napromienianie, w tym insercję w reaktorze jądrowym;

b. elementy specjalnie zaprojektowane do zespołów docelowych wyszczególnionych w pozycji 1B235.a.

Uwaga techniczna:

Elementy specjalnie zaprojektowane do zespołów docelowych do produkcji trytu mogą obejmować granulaty trytu, pochłaniacze trytu i specjalnie powlekane okładziny.

1C Materiały

Uwaga techniczna:

Metale i stopy:

Jeżeli nie zastrzeżono inaczej, terminy 'metale' i 'stopy' używane w pozycjach od 1C001 do 1C012 dotyczą następujących wyrobów surowych i półfabrykatów:

Wyroby surowe:

Anody, kule, pręty (łącznie z prętami karbowanymi i ciągnionymi), kęsy, bloki, bochny, brykiety, placki, katody, kryształy, kostki, struktury, ziarna, sztaby, bryły, pastylki, surówki, proszki, podkładki, śruty, płyty, owale osadnicze, gąbki i drążki.

Półfabrykaty (zarówno powlekane, pokrywane galwanicznie, wiercone i wykrawane, jak i niepoddane żadnej z tych obróbek):

a. przerobione plastycznie lub obrobione materiały wyprodukowane poprzez walcowanie, wyciąganie, wytłaczanie, kucie, prasowanie, granulowanie, rozpylanie, mielenie, tj.: kątowniki, ceowniki, koła, tarcze, pyły, płatki, folie, odkuwki, płyty, proszki, wytłoczki, wypraski, wstęgi, pierścienie, pręty (w tym pręty spawalnicze, walcówki i druty walcowane), kształtowniki, arkusze, taśmy, rury, rurki (w tym rury bezszwowe, rury o przekroju kwadratowym i tuleje rurowe), druty ciągnione i tłoczone;

b. materiały odlewnicze produkowane przez odlewanie w piasku, kokilach, formach metalowych, gipsowych i innych, w tym przez odlewanie pod ciśnieniem, formy spiekane i formy wykonywane w metalurgii proszkowej.

Cel kontroli nie powinien być omijany przez eksportowanie form niewymienionych w wykazie jako produktów rzekomo finalnych, ale będących w rzeczywistości formami surowymi lub półfabrykatami.

1C001 Następujące materiały specjalnie opracowane do pochłaniania promieniowania elektromagnetycznego lub polimery przewodzące samoistnie:

N.B. ZOB. TAKŻE POZYCJA 1C101.

a. materiały pochłaniające fale o częstotliwościach powyżej 2 × 108 Hz, ale poniżej 3 × 1012 Hz;

Uwaga 1: Pozycja 1C001.a nie obejmuje kontrolą:

a. pochłaniaczy typu włosowego, wykonanych z włókien naturalnych lub syntetycznych, w których pochłanianie osiąga się innym sposobem niż magnetyczny;

b. pochłaniaczy niewykazujących strat magnetycznych oraz takich, których powierzchnia, na którą pada promieniowanie, nie jest planarna, w tym ostrosłupów, stożków, klinów i powierzchni zwichrowanych;

c. pochłaniaczy planarnych spełniających wszystkie poniższe kryteria:

1. wykonane z któregokolwiek z poniższych:

a. ze spienionych tworzyw sztucznych (elastycznych lub nieelastycznych) wzmacnianych węglem lub z materiałów organicznych, łącznie z materiałami wiążącymi, dających więcej niż 5 % echa w porównaniu z metalami, w paśmie o szerokości wyższej o ± 15 % od częstotliwości centralnej padającej fali, i nieodpornych na temperatury przekraczające 450 K (177 °C); lub

b. z materiałów ceramicznych dających o ponad 20 % echa więcej w porównaniu z metalami, w paśmie o szerokości wyższej o ± 15 % od częstotliwości centralnej padającej fali, i nieodpornych na temperatury przekraczające 800 K (527 °C);

Uwaga techniczna:

Próbki do badania stopnia pochłaniania materiałów wyszczególnionych w uwadze 1.c.1 do pozycji 1C001.a. powinny być kwadratami o boku równym co najmniej 5 długościom fali o częstotliwości centralnej i umieszczone w polu dalekim elementu promieniującego fale elektromagnetyczne.

2. wytrzymałość na rozciąganie poniżej 7 × 106 N/m2; oraz

3. wytrzymałość na ściskanie poniżej 14 × 106 N/m2;

d. pochłaniaczy planarnych wykonanych ze spieku ferrytowego, spełniających wszystkie poniższe kryteria:

1. gęstość względna powyżej 4,4; oraz

2. maksymalna temperatura robocza na poziomie 548 K (275 °C).

Uwaga 2: Żadne sformułowanie w uwadze 1 do pozycji 1C001.a nie zwalnia z kontroli materiałów magnetycznych użytych jako pochłaniacze fal w farbach.

b. materiały nieprzezroczyste dla promieniowania widzialnego i specjalnie opracowane do pochłaniania promieniowania bliskiego podczerwieni o długości fali powyżej 810 nm, ale poniżej 2 000 nm (częstotliwości powyżej 150 THz, ale poniżej 370 THz);

Uwaga: Pozycja 1C001.b nie obejmuje kontrolą materiałów specjalnie zaprojektowanych lub opracowanych do któregokolwiek z poniższych zastosowań:

a. "laserowe" znakowanie polimerów; lub

b. "laserowe" spawanie polimerów;

c. materiały polimerowe przewodzące samoistnie, o 'objętościowej przewodności elektrycznej' powyżej 10 000 S/m (simensów na metr) lub 'oporności powierzchniowej' poniżej 100 omów/m2, których podstawową częścią składową jest którykolwiek z następujących polimerów:

1. polianilina;

2. polipirol;

3. politiofen;

4. polifenylenowinylen; lub

5. polietylenowinylen.

Uwaga: Pozycja 1C001.c nie obejmuje kontrolą materiałów w postaci ciekłej.

Uwaga techniczna:

'Objętościową przewodność elektryczną' oraz 'oporność powierzchniową' należy określać zgodnie z normą ASTM D-257 lub jej odpowiednikami krajowymi.

1C002 Następujące stopy metali, proszki stopów metali lub materiały stopowe:

N.B. ZOB. TAKŻE POZYCJA 1C202.

Uwaga: Pozycja 1C002 nie obejmuje kontrolą stopów metali, proszków stopów metali ani materiałów stopowych, specjalnie przeznaczonych do celów powlekania.

Uwagi techniczne:

1. Do stopów metalu według pozycji 1C002 zalicza się takie, które zawierają wyższy procent wagowy danego metalu niż dowolnego innego pierwiastka.

2. 'Trwałość w próbie pełzania do zerwania' należy określać według normy ASTM E-139 lub jej krajowych odpowiedników.

3. 'Trwałość w niskocyklowych badaniach zmęczeniowych' należy określać według normy ASTM E-606 'Zalecana metoda niskocyklowego badania zmęczeniowego przy stałej amplitudzie' lub jej krajowych odpowiedników. Badania należy prowadzić przy obciążeniu skierowanym osiowo, przy średniej wartości współczynnika asymetrii cyklu 1 oraz wartości współczynnika spiętrzenia naprężeń (Kt) równej 1. Naprężenie średnie definiuje się jako różnicę naprężenia maksymalnego i minimalnego podzieloną przez naprężenie maksymalne.

a. następujące glinki:

1. glinki niklu zawierające wagowo co najmniej 15 %, a co najwyżej 38 % glinu i przynajmniej jeden dodatek stopowy;

2. glinki tytanu zawierające wagowo 10 % lub więcej glinu i przynajmniej jeden dodatek stopowy;

b. następujące stopy metali wykonane z materiałów w postaci proszków lub pyłów wyszczególnionych w pozycji 1C002.c:

1. stopy niklu spełniające którekolwiek z poniższych kryteriów:

a. ich 'trwałość w próbie pełzania do zerwania' wynosi 10 000 lub więcej godzin w temperaturze 923 K (650 °C) przy naprężeniu 676 MPa; lub

b. ich 'trwałość w niskocyklowych badaniach zmęczeniowych' wynosi 10 000 lub więcej cykli w temperaturze 823 K (550 °C) przy maksymalnym naprężeniu 1 095 MPa;

2. stopy niobu spełniające którekolwiek z poniższych kryteriów:

a. ich 'trwałość w próbie pełzania do zerwania' wynosi 10 000 lub więcej godzin w temperaturze 1 073 K (800 °C) przy naprężeniu 400 MPa; lub

b. ich 'trwałość w niskocyklowych badaniach zmęczeniowych' wynosi 10 000 lub więcej cykli w temperaturze 973 K (700 °C) przy maksymalnym naprężeniu 700 MPa;

3. stopy tytanu spełniające którekolwiek z poniższych kryteriów:

a. ich 'trwałość w próbie pełzania do zerwania' wynosi 10 000 lub więcej godzin w temperaturze 723 K (450 °C) przy naprężeniu 200 MPa; lub

b. ich 'trwałość w niskocyklowych badaniach zmęczeniowych' wynosi 10 000 lub więcej cykli w temperaturze 723 K (450 °C) przy maksymalnym naprężeniu 400 MPa;

4. stopy glinu spełniające którekolwiek z poniższych kryteriów:

a. ich wytrzymałość na rozciąganie wynosi 240 MPa lub więcej w temperaturze 473 K (200 °C); lub

b. ich wytrzymałość na rozciąganie wynosi 415 MPa lub więcej w temperaturze 298 K (25 °C);

5. stopy magnezu spełniające wszystkie poniższe kryteria:

a. ich wytrzymałość na rozciąganie wynosi 345 MPa lub więcej; oraz

b. szybkość korozji w 3 % wodnym roztworze chlorku sodowego, mierzona według normy ASTM G-31 lub jej krajowych odpowiedników, wynosi poniżej 1 mm/rok;

c. proszki lub pyły stopów metali spełniające wszystkie poniższe kryteria:

1. wykonane z dowolnego materiału o podanych poniżej składach:

Uwaga techniczna:

W podanych poniżej związkach X oznacza jeden lub większą liczbę składników stopu.

a. stopów niklu (Ni-Al-X, Ni-X-Al) przeznaczonych do wyrobu części lub zespołów silników turbinowych, tj. zawierających mniej niż 3 cząsteczki niemetaliczne (wprowadzone podczas procesu produkcji) o wielkości przekraczającej 100 μm na 109 cząsteczek stopu;

b. stopów niobu (Nb-Al-X lub Nb-X-Al, Nb-Si-X lub Nb-X-Si, Nb-Ti-X lub Nb-X-Ti);

c. stopów tytanu (Ti-Al-X lub Ti-X-Al);

d. stopów glinu (Al-Mg-X lub Al-X-Mg, Al-Zn-X lub Al-X-Zn, Al-Fe-X lub Al-X-Fe); lub

e. stopów magnezu (Mg-Al-X lub Mg-X-Al);

2. wyprodukowane w atmosferze o regulowanych parametrach jedną z następujących metod:

a. 'rozpylania próżniowego';

b. 'rozpylania gazowego';

c. 'rozpylania rotacyjnego';

d. 'chłodzenia ultraszybkiego';

e. 'formowania rotacyjnego z fazy stopionej' i 'rozdrabniania';

f. 'formowania ekstrakcyjnego z fazy stopionej' i 'rozdrabniania';

g. 'stapiania mechanicznego'; lub

h. 'atomizacji plazmowej'; oraz

3. nadające się do formowania materiałów wyszczególnionych w pozycji 1C002.a lub 1C002.b;

d. materiały stopowe spełniające wszystkie poniższe kryteria:

1. wykonane z dowolnego materiału o składzie wyszczególnionym w pozycji 1C002.c.1;

2. w postaci niesproszkowanych płatków, wstążek lub cienkich pręcików; oraz

3. wyprodukowane w atmosferze o regulowanych parametrach jedną z następujących metod:

a. 'chłodzenia ultraszybkiego';

b. 'formowania rotacyjnego z fazy stopionej'; lub

c. 'formowania ekstrakcyjnego z fazy stopionej'.

Uwagi techniczne:

1. 'Rozpylanie próżniowe' oznacza proces rozpylania strumienia stopionego metalu na kropelki o średnicy 500 μm lub mniejszej poprzez szybkie uwolnienie rozpuszczonego gazu w warunkach podciśnienia.

2. 'Atomizacja gazowa' oznacza proces rozpylania strumienia stopionego metalu na kropelki o średnicy 500 μm lub mniejszej za pomocą strumienia gazu o wysokim ciśnieniu.

3. 'Atomizacja rotacyjna' oznacza proces rozpylania strumienia lub jeziorka stopionego metalu na kropelki o średnicy 500 μm lub mniejszej za pomocą siły odśrodkowej.

4. 'Chłodzenie ultraszybkie' oznacza technikę 'gwałtownego krzepnięcia' polegającą na uderzaniu stopionego strumienia metalu w chłodzony blok, w wyniku czego powstaje produkt w postaci płatków.

5. 'Formowanie rotacyjne z fazy stopionej' oznacza technikę 'gwałtownego krzepnięcia' polegającą na uderzaniu strumienia stopionego metalu w wirujący chłodzony blok, wskutek czego powstaje wyrób w postaci płatków, wstęgi lub pręcików.

6. 'Rozdrabnianie' oznacza proces wprowadzania materiału w postać drobnocząstkową przez zgniatanie lub mielenie.

7. 'Formowanie ekstrakcyjne z fazy stopionej' oznacza technikę 'gwałtownego krzepnięcia' i ekstrahowania wyrobu stopowego podobnego do wstęgi, polegającą na zanurzaniu krótkiego odcinka wirującego chłodzonego bloku w wannie stopionego stopu metalowego.

8. 'Stapianie mechaniczne' oznacza technikę wykonywania stopów polegającą na mechanicznym łączeniu, kruszeniu i ponownym łączeniu sproszkowanych pierwiastków i głównego składnika stopowego. Przez dodawanie odpowiednich proszków można wprowadzać do stopu cząstki niemetaliczne.

9. 'Atomizacja plazmowa' oznacza proces rozpylania strumienia stopionego metalu na kropelki o średnicy 500 μm lub mniejszej przy zastosowaniu pochodni plazmowych w atmosferze gazów obojętnych.

10. 'Gwałtowne krzepnięcie" oznacza proces obejmujący krzepnięcie roztopionego materiału podczas chłodzenia z szybkością powyżej 1 000 K/s.

1C003 Metale magnetyczne, bez względu na typ i postać, spełniające którekolwiek z poniższych kryteriów:

a. ich początkowa względna przenikalność magnetyczna wynosi 120 000 lub więcej, a grubość 0,05 mm lub mniej;

Uwaga techniczna:

Początkową względną przenikalność magnetyczną należy mierzyć na materiałach całkowicie wyżarzonych.

b. stopy magnetostrykcyjne spełniające którekolwiek z poniższych kryteriów:

1. magnetostrykcja nasycenia powyżej 5 × 10-4; lub

2. współczynnik sprzężenia żyromagnetycznego (k) powyżej 0,8; lub

c. taśmy ze stopów amorficznych lub 'nanokrystalicznych' spełniające wszystkie poniższe kryteria:

1. skład zawierający co najmniej 75 % wagowych żelaza, kobaltu lub niklu;

2. indukcja magnetyczna nasycenia (Bs) wynosząca 1,6 T lub więcej; oraz

3. spełniające którekolwiek z poniższych kryteriów:

a. grubość taśmy 0,02 mm lub mniejsza; lub

b. oporność właściwa 2 × 10-4 omów cm lub większa.

Uwaga techniczna:

Pod pojęciem materiały 'nanokrystaliczne' w pozycji 1C003.c rozumie się materiały o rozmiarze ziarna krystalicznego wynoszącym 50 nm lub mniej, zmierzonym metodą dyfrakcji promieniowania rentgenowskiego.

1C004 Stopy uranowo-tytanowe lub stopy wolframu na "matrycy" z żelaza, niklu lub miedzi spełniające wszystkie poniższe kryteria:

a. gęstość powyżej 17,5 g/cm3;

b. granica sprężystości powyżej 880 MPa;

c. wytrzymałość na rozciąganie powyżej 1 270 MPa; oraz

d. wydłużenie powyżej 8 %.

1C005 Następujące "nadprzewodzące" przewodniki "kompozytowe" o długości powyżej 100 m lub masie powyżej 100 g:

a. "nadprzewodzące" przewodniki "kompozytowe", w których skład wchodzi co najmniej jedno 'włókno' niobowo-tytanowe, spełniające oba poniższe kryteria:

1. osadzone w "matrycy" różnej od miedzianej lub "matrycy" mieszanej na osnowie miedzi; oraz

2. mające pole przekroju poprzecznego poniżej 0,28 × 10-4 mm2 (o średnicy 6 μm w przypadku 'włókien' o przekroju kołowym);

b. "nadprzewodzące" przewodniki "kompozytowe", w których skład wchodzi co najmniej jedno 'włókno' "nadprzewodzące" inne niż niobowo-tytanowe, spełniające wszystkie poniższe kryteria:

1. "temperatura krytyczna" przy zerowej indukcji magnetycznej powyżej 9,85 K (- 263,31 °C); oraz

2. pozostawanie w stanie "nadprzewodzącym" w temperaturze 4,2 K (- 268,96 °C) pod działaniem pola magnetycznego działającego w jakimkolwiek kierunku prostopadłym do osi podłużnej przewodnika oraz równoważnego indukcji magnetycznej 12 T o krytycznej gęstości prądu większej niż 1 750 A/mm2 w całkowitym polu przekroju poprzecznego przewodnika;

c. "nadprzewodzące" przewodniki "kompozytowe", w których skład wchodzi co najmniej jedno 'włókno' "nadprzewodzące", które nadal są "nadprzewodzące" w temperaturze powyżej 115 K (- 158,16 °C).

Uwaga techniczna:

Do celów pozycji 1C005 'włókna' mogą być w postaci drutu, cylindra, folii, taśmy lub wstęgi.

1C006 Następujące płyny i materiały smarne:

a. nieużywane;

b. materiały smarne zawierające jako części składowe podstawowe którekolwiek z poniższych:

1. etery lub tioetery fenylenowe lub alkilofenylenowe lub ich mieszaniny, zawierające powyżej dwóch grup funkcyjnych eteru lub tioeteru lub ich mieszaninę; lub

2. fluorowe oleje silikonowe o lepkości kinematycznej poniżej 5 000 mm2/s (5 000 centystokesów) mierzonej w temperaturze 298 K (25 °C);

c. płyny zwilżające lub flotacyjne spełniające wszystkie poniższe kryteria:

1. czystość powyżej 99,8 %;

2. zawierające mniej niż 25 cząstek o średnicy 200 μm lub większej w 100 ml; oraz

3. wykonane co najmniej w 85 % z któregokolwiek z poniższych:

a. dibromotetrafluoroetanu (CAS 25497-30-7, 124-73-2, 27336-23-8);

b. polichlorotrifluoroetylenu (tylko modyfikowanego olejem lub woskiem); lub

c. polibromotrifluoroetylenu;

d. fluorowęglowe elektroniczne płyny chłodzące spełniające wszystkie poniższe kryteria:

1. zawartość wagowa 85 % lub więcej następujących związków lub ich mieszanin:

a. monomeryczne postacie perfluoropolialkiloeterotriazyn lub perfluoropolialkiloeterów;

b. perfluoroalkiloaminy;

c. perfluorocykloalkany; lub

d. perfluoroalkany;

2. gęstość przy 298 K (25 °C) wynosząca 1,5 g/ml lub więcej;

3. stan ciekły w temperaturze 273 K (0 °C); oraz

4. zawartość wagowa fluoru 60 % lub więcej.

Uwaga: Pozycja 1C006.d nie obejmuje kontrolą materiałów określonych i pakowanych jako produkty medyczne.

1C007 Następujące proszki ceramiczne, "materiały kompozytowe" na "matrycy" ceramicznej oraz 'materiały macierzyste':

N.B.: ZOB. TAKŻE POZYCJA 1C107.

a. proszki ceramiczne z diborku tytanu (TiB2) (CAS 12045-63-5), w których łączna ilość zanieczyszczeń metalicznych, z wyłączeniem dodatków zamierzonych, wynosi poniżej 5 000 ppm (części na milion), w których przeciętne wymiary cząstek są równe lub mniejsze niż 5 μm oraz które zawierają nie więcej niż 10 % cząstek o wielkości powyżej 10 μm;

b. nieużywane;

c. następujące "materiały kompozytowe" na "matrycy" ceramicznej;

1. "materiały kompozytowe" ceramicznoceramiczne na "matrycy" szklanej lub tlenkowej, wzmacniane którymkolwiek z następujących materiałów:

a. włókna ciągłe wykonane z jednego z następujących materiałów:

1. Al203 (CAS 1344-28-1); lub

2. Si-C-N; lub

Uwaga: Pozycja 1C007.c.1.a nie obejmuje kontrolą "materiałów kompozytowych" zawierających włókna posiadające wytrzymałość na rozciąganie mniejszą niż 700 MPa przy temperaturze 1 273 K (1 000 °C) lub odporność na pełzanie większą niż 1 % odkształcenia przy obciążeniu 100 MPa i temperaturze 1 273 K (1 000 °C) w czasie 100 godzin.

b. włókna posiadające wszystkie poniższe cechy:

1. wykonane z któregokolwiek z następujących materiałów:

a. Si-N;

b. Si-C;

c. Si-Al-O-N; lub

d. Si-O-N; oraz

2. mające "wytrzymałość właściwą na rozciąganie" większą niż 12,7 × 103 m;

2. "materiały kompozytowe" na "matrycy" ceramicznej, w których "matrycę" stanowią węgliki lub azotki krzemu, cyrkonu lub boru;

d. nieużywane;

e. następujące 'materiały macierzyste', specjalnie zaprojektowane do "produkcji" materiałów ujętych w pozycji 1C007.c:

1. polidiorganosilany;

2. polisilazany;

3. polikarbosilazany;

Uwaga techniczna:

Do celów pozycji 1C007 'materiały macierzyste' oznaczają materiały polimerowe lub metaloorganiczne o specjalnym zastosowaniu używane do "produkcji" węglika krzemu, azotku krzemu lub materiałów ceramicznych zawierających krzem, węgiel i azot.

f. nieużywane.

1C008 Następujące materiały polimerowe niezawierające fluoru:

a. następujące imidy:

1. bismaleimidy;

2. poliamidoimidy aromatyczne (PAI) o 'temperaturze zeszklenia (Tg)' powyżej 563 K (290 °C);

3. poliimidy aromatyczne o 'temperaturze zeszklenia (Tg)' powyżej 505 K (232 °C);

4. polieteroimidy aromatyczne o 'temperaturze zeszklenia (Tg)' powyżej 563 K (290 °C);

Uwaga: Pozycja 1C008.a obejmuje kontrolą substancje ciekłe lub stałe w formie "topliwej", w tym w postaci żywicy, proszku, granulek, folii, arkuszy, taśmy lub wstęgi.

N.B. Wyroby z poliimidów aromatycznych innych niż "topliwe", w postaci folii, arkuszy, taśm lub wstęg, zob. 1A003.

b. nieużywane;

c. nieużywane;

d. poliketony arylenowe;

e. polisiarczki arylenowe, w których grupą arylenową jest bifenylen, trifenylen lub ich kombinacja;

f. polisulfon bifenylenoeterowy o 'temperaturze zeszklenia (Tg)' powyżej 563 K (290 °C).

Uwagi techniczne:

1. 'Temperatura zeszklenia (Tg)' dla materiałów termoplastycznych z pozycji 1C008.a.2, materiałów z pozycji 1C008.a.4. oraz materiałów z pozycji 1C008.f określana jest przy użyciu metody opisanej w normie ISO 11357-2 (1999) lub jej odpowiednikach krajowych.

2. 'Temperatura zeszklenia (Tg)' dla materiałów termoutwardzalnych z pozycji 1C008.a.2 oraz materiałów z pozycji 1C008.a.3 określana jest przy użyciu metody trzypunktowego zginania opisanej w normie ASTM D 7028-07 lub jej odpowiednikach krajowych. Test ten przeprowadza się na suchej próbce, która osiągnęła poziom utwardzenia co najmniej 90 %, jak określono w normie ASTM E 2160-04 lub jej odpowiednikach krajowych, i była utwardzana przy zastosowaniu połączenia procesu utwardzania standardowego i utwardzania dodatkowego, który daje najwyższą wartość Tg.

1C009 Następujące nieprzetworzone związki fluorowe:

a. nieużywane;

b. poliimidy fluorowane zawierające 10 % wagowych lub więcej związanego fluoru;

c. fluorowane elastomery fosfazenowe zawierające 30 % wagowych lub więcej związanego fluoru.

1C010 Następujące "materiały włókniste lub włókienkowe":

N.B. ZOB. TAKŻE POZYCJE 1C210 I 9C110.

Uwagi techniczne:

1. Do celów obliczenia "wytrzymałości właściwej na rozciąganie", "modułu właściwego" lub ciężaru właściwego "materiałów włóknistych i włókienkowych" z pozycji 1C010.a., 1C010.b., 1C010.c. lub 1C010.e.1.b. wytrzymałość na rozciąganie i moduł należy określać za pomocą metody A opisanej w normie ISO 10618 (2004) lub jej odpowiednikach krajowych

2. Ocenę "wytrzymałości właściwej na rozciąganie", "modułu właściwego" lub ciężaru właściwego niejednokierunkowych "materiałów włóknistych i włókienkowych" (np. tkanin, mat lub oplotów) z pozycji 1C010 należy oprzeć na mechanicznych właściwościach składowych włókien jednakowo ukierunkowanych (np. włókien elementarnych, przędz, rowingów lub kabli) przed ich przetworzeniem w niejednokierunkowe "materiały włókniste i włókienkowe".

a. organiczne "materiały włókniste lub włókienkowe", spełniające oba poniższe kryteria:

1. "moduł właściwy" większy niż 12,7 × 106 m; oraz

2. "wytrzymałość właściwa na rozciąganie" większa niż 23,5 × 104 m;

Uwaga: Pozycja 1C010.a nie obejmuje kontrolą polietylenu.

b. węglowe "materiały włókniste lub włókienkowe", spełniające oba poniższe kryteria:

1. "moduł właściwy" większy niż 14,65 × 106 m; oraz

2. "wytrzymałość właściwa na rozciąganie" większa niż 26,82 × 104 m;

Uwaga: Pozycja 1C010.b nie obejmuje kontrolą:

a. "materiałów włóknistych lub włókienkowych" przeznaczonych do naprawy konstrukcji lub laminatów "cywilnych statków powietrznych", które spełniają wszystkie z poniższych kryteriów:

1. mają powierzchnię nieprzekraczającą 1 m2;

2. mają długość nieprzekraczającą 2,5 m; oraz

3. mają szerokość przekraczającą 15 mm.

b. mechanicznie siekanych lub ciętych "materiałów włóknistych lub włókienkowych" o długości nieprzekraczającej 25,0 mm.

c. nieorganiczne "materiały włókniste i włókienkowe", spełniające oba poniższe kryteria:

1. "moduł właściwy" większy niż 2,54 × 106 m; oraz

2. temperatura topnienia, mięknienia, rozkładu lub sublimacji powyżej 1 922 K (1 649 °C) w środowisku obojętnym;

Uwaga: Pozycja 1C010.c nie obejmuje kontrolą:

a. nieciągłych, wielofazowych, polikrystalicznych włókien z tlenku glinu w postaci włókien ciętych lub mat o strukturze bezładnej, zawierających wagowo 3 % lub więcej tlenku krzemu i mających "moduł właściwy" poniżej 10 × 106 m;

b. włókien molibdenowych i ze stopów molibdenowych;

c. włókien borowych;

d. nieciągłych włókien ceramicznych o temperaturze topnienia, mięknienia, rozkładu lub sublimacji poniżej 2 043 K (1 770 °C) w środowisku obojętnym.

d. "materiały włókniste lub włókienkowe" spełniające którekolwiek z poniższych kryteriów:

1. zawierające którekolwiek z poniższych:

a. polieteroimidy określone w pozycji 1C008.a; lub

b. materiały ujęte w pozycjach od 1C008.d do 1C008.f; lub

2. złożone z materiałów ujętych w pozycji 1C010.d.1.a lub 1C010.d.1.b i 'zmieszane' z innymi materiałami włóknistymi ujętymi w pozycjach 1C010.a, 1C010.b lub 1C010.c;

Uwaga techniczna:

'Mieszanie' oznacza mieszanie włókien materiałów termoplastycznych z włóknami materiałów wzmacniających w celu wytworzenia mieszanki włókien wzmacniających z "matrycą", mającej w całości formę włóknistą.

e. "materiały włókniste lub włókienkowe" w pełni lub częściowo impregnowane żywicą lub pakiem (prepregi), "materiały włókniste lub włókienkowe" powlekane metalem lub węglem (preformy) lub 'preformy włókien węglowych' spełniające wszystkie z poniższych kryteriów:

1. spełniające którekolwiek z poniższych kryteriów:

a. zawierające nieorganiczne "materiały włókniste lub włókienkowe" określone w pozycji 1C010.c; lub

b. zawierające organiczne lub węglowe "materiały włókniste lub włókienkowe" spełniające wszystkie z poniższych kryteriów:

1. "moduł właściwy" większy niż 10,15 × 106 m; oraz

2. "wytrzymałość właściwa na rozciąganie" większa niż 17,7 × 104 m; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. zawierające żywicę lub pak określone w poz. 1C008 lub 1C009.b;

b. mające 'temperaturę zeszklenia wyznaczoną metodą dynamicznej analizy mechanicznej (DMA Tg)' równą lub przekraczającą 453 K (180 °C) i zawierające żywice fenolowe; lub

c. mające 'temperaturę zeszklenia wyznaczoną metodą dynamicznej analizy mechanicznej (DMA Tg)' równą lub przekraczającą 505 K (232 °C) i zawierające żywicę lub pak, które nie są wymienione w poz. 1C008 ani 1C009.b i nie są żywicami fenolowymi;

Uwaga 1: "Materiały włókniste lub włókienkowe" powlekane metalem lub węglem (preformy) lub 'preformy włókien węglowych' nieimpregnowane żywicą ani pakiem są wyszczególnione jako "materiały włókniste lub włókienkowe" w pozycji 1C010.a, 1C010.b i 1C010.c.

Uwaga 2: Pozycja 1C010.e nie obejmuje kontrolą:

a. impregnowanych "matrycą" z żywicy epoksydowej węglowych "materiałów włóknistych lub włókienkowych" (prepregów) przeznaczonych do naprawy konstrukcji lub laminatów "cywilnych statków powietrznych", które spełniają wszystkie z poniższych kryteriów:

1. mają powierzchnię nieprzekraczającą 1 m2;

2. mają długość nieprzekraczającą 2,5 m; oraz

3. mają szerokość przekraczającą 15 mm.

b. w pełni lub częściowo impregnowanych żywicą lub pakiem mechanicznie siekanych, mielonych lub ciętych węglowych "materiałów włóknistych lub włókienkowych" o długości nieprzekraczającej 25,0 mm, w przypadku gdy zastosowano żywicę lub pak inne niż określone w pozycji 1C008 lub 1C009.b.

Uwagi techniczne:

1. 'Preformy włókien węglowych' oznaczają uporządkowany układ powlekanych lub niepowlekanych włókien przeznaczony do tworzenia struktur składowych przed użyciem "matrycy" do tworzenia "materiału kompozytowego".

2. 'Temperatura zeszklenia wyznaczona metodą dynamicznej analizy mechanicznej (DMA Tg)' dla materiałów wyszczególnionych w pozycji 1C010.e jest określana za pomocą metody opisanej w normie ASTM D 7028-07 lub równoważnej normie krajowej przy użyciu suchej próbki. W przypadku materiałów termoutwardzalnych stopień utwardzenia suchej próbki musi wynosić co najmniej 90 % zgodnie z normą ASTM E 2160-04 lub równoważną normą krajową.

1C011 Następujące metale i związki:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA I POZYCJA 1C111.

a. metale o rozmiarach ziarna mniejszych niż 60 μm, zarówno w postaci sferycznej, rozpylanej, sferoidalnej, płatków, jak i zmielonej, wykonane z materiałów zawierających 99 % lub więcej cyrkonu, magnezu lub ich stopów;

Uwaga techniczna:

Naturalna zawartość hafnu w cyrkonie (zwykle od 2 % do 7 %) jest liczona razem z cyrkonem.

Uwaga: Metale lub stopy wyszczególnione w pozycji 1C011.a są objęte kontrolą bez względu na to, czy są zamknięte w kapsułkach z glinu, magnezu lub berylu.

b. bor lub stopy boru o rozmiarach ziarna 60 μm lub mniejszych, jak następuje:

1. bor o czystości 85 % wagowo lub większej;

2. stopy boru o zawartości boru 85 % wagowo lub większej;

Uwaga: Metale lub stopy wyszczególnione w pozycji 1C011.b są objęte kontrolą bez względu na to, czy są zamknięte w kapsułkach z glinu, magnezu lub berylu.

c. azotan guanidyny (CAS 506-93-4);

d. nitroguanidyna (NQ) (CAS 556-88-7).

N.B. Zob. także wykaz uzbrojenia - proszki metali zmieszane z innymi substancjami dające w wyniku mieszaninę przeznaczoną do celów wojskowych.

1C012 Następujące materiały:

Uwaga techniczna:

Materiały te są typowo wykorzystywane do jądrowych źródeł ciepła.

a. pluton w dowolnej postaci zawierający izotop pluton-238 w ilości powyżej 50 % wagowych;

Uwaga: Pozycja 1C012.a nie obejmuje kontrolą:

a. dostaw zawierających pluton w ilości 1 grama lub mniejszej;

b. dostaw zawierających 3 "gramy efektywne" lub mniej, w przypadku gdy pluton jest zawarty w czujnikach instrumentów pomiarowych;

b. "uprzednio separowany" neptun-237 w dowolnej formie.

Uwaga: Pozycja 1C012.b nie obejmuje kontrolą dostaw zawierających neptun-237 w ilości 1 grama lub mniejszej.

1C101 Materiały i urządzenia do obiektów o zmniejszonej wykrywalności za pomocą odbitych fal radarowych, śladów w zakresie promieniowania nadfioletowego lub podczerwonego i śladów akustycznych, inne niż określone w pozycji 1C001, możliwe do zastosowania w 'pociskach rakietowych', podsystemach "pocisków rakietowych" lub bezzałogowych statkach powietrznych wyszczególnionych w pozycji 9A012 lub 9A112.a.

Uwaga 1: Pozycja 1C101 obejmuje:

a. materiały strukturalne i powłoki specjalnie opracowane pod kątem zmniejszenia ich echa radarowego;

b. powłoki, w tym farby, specjalnie opracowane pod kątem zmniejszenia ilości odbijanego lub emitowanego promieniowania z zakresu mikrofalowego, podczerwonego lub nadfioletowego promieniowania elektromagnetycznego.

Uwaga 2: Pozycja 1C101 nie dotyczy powłok, które są specjalnie używane do regulacji temperatur w satelitach.

Uwaga techniczna:

W pozycji 1C101 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

1C102 Przesycane pirolizowane materiały węglowo-węglowe przeznaczone do pojazdów kosmicznych wyszczególnionych w pozycji 9A004 lub do rakiet meteorologicznych (sondujących) wyszczególnionych w pozycji 9A104.

1C107 Następujące materiały grafitowe i ceramiczne, inne niż wyszczególnione w pozycji 1C007:

a. drobnoziarniste materiały grafitowe o gęstości nasypowej co najmniej 1,72 g/cm3 lub większej, mierzonej w temperaturze 288 K (15 °C) i o wymiarach ziarna 100 μm lub mniejszych, możliwe do zastosowania w dyszach do rakiet i stożkach czołowych rakiet, umożliwiające uzyskanie w drodze obróbki następujących produktów:

1. cylindry o średnicy 120 mm lub większej i długości 50 mm lub większej;

2. rury o średnicy wewnętrznej 65 mm lub większej i grubości ścianki 25 mm lub większej i długości 50 mm lub większej; lub

3. bloki o wymiarach 120 mm × 120 mm × 50 mm lub większe; N.B. Zob. także pozycja 0C004.

b. pirolityczne lub wzmacniane włóknami materiały grafitowe nadające się do zastosowania w dyszach rakiet i stożkach czołowych używanych w "pociskach rakietowych", kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104;

N.B. Zob. także pozycja 0C004.

c. ceramiczne materiały kompozytowe (o stałej dielektrycznej poniżej 6 przy każdej częstotliwości od 100 MHz do 100 GHz), do użytku w osłonach anten radiolokatora używanych w "pociskach rakietowych", kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104;

d. skrawalne, niewypalane materiały ceramiczne wzmacniane włóknami krzemo-węglowymi, do użytku w stożkach czołowych używanych w "pociskach rakietowych", kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104;

e. wzmocnione krzemo-węglowe ceramiczne materiały kompozytowe do użytku w stożkach czołowych, rakietach ponownie wchodzących w atmosferę i klapach dysz używanych w "pociskach rakietowych", kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104;

f. skrawalne ceramiczne materiały kompozytowe składające się z matrycy z 'materiału ceramicznego ultra-wysokiej temperatury (UHTC)' o temperaturze topnienia równej lub wyższej niż 3 000 °C i wzmacniane włóknami lub włókienkami, do użytku w podzespołach pocisków rakietowych (takich jak stożki czołowe, rakiety ponownie wchodzące w atmosferę, krawędzie czołowe, łopatki kierownicze strumienia gazów wylotowych, powierzchnie sterujące lub wkłady do wlotów silników rakietowych) używanych w "pociskach rakietowych", kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104 lub 'pociskach rakietowych'.

Uwaga: Pozycja 1C107.f. nie obejmuje kontrolą 'materiałów ceramicznych ultrawysokiej temperatury (UHTC)' w postaci niekompozytowej.

Uwaga techniczna 1:

Termin 'pocisk rakietowy' w pozycji 1C107.f oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

Uwaga techniczna 2:

'Materiały ceramiczne ultrawysokiej temperatury (UHTC)' obejmują:

1. diborek tytanu (TiB2);

2. diborek cyrkonu (ZrB2);

3. diborek niobu (NbB2);

4. diborek hafnu (HfB2);

5. diborek tantalu (TaB2);

6. węglik tytanu (TiC);

7. węglik cyrkonu (ZrC);

8. węglik niobu (NbC);

9. węglik hafnu (HfC);

10. węglik tantalu (TaC).

1C111 Następujące substancje napędowe i związki chemiczne do nich, inne niż wyszczególnione w pozycji 1C011:

a. substancje napędowe:

1. sferyczny lub sferoidalny proszek aluminiowy, inny niż wyszczególniony w wykazie uzbrojenia, złożony z cząstek o wielkości poniżej 200 μm, o zawartości glinu wynoszącej 97 % wagowych lub większej, jeżeli co najmniej 10 % ciężaru ogólnego stanowią cząstki o wielkości mniejszej niż 63 μm, zgodnie z ISO 2591-1:1988 lub równoważnymi normami krajowymi;

Uwaga techniczna:

Wielkość cząstek 63 μm (ISO R-565) odpowiada siatce 250 (Tyler) lub siatce 230 (norma ASTM E-11).

2. następujące proszki metali, inne niż wyszczególnione w wykazie uzbrojenia:

a. proszki cyrkonu, berylu lub magnezu lub stopów tych metali, jeżeli co najmniej 90 % wagi lub objętości wszystkich cząstek stanowią cząstki o wielkości mniejszej niż 60 μm (zmierzone przy pomocy technik pomiaru, takich jak przesiewanie, dyfrakcja laserowa lub skanowanie optyczne), w postaci sferycznej, zatomizowanej, sferoidalnej, płatków lub silnie rozdrobnionego proszku, zawierające 97 % wagowych lub więcej któregokolwiek z poniższych:

1. cyrkonu;

2. berylu; lub

3. magnezu;

Uwaga techniczna:

Naturalna zawartość hafnu w cyrkonie (zwykle od 2 % do 7 %) jest liczona razem z cyrkonem.

b. proszki boru lub stopów boru o zawartości boru 85 % wagi lub większej, jeżeli co najmniej 90 % wagi lub objętości wszystkich cząstek stanowią cząstki o wielkości mniejszej niż 60 μm (zmierzone przy pomocy technik pomiaru, takich jak przesiewanie, dyfrakcja laserowa lub skanowanie optyczne), w postaci sferycznej, zatomizowanej, sferoidalnej, płatków lub silnie rozdrobnionego proszku;

Uwaga: Pozycje 1C111a.2.a oraz 1C111a.2.b obejmują kontrolą mieszaniny proszków o multimodalnej dystrybucji cząstek (np. mieszaniny różnej wielkości ziaren), jeżeli kontrolą objęta jest co najmniej jedna z form.

3. następujące utleniacze używane w silnikach rakietowych na paliwo ciekłe:

a. tritlenek diazotu (CAS 10544-73-7);

b. ditlenek azotu (CAS 10102-44-0)/tetratlenek diazotu (CAS 10544-72-6);

c. pentatlenek diazotu (CAS 10102-03-1);

d. mieszaniny tlenków azotu (MON);

Uwaga techniczna:

Mieszaniny tlenków azotu stanowią roztwory tlenku azotu (NO) w tetratlenku diazotu/ditlenku azotu (N204/NO2), które mogą być wykorzystane w systemach rakietowych. Istnieje cała skala mieszanin, które mogą być oznaczone jako MONi lub MONij, gdzie i oraz j są liczbami całkowitymi przedstawiającymi procentową zawartość tlenku azotu w danej mieszaninie (np. MON3 zawiera 3 % tlenku azotu, MON25 - 25 % tlenku azotu. Górną granicę stanowi MON40 - 40 % zawartości wagowej).

e. ZOB. WYKAZ UZBROJENIA dla inhibitowanego dymiącego na czerwono kwasu azotowego (IRF-NA);

f. ZOB. WYKAZ UZBROJENIA ORAZ POZYCJĘ 1C238 dla związków chemicznych składających się z fluoru oraz jednego lub więcej innych fluorowców, tlenu lub azotu;

4. następujące pochodne hydrazyny:

N.B.: ZOB. TAKŻE WYKAZ UZBROJENIA.

a. trimetylohydrazyna (CAS 1741-01-1);

b. tetrametylohydrazyna (CAS 6415-12-9);

c. N,N-diallilohydrazyna (CAS 5164-11-4);

d. allilohydrazyna (CAS 7422-78-8);

e. etylenodihydrazyna (CAS 6068-98-0);

f. diazotan monometylohydrazyny;

g. niesymetryczny diazotan monometylohydrazyny;

h. azydek hydrazyny (CAS 14546-44-2);

i. azydek 1,1-dimetylohydrazyny (CAS 227955-52-4) / azydek 1,2-dimetylohydrazyny (CAS 299177-50-7);

j. diazotan hydrazyny (CAS 13464-98-7);

k. diimido szczawian dihydrazyny (CAS 3457-37-2);

l. azotan 2-hydroksyetylohydrazyny (HEHN);

m. zob. wykaz uzbrojenia dla nadchloranu hydrazyny;

n. dinadchloran hydrazyny (CAS 13812-39-0);

o. azotan metylohydrazyny (MHN) (CAS 29674-96-2);

p. azotan 1,1-dietylohydrazyny (DEHN) / azotan 1,2-dietylohydrazyny (DEHN) (CAS 363453-17-2);

q. azotan 3,6-dihydrazynotetrazyny (azotan 1,4-dihydrazyny) (DHTN);

5. materiały o wysokiej gęstości energetycznej inne niż wymienione w wykazie uzbrojenia, które mogą być wykorzystywane w 'pociskach rakietowych' lub bezzałogowych statkach powietrznych wyszczególnionych w poz. 9A012 lub 9A112.a.;

a. paliwa mieszane składające się z paliw stałych i ciekłych, takie jak paliwo borowodorowe, o gęstości energetycznej na jednostkę masy na poziomie 40 × 106 J/kg lub większej;

b. inne mające wysoką gęstość energetyczną paliwa i dodatki do paliw (np. kuban, roztwory jonowe, JP-10) o gęstości energetycznej na jednostkę objętości na poziomie 37,5 × 109 J/m3 lub większej zmierzonej w temperaturze 20 °C i przy ciśnieniu jednej atmosfery (101,325 kPa);

Uwaga: Pozycja 1C111.a.5.b nie obejmuje kontrolą rafinowanych paliw kopalnych ani biopaliw wytworzonych z warzyw, w tym paliw silnikowych dopuszczonych do stosowania w lotnictwie cywilnym, chyba że są przeznaczone specjalnie do 'pocisków rakietowych' lub bezzałogowych statków powietrznych wyszczególnionych w poz. 9A012 lub 9A112.a.

Uwaga techniczna:

W pozycji 1C111.a.5. 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

6. następujące paliwa zastępujące hydrazynę:

a. azydek 2-dimetyloaminoetylu (DMAZ) (CAS 86147-04-8);

b. substancje polimerowe:

1. polibutadien o łańcuchach zakończonych grupą karboksylową (CTPB);

2. polibutadien o łańcuchach zakończonych grupą hydroksylową (HTPB) (CAS 69102-90-5), inny niż wyszczególniony w wykazie uzbrojenia;

3. kopolimer butadienu z kwasem akrylowym (PBAA);

4. kopolimer butadienu z kwasem akrylowym i akrylonitrylem (PBAN) (CAS 25265-19-4 / CAS 68891-50-9);

5. glikol polietylenowo-politetrahydrofuranowy (TPEG);

Uwaga techniczna:

Glikol polietylenowo-politetrahydrofuranowy (TPEG) jest kopolimerem blokowym polibutano-1,4-diolu (CAS 110-63-4) i glikolu polietylenowego (PEG) (CAS 25322-68-3).

6. azotan poliglicydylu (PGN lub poly-GLYN) (CAS 27814-48-8);

c. inne dodatki i środki do materiałów miotających:

1. ZOB. WYKAZ UZBROJENIA DLA węgloborowodorów, dekaborowodorów, pentaborowodorów oraz i ich pochodnych;

2. diazotan glikolu trietylenowego (TEGDN) (CAS 111-22-8);

3. 2-nitrodifenyloamina (CAS 119-75-5);

4. triazotan trimetyloetanu (TMETN) (CAS 3032-55-1);

5. diazotan glikolu dietylenowego (DEGDN) (CAS 693-21-0);

6. pochodne ferrocenu, takie jak:

a. zob. wykaz uzbrojenia dla katocenu;

b. zob. wykaz uzbrojenia dla ferrocenu etylu;

c. zob. wykaz uzbrojenia dla ferrocenu propylu;

d. zob. wykaz uzbrojenia dla ferrocenu n-butylu;

e. zob. wykaz uzbrojenia dla ferrocenu pentylu;

f. zob. wykaz uzbrojenia dla ferrocenu dicyklopentylu;

g. zob. wykaz uzbrojenia dla ferrocenu dicykloheksylu; h. zob. wykaz uzbrojenia dla ferrocenu dietylu;

i. zob. wykaz uzbrojenia dla ferrocenu dipropylu;

j. zob. wykaz uzbrojenia dla ferrocenu dibutylu;

k. zob. wykaz uzbrojenia dla ferrocenu diheksylu;

l. zob. wykaz uzbrojenia dla ferrocenu acetylu / 1,1'-ferrocenu diacetylu;

m. zob. wykaz uzbrojenia dla kwasów karboksylowych ferrocenu;

n. zob. wykaz uzbrojenia dla butacenu;

o. inne pochodne ferrocenu wykorzystywane jako modyfikatory szybkości spalania paliwa rakietowego, różne od wyszczególnionych w wykazie uzbrojenia;

Uwaga: Pozycja 1C111.c.6.o nie obejmuje kontrolą pochodnych ferrocenu, które zawierają sześciowęglową aromatyczną grupę funkcyjną połączoną z cząsteczką ferrocenu.

7. 4,5 diazydometylo-2-metylo-1,2,3-triazol (izo-DAMTR), inny niż wyszczególniony w wykazie uzbrojenia.

d. 'żelowe paliwa napędowe', inne niż te wyszczególnione w wykazie uzbrojenia, opracowane konkretnie do użytku w 'pociskach rakietowych'.

Uwagi techniczne:

1. 'Żelowe paliwo napędowe' w pozycji 1C111.d oznacza paliwo lub preparat utleniający wykorzystujące środek żelujący, taki jak krzemiany, kaolin (glinka), węgiel lub dowolny polimeryczy środek żelujący.

2. Termin 'pocisk rakietowy' w pozycji 1C111.d oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

Uwaga: Dla substancji miotających oraz chemikaliów składowych materiałów miotających, niewyszczególnionych w pozycji 1C111 zob. wykaz uzbrojenia.

1C116 Stale maraging, stosowane w 'pociskach rakietowych', spełniające wszystkie z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJA 1C216.

a. mające wytrzymałość na rozciąganie, mierzoną w temperaturze 293 K (20 °C), równą lub większą niż:

1. 0,9 GPa w fazie wyżarzenia roztworu; lub

2. 1,5 GPa w fazie utwardzenia wydzieleniowego; oraz

b. posiadające którąkolwiek z następujących postaci:

1. blachy, płyty lub rury o grubości ścianek lub płyt mniejszej lub równej 5,0 mm;

2. formy cylindryczne o grubości ścianek mniejszej lub równej 50 mm i średnicy wewnętrznej większej lub równej 270 mm.

Uwaga techniczna 1:

Stale maraging są stopami żelaza:

1. charakteryzującymi się ogólnie wysoką zawartością niklu, bardzo niską zawartością węgla i wykorzystaniem składników substytucyjnych lub przyspieszających, które umożliwiają wzmocnienie i utwardzenie wydzieleniowe tego stopu;

2. oraz poddawanymi cyklom obróbki cieplnej w celu ułatwienia procesu transformacji martenzytycznej (faza wyżarzenia roztworu), a następnie utwardzanymi (faza utwardzenia wydzieleniowego).

Uwaga techniczna 2:

W pozycji 1C116 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

1C117 Następujące materiały służące do wytwarzania elementów 'pocisków rakietowych':

a. wolfram i jego stopy w postaci pyłu zawierające wagowo co najmniej 97 % wolframu o wielkości cząstek nie większej niż 50 × 10-6 m (50 μm);

b. molibden i jego stopy w postaci pyłu zawierające wagowo co najmniej 97 % molibdenu o wielkości cząstek nie większej niż 50 × 10-6 m (50 μm);

c. materiały zawierające wolfram w postaci stałej, spełniające wszystkie z poniższych kryteriów:

1. wszelkie materiały o następującym składzie:

a. wolfram i jego stopy zawierające wagowo co najmniej 97 % wolframu;

b. wolfram nasycony miedzią zawierający wagowo co najmniej 80 % wolframu; lub

c. wolfram nasycony srebrem zawierający wagowo co najmniej 80 % wolframu; oraz

2. umożliwiające uzyskanie w drodze obróbki skrawaniem następujących produktów:

a. cylindry o średnicy 120 mm lub większej i długości 50 mm lub większej;

b. rury o średnicy wewnętrznej 65 mm lub większej i grubości ścianki 25 mm lub większej i długości 50 mm lub większej; lub

c. bloki o wymiarach 120 mm × 120 mm × 50 mm lub większe;

Uwaga techniczna:

W pozycji 1C117 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

1C118 Stabilizowana tytanem stal nierdzewna dupleksowa (Ti-DSS) spełniająca wszystkie poniższe kryteria:

a. spełniająca wszystkie poniższe kryteria:

1. zawartość wagowa chromu 17,0 - 23,0 % oraz zawartość wagowa niklu 4,5 - 7,0 %;

2. zawartość wagowa tytanu większa niż 0,10 %; oraz

3. obecność mikrostruktury ferrytowo-austenitowej (nazywanej także mikrostrukturą dwufazową), w której co najmniej 10 % objętości stanowi austenit (zgodnie z normą ASTM E-1181-87 lub jej odpowiednikiem krajowym); oraz

b. posiadająca którąkolwiek z następujących postaci:

1. sztaby lub pręty o wielkości większej lub równej 100 mm w każdym z wymiarów;

2. arkusze o szerokości większej lub równej 600 mm i grubości mniejszej lub równej 3 mm; lub

3. rury o średnicy zewnętrznej większej lub równej 600 mm i grubości ścianek mniejszej lub równej 3 mm.

1C202 Stopy, inne niż wyszczególnione w pozycji 1C002.b.3 lub b.4, takie jak:

a. stopy glinu posiadające obydwie wyszczególnione niżej cechy:

1. 'zdolne do' osiągnięcia wytrzymałości na rozciąganie większej lub równej 460 MPa w temperaturze 293 K (20 °C); oraz

2. posiadające postać rur lub litych elementów cylindrycznych (w tym odkuwek) o średnicy zewnętrznej powyżej 75 mm;

b. stopy tytanu posiadające obydwie wyszczególnione niżej cechy:

1. 'zdolne do' osiągnięcia wytrzymałości na rozciąganie większej lub równej 900 MPa w temperaturze 293 K (20 °C); oraz

2. posiadające postać rur lub litych elementów cylindrycznych (w tym odkuwek) o średnicy zewnętrznej powyżej 75 mm;

Uwaga techniczna:

Określenie stopy 'zdolne do' obejmuje stopy przed obróbką cieplną lub po obróbce cieplnej.

1C210 'Materiały włókniste lub włókienkowe' lub prepregi, inne niż wyszczególnione w pozycji 1C010.a, b lub e, takie jak:

a. węglowe lub aramidowe 'materiały włókniste lub włókienkowe' posiadające którąkolwiek z niżej wyszczególnionych cech:

1. "moduł właściwy" większy lub równy 12,7 × 106 m; lub

2. "wytrzymałość właściwa na rozciąganie" większa lub równa 23,5 × 104 m;

Uwaga: Pozycja 1C210.a nie obejmuje kontrolą aramidowych 'materiałów włóknistych lub włókienkowych', zawierających wagowo 0,25 % lub więcej dowolnego modyfikatora powierzchni włókien opartego na estrach.

b. szklane 'materiały włókniste lub włókienkowe' posiadające obydwie z niżej wyszczególnionych cech:

1. "moduł właściwy" większy lub równy 3,18 × 106 m; oraz

2. "wytrzymałość właściwa na rozciąganie" większa lub równa 7,62 × 104 m;

c. termoutwardzalne, impregnowane żywicą, ciągłe "przędze", "rowingi", "kable" lub "taśmy" o szerokości nieprzekraczającej 15 mm (prepregi), wykonane z węglowych lub szklanych 'materiałów włóknistych lub włókienkowych' wyszczególnionych w pozycji 1C210.a lub b.

Uwaga techniczna:

Żywice tworzą matryce kompozytów.

Uwaga: W pozycji 1C210 pojęcie 'materiały włókniste lub włókienkowe' ogranicza się do ciągłych "włókien elementarnych", "przędz", "rowingów", "kabli" lub "taśm".

1C216 Stal maraging, inna niż wyszczególniona w pozycji 1C116, 'zdolna do' osiągania wytrzymałości na rozciąganie większej lub równej 1 950 MPa, w temperaturze 293 K (20 °C).

Uwaga: Pozycja 1C216 nie obejmuje kontrolą form, w których wszystkie wymiary liniowe są mniejsze niż lub równe 75 mm.

Uwaga techniczna:

Określenie stal maraging 'zdolna do' obejmuje stal maraging przed obróbką cieplną lub po obróbce cieplnej.

1C225 Bor wzbogacony izotopem boru-10 (10B) w stopniu większym niż jego naturalna liczebność izotopowa, taki jak: bor pierwiastkowy, związki i mieszaniny zawierające bor, wyroby oraz złom i odpady powstałe z wyżej wymienionych.

Uwaga: W pozycji 1C225 mieszaniny zawierające bor obejmują materiały obciążone borem.

Uwaga techniczna:

Naturalna liczebność izotopowa boru-10 wynosi wagowo ok. 18,5 % (atomowo 20 %).

1C226 Wolfram, węglik wolframu oraz stopy zawierające wagowo powyżej 90 % wolframu, inne niż wymienione w pozycji 1C117, posiadające obydwie z niżej wyszczególnionych cech:

a. w postaci form wydrążonych o symetrii cylindrycznej (łącznie z segmentami cylindrycznymi) o średnicy wewnętrznej od 100 do 300 mm; oraz

b. masa większa niż 20 kg.

Uwaga: Pozycja 1C226 nie obejmuje kontrolą wyrobów specjalnie zaprojektowanych jako odważniki lub kolimatory promieniowania gamma.

1C227 Wapń posiadający obydwie z niżej wyszczególnionych cech:

a. zawartość wagowa zanieczyszczeń metalami różnymi od magnezu poniżej 1 000 ppm; oraz

b. zawartość wagowa boru poniżej 10 ppm.

1C228 Magnez posiadający obydwie z niżej wyszczególnionych cech:

a. zawartość wagowa zanieczyszczeń metalami różnymi od wapnia poniżej 200 ppm; oraz

b. zawartość wagowa boru poniżej 10 ppm.

1C229 Bizmut posiadający obydwie z niżej wyszczególnionych cech:

a. czystość wagowa większa niż lub równa 99,99 %; oraz

b. zawartość wagowa srebra poniżej 10 ppm.

1C230 Beryl metaliczny, stopy zawierające wagowo więcej niż 50 % berylu, związki berylu, wyroby oraz złom i odpady powstałe z wyżej wymienionych, inne niż wyszczególnione w wykazie uzbrojenia.

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

Uwaga: Pozycja 1C230 nie obejmuje kontrolą:

a. metalowych okien do aparatury rentgenowskiej lub do urządzeń wiertniczych;

b. profili tlenkowych w postaci przetworzonej lub półprzetworzonej, zaprojektowanych specjalnie do elementów zespołów elektronicznych lub jako podłoża do obwodów elektronicznych;

c. berylu (krzemianu berylu i glinu) w postaci szmaragdów lub akwamarynów.

1C231 Hafn metaliczny, stopy oraz związki hafnu zawierające wagowo więcej niż 60 % hafnu, wyroby oraz złom i odpady z powstałe z wyżej wymienionych.

1C232 Hel-3 (3He), mieszaniny zawierające hel-3 oraz wyroby lub urządzenia zawierające dowolne z wyżej wymienionych substancji.

Uwaga: Pozycja 1C232 nie obejmuje kontrolą wyrobów lub urządzeń zawierających mniej niż 1 g helu-3.

1C233 Lit wzbogacony izotopem litu-6 (6Li) w stopniu większym niż naturalna liczebność izotopowa oraz produkty lub urządzenia zawierające wzbogacony lit, takie jak: lit pierwiastkowy, stopy, związki, mieszaniny zawierające lit, wyroby oraz złom i odpady powstałe z wyżej wymienionych.

Uwaga: Pozycja 1C233 nie obejmuje kontrolą dozymetrów termoluminescencyjnych.

Uwaga techniczna:

Naturalna liczebność izotopowa litu-6 wynosi wagowo ok. 6,5 % (atomowo 7,5 %).

1C234 Cyrkon z zawartością wagową hafnu mniejszą niż 1 część hafnu do 500 części cyrkonu, taki jak: metal, stopy zawierające wagowo ponad 50 % cyrkonu, związki, wyroby oraz złom i odpady powstałe z wyżej wymienionych, inne niż wyszczególnione w pozycji 0A001.f.

Uwaga: Pozycja 1C234 nie obejmuje kontrolą cyrkonu w postaci folii o grubości mniejszej lub równej 0,10 mm.

1C235 Tryt, związki trytu i mieszanki zawierające tryt, w których stosunek atomów trytu do wodoru przewyższa 1 część na 1 000, oraz wyroby lub urządzenia zawierające te materiały.

Uwaga: Pozycja 1C235 nie obejmuje kontrolą wyrobów lub urządzeń zawierających mniej niż 1,48 × 103 GBq (40 Ci) trytu.

1C236 'Radionuklidy' do tworzenia źródeł neutronów w oparciu o reakcję cząstek alfa-neutron, inne niż wyszczególnione w pozycjach 0C001 i 1C012.a, w następujących postaciach:

a. pierwiastki;

b. związki o całkowitej aktywności alfa większej lub równej 37 GBq/kg (1 Ci/kg);

c. mieszaniny o całkowitej aktywności alfa większej lub równej 37 GBq/kg (1 Ci/kg);

d. wyroby lub urządzenia zawierające wyżej wymienione substancje.

Uwaga: Pozycja 1C236 nie obejmuje kontrolą wyrobów lub urządzeń o aktywności alfa poniżej 3,7 GBq (100 mCi).

Uwaga techniczna:

W pozycji 1C236 'radionuklidy' oznaczają którekolwiek z poniższych:

- aktyn-225 (225Ac)

- aktyn-227 (227Ac)

- kaliforn-253 (253Cf)

- kiur-240 (240Cm)

- kiur-241 (241Cm)

- kiur-242 (242Cm)

- kiur-243 (243Cm)

- kiur-244 (244Cm)

- einstein-253 (253Es)

- einstein-254 (254Es)

- gadolin-148 (148Gd)

- pluton-236 (236Pu)

- pluton-238 (238Pu)

- polon-208 (208Po)

- polon-209 (209Po)

- polon-210 (210Po)

- rad-223 (223Ra)

- tor-227 (227Th)

- tor-228 (228Th)

- uran-230 (230U)

- uran-232 (232U)

1C237 Rad-226 (226Ra), stopy oraz związki radu-226, mieszaniny zawierające rad-226, powstałe z nich wyroby, oraz produkty i urządzenia powstałe z wyżej wymienionych.

Uwaga: Pozycja 1C237 nie obejmuje kontrolą:

a. aplikatorów medycznych;

b. wyrobów lub urządzeń zawierających mniej niż 0,37 GBq (10 mCi) radu-226.

1C238 Trifulorek chloru (ClF3).

1C239 Kruszące materiały wybuchowe, inne niż wymienione w wykazie uzbrojenia, substancje lub mieszaniny zawierające wagowo więcej niż 2 % tych materiałów, o gęstości krystalicznej większej niż 1,8 g/cm3 i prędkości detonacji powyżej 8 000 m/s.

1C240 Proszek niklu i porowaty nikiel metaliczny, inny niż wyszczególniony w pozycji 0C005, taki jak:

a. proszek niklu posiadający obydwie z niżej wymienionych cech:

1. czystość niklowego składnika wagowego większa niż lub równa 99,0 %; oraz

2. średnia wielkość cząstek mniejsza niż 10 μm, mierzona według normy B330 Amerykańskiego Towarzystwa Materiałoznawczego (ASTM);

b. porowaty nikiel metaliczny wytwarzany z materiałów wyszczególnionych w pozycji 1C240.a.

Uwaga: Pozycja 1C240 nie obejmuje kontrolą:

a. włókienkowych proszków niklu;

b. pojedynczych porowatych blach niklowych o polu powierzchni arkusza mniejszym lub równym 1 000 cm2.

Uwaga techniczna:

Pozycja 1C240.b odnosi się do porowatego metalu wyrabianego metodą zagęszczania lub spiekania materiałów wyszczególnionych w pozycji 1C240.a, celem otrzymania metalu z drobnymi porami, wzajemnie łączącymi się w całości struktury.

1C241 Ren i jego stopy zawierające wagowo co najmniej 90 % renu; oraz stopy renu i wolframu zawierające wagowo powyżej 90 % jakiejkolwiek kombinacji renu i wolframu, inne niż wymienione w pozycji 1C226, posiadające obydwie z niżej wyszczególnionych cech:

a. w postaci form wydrążonych o symetrii cylindrycznej (łącznie z segmentami cylindrycznymi) o średnicy wewnętrznej od 100 do 300 mm; oraz

b. masa większa niż 20 kg.

1C350 Następujące substancje chemiczne, które mogą być wykorzystane jako prekursory dla toksycznych środków chemicznych, oraz "mieszaniny chemiczne" zawierające jedną lub więcej z niżej wymienionych substancji:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA I POZYCJA 1C450.

1. tiodiglikol (111-48-8);

2. tlenochlorek fosforu (10025-87-3);

3. metylofosfonian dimetylu (756-79-6);

4. ZOB. WYKAZ UZBROJENIA dla: difluorek metylofosfonowy (676-99-3);

5. dichlorek metylofosfonowy (676-97-1);

6. fosforyn dimetylu (DMP)(868-85-9);

7. trichlorek fosforu (7719-12-2);

8. fosforyn trimetylu (TMP)(121-45-9);

9. chlorek tionylu (7719-09-7);

10. 3-hydroksy-1-metylopiperydyna (3554-74-3);

11. chlorek N,N-diizopropylo-(beta)-aminoetylu (96-79-7);

12. N,N-diizopropylo-(beta)-tioloetanoamina (5842-07-9);

13. 3-chinuklidynol (1619-34-7);

14. fluorek potasu (7789-23-3);

15. 2-chloroetanol (107-07-3);

16. dimetyloamina (124-40-3);

17. etylofosfonian dietylu (78-38-6);

18. N,N-dimetylofosforoamidan dietylu (2404-03-7);

19. fosfonian dietylu (762-04-9);

20. chlorowodorek dimetyloaminy (506-59-2);

21. dichloro(etylo)fosfina (1498-40-4);

22. dichlorek etylofosfonowy (1066-50-8);

23. ZOB. WYKAZ UZBROJENIA dla: difluorek etylofosfonowy (753-98-0);

24. fluorowodór (7664-39-3);

25. benzilan metylu (76-89-1);

26. dichloro(metylo)fosfina (676-83-5);

27. N,N-diizopropylo-(beta)-amino etanol (96-80-0);

28. alkohol pinakolinowy (464-07-3);

29. ZOB. WYKAZ UZBROJENIA dla: O-etylo O-2-diizopropyloaminoetylo metylofosfinin (QL) (57856-11-8);

30. fosforyn trietylu (122-52-1);

31. trichlorek arsenu (7784-34-1);

32. kwas benzilowy (76-93-7);

33. metylofosfonin dietylu (15715-41-0);

34. etylofosfonian dimetylu (6163-75-3);

35. etylodifluorofosfina (430-78-4);

36. metylodifluorofosfina (753-59-3);

37. 3-chinuklidynon (3731-38-2);

38. pentachlorek fosforu (10026-13-8);

39. pinakolon (75-97-8);

40. cyjanek potasu (151-50-8);

41. wodorofluorek potasu (7789-29-9);

42. wodorofluorek amonu lub bifluorek amonu (1341-49-7);

43. fluorek sodu (7681-49-4);

44. wodorofluorek sodu (1333-83-1);

45. cyjanek sodu (143-33-9);

46. trietanoloamina (102-71-6);

47. pentasiarczek fosforawy (1314-80-3);

48. di-izopropyloamina (108-18-9);

49. dietyloaminoetanol (100-37-8);

50. siarczek sodu (1313-82-2);

51. monochlorek siarki (10025-67-9);

52. dichlorek siarki (10545-99-0);

53. chlorowodorek trietanoloaminy (637-39-8);

54. chlorowodorek chlorku N,N-diizopropylo-(beta)-aminoetylu (4261-68-1);

55. kwas metylofosfonowy (993-13-5);

56. metylofosfonian dietylu (683-08-9);

57. dichlorek N,N-dimetylofosforoamidowy (677-43-0);

58. fosforyn triizopropylu (116-17-6);

59. etylodietanoloamina (139-87-7);

60. O,O-dietylo fosforotionian (2465-65-8);

61. O,O-dietylo fosforoditionian (298-06-6);

62. heksafluorokrzemian sodu (16893-85-9);

63. dichlorek metylotiofosfonowy (676-98-2);

64. dietyloamina (109-89-7);

65. chlorowodorek N,N-Diisopropyloaminoetanoetiolu (41480-75-5).

Uwaga 1: Dla wywozu do "państw niebędących stronami konwencji o zakazie broni chemicznej" pozycja 1C350 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C350.1, .3, .5, .11, .12, .13, .17, .18, .21, .22, .26, .27, .28, .31, .32, .33, .34, .35, .36, .54, .55, .56, .57, 63 i .65, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 10 % mieszaniny.

Uwaga 2: Dla wywozu do "państw będących stronami konwencji o zakazie broni chemicznej" pozycja 1C350 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C350.1, .3, .5, .11, .12, .13, .17, .18, .21, .22, .26, .27, .28, .31, .32, .33, .34, .35, .36, .54, .55, .56, .57, .63 i .65, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 3: Pozycja 1C350 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C350 .2, .6, .7, .8, .9, .10, .14, .15, .16, .19, .20, .24, .25, .30, .37, .38, .39, .40, .41, .42, .43, .44, .45, .46, .47, .48, .49, .50, .51, .52, .53, .58, .59, .60, .61, .62 i .64, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 4: Pozycja 1C350 nie obejmuje kontrolą wyrobów określanych jako towary konsumpcyjne pakowane do sprzedaży detalicznej do osobistego użytku lub pakowane do indywidualnego użytku.

1C351 Ludzkie i zwierzęce czynniki chorobotwórcze oraz "toksyny", takie jak:

a. następujące wirusy pochodzenia naturalnego, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub jako materiał łącznie z materiałem żywym, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. wirus afrykańskiej choroby koni;

2. wirus afrykańskiego pomoru świń;

3. wirus Andes;

4. wirusy grypy ptaków, które są:

a. niescharakteryzowane; lub

b. określone w załączniku I pkt 2 do unijnej dyrektywy 2005/94/WE (Dz.U. L 10 z 14.1.2006, s. 16) jako posiadające wysokie właściwości chorobotwórcze, w tym:

1. wirusy typu A o wartości IVPI (wskaźnik dożylnej chorobotwórczości) dla sześciotygodniowych kurcząt powyżej 1,2; lub

2. wirusy typu A podtypów H5 i H7, z sekwencjami genomu kodującymi liczne aminokwasy zasadowe w miejscu cięcia cząsteczki hemaglutyniny podobnymi do sekwencji obserwowanych w innych wirusach HPAI, wskazujących na możliwość rozszczepienia cząsteczki hemaglutyniny przez większość proteaz gospodarza;

5. wirus choroby niebieskiego języka;

6. wirus Chapare;

7. wirus gorączki Chikungunya;

8. wirus Choclo;

9. wirus kongijsko-krymskiej gorączki krwotocznej;

10. nieużywane;

11. wirus Dobrava-Belgrade;

12. wirus wschodnioamerykańskiego końskiego zapalenia mózgu;

13. wirus Ebola: wszystkie wirusy należące do rodzaju Ebolavirus;

14. wirus pryszczycy;

15. wirus ospy koziej;

16. wirus Guanarito;

17. wirus Hantaan;

18. wirus Hendra;

19. wirus SHV-1 (Herpesvirus suis typ 1) (wirus wścieklizny rzekomej; choroba Aujeszkyego);

20. wirus klasycznego pomoru świń;

21. wirus japońskiego zapalenia mózgu;

22. wirus Junin;

23. wirus Lasu Kyasanur;

24. wirus Laguna Negra;

25. wirus Lassa;

26. wirus choroby skokowej owiec;

27. wirus Lujo;

28. wirus choroby zgrudowacenia skóry;

29. wirus limfocytowego zapalenia opon mózgowych;

30. wirus Machupo;

31. wirus marburski: wszystkie wirusy należące do rodzaju Marburgvirus;

32. wirus małpiej ospy;

33. wirus zapalenia mózgu z Murray Valley;

34. wirus rzekomego pomoru drobiu (wirus z Newcastle);

35. wirus Nipah;

36. wirus omskiej gorączki krwotocznej;

37. wirus Oropouche;

38. wirus pomoru przeżuwaczy;

39. wirus choroby pęcherzykowej u świń;

40. wirus Powassan;

41. wirus wścieklizny i wszystkie inne wirusy należące do rodzaju Lyssa;

42. wirus gorączki z Rift Valley;

43. wirus zarazy bydlęcej;

44. wirus Rocio;

45. wirus Sabia;

46. wirus Seoul;

47. wirus ospy owczej;

48. wirus Sin Nombre;

49. wirus zapalenia mózgu z St Louis;

50. enterowirusowe zapalenie mózgu i rdzenia świń;

51. wirus kleszczowego zapalenia mózgu (podtyp dalekowschodni);

52. wirus ospy naturalnej;

53. wirus wenezuelskiego końskiego zapalenia mózgu;

54. wirus pęcherzykowego zapalenia jamy gębowej;

55. wirus zachodnioamerykańskiego końskiego zapalenia mózgu;

56. wirus żółtej gorączki;

57. koronawirus ciężkiej ostrej niewydolności oddechowej (koronawirus SARS);

58. zrekonstruowany wirus grypy z 1918 r.;

b. nieużywane;

c. następujące bakterie pochodzenia naturalnego, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub jako materiał łącznie z materiałem żywym, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. laseczka wąglika (Bacillus anthracis);

2. pałeczka ronienia bydła (Brucella abortus bovis);

3. pałeczka maltańska (Brucella melitensis);

4. pałeczka ronienia świń (Brucella abortus suis);

5. pałeczka nosacizny Burkholderia mallei (Pseudomonas mallei);

6. pałeczka melioidozy Burkholderia pseudomallei (Pseudomonas pseudomallei);

7. zarazek papuzicy Chlamydia psittaci (Chlamydophila psittaci);

8. laseczka jadu kiełbasianego gatunku Clostridium argentinense (znana wcześniej jako Clostridium botulinum typ G), szczepy wytwarzające neurotoksynę botulinową;

9. Clostridium baratii, szczep wytwarzający neurotoksynę botulinową;

10. laseczka jadu kiełbasianego (Clostridium botulinum);

11. Clostridium butyricum, szczep wytwarzający neurotoksynę botulinową;

12 laseczka zgorzeli gazowej wytwarzająca odmiany egzotoksyn (Clostridium perfringens);

13. riketsja gorączki Q (Coxiella burnetii);

14. pałeczka tularemii (Francisella tularensis);

15. Mycoplasma capricolum podgatunek capripneumoniae (szczep F38);

16. Mycoplasma mycoides ssp. mycoides SC ("mała kolonia");

17. riketsja duru plamistego (Riketsja prowazekii);

18. pałeczka duru Salmonella enterica subspecies enterica serotyp Typhi (Salmonella typhi);

19. pałeczka okrężnicy (Escherichia coli) wytwarzająca toksynę Shiga (STEC) z grup serologicznych O26, O45, O103, O104, O111, O121, O145, O157 oraz innych grup serologicznych wytwarzających toksynę Shiga;

Uwaga: Pałeczka Escherichia coli wytwarzająca toksynę Shiga (STEC) obejmuje między innymi szczep enterokrwotoczny E. coli (EHEC), szczep E. coli wytwarzający werotoksynę (VTEC) lub szczep E. Coli wytwarzający werocytotoksynę (VTEC).

20. pałeczka czerwonki (Shigella dysenteriae);

21. przecinkowiec cholery (Vibrio cholerae);

22. pałeczka dżumy (Yersinia pestis);

d. następujące "toksyny" i ich "podjednostki toksyn":

1. toksyny botulinowe;

2. toksyny alfa, beta 1, beta 2, epsilon i jota laseczki zgorzeli gazowej;

3. konotoksyny;

4. rycyna;

5. saksytoksyna;

6. toksyny Shiga (toksyny Shiga-podobne, werotoksyny, werocytotoksyny);

7. enterotoksyny gronkowca złocistego, hemolizyna alfa oraz toksyna wywołująca zespół wstrząsu toksycznego (wcześniej znana jako enterotoksyna F gronkowca);

8. tetrodotoksyna;

9. nieużywane;

10. mikrocystyny (Cyanginosin);

11. aflatoksyny;

12. abryna;

13. toksyna cholery;

14. toksyna diacetoksyscyrpenolowa;

15. toksyna T-2;

16. toksyna HT-2;

17. toksyna modekcyny;

18. toksyna wolkenzyny;

19. lektyna 1 jemioły pospolitej (wiskotoksyna);

Uwaga: Pozycja 1C351.d nie obejmuje kontrolą toksyn botulinowych ani konotoksyn w postaci wyrobów spełniających wszystkie poniższe kryteria:

1. są wyrobami farmaceutycznymi przeznaczonymi do podawania ludziom w leczeniu schorzeń;

2. są opakowane do rozprowadzania jako wyroby lecznicze;

3. są dopuszczone przez władze państwowe do obrotu jako wyroby lecznicze.

e. następujące grzyby, naturalne, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub materiału zawierającego żywe organizmy, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. Coccidioides immitis;

2. Coccidioides posadasii.

Uwaga: Pozycja 1C351 nie obejmuje kontrolą "szczepionek" ani "immunotoksyn".

1C353 Następujące 'Elementy genetyczne' oraz 'zmodyfikowane genetycznie organizmy':

a. wszelkie 'zmodyfikowane genetycznie organizmy', które obejmują, lub 'element genetyczny', który koduje którekolwiek z poniższych:

1. którykolwiek gen lub geny specyficzne dla wirusów wyszczególnionych w pozycjach 1C351.a. lub 1C354.a.

2. którykolwiek gen lub geny specyficzne dla bakterii wyszczególnionych w pozycjach 1C351.c. lub 1C354.b. lub grzybów określonych w pozycjach 1C351.e. lub 1C354.c., które to geny wykazują którąkolwiek z poniższych cech:

a. same lub przez swoje produkty transkrybowane lub transponowane stanowią istotne zagrożenie dla zdrowia ludzi, zwierząt lub roślin; lub

b. mogą 'powodować lub wzmacniać chorobotwórczość', lub

3. wszelkie "toksyny" wyszczególnione w pozycji 1C351.d lub należące do nich "podjednostki toksyn".

Uwagi techniczne:

1. 'Zmodyfikowane genetycznie organizmy' obejmują organizmy, w których sekwencja kwasu nukleinowego została utworzona lub zmieniona w drodze umyślnego manipulowania molekułami.

2. 'Elementy genetyczne' zawierają między innymi chromosomy, genomy, plazmidy, transpozony, wektory i organizmy inaktywowane zawierające odzyskiwalne fragmenty kwasu nukleinowego, bez względu na to, czy są modyfikowane genetycznie lub czy są w całości lub częściowo syntetyzowane chemicznie. Do celów kontroli elementów genetycznych kwasy nukleinowe z organizmu inaktywowanego, wirusa lub próbki uznaje się za odzyskiwalne, jeżeli inaktywacja i przygotowanie materiału ma na celu ułatwienie lub wiadomo, że ułatwia izolowanie, oczyszczanie, magnifikację, wykrywanie lub identyfikację kwasów nukleinowych.

3. 'Powodowanie lub wzmacnianie chorobotwórczości' jest zdefiniowane jako insercja lub integracja sekwencji kwasu nukleinowego, która/które spowodują lub zwiększą zdolność biorcy do wykorzystania do rozmyślnego spowodowania choroby lub śmierci. Może to obejmować zmiany dotyczące m.in.: zjadliwości, zdolności do przenoszenia się, stabilności, drogi zakażenia, zakresu żywicieli, odtwarzalności, zdolności do obejścia lub pokonania odporności żywiciela, odporności na medyczne środki zapobiegawcze lub wykrywalności.

Uwaga: Poycja 1C353 nie obejmuje kontrolą sekwencji kwasów nukleinowych pałeczki Escherichia coli wytwarzającej toksynę Shiga grup serologicznych O26, O45, O103, O104, O111, O121, O145, O157 oraz innych grup serologicznych wytwarzających toksynę Shiga, innych niż elementy genetyczne kodujące toksynę Shiga lub ich podjednostki.

1C354 Roślinne czynniki chorobotwórcze, takie jak:

a. następujące wirusy pochodzenia naturalnego, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub jako materiał łącznie z materiałem żywym, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. andyjski utajony wirus ziemniaka;

2. wiroid wrzecionowatości bulw ziemniaka;

b. następujące bakterie pochodzenia naturalnego, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub jako materiał łącznie z materiałem żywym, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. Xantomonas albilineans;

2. Xanthomonas axonopodis pv. citri (Xanthomonas campestris pv. citri A) [Xanthomonas campestris pv. citri];

3. Xanthomonas oryzae pv. oryzae (Pseudomonas campestris pv. oryzae);

4. Clavibacter michiganensis subsp. sepedonicus (Corynebacterium michiganensis subsp. sepedonicum lub Corynebacterium sepedonicum);

5. Ralstonia solanacearum, rasa 3, biowar 2;

c. następujące grzyby pochodzenia naturalnego, wzmocnione lub zmodyfikowane, w postaci "izolowanych żywych kultur" lub jako materiał łącznie z materiałem żywym, który został celowo zaszczepiony lub zakażony takimi kulturami:

1. Colletotrichum kahawae (Colletotrichum coffeanum var. virulans);

2. Cochliobolus miyabeanus (Helminthosporium oryzae);

3. Microcyclus ulei (syn. Dothidella ulei);

4. Puccinia graminis ssp. graminis var. graminis/Puccinia graminis ssp. graminis var. stakmanii (Puccinia graminis [syn. Puccinia graminis f. sp. tritici]);

5. Puccinia striiformis (syn. Puccinia glumarum);

6. Magnaporthe oryzae (Pyricularia oryzae);

7. Peronosclerospora philippinensis (Peronosclerospora sacchari);

8. Sclerophthora rayssiae var. zeae;

9. Synchytrium endobioticium;

10. Tilletia indica;

11. Thecaphora solani.

1C450 Toksyczne związki chemiczne, prekursory toksycznych związków chemicznych oraz "mieszaniny chemiczne" zawierające jedną lub więcej z tych substancji, takie jak:

N.B. ZOB. TAKŻE POZYCJE 1C350, 1C351.d ORAZ WYKAZ UZBROJENIA.

a. toksyczne związki chemiczne, takie jak:

1. amiton: O,O-dietylo-S-[2-(dietyloamino)etylo] fosforotiolan (78-53-5) oraz odpowiednie alkilowane lub protonowane sole;

2. PFIB: 1,1,3,3,3-pentafluoro-2-(trifluorometylo)-1-propen (382-21-8);

3. ZOB. WYKAZ UZBROJENIA dla BZ: 3-chinuklidylo benzylan (6581-06-2);

4. fosgen: dichlorek karbonylu (75-44-5);

5. chlorocyjan (506-77-4);

6. cyjanowodór (74-90-8);

7. chloropikryna: trichloronitrometan (76-06-2);

Uwaga 1: Dla wywozu do "państw niebędących stronami konwencji o zakazie broni chemicznej" pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C450.a.1 oraz .a.2, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 1 % mieszaniny.

Uwaga 2: Dla wywozu do "państw będących stronami konwencji o zakazie broni chemicznej" pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C450.a.1 oraz .a.2, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 3: Pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C450.a.4, .a.5, .a.6 oraz .a.7, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 4: Pozycja 1C450 nie obejmuje kontrolą wyrobów określanych jako towary konsumpcyjne pakowane do sprzedaży detalicznej do osobistego użytku lub pakowane do indywidualnego użytku.

b. prekursory toksycznych związków chemicznych, takie jak:

1. związki chemiczne, inne niż wymienione w wykazie uzbrojenia lub w pozycji 1C350, posiadające atom fosforu, z którym związana jest jedna grupa metylowa, etylowa, propylowa lub izopropylowa, lecz nie więcej atomów węgla;

Uwaga: Pozycja 1C450.b.1 nie obejmuje kontrolą fonofosu: O-etylo S-fenylo-etylofosfonotiolotionianu (944-22-9).

2. dihalogenki N,N-dialkilo (metylo, etylo, propylo lub izopropylo) fosforoamidowe, inne niż dichlorek N,N-dimetylofosforoamidowy;

N.B.: Zob. pozycja 1C350.57 dla dichlorku N,N-dimetylofosforoamidowego.

3. N,N-dialkilo (metylo, etylo, propylo lub izopropylo)-fosforoamidany dialkilu (metylu, etylu, propylu lub izopropylu), inne niż N,N-dimetylofosforoamidan dietylu wyszczególniony w pozycji 1C350;

4. chlorki 2-N,N-dialkilo (metylo, etylo, propylo lub izopropylo) aminoetylu i odpowiednie protonowane sole, inne niż chlorek N,N-diizopropylo-(beta)-aminoetylu lub chlorowodorek chlorku N,N-diizopro-pylo-(beta)-aminoetylu wyszczególnione w pozycji 1C350;

5. N,N-dialkilo (metylo, etylo, propylo lub izopropylo) aminoetan-2-ole i odpowiednie protonowane sole, inne niż N,N-diizopropylo-(beta)-aminoetanol (96-80-0) i N,N-dietyloaminoetanol (100-37-8) wyszczególnione w pozycji 1C350;

Uwaga: Pozycja 1C450.b.5 nie obejmuje kontrolą:

a. N,N-dimetyloaminoetanolu (108-01-0) i odpowiednich protonowanych soli;

b. protonowanych soli N,N-dietyloaminoetanolu (100-37-8).

6. N,N-dialkilo (metylo, etylo, propylo lub izopropylo) aminoetano-2-tiole i odpowiednie protonowane sole, inne niż N,N-diizopropylo-(beta)-aminoetanotiol (5842-07-9) i chlorowodorek N,N-Diisopropy-loaminoetanoetiolu (41480-75-5) wyszczególniony w pozycji 1C350;

7. etylodietanoloamina (139-87-7) - zob. 1C350;

8. metylodietanoloamina (105-59-9).

Uwaga 1: Dla wywozu do "państw niebędących stronami konwencji o zakazie broni chemicznej" pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C450.b.1, .b.2, .b.3, .b.4, .b.5 oraz .b.6, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 10 % mieszaniny.

Uwaga 2: Dla wywozu do "państw będących stronami konwencji o zakazie broni chemicznej" pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunktach 1C450.b.1, .b.2, .b.3, .b.4, .b.5 oraz .b.6, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 3: Pozycja 1C450 nie obejmuje kontrolą "mieszanin chemicznych" zawierających jedną lub więcej substancji chemicznych wyszczególnionych w podpunkcie 1C450.b.8, w których żadna z indywidualnie wyszczególnionych substancji chemicznych nie stanowi wagowo więcej niż 30 % mieszaniny.

Uwaga 4: Pozycja 1C450 nie obejmuje kontrolą wyrobów określanych jako towary konsumpcyjne pakowane do sprzedaży detalicznej do osobistego użytku lub pakowane do indywidualnego użytku.

1D Oprogramowanie

1D001 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "rozwoju", "produkcji" lub "użytkowania" urządzeń wyszczególnionych w pozycjach od 1B001 do 1B003.

1D002 "Oprogramowanie" do "rozwoju" "matryc" organicznych, "matryc" metalowych, "matryc" węglowych do laminatów oraz "kompozytów".

1D003 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane, aby umożliwić urządzeniom wypełnianie funkcji urządzeń wyszczególnionych w pozycjach 1A004.c lub 1A004.d.

1D101 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do celów obsługi lub konserwacji wyrobów wyszczególnionych w pozycjach 1B101, 1B102, 1B115, 1B117, 1B118 lub 1B119.

1D103 "Oprogramowanie" specjalnie zaprojektowane do badania obiektów o zmniejszonej wykrywalności za pomocą odbitych fal radarowych, śladów w zakresie promieniowania nadfioletowego/podczerwonego i śladów akustycznych.

1D201 "Oprogramowanie" specjalnie zaprojektowane do "użytkowania" wyrobów wyszczególnionych w pozycji 1B201.

1E Technologia

1E001 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" sprzętu lub materiałów wyszczególnionych w pozycjach 1A002 do 1A005, 1A006.b, 1A007, 1B lub 1C.

1E002 Inne "technologie", takie jak:

a. "technologia" do "rozwoju" lub "produkcji" polibenzotiazoli lub polibenzoksazoli;

b. "technologia" do "rozwoju" lub "produkcji" związków elastomerów fluorowych, zawierających co najmniej jeden monomer eteru winylowego;

c. "technologia" do projektowania lub "produkcji" proszków ceramicznych lub innych niż "kompozytowe" materiałów ceramicznych, takich jak:

1. proszki ceramiczne spełniające wszystkie poniższe kryteria:

a. zawierające którykolwiek z następujących związków:

1. pojedyncze lub kompleksowe tlenki cyrkonu oraz kompleksowe tlenki krzemu lub glinu;

2. pojedyncze azotki boru (w postaci regularnych kryształów);

3. pojedyncze lub kompleksowe węgliki krzemu lub boru; lub

4. pojedyncze lub kompleksowe azotki krzemu;

b. posiadające całkowitą zawartość zanieczyszczeń metalicznych (z wyłączeniem celowych domieszek) w którejkolwiek z poniższych wysokości:

1. poniżej 1 000 ppm dla pojedynczych tlenków lub węglików; lub

2. poniżej 5 000 ppm dla związków kompleksowych lub pojedynczych azotków; oraz

c. będące którymkolwiek z poniższych:

1. tlenkiem cyrkonu (CAS 1314-23-4) o przeciętnych wymiarach cząsteczek mniejszych lub równych 1 μm, niezawierającym więcej niż 10 % cząsteczek większych niż 5 μm; lub

2. innymi proszkami ceramicznymi o przeciętnych wymiarach cząsteczek mniejszych lub równych 5 μm, niezawierającymi więcej niż 10 % cząsteczek większych niż 10 μm;

2. nie-"kompozytowe" materiały ceramiczne składające się z materiałów wyszczególnionych w pozycji 1E002.c.1;

Uwaga: Pozycja 1E002.c.2 nie obejmuje kontrolą "technologii" materiałów ściernych.

d. nieużywane.

e. "technologia" do instalacji, obsługiwania lub naprawy materiałów wyszczególnionych w pozycji 1C001;

f. "technologia" do naprawy struktur "kompozytowych", laminatów lub materiałów wyszczególnionych w pozycji 1A002 lub 1C007.c;

Uwaga: Pozycja 1E002.f nie obejmuje kontrolą "technologii" do naprawy struktur "cywilnych statków powietrznych" za pomocą węglowych "materiałów włóknistych lub włókienkowych" oraz żywic epoksydowych, zawartych w instrukcjach producenta "statku powietrznego".

g. "biblioteki" specjalnie zaprojektowane lub zmodyfikowane, aby umożliwić urządzeniom wypełnianie funkcji urządzeń wyszczególnionych w pozycjach 1A004.c lub 1A004.d.

1E101 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "użytkowania" wyrobów wyszczególnionych w pozycjach 1A102, 1B001, 1B101, 1B102, 1B115 do 1B119, 1C001, 1C101, 1C107, 1C111 do 1C118, 1D101 lub 1D103.

1E102 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" "oprogramowania" wyszczególnionego w pozycjach 1D001, 1D101 lub 1D103.

1E103 "Technologia" do regulacji temperatur, ciśnień lub atmosfery w autoklawach lub hydroklawach w przypadku wykorzystania do "produkcji" "kompozytów" lub "kompozytów" częściowo przetworzonych.

1E104 "Technologia" do "produkcji" pirolitycznie wytwarzanych materiałów, formowanych w matrycy, na trzpieniu lub innym podłożu z gazów prekursorowych, ulegających rozkładowi w temperaturach od 1 573 K (1 300 °C) do 3 173 K (2 900 °C) przy ciśnieniach od 130 Pa do 20 kPa.

Uwaga: Pozycja 1E104 obejmuje "technologię" do łączenia gazów prekursorowych, wartości natężeń przepływu, harmonogramy oraz parametry sterowania procesem.

1E201 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "użytkowania" wyrobów wyszczególnionych w pozycjach 1A002, 1A007, 1A202, 1A225 to 1A227, 1B201, 1B225 do 1B234, 1C002.b.3. lub.b.4., 1C010.b., 1C202, 1C210, 1C216, 1C225 do 1C241 lub 1D201.

1E202 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" wyrobów wyszczególnionych w pozycjach 1A007, 1A202 lub 1A225 do 1A227.

1E203 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" "oprogramowania" wyszczególnionego w pozycji 1D201.

KATEGORIA 2 - PRZETWARZANIE MATERIAŁÓW

2A Systemy, urządzenia i części składowe

N.B. Dla łożysk bezgłośnych zob. wykaz uzbrojenia.

2A001 Łożyska, zespoły łożysk oraz ich części składowe:

N.B. ZOB. TAKŻE POZYCJA 2A101.

Uwaga: Pozycja 2A001 nie obejmuje kontrolą kulek o tolerancji określanej przez producenta zgodnie z normą ISO 3290 jako klasa 5 (lub równoważnik krajowy) lub gorszej.

a. łożyska kulkowe lub pełne wałeczkowe o tolerancjach, określonych przez producenta zgodnie z normą ISO 492 (lub według innych odpowiedników krajowych), 4 klasy tolerancji lub lepszej, posiadające 'pierścienie' oraz 'elementy toczne' wykonane z monelu lub berylu;

Uwaga: Pozycja 2A001.a nie obejmuje kontrolą łożysk z wałeczkami stożkowymi.

Uwagi techniczne:

1. 'Pierścień' - część promieniowego łożyska tocznego w kształcie obrączki zawierająca jedną lub więcej bieżni (ISO 5593:1997).

2. 'Element toczny' - kulka lub wałek obracające się między bieżniami (ISO 5593:1997).

b. nieużywane;

c. aktywne zespoły łożysk magnetycznych, wykorzystujące którekolwiek z poniższych:

1. materiały o gęstości strumienia 2,0 T lub większej, przenoszące obciążenia większe niż 414 MPa;

2. całkowicie elektromagnetyczne, trójwymiarowe jednobiegunowe konstrukcje dla siłowników; lub

3. wysokotemperaturowe (450 K (177 °C) i więcej) czujniki położenia.

2A101 Łożyska kulkowe promieniowe, inne niż wyszczególnione w pozycji 2A001, o tolerancjach określonych zgodnie z normą ISO 492, 2. klasy tolerancji (lub zgodnie z normą ANSI/ABMA Std 20 - klasa tolerancji ABEC 9 lub według innych odpowiedników krajowych) lub lepszej, mające wszystkie wymienione poniżej cechy:

a. średnica wewnętrzna 12-50 mm;

b. średnica zewnętrzna 25-100 mm; oraz

c. szerokość 10-20 mm.

2A225 Tygle, wykonane z materiałów odpornych na płynne aktynowce, takie jak:

a. tygle spełniające oba poniższe kryteria:

1. mające pojemność od 150 cm3 do 8 000 cm3; oraz

2. wykonane z jednego z następujących materiałów lub ich kombinacji lub nimi powlekane, o ogólnym poziomie wagowym domieszek 2 % lub mniejszym:

a. fluorek wapnia (CaF2);

b. cyrkonian wapnia (metacyrkonian) (CaZrO3);

c. siarczek ceru (Ce2S3);

d. tlenek erbowy (erbia) (Er203);

e. tlenek hafnowy (hafnia) (HfO2);

f. tlenek magnezowy (MgO);

g. azotowany stop niobu z tytanem i wolframem (około 50 % Nb, 30 % Ti, 20 % W);

h. tlenek itrowy (itria) (Y203); lub

i. tlenek cyrkonu (cyrkonia) (ZrO2);

b. tygle spełniające oba poniższe kryteria:

1. mające pojemność od 50 cm3 do 2 000 cm3; oraz

2. wykonane z tantalu lub nim pokryte, o czystości wagowej tantalu 99,9 % lub większej;

c. tygle spełniające wszystkie poniższe kryteria:

1. mające pojemność od 50 cm3 do 2 000 cm3;

2. wykonane z tantalu lub nim pokryte, o czystości wagowej tantalu 98 % lub większej; oraz

3. powlekane węglikiem, azotkiem lub borkiem tantalu lub jakąkolwiek ich kombinacją.

2A226 Zawory posiadające wszystkie z następujących cech:

a. "wymiar nominalny" 5 mm lub większy;

b. wyposażone w uszczelnienia mieszkowe; oraz

c. w całości wykonane z glinu, stopu glinu, niklu lub stopu niklu zawierającego wagowo ponad 60 % niklu lub pokryte nimi.

Uwaga techniczna:

Dla zaworów o różnych średnicach otworu wlotowego i wylotowego pojęcie "wymiar nominalny" w pozycji 2A226 odnosi się do najmniejszej średnicy.

2B Urządzenia testujące, kontrolne i produkcyjne

Uwagi techniczne:

1. Pomocnicze, równoległe osie konturowe (np. oś "w" w wiertarkach poziomych lub pomocnicza oś obrotowa, której linia centralna biegnie równolegle do głównej osi obrotu) nie są zaliczane do całkowitej liczby osi kształtowych. Osie obrotowe nie muszą obracać się o 360°. Oś obrotowa może być napędzana za pomocą urządzenia liniowego (np. śruby lub mechanizmu zębatkowego).

2. Dla celów pozycji 2B za liczbę osi, które mogą być koordynowane jednocześnie w celu "sterowania kształtowego", uznaje się liczbę osi, wzdłuż których lub dookoła których w trakcie obrabiania przedmiotu wykonywane są ruchy jednoczesne i wzajemnie powiązane pomiędzy obrabianym przedmiotem a narzędziem. Nie obejmuje to żadnych dodatkowych osi, wzdłuż lub dookoła których wykonywane są inne ruchy względne maszyny, takich jak:

a. systemów obciągania ściernic w szlifierkach;

b. równoległych osi obrotowych, przeznaczonych do mocowania oddzielnych przedmiotów obrabianych;

c. współliniowych osi obrotowych przeznaczonych do manipulowania tym samym przedmiotem poprzez zamocowanie go w uchwytach z oddzielnych końców.

3. Nazewnictwo osi powinno być zgodne z Międzynarodową Normą ISO 841:2001, Systemy automatyki przemysłowej i ich integracja - Numeryczne sterowanie maszynami - Nazewnictwo osi układu współrzędnych i ruchów.

4. Na potrzeby pozycji od 2B001 do 2B009 "wrzeciono wahliwe" jest zaliczane do osi obrotowych.

5. Gwarantowaną "jednokierunkową powtarzalność pozycjonowania" można stosować jako rozwiązanie alternatywne w stosunku do indywidualnych testów dla każdego modelu obrabiarki. Jest ona ustalana w następujący sposób:

a. wybrać pięć egzemplarzy modelu maszyny, który ma być oceniany;

b. zmierzyć powtarzalność osi liniowej (R↑ ,R↓ ) zgodnie z normą ISO 230-2:2014 i ocenić "jednokierunkową powtarzalność pozycjonowania" dla każdej osi każdej z pięciu obrabiarek;

c. ustalić średnią arytmetyczną wartość "jednokierunkowej powtarzalności pozycjonowania" - wartości dla każdej osi wszystkich pięciu obrabiarek łącznie. Te średnie arytmetyczne wartości "jednokierunkowej powtarzalności pozycjonowania" (UPR) stają się wartością gwarantowaną każdej osi modelu (UPRx, UPRy, ...);

d. ponieważ wykaz kategorii 2 odnosi się do każdej osi liniowej, wartości gwarantowanych "jednokierunkowej powtarzalności pozycjonowania" będzie tyle, ile jest osi liniowych;

e. jeżeli któraś z osi modelu maszyny niewyszczególnionego w pozycjach 2B001.a do 2B001.c posiada gwarantowaną "jednokierunkową powtarzalność pozycjonowania" równą lub mniejszą niż określona "jednokierunkowa powtarzalność pozycjonowania" każdego z modeli obrabiarek plus 0,7 μm, od wytwórcy powinno się wymagać potwierdzania poziomu dokładności raz na osiemnaście miesięcy.

6. Dla celów pozycji 2B001.a do 2B001.c nie uwzględnia się niepewności pomiarowej w odniesieniu do "jednokierunkowej powtarzalności pozycjonowania" obrabiarek, jak zdefiniowano w Międzynarodowej Normie ISO 230-2:2014 lub jej równoważnikach krajowych.

7. Dla celów pozycji 2B001.a. do 2B001.c.. pomiar osi wykonuje się zgodnie z procedurami badawczymi określonymi w pkt 5.3.2. normy ISO 230-2:2014. Badania dotyczące osi dłuższych niż 2 m przeprowadza się na odcinkach o długości 2 m. Osie dłuższe niż 4 m wymagają wielokrotnych badań (np. dwa badania dla osi dłuższych niż 4 m i nie dłuższych niż 8 m, trzy badania dla osi dłuższych niż 8 m i nie dłuższych niż 12 m), każde na odcinkach o długości 2 m i rozłożonych w równych odstępach na całej długości osi. Badane odcinki są równo rozłożone wzdłuż całej długości osi, natomiast jakikolwiek dodatkowy odcinek zostaje równo podzielony na początku, w środku i na końcu badanych odcinków. Należy zgłosić najmniejszą wartość "jednokierunkowej powtarzalności pozycjonowania" odnotowaną w badanych odcinkach.

2B001 Obrabiarki oraz ich różne kombinacje, do skrawania (lub cięcia) metali, materiałów ceramicznych lub "kompozytów", które, według danych technicznych producenta, mogą być wyposażone w urządzenia elektroniczne do "sterowania numerycznego", w tym:

N.B. ZOB. TAKŻE POZYCJA 2B201.

Uwaga 1: Pozycja 2B001 nie obejmuje kontrolą obrabiarek do specjalnych zastosowań ograniczonych do wytwarzania kół zębatych. Dla takich maszyn zob. pozycja 2B003.

Uwaga 2: Pozycja 2B001 nie obejmuje kontrolą obrabiarek do specjalnych zastosowań ograniczonych do wytwarzania którychkolwiek z poniższych:

a. wałów korbowych lub rozrządowych;

b. narzędzi lub noży do obrabiarek;

c. ślimaków do wytłaczarek;

d. grawerowanych lub szlifowanych części biżuterii; lub

e. protez dentystycznych.

Uwaga 3: Obrabiarki posiadające co najmniej dwie z trzech następujących zdolności: toczenia, frezowania lub szlifowania (np. tokarka ze zdolnością do frezowania), muszą być oszacowane stosownie odpowiednio do każdej pozycji 2B001.a, .b lub .c.

N.B. W odniesieniu do maszyn wykorzystujących optyczną obróbkę wykańczającą - zob. pozycja 2B002.

a. tokarki posiadające dwie lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego", spełniające którekolwiek z poniższych kryteriów:

1. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 0,9 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu mniejszej niż 1,0 m; lub

2. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,1 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 1,0 m;

Uwaga 1: Pozycja 2B001.a nie obejmuje kontrolą tokarek specjalnie zaprojektowanych do wytwarzania soczewek kontaktowych i spełniających wszystkie poniższe kryteria:

a. sterownik obrabiarki jest ograniczony do wykorzystywania oprogramowania służącego do programowania obróbki detali opartego na oprogramowaniu okulistycznym; oraz

b. brak uchwytów próżniowych.

Uwaga 2: Pozycja 2B001.a. nie obejmuje kontrolą tokarek (Swissturn), ograniczonych do obrabiania tylko prętów podawanych, jeśli maksymalna średnica pręta jest równa lub mniejsza niż 42 mm i nie ma możliwości mocowania uchwytami. Maszyny mogą mieć możliwość wiercenia lub frezowania części o średnicy mniejszej niż 42 mm.

b. frezarki spełniające którekolwiek z poniższych kryteriów:

1. trzy osie liniowe oraz dodatkowo jedna oś obrotowa, które można jednocześnie koordynować w celu "sterowania kształtowego", spełniające którekolwiek z poniższych kryteriów:

a. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 0,9 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu mniejszej niż 1,0 m; lub

b. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,1 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 1,0 m;

2. pięć lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego", spełniające jedno z poniższych kryteriów:

a. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 0,9 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu mniejszej niż 1,0 m;

b. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,4 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 1 m i mniejszej niż 4 m; lub

c. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 6,0 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 4 m;

3. "jednokierunkowa powtarzalność pozycjonowania" dla wiertarek współrzędnościowych równa lub mniejsza (lepsza) niż 1,1 μm mierzona wzdłuż jednej lub więcej osi liniowych; lub

4. maszyny do obróbki frezem jednoostrzowym spełniające wszystkie poniższe kryteria:

a. wartość "bicia promieniowego" i "bicia osiowego" wrzeciona mniejsza (lepsza) niż 0,0004 mm; oraz

b. wartość odchylenia kątowego posuwu (odchyłu, skoku i obrotu) mniejsza (lepsza) niż 2 sekundy kątowe, na 300 mm odcinku ruchu;

c. szlifierki spełniające którekolwiek z poniższych kryteriów:

1. spełniające wszystkie z poniższych kryteriów:

a. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,1 μm mierzona wzdłuż jednej lub więcej osi liniowych; oraz

b. trzy lub cztery osie, które można jednocześnie koordynować w celu "sterowania kształtowego"; lub

2. pięć lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego", spełniające którekolwiek z poniższych kryteriów:

a. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,1 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu mniejszej niż 1 m;

b. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 1,4 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 1 m i mniejszej niż 4 m; lub

c. "jednokierunkowa powtarzalność pozycjonowania" równa lub mniejsza (lepsza) niż 6,0 μm mierzona wzdłuż jednej lub więcej osi liniowych przy długości ruchu równej lub większej niż 4 m;

Uwaga: Pozycja 2B001.c nie obejmuje kontrolą następujących szlifierek:

a. szlifierek do zewnętrznego, wewnętrznego i zewnętrzno-wewnętrznego szlifowania na okrągło, spełniających wszystkie poniższe kryteria:

1. ograniczenie do szlifowania na okrągło; oraz

2. ograniczenie do maksymalnych wymiarów przedmiotu obrabianego do 150 mm średnicy zewnętrznej lub długości;

b. obrabiarek skonstruowanych specjalnie jako szlifierki współrzędnościowe, nieposiadających osi z ani osi w, o "jednokierunkowej powtarzalności pozycjonowania" mniejszej (lepszej) niż 1,1 μm;

c. szlifierek powierzchniowych.

d. obrabiarki elektroiskrowe (EDM), niedrutowe, posiadające dwie lub więcej osi obrotowych, które można jednocześnie koordynować w celu "sterowania kształtowego";

e. obrabiarki do obróbki skrawaniem metali, materiałów ceramicznych lub "kompozytowych" spełniające wszystkie poniższe kryteria:

1. usuwające materiał za pomocą któregokolwiek z niżej wymienionych sposobów:

a. wysokociśnieniowym strumieniem wody lub innej cieczy roboczej, w tym zawierającej substancje ścierne;

b. wiązką elektronów; lub

c. wiązką "laserową"; oraz

2. posiadające co najmniej dwie osie obrotowe i spełniające wszystkie poniższe kryteria:

a. można je jednocześnie koordynować w celu "sterowania kształtowego"; oraz

b. posiadają "dokładność" pozycjonowania mniejszą (lepszą) niż 0,003o;

f. wiertarki do głębokich otworów i tokarki zmodyfikowane do wiercenia głębokich otworów posiadające maksymalną zdolność do wiercenia otworów o głębokości przekraczającej 5 m.

2B002 Obrabiarki sterowane numerycznie wykorzystujące optyczną obróbkę wykańczającą przystosowane do selektywnego usuwania materiału w celu uzyskania optycznych powierzchni asferycznych spełniające wszystkie poniższe kryteria:

a. obróbka wykańczająca z tolerancją mniejszą (lepszą) niż 1,0 μm;

b. obróbka wykańczająca pozwalająca na uzyskanie chropowatości mniejszej (lepszej) niż 100 nm (wartość średnia kwadratowa);

c. cztery lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego"; oraz

d. wykorzystujące którykolwiek z następujących procesów:

1. magnetoreologiczna obróbka wykańczająca ('MRF');

2. elektroreologiczna obróbka wykańczająca ('ERF');

3. 'obróbka wykończeniowa wiązką cząstek wysokoenergetycznych';

4. 'obróbka narzędziami z membranami ciśnieniowymi'; lub

5. 'obróbka strumieniem płynu'.

Uwagi techniczne:

Do celów pozycji 2B002:

1. 'MRF' oznacza proces usuwania materiału wykorzystujący ścierny płyn magnetyczny, którego lepkość sterowana jest polem magnetycznym.

2. 'ERF' oznacza proces usuwania materiału wykorzystujący ścierny płyn, którego lepkość sterowana jest polem elektrycznym.

3. 'Obróbka wykończeniowa wiązką cząstek wysokoenergetycznych' wykorzystuje plazmy atomów reaktywnych (RAP) lub wiązki jonowe do selektywnego usuwania materiału.

4. 'Obróbka narzędziami z membranami ciśnieniowymi' oznacza proces wykorzystujący membranę pod ciśnieniem, która ulega deformacji, w celu zetknięcia z obrabianym przedmiotem na małej powierzchni.

5. Podczas 'obróbki strumieniem płynu' do usuwania materiału wykorzystuje się strugę płynu.

2B003 Obrabiarki "sterowane numerycznie" lub ręcznie oraz specjalnie do nich zaprojektowane podzespoły, urządzenia sterujące i oprzyrządowanie, specjalnie opracowane do skrawania, obróbki, wykańczania, szlifowania lub gładzenia hartowanych (Rc = 40 lub więcej) kół zębatych o zębach prostych, kół zębatych śrubowych i daszkowych o średnicy toczonej powyżej 1 250 mm i szerokości wieńca wynoszącej 15 % średnicy toczonej lub większej, wykończone do jakości AGMA 14 lub wyższej (równoważnej Klasie 3 normy ISO 1328).

2B004 Pracujące na gorąco "prasy izostatyczne" spełniające wszystkie poniższe kryteria oraz specjalnie zaprojektowane do nich podzespoły i oprzyrządowanie, takie jak:

N.B. ZOB. TAKŻE POZYCJE 2B104 I 2B204.

a. posiadające możliwość regulacji warunków termicznych w zamkniętej formie oraz wyposażone w komorę formy o średnicy wewnętrznej 406 mm lub większej; oraz

b. spełniające którekolwiek z poniższych kryteriów:

1. maksymalne ciśnienie robocze powyżej 207 MPa;

2. regulacja warunków termicznych powyżej 1 773 K (1 500 °C); lub

3. łatwość nasycania węglowodorami i usuwania powstających gazowych produktów rozkładu.

Uwaga techniczna:

Wewnętrzny wymiar komory oznacza wymiar komory, w którym osiąga się zarówno temperaturę roboczą, jak i ciśnienie robocze; termin ten nie obejmuje kontrolą osprzętu. Wymiar ten będzie mniejszą ze średnic wewnętrznych komory ciśnieniowej lub izolowanej komory paleniskowej, w zależności od tego, która z tych komór jest umieszczona wewnątrz drugiej.

N.B.: W przypadku specjalnie zaprojektowanych matryc, form i oprzyrządowania zob. pozycje 1B003, 9B009 oraz wykaz uzbrojenia.

2B005 Sprzęt specjalnie zaprojektowany do osadzania, przetwarzania i automatycznej kontroli w czasie obróbki pokryć i powłok nieorganicznych oraz modyfikacji warstw powierzchniowych, przeznaczony do wytwarzania podłoży wyszczególnionych kolumnie 2 technikami wymienionymi w kolumnie 1 tabeli zamieszczonej po pozycji 2E003.f oraz specjalnie do nich opracowane zautomatyzowane podzespoły do obsługiwania, ustalania położenia, manipulowania i sterowania, w tym:

a. sprzęt produkcyjny do chemicznego osadzania warstw z faz gazowych (CVD) spełniający oba poniższe kryteria:

N.B.: ZOB. TAKŻE POZYCJA 2B105.

1. modyfikacja procesu do wymienionego poniżej:

a. CVD pulsujące;

b. rozkład termiczny z regulowaną nukleacją (CNTD); lub

c. CVD intensyfikowane lub wspomagane plazmowo; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. zawierający wysokopróżniowe (równe lub mniejsze od 0,01 Pa) uszczelnienia wirujące; lub

b. zawierający wbudowane urządzenia do regulowania grubości powłoki;

b. sprzęt produkcyjny do implantacji jonów o natężeniu wiązki 5 mA lub większym;

c. sprzęt produkcyjny do elektronowego naparowywania próżniowego (EB-PVD) zaopatrzony w układy zasilania o mocy powyżej 80 kW i posiadający którekolwiek z poniższych:

1. "laserowy" system regulacji poziomu cieczy, umożliwiający precyzyjne sterowanie podawaniem materiału wsadowego; lub

2. system kontroli wydajności, sterowany komputerowo, działający na zasadzie fotoluminescencji zjonizowanych atomów w strumieniu odparowanego czynnika, umożliwiający sterowanie wydajnością napylania pokrycia, składającego się z dwóch lub więcej pierwiastków;

d. sprzęt produkcyjny do napylania plazmowego spełniający którekolwiek z poniższych kryteriów:

1. możliwość pracy w atmosferze o regulowanym niskim ciśnieniu (równym lub mniejszym od 10 kPa, mierzonym powyżej i w zakresie 300 mm od wylotu dyszy natryskowej) w komorze próżniowej, w której przed rozpoczęciem napylania można obniżyć ciśnienie do 0,01 Pa; lub

2. zawierający wbudowane urządzenia do regulowania grubości powłoki;

e. sprzęt produkcyjny do rozpylania jonowego zdolny do osiągania prądu o gęstości 0,1 mA/mm2 lub większej przy wydajności napylania 15 μm/h lub wyższej;

f. sprzęt produkcyjny do napylania łukowo-katodowego zawierający siatki elektromagnesów do sterowania łukiem na katodzie;

g. sprzęt produkcyjny do powlekania jonowego zdolny do przeprowadzenia na miejscu pomiaru jednego z niżej wymienionych parametrów:

1. grubości powłoki na podłożu i wydajności procesu; lub

2. właściwości optycznych.

Uwaga: Pozycja 2B005 nie obejmuje kontrolą urządzeń do chemicznego osadzania warstw z faz gazowych, napylania katodowego, napylania jonowego, jonowego powlekania lub implantacji jonów, specjalnie zaprojektowanych do narzędzi tnących i skrawających.

2B006 Systemy, sprzęt, podzespoły położenia oraz "zespoły elektroniczne" do kontroli wymiarowej lub pomiarów, takie jak:

a. sterowane komputerowo lub "sterowane numerycznie" urządzenia do pomiaru współrzędnych (CMM), posiadające maksymalny dopuszczalny błąd pomiaru długości (E0,MPE), wzdłuż trzech osi (objętościowy), w dowolnym punkcie zakresu roboczego maszyny (tj. w długości osi) równy lub mniejszy (lepszy) niż (1,7 + L/1 000) μm (gdzie L jest długością, mierzoną w mm), zgodnie z ISO 10360-2:2009;

Uwaga techniczna:

Maksymalny dopuszczalny błąd pomiaru długości (E0,MPE) najdokładniejszej konfiguracji urządzenia do pomiaru współrzędnych określonej przez producenta (np. najlepsze: czujnik, długość ramienia, parametry ruchu, warunki środowiskowe) przy "wszystkich dostępnych kompensacjach" porównuje się do progu 1,7 + L/1 000 μm.

N.B. ZOB. TAKŻE POZYCJA 2B206.

b. przyrządy lub systemy do pomiaru odchylenia liniowego, podzespoły położenia liniowego ze sprzężeniem zwrotnym oraz "zespoły elektroniczne", takie jak:

Uwaga: Interferometry i enkodery optyczne do pomiaru wyposażone w "laser" są wyszczególnione tylko w pozycjach 2B006.b.3. i 2B206.c.

1. 'bezstykowe systemy pomiarowe' o "rozdzielczości" równej lub mniejszej (lepszej) niż 0,2 μm w zakresie pomiarowym do 0,2 mm;

Uwaga techniczna:

Do celów pozycji 2B006.b.1 'Bezstykowe systemy pomiarowe' zaprojektowano do pomiaru odległości pomiędzy czujnikiem a obiektem mierzonym wzdłuż pojedynczego wektora, gdy czujnik albo obiekt mierzony znajduje się w ruchu.

2. podzespoły położenia liniowego ze sprzężeniem zwrotnym, specjalnie zaprojektowane do obrabiarek i posiadające całkowitą "dokładność" mniejszą (lepszą) niż (800 + (600 × L/1 000)) nm (gdzie L równa się efektywnej długości w mm);

3. systemy pomiarowe spełniające wszystkie poniższe kryteria:

a. zawierające "laser";

b. "rozdzielczość" w pełnym zakresie wynoszącą 0,200 nm lub mniej (lepsza); oraz

c. zdolne do osiągnięcia "niepewności pomiaru" równej lub mniejszej (lepszej) niż (1,6 + L/2 000) nm (gdzie L jest długością mierzoną w mm) w każdym miejscu w ramach zakresu pomiaru, przy uwzględnieniu kompensacji ze względu na współczynnik refrakcji powietrza i pomiarze trwającym 30 sekund w temperaturze 20± 0,01 °C; lub

4. "zespoły elektroniczne" specjalnie zaprojektowane do realizacji funkcji sprzężenia zwrotnego w systemach wyszczególnionych w pozycji 2B006.b.3;

c. podzespoły położenia obrotowego ze sprzężeniem zwrotnym specjalnie zaprojektowane do obrabiarek albo przyrządów do pomiaru odchylenia kątowego, o "dokładności" położenia kątowego równej lub mniejszej (lepszej) niż 0,9 sekundy kątowej;

Uwaga: Pozycja 2B006.c nie obejmuje kontrolą przyrządów optycznych, takich jak autokolimatory, wykorzystujących światło kolimowane (np. światło "lasera"), w celu wykrycia odchylenia kątowego zwierciadła.

d. sprzęt do pomiaru szorstkości powierzchni (w tym wad powierzchni) poprzez pomiar rozproszenia światła, o czułości 0,5 nm lub mniejszej (lepszej);

Uwaga: Pozycja 2B006 obejmuje obrabiarki, inne niż wyszczególnione w pozycji 2B001, które można wykorzystać do celów pomiarowych, jeżeli spełniają lub przewyższają kryteria określone dla funkcji maszyny pomiarowej.

2B007 "Roboty" posiadające którąkolwiek z niżej wymienionych cech charakterystycznych oraz specjalnie zaprojektowane do nich urządzenia sterujące i "manipulatory", w tym;

N.B. ZOB. TAKŻE POZYCJA 2B207.

a. nieużywane;

b. specjalnie zaprojektowane w celu spełniania wymagań krajowych norm bezpieczeństwa, stosowanych w środowiskach środków potencjalnie wybuchowych;

Uwaga: Pozycja 2B007.b nie obejmuje kontrolą "robotów" specjalnie zaprojektowanych do komór lakierniczych.

c. specjalnie zaprojektowane lub odpowiednio wzmocnione przed promieniowaniem w celu przeciwstawienia się dawce promieniowania wynoszącej 5 × 103 Gy (Si) bez pogorszenia parametrów działania; lub

Uwaga techniczna:

Termin Gy (Si) odnosi się do energii w dżulach na kilogram pochłoniętej przez nieekranowaną próbkę krzemu poddaną promieniowaniu jonizującemu.

d. specjalnie zaprojektowane do działania na wysokościach przekraczających 30 000 m.

2B008 następujące 'stoły obrotowo-przechylne' oraz "wrzeciona wahliwe", specjalnie zaprojektowane do obrabiarek:

a. nieużywane;

b. nieużywane;

c. 'stoły obrotowo-przechylne' spełniające wszystkie poniższe kryteria:

1. zaprojektowane do obrabiarek do toczenia, frezowania lub szlifowania; oraz

2. dwie osie obrotowe zaprojektowane tak, by można było je jednocześnie koordynować w celu "sterowania kształtowego";

Uwaga techniczna:

'Stół obrotowo-przechylny' oznacza stół umożliwiający obracanie i przechylanie obrabianego przedmiotu względem dwóch osi nierównoległych.

d. "wrzeciona wahliwe" spełniające wszystkie poniższe kryteria:

1. zaprojektowane do obrabiarek do toczenia, frezowania lub szlifowania; oraz

2. zaprojektowane tak, by można było je jednocześnie koordynować w celu "sterowania kształtowego";

2B009 Maszyny do wyoblania i tłoczenia kształtowego, które według danych technicznych producenta mogą być wyposażone w zespoły "sterowania numerycznego" lub komputerowego oraz spełniające oba poniższe kryteria:

N.B. ZOB. TAKŻE POZYCJE 2B109 I 2B209.

a. trzy lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego"; oraz

b. nacisk wałka większy niż 60 kN.

Uwaga techniczna:

Do celów pozycji 2B009 maszyny łączące funkcje wyoblania i tłoczenia kształtowego są traktowane jako urządzenia do tłoczenia kształtowego.

2B104 "Prasy izostatyczne", inne niż wyszczególnione w pozycji 2B004, spełniające wszystkie poniższe kryteria:

N.B. ZOB. TAKŻE POZYCJA 2B204.

a. maksymalne ciśnienie robocze 69 MPa lub większe;

b. skonstruowane dla osiągnięcia i utrzymania środowiska o regulowanych parametrach termicznych rzędu 873 K (600 °C) lub większych; oraz

c. posiadające komorę o średnicy wewnętrznej 254 mm lub większej.

2B105 Piece do CVD (chemical vapour deposition - chemicznego osadzania warstw z faz gazowych), inne niż wyszczególnione w pozycji 2B005.a, zaprojektowane lub zmodyfikowane dla zagęszczania kompozytów węglowo-węglowych.

2B109 Maszyny do tłoczenia kształtowego, inne niż wyszczególnione w pozycji 2B009, nadające się do "produkcji" części składowych systemów napędowych i sprzętu napędowego (np. osłon silników i elementów międzystopniowych) do "pocisków rakietowych", oraz specjalnie zaprojektowane komponenty, takie jak:

N.B. ZOB. TAKŻE POZYCJA 2B209.

a. maszyny do tłoczenia kształtowego spełniające wszystkie poniższe kryteria:

1. wyposażone lub według specyfikacji technicznej producenta mogące być wyposażone w zespoły "sterowania numerycznego" lub komputerowego; oraz

2. posiadające więcej niż dwie osie, które można jednocześnie koordynować w celu "sterowania kształtowego";

b. specjalnie zaprojektowane części składowe do maszyn tłoczenia kształtowego, wyszczególnionych w pozycjach 2B009 i 2B109.a.

Uwaga techniczna:

Maszyny łączące funkcje wyoblania i tłoczenia kształtowego są na potrzeby pozycji 2B109 traktowane jako urządzenia do tłoczenia kształtowego.

2B116 Następujące systemy do badań wibracyjnych, sprzęt i części składowe z nimi związane:

a. systemy do badań wibracyjnych, wykorzystujące techniki sprzężenia zwrotnego lub pętli zamkniętej, zawierające sterowniki cyfrowe, przystosowane do przyspieszenia o wartości równej lub większej niż 10 g rms między 20 Hz a 2 kHz i przekazujące jednocześnie siły równe lub większe niż 50 kN, mierzone na 'nagim stole';

b. sterowniki cyfrowe współpracujące ze specjalnie opracowanym oprogramowaniem do badań wibracyjnych, cechujące się 'pasmem sterowania w czasie rzeczywistym' powyżej 5 kHz, zaprojektowane do użytku w systemach do badań wibracyjnych, wyszczególnionych w pozycji 2B116.a;

Uwaga techniczna:

W pozycji 2B116.b 'pasmo sterowania w czasie rzeczywistym' oznacza maksymalną szybkość, z jaką sterownik może wykonać całkowite cykle próbkowania, przetwarzania danych i przesyłania sygnałów sterowniczych.

c. mechanizmy do wymuszania wibracji (wstrząsarki) wyposażone lub nie wyposażone w odpowiednie wzmacniacze, zdolne do przekazywania sił 50 kN lub większych, mierzonych na 'nagim stole', używane w systemach do badań wibracyjnych wyszczególnionych w pozycji 2B116.a;

d. konstrukcje podtrzymujące próbki do badań oraz urządzenia elektroniczne, zaprojektowane do łączenia wielu wstrząsarek w system umożliwiający uzyskanie łącznej siły skutecznej 50 kN lub większej, mierzonej na 'nagim stole', używane w systemach do badań wibracyjnych wyszczególnionych w pozycji 2B116.a.

Uwaga techniczna:

W pozycji 2B116 pojęcie 'nagi stół' oznacza płaski stół lub powierzchnię, bez osprzętu i wyposażenia.

2B117 Środki do sterowania sprzętem i przebiegiem procesów, inne niż wyszczególnione w pozycjach 2B004, 2B005.a, 2B104 lub 2B105, zaprojektowane lub zmodyfikowane dla zagęszczania i pirolizy kompozytów strukturalnych do dysz rakietowych oraz głowic powracających do atmosfery.

2B119 Następujące maszyny do wyważania i powiązany z nimi sprzęt:

N.B. ZOB. TAKŻE POZYCJA 2B219.

a. maszyny do wyważania, posiadające wszystkie wymienione niżej cechy:

1. nienadające się do wyważania wirników/zespołów o masie większej niż 3 kg;

2. nadające się do wyważania wirników/zespołów przy prędkościach obrotowych większych niż 12 500 obr./min.;

3. nadające się do korekcji niewyważenia w dwu lub więcej płaszczyznach; oraz

4. nadające się do wyważania resztkowego niewyważenia właściwego wynoszącego 0,2 g mm/kg masy wirnika;

Uwaga: Pozycja 2B119.a nie obejmuje kontrolą wyważarek zaprojektowanych lub zmodyfikowanych dla urządzeń dentystycznych i innego sprzętu medycznego.

b. głowice wskaźników zaprojektowane lub zmodyfikowane do wykorzystania w maszynach wyszczególnionych w pozycji 2B119.a.

Uwaga techniczna:

Głowice wskaźników określane są czasami jako oprzyrządowanie wyważające.

2B120 Symulatory ruchu lub stoły obrotowe spełniające wszystkie poniższe kryteria:

a. dwie osie lub więcej;

b. zaprojektowane lub zmodyfikowane tak, by zawierać pierścienie ślizgowe lub zintegrowane urządzenia bezstykowe zdolne do przekazywania zasilania elektrycznego lub sygnałów sterowniczych; oraz

c. spełniające którekolwiek z poniższych kryteriów:

1. spełniające wszystkie poniższe kryteria dla jakiejkolwiek pojedynczej osi:

a. zdolność do osiągania prędkości obrotowej równej 400 o/s lub większej lub 30 o/s lub mniejszej; oraz

b. rozdzielczość tempa obracania równa 6 o/s lub mniejsza z dokładnością równą 0,6 o/s lub mniejszą;

2. posiadające stabilność dla najgorszego przypadku równą ± 0,05 % lub lepszą, uśrednioną w zakresie 10 o lub większym; lub

3. mające "dokładność" pozycjonowania równą 5 sekund kątowych lub mniej (lepszą).

Uwaga 1: Pozycja 2B120 nie obejmuje kontrolą stołów obrotowych zaprojektowanych lub zmodyfikowanych dla obrabiarek lub sprzętu medycznego. Dla uregulowań dotyczących obrabiarkowych stołów obrotowych zob. pozycja 2B008.

Uwaga 2: Symulatory ruchu lub stoły obrotowe wyszczególnione w pozycji 2B120 są objęte kontrolą niezależnie od tego, czy w momencie wywozu miały już zamontowane pierścienie ślizgowe lub zintegrowane urządzenia bezstykowe.

2B121 Stoły pozycjonujące (sprzęt zdolny do precyzyjnego ustawiania położenia kątowego w dowolnej osi), inne niż wyszczególnione w pozycji 2B120, posiadające wszystkie następujące cechy:

a. dwie osie lub więcej; oraz

b. mające "dokładność" pozycjonowania równą 5 sekund kątowych lub mniej (lepszą).

Uwaga: Pozycja 2B121 nie obejmuje kontrolą stołów obrotowych zaprojektowanych lub zmodyfikowanych dla obrabiarek lub sprzętu medycznego. Dla uregulowań dotyczących obrabiarkowych stołów obrotowych zob. pozycja 2B008.

2B122 Wirówki umożliwiające nadanie przyśpieszenia ponad 100 g i posiadające pierścienie ślizgowe lub zintegrowane urządzenia bezstykowe zaprojektowane lub zmodyfikowane tak, aby były zdolne do przekazywania zasilania elektrycznego lub sygnałów sterowniczych.

Uwaga: Wirówki wyszczególnione w pozycji 2B122 są objęte kontrolą niezależnie od tego, czy w momencie wywozu miały już zamontowane pierścienie ślizgowe lub zintegrowane urządzenia bezstykowe.

2B201 Obrabiarki i wszelkie ich zestawy poza wyszczególnionymi poniżej w pozycji 2B001, do skrawania lub cięcia metali, materiałów ceramicznych lub "kompozytowych", które stosownie do specyfikacji technicznej producenta mogą być wyposażone w urządzenia elektroniczne do jednoczesnego "sterowania kształtowego" w dwóch lub więcej osiach:

Uwaga techniczna:

Zamiast indywidualnych testów dla każdego modelu obrabiarki można stosować poziomy gwarantowanej dokładności pozycjonowania, ustalone zgodnie z poniższymi procedurami przy pomiarach wykonanych stosownie do normy ISO 230-2:1988 10  lub jej odpowiednika krajowego pod warunkiem dostarczenia ich organom krajowym i zaakceptowania ich przez nie. Określanie poziomu gwarantowanej dokładności pozycjonowania:

a. wybrać pięć egzemplarzy modelu maszyny, który ma być oceniany;

b. zmierzyć liniowe dokładności osi zgodnie z ISO 230-2:1988 11 ;

c. określić wartości dokładności (A) dla każdej osi każdej maszyny. Metodę obliczania wartości dokładności opisano w normie ISO 230-2:1988 12 ;

d. określić średnią wartość dokładności dla każdej osi. Średnia wartość staje się gwarantowaną dokładnością pozycjonowania dla każdej osi modelu (Âx, Ây,...);

e. ponieważ pozycja 2B201 odnosi się do każdej osi liniowej, wartości gwarantowanej dokładności pozycjonowania będzie tyle, ile jest osi liniowych;

f jeśli dowolna oś obrabiarki niewyszczególnionej w pozycjach 2B201.a., 2B201.b. lub 2B201.c. ma gwarantowaną dokładność pozycjonowania wynoszącą 6 μ m lub lepiej (mniej) w przypadku szlifierek oraz 8 μ m lub lepiej (mniej) w przypadku frezarek i tokarek, zawsze zgodnie z normą ISO 230-2:1988 13 , od wytwórcy należy wymagać ponownego potwierdzania poziomu dokładności co osiemnaście miesięcy.

a. frezarki posiadające którąkolwiek z wymienionych poniżej cech:

1. dokładność pozycjonowania, z uwzględnieniem "wszystkich dostępnych kompensacji", równa 6 μm lub mniej (lepsza), zgodnie z ISO 230-2:1988 (1) lub równoważną normą krajową, wzdłuż dowolnej osi liniowej;

2. dwie lub więcej konturowych osi obrotu; lub

3. pięć lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego";

Uwaga: Pozycja 2B201.a nie obejmuje kontrolą frezarek posiadających następujące cechy:

a. robocza długość osi x większa niż 2 m; oraz

b. ogólna dokładność pozycjonowania wzdłuż osi x większa (gorsza) niż 30 μ m;

b. szlifierki posiadające którąkolwiek z wymienionych poniżej cech:

1. dokładność pozycjonowania, z uwzględnieniem "wszystkich dostępnych kompensacji", równa 4 μm lub mniej (lepsza), zgodnie z ISO 230-2:1988 14  lub równoważną normą krajową, wzdłuż dowolnej osi liniowej;

2. dwie lub więcej konturowych osi obrotu; lub

3. pięć lub więcej osi, które można jednocześnie koordynować w celu "sterowania kształtowego";

Uwaga: Pozycja 2B201.b nie obejmuje kontrolą następujących szlifierek:

a. szlifierek do zewnętrznego, wewnętrznego i zewnętrzno-wewnętrznego szlifowania na okrągło, posiadających wszystkie niżej wymienione cechy:

1. ograniczenie do maksymalnych wymiarów przedmiotu obrabianego do 150 mm średnicy zewnętrznej lub długości; oraz

2. osie ograniczone do x, z i c;

b. szlifierek współrzędnościowych nieposiadających osi z lub osi w przy ogólnej dokładności pozycjonowania mniejszej (lepszej) niż 4 μ m zgodnie z ISO 230-2:1988 15  lub równoważną normą krajową.

c. tokarek, które mają dokładności pozycjonowania z uwzględnieniem "wszystkich dostępnych kompensacji" lepsze (mniejsze) niż 6 μm, zgodnie z normą 230-2:1988 16 , wzdłuż dowolnej osi liniowej (ogólna dokładność pozycjonowania), dla maszyn zdolnych do obrabiania średnic powyżej 35 mm;

Uwaga: Pozycja 2B201.c. nie obejmuje kontrolą tokarek (Swissturn), ograniczonych do obrabiania tylko prętów podawanych, jeśli maksymalna średnica pręta jest równa lub mniejsza niż 42 mm i nie ma możliwości mocowania uchwytami. Maszyny mogą mieć możliwość wiercenia lub frezowania części o średnicy mniejszej niż 42 mm.

Uwaga 1: Pozycja 2B201 nie obejmuje kontrolą obrabiarek do specjalnych zastosowań ograniczonych do wytwarzania dowolnych z następujących części:

a. kół zębatych;

b. wałów korbowych lub rozrządowych;

c. narzędzi lub noży do obrabiarek;

d. ślimaków do wytłaczarek;

Uwaga 2: Obrabiarki posiadające co najmniej dwie z trzech następujących zdolności: toczenia, frezowania lub szlifowania (np. tokarka ze zdolnością do frezowania), muszą być oszacowane stosownie odpowiednio do każdej pozycji 2B201.a, b lub .c.

Uwaga 3: Pozycje 2B201.a.3. i 2B201.b.3. obejmują obrabiarki oparte o kinematykę równoległo-liniową (np. typu hexapod) posiadające 5 lub więcej osi, z których żadna nie jest osią obrotu.

2B204 "Prasy izostatyczne", inne niż wyszczególnione w pozycjach 2B004 lub 2B104 i sprzęt z nimi związany, w tym:

a. "prasy izostatyczne" posiadające obydwie niżej wymienione cechy:

1. zdolność do osiągnięcia maksymalnego ciśnienia roboczego równego 69 MPa lub większego; oraz

2. wnękę komorową o średnicy wewnętrznej przekraczającej 152 mm;

b. matryce, formy i zespoły sterujące specjalnie zaprojektowane do "pras izostatycznych" wyszczególnionych w pozycji 2B204.a.

Uwaga techniczna:

W pozycji 2B204 wewnętrzny wymiar komory oznacza wymiar, w którym osiąga się zarówno temperaturę roboczą, jak i ciśnienie robocze, a termin ten nie obejmuje osprzętu. Wymiar ten będzie mniejszą ze średnic wewnętrznych komory ciśnieniowej lub izolowanej komory paleniskowej, w zależności od tego, która z tych komór jest umieszczona wewnątrz drugiej.

2B206 Następujące maszyny, przyrządy oraz systemy do kontroli wymiarów, inne niż wyszczególnione w pozycji 2B006:

a. sterowane komputerowo lub "sterowane numerycznie" urządzenia do pomiaru współrzędnych spełniające jedno z poniższych kryteriów:

1. mające tylko dwie osie i dające maksymalny dopuszczalny błąd pomiaru długości wzdłuż jakiejkolwiek osi (w układzie jednowymiarowym), oznaczony jako kombinacja E0xMPE, E0yMPE lub E0zMPE, równy lub mniejszy (lepszy) niż (1,25 + L/1 000) μm (gdzie L jest długością mierzoną w mm) w dowolnym punkcie zakresu roboczego maszyny (tj. na całej długości osi), zgodnie z ISO 10360-2(2009); lub

2. mające trzy lub więcej osi i dające maksymalny dopuszczalny błąd pomiaru długości (E0 MPE) wzdłuż trzech osi (tj. objętościowy) równy lub mniejszy (lepszy) niż (1,7 + L/800) μm (gdzie L jest długością mierzoną w mm) w dowolnym punkcie zakresu roboczego maszyny (tj. na całej długości osi), zgodnie z ISO 10360-2(2009);

Uwaga techniczna:

Maksymalny dopuszczalny błąd pomiaru długości (E0,MPE) najdokładniejszej konfiguracji urządzenia do pomiaru współrzędnych zgodnie z ISO 10360-2:2009 określonej przez producenta (np. najlepsze: czujnik, długość ramienia, parametry ruchu, warunki środowiskowe) przy "wszystkich dostępnych kompensacjach" porównuje się do progu 1,7 + L/800 μm.

b. systemy do jednoczesnej liniowo-kątowej kontroli półpowłok, posiadające obie z niżej wymienionych cech:

1. "niepewność pomiarową", wzdłuż dowolnej osi liniowej, równą lub mniejszą (lepszą) niż 3,5 μm na 5 mm; oraz

2. "odchylenie położenia kątowego" równe lub mniejsze niż 0,02o;

c. systemy pomiarowe 'odchylenia liniowego', posiadające wszystkie niżej wymienione cechy:

Uwaga techniczna:

Do celów pozycji 2B206.c. 'odchylenie liniowe' oznacza zmianę odległości pomiędzy czujnikiem a obiektem mierzonym.

1. zawierające "laser"; oraz

2. zdolne, by utrzymać, przez co najmniej 12 godzin, przy temperaturze ± 1 K (± 1 °C), w warunkach znormalizowanej temperatury i znormalizowanego ciśnienia, wszystkich z poniższych parametrów:

a. "rozdzielczość" w pełnym zakresie wynoszącą 0,1 μm lub lepszą; oraz

b. "niepewność pomiaru" równą lub lepszą (mniejszą) niż (0,2 + L/2 000) μm (L oznacza zmierzoną długość w mm).

Uwaga: Pozycja 2B206.c. nie obejmuje kontrolą interferometrycznych systemów pomiarowych nieposiadających zamkniętej lub otwartej pętli sprzężenia zwrotnego, zawierających "laser" do pomiaru błędów ruchu posuwistego obrabiarek, urządzeń kontroli wymiarów lub podobnego wyposażenia.

d. systemy transformatorowych różnicowych czujników położenia liniowego (LVDT) posiadające obie z niżej wymienionych cech:

Uwaga techniczna:

Do celów pozycji 2B206.d. 'odchylenie liniowe' oznacza zmianę odległości pomiędzy czujnikiem a obiektem mierzonym.

1. spełniające którekolwiek z poniższych kryteriów:

a. mające "liniowość" równą lub mniejszą (lepszą) niż 0,1 %, mierzoną od 0 do 'pełnego zakresu roboczego' dla LVDT o zakresie roboczym do 5 mm; lub

b. mające "liniowość" równą lub mniejszą (lepszą) niż 0,1 %, mierzoną od 0 do 5 mm dla LVDT o pełnym zakresie roboczym większym niż 5 mm; oraz

2. dryft równy lub lepszy (mniejszy) niż 0,1 % na dzień w standardowej temperaturze pomieszczenia pomiarowego ± 1 K (± 1°C).

Uwaga 1: Obrabiarki, które można wykorzystać do celów pomiarowych, są objęte kontrolą, jeżeli spełniają lub przekraczają kryteria określone dla funkcji obrabiarki lub maszyny pomiarowej.

Uwaga 2: Maszyna wyszczególniona w pozycji 2B206 jest objęta kontrolą, jeżeli jej zakres pracy przekracza w jakikolwiek sposób próg objęcia kontrolą.

Uwagi techniczne:

Wszystkie parametry wartości pomiarowych w pozycji 2B206 reprezentują wartości plus/minus, tj. pasmo niepełne.

2B207 "Roboty", "manipulatory" i jednostki sterujące, inne niż wyszczególnione w pozycji 2B007, takie jak:

a. "roboty" lub "manipulatory" specjalnie zaprojektowane tak, aby spełniały krajowe normy bezpieczeństwa stosowane przy obchodzeniu się z kruszącymi materiałami wybuchowymi (np. spełniające warunki ujęte w przepisach elektrycznych, stosowanych wobec kruszących materiałów wybuchowych);

b. jednostki sterujące, specjalnie zaprojektowane do "robotów" i "manipulatorów" wyszczególnionych w pozycji 2B207.a.

2B209 Następujące maszyny do tłoczenia kształtowego, maszyny do wyoblania kształtowego posiadające możliwość realizacji funkcji tłoczenia kształtowego, inne niż wyszczególnione w pozycjach 2B009 lub 2B109, oraz trzpienie:

a. maszyny spełniające oba poniższe kryteria:

1. mające trzy lub więcej wałki (aktywne lub prowadzące); oraz

2. mogące być wyposażone, według specyfikacji technicznej producenta, w zespoły "sterowania nume-rycznego" lub komputerowego;

b. trzpienie do formowania wirników zaprojektowane do formowania wirników cylindrycznych o średnicy wewnętrznej pomiędzy 75 mm a 400 mm.

Uwaga: Pozycja 2B209.a obejmuje maszyny posiadające tylko pojedynczy wałek przeznaczony do odkształcania metalu oraz dwa pomocnicze wałki podtrzymujące trzpień, ale nieuczestniczące bezpośrednio w procesie odkształcania.

2B219 Następujące odśrodkowe maszyny do wielopłaszczyznowego wyważania, stałe lub przenośne, poziome lub pionowe:

a. wyważarki odśrodkowe zaprojektowane do wyważania elastycznych wirników o długości 600 mm lub większej, posiadające wszystkie niżej wymienione cechy:

1. wychylenie lub średnica czopa powyżej 75 mm;

2. zdolność do wyważania zespołów o masie od 0,9 do 23 kg; oraz

3. zdolność do osiągania prędkości obrotowych w czasie wyważania powyżej 5 000 obr./min.;

b. wyważarki odśrodkowe zaprojektowane do wyważania cylindrycznych zespołów wirnika, posiadające wszystkie niżej wymienione cechy:

1. średnica czopa powyżej 75 mm;

2. zdolność do wyważania zespołów o masie od 0,9 do 23 kg;

3. zdolność do osiągania minimalnego resztkowego niewyważenia właściwego rzędu 10 g mm/kg dla jednej płaszczyzny lub mniejszym; oraz

4. napęd pasowy.

2B225 Zdalnie sterowane manipulatory, które mogą być stosowane do zdalnego wykonywania prac podczas rozdzielania radiochemicznego oraz w komorach gorących, posiadające wszystkie niżej wymienione cechy:

a. możliwość pokonania ściany komory gorącej o grubości 0,6 m lub większej (dla operacji wykonywanych poprzez ścianę); lub

b. możliwość zmostkowania ponad szczytem ściany komory gorącej o grubości 0,6 m lub większej (dla operacji wykonywanych ponad ścianą).

Uwaga techniczna:

Zdalnie sterowane manipulatory przekształcają działanie człowieka operatora na ramię robocze i uchwyt końcowy. Mogą być typu 'master/slave' lub być sterowane joystickiem lub z klawiatury.

2B226 Piece indukcyjne z regulowaną atmosferą (próżniowe lub z gazem obojętnym), inne niż te wymienione w pozycjach 9B001 i 3B001, i instalacje do ich zasilania, takie jak:

N.B. ZOB. TAKŻE POZYCJE 3B001 I 9B001.

a. piece posiadające wszystkie niżej wymienione cechy:

1. zdolność do pracy w temperaturach powyżej 1 123 K (850 °C);

2. wyposażone w cewki indukcyjne o średnicy 600 mm lub mniejszej; oraz

3. zaprojektowane do poboru mocy wynoszącego 5 kW lub więcej;

Uwaga: Pozycja 2B226.a nie obejmuje kontrolą pieców przeznaczonych do przetwarzania płytek półprzewodnikowych.

b. instalacje zasilające, o wydajności znamionowej 5 kW lub większej, specjalnie zaprojektowane do pieców wyszczególnionych w pozycji 2B226.a.

2B227 Próżniowe oraz posiadające inną regulowaną atmosferę, roztapiające i odlewnicze piece metalurgiczne oraz sprzęt z nimi związany, w tym:

a. piece łukowe do przetapiania, piece łukowe do topienia i piece łukowe do topienia i odlewania posiadające obydwie niżej wymienione cechy:

1. wydajność elektrody topliwej pomiędzy 1 000 cm3 a 20 000 cm3; oraz

2. zdolne do pracy w temperaturach topienia powyżej 1 973 K (1 700°C);

b. piece do topienia wiązką elektronów, plazmowe piece do atomizacji i plazmowe piece do topienia posiadające obie niżej wymienione cechy:

1. moc 50 kW lub większa; oraz

2. zdolne do pracy w temperaturach topienia powyżej 1 473 K (1 200°C);

c. komputerowe systemy do sterowania i śledzenia przebiegu procesów, specjalnie skonfigurowane do jakichkolwiek pieców wyszczególnionych w pozycji 2B227.a lub 2B227.b;

d. pochodnie plazmowe, specjalnie zaprojektowane do pieców wymienionych w pozycji 2B227.b, posiadające obydwie niżej wymienione cechy:

1. praca przy zasilaniu mocą większą niż 50 kW; oraz

2. zdolne do pracy w temperaturach powyżej 1 473 K (1 200°C);

e. działa elektronowe, specjalnie zaprojektowane do pieców wymienionych w pozycji 2B227.b, pracujące przy zasilaniu mocą większą niż 50 kW.

2B228 Sprzęt do wytwarzania, montażu oraz prostowania wirników, trzpienie i matryce do formowania mieszków, w tym:

a. sprzęt do montażu wirników, przeznaczony do montażu sekcji rurowych wirników odśrodkowych wirówek gazowych, przegród oraz pokryw;

Uwaga: Pozycja 2B228.a obejmuje precyzyjne trzpienie, zaciski i maszyny do pasowania skurczowego.

b. sprzęt do prostowania wirników, przeznaczony do osiowania sekcji rurowych wirników odśrodkowych wirówek gazowych na wspólnej osi;

Uwaga techniczna:

W pozycji 2B228.b taki sprzęt składa się zazwyczaj z dokładnych czujników pomiarowych, podłączonych do komputera, sterującego następnie pracą np. pneumatycznego bijaka wykorzystywanego do ustawiania sekcji rurowych wirnika.

c. trzpienie i matryce do formowania mieszków, służące do wytwarzania mieszków jednozwojowych.

Uwaga techniczna:

Mieszki, o których mowa w pozycji 2B228.c, posiadają wszystkie niżej wymienione cechy:

1. średnica wewnętrzna pomiędzy 75 mm a 400 mm;

2. długość równa lub większa niż 12,7 mm;

3. głębokość pojedynczego zwoju większa niż 2 mm; oraz

4. wykonane z wysokowytrzymałych stopów glinu, stali maraging lub wysokowytrzymałych "materiałów włóknistych lub włókienkowych".

2B230 Wszystkie rodzaje 'przetworników ciśnienia' zdolne do pomiaru ciśnienia bezwzględnego, posiadające wszystkie niżej wymienione cechy

a. wyposażone w czujniki ciśnień wykonane z glinu, stopów glinu, tlenku glinu (aluminy lub szafiru), niklu, stopów niklu o zawartości wagowej niklu ponad 60 % lub polimerów fluorowęglowodorowych lub też zabezpieczone tymi materiałami;

b. wyposażone ewentualnie w uszczelnienia, istotne dla uszczelniania czujników ciśnień i stykające się bezpośrednio z przetwarzanym medium, wykonane z glinu, stopów glinu, tlenku glinu (aluminy lub szafiru), niklu, stopów niklu o zawartości wagowej niklu ponad 60 % lub polimerów fluorowęglowodorowych lub też zabezpieczone tymi materiałami; oraz

c. spełniające którekolwiek z poniższych kryteriów:

1. pełny zakres pomiarowy poniżej 13 kPa oraz 'dokładność' lepsza niż 1 % (w całym zakresie); lub

2. pełny zakres pomiarowy wynoszący 13 kPa lub więcej oraz 'dokładność' lepsza niż 130 Pa przy pomiarze na poziomie 13 kPa.

Uwagi techniczne:

1. W pozycji 2B230 'przetwornik ciśnienia' oznacza urządzenie, które przekształca pomiar ciśnienia na sygnał.

2. Na potrzeby pozycji 2B230 pojęcie 'dokładność' obejmuje nieliniowość, histerezę i powtarzalność w temperaturze otoczenia.

2B231 Pompy próżniowe posiadające wszystkie niżej wymienione cechy:

a. gardziel wlotową o średnicy równej lub większej niż 380 mm;

b. wydajność pompowania równą lub większą niż 15 m3/s; oraz

c. są zdolne do wytwarzania próżni końcowej o ciśnieniu lepszym niż 13 mPa.

Uwagi techniczne:

1. Wydajność pompowania jest określona w pomiarze z użyciem azotu lub powietrza.

2. Próżnia końcowa jest określana na wlocie do pompy po jego zatkaniu.

2B232 Wysokoprędkościowe systemy miotające (napędowe, gazowe, cewkowe, elektromagnetyczne, elektrotermiczne lub inne rozwinięte systemy) zdolne do przyspieszania pocisków do prędkości 1,5 km/s lub większej.

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

2B233 Sprężarki śrubowe o uszczelnieniu mieszkowym oraz śrubowe pompy próżniowe o uszczelnieniu mieszkowym, spełniające wszystkie poniższe kryteria:

N.B. ZOB. TAKŻE POZYCJA 2B350.i.

a. objętościowy współczynnik przepływu na wlocie wynoszący 50 m3/h lub więcej;

b. stopień sprężania 2:1 lub wyższy; oraz

c. wszystkie ich powierzchnie mające bezpośredni kontakt z medium gazowym są wykonane z jednego z następujących materiałów:

1. glin lub stop glinu;

2. tlenek glinu;

3. stal nierdzewna;

4. nikiel lub stop niklu;

5. brąz fosforowy; lub

6. polimery fluorowe.

2B350 Następujące obiekty, sprzęt i części składowe do produkcji substancji chemicznych:

a. zbiorniki reakcyjne lub reaktory, wyposażone lub niewyposażone w mieszadła, o całkowitej pojemności wewnętrznej (geometrycznej) powyżej 0,1 m3 (100 litrów) i poniżej 20 m3 (20 000 litrów), w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

N.B. W odniesieniu do prefabrykowanych zestawów do naprawy - zob. pozycja 2B350.k.

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

5. tantalu lub 'stopów' tantalu;

6. tytanu lub 'stopów' tytanu;

7. cyrkonu lub 'stopów' cyrkonu; lub

8. niobu lub 'stopów' niobu;

b. mieszadła do zbiorników reakcyjnych lub reaktorów, wyszczególnionych w pozycji 2B350.a oraz wirniki napędzane, łopatki lub wały do takich mieszadeł, w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

5. tantalu lub 'stopów' tantalu;

6. tytanu lub 'stopów' tytanu;

7. cyrkonu lub 'stopów' cyrkonu; lub

8. niobu lub 'stopów' niobu;

c. zbiorniki magazynowe, zasobniki lub odbiorniki o całkowitej pojemności wewnętrznej (geometrycznej) powyżej 0,1 m3 (100 litrów), w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

N.B. W odniesieniu do prefabrykowanych zestawów do naprawy - zob. pozycja 2B350.k.

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

5. tantalu lub 'stopów' tantalu;

6. tytanu lub 'stopów' tytanu;

7. cyrkonu lub 'stopów' cyrkonu; lub

8. niobu lub 'stopów' niobu;

d. wymienniki ciepła lub skraplacze o polu powierzchni wymiany ciepła powyżej 0,15 m2 oraz poniżej 20 m2 oraz rury, płytki, zwoje lub bloki (rdzenie) skonstruowane do takich wymienników ciepła lub skraplaczy, w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi), są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. grafitu lub 'grafitu węglowego';

5. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

6. tantalu lub 'stopów' tantalu;

7. tytanu lub 'stopów' tytanu;

8. cyrkonu lub 'stopów' cyrkonu;

9. węglika krzemu;

10. węglika tytanu; lub

11. niobu lub 'stopów' niobu;

e. kolumny destylacyjne lub absorpcyjne o średnicy wewnętrznej powyżej 0,1 m oraz rozdzielacze cieczy i par, kolektory cieczy, zaprojektowane do takich kolumn destylacyjnych lub absorpcyjnych, w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. grafitu lub 'grafitu węglowego';

5. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

6. tantalu lub 'stopów' tantalu;

7. tytanu lub 'stopów' tytanu;

8. cyrkonu lub 'stopów' cyrkonu; lub

9. niobu lub 'stopów' niobu;

f. zdalnie sterowany sprzęt napełniający, w którym wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu; lub

2. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

g. zawory i ich części, takie jak:

1. zawory spełniające oba poniższe kryteria:

a. o 'rozmiarze znamionowym' większym niż 10 mm (3/8"); oraz

b. których wszystkie powierzchnie mające bezpośredni kontakt z wytwarzaną, przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z 'materiałów odpornych na korozję';

2. zawory, inne niż wyszczególnione w pozycji 2B350.g.1, spełniające wszystkie poniższe kryteria:

a. o 'rozmiarze znamionowym' równym lub większym niż 25,4 mm (1") oraz równym lub mniejszym niż 101,6 mm (4");

b. mające obudowę (korpus zaworu) lub preformowane wkładki doosłonowe;

c. mające część zamykającą, która może być wymieniana; oraz

d. których wszystkie powierzchnie obudowy (korpusu zaworu) lub preformowanych wkładek doosłonowych mające bezpośredni kontakt z wytwarzaną, przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z 'materiałów odpornych na korozję';

3. następujące części do zaworów wyszczególnionych w pozycjach 2B350.g.1 lub 2B350.g.2, których wszystkie powierzchnie mające bezpośredni kontakt z wytwarzaną, przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z 'materiałów odpornych na korozję':

a. obudowy (korpusy zaworów);

b. preformowane wkładki doosłonowe;

Uwagi techniczne:

1. Dla celów pozycji 2B350.g 'materiały odporne na korozję' oznaczają jeden z poniższych materiałów:

a. nikiel lub stopy o zawartości wagowej niklu powyżej 40 %;

b. stopy o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

c. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

d. szkło lub okładziny szklane (w tym materiały powlekane szkliwami lub emaliowane);

e. tantal lub stopy tantalu;

f. tytan lub stopy tytanu;

g. cyrkon lub 'stopy cyrkonu; h. niob lub 'stopy niobu; lub

i. następujące materiały ceramiczne:

1. węglik krzemu o czystości wagowej co najmniej 80 %;

2. tlenek glinu o czystości wagowej co najmniej 99,9 %;

3. tlenek cyrkonu (cyrkonia).

2. 'Rozmiar znamionowy oznacza mniejszą ze średnic: wlotu lub wylotu.

h. rury wielościenne, zawierające okna do wykrywania nieszczelności, w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi) są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

3. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

4. grafitu lub 'grafitu węglowego';

5. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

6. tantalu lub 'stopów' tantalu;

7. tytanu lub 'stopów' tytanu;

8. cyrkonu lub 'stopów' cyrkonu; lub

9. niobu lub 'stopów' niobu;

i. pompy wielokrotnie uszczelnione i nieuszczelnione, o maksymalnym natężeniu przepływu, według specyfikacji producenta, powyżej 0,6 m3/h lub pompy próżniowe o maksymalnym natężeniu przepływu, według specyfikacji producenta, powyżej 5 m3/h (w warunkach znormalizowanej temperatury (273 K (0 °C)) oraz ciśnienia (101,3 kPa)), inne niż wyszczególnione w pozycji 2B233, oraz obudowy (korpusy pomp), preformowane wkładki pomp, wirniki, tłoki lub dysze do pomp strumieniowych skonstruowane do takich pomp, w których wszystkie powierzchnie mające bezpośredni kontakt z przetwarzaną lub znajdującą się w nich substancją chemiczną (substancjami chemicznymi), są wykonane z jednego z następujących materiałów:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. materiałów ceramicznych;

3. żelazokrzemu (stopów żelaza o wysokiej zawartości krzemu);

4. polimerów fluorowych (materiałów polimerowych lub elastomerowych o zawartości wagowej fluoru powyżej 35 %);

5. szkła (w tym materiałów powlekanych szkliwami lub emaliowanych lub wykładanych szkłem);

6. grafitu lub 'grafitu węglowego';

7. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

8. tantalu lub 'stopów' tantalu;

9. tytanu lub 'stopów' tytanu;

10. cyrkonu lub 'stopów' cyrkonu; lub

11. niobu lub 'stopów' niobu;

Uwaga techniczna:

W pozycji 2B350.i. termin uszczelnienie odnosi się tylko do uszczelnień, które mają bezpośredni kontakt z przetwarzaną substancją chemiczną (substancjami chemicznymi) (lub są do tego zaprojektowane) oraz pełnią funkcję uszczelniacza podczas przesuwu wału napędowego obrotowego lub posuwistozwrotnego przez korpus pompy.

j. piece do unieszkodliwiania termicznego, zaprojektowane do niszczenia chemikaliów wyszczególnionych w pozycji 1C350, posiadające specjalnie zaprojektowane systemy doprowadzania odpadów, specjalne urządzenia obsługujące oraz przeciętną temperaturę w komorze spalania powyżej 1 273 K (1 000 °C), w których wszystkie powierzchnie w systemie doprowadzania odpadów mające bezpośredni kontakt z odpadami są wykonane z jednego z następujących materiałów lub nim pokryte:

1. 'stopów' o zawartości wagowej powyżej 25 % niklu i 20 % chromu;

2. materiałów ceramicznych; lub

3. niklu lub 'stopów' o zawartości wagowej niklu powyżej 40 %;

k. Następujące prefabrykowane zestawy do naprawy posiadające powierzchnie metaliczne mające bezpośredni kontakt z przetwarzaną substancją chemiczną (przetwarzanymi substancjami chemicznymi), wykonane z tantalu lub stopów tantalu, oraz specjalnie do nich zaprojektowane elementy:

1. zaprojektowane do mechanicznego przyłączenia do wykładanych szkłem zbiorników reakcyjnych lub reaktorów wyszczególnionych w pozycji 2B350.a.; lub

2. zaprojektowane do mechanicznego przyłączenia do wykładanych szkłem zbiorników magazynowych, zasobników lub odbiorników wyszczególnionych w pozycji 2B350.c.;

Uwaga: Dla celów pozycji 2B350 materiały używane na uszczelki, wypełnienia, uszczelnienia, śruby, podkładki i inne materiały pełniące funkcję uszczelniającą nie decydują o statusie kontroli, pod warunkiem że części te są wymienialne.

Uwagi techniczne:

1. 'Grafit węglowy' jest substancją składającą się z węgla amorficznego i grafitu, w której zawartość wagowa grafitu wynosi 8 % lub więcej.

2. W przypadku materiałów wymienionych w powyższych pozycjach termin 'stop', jeżeli nie towarzyszy mu szczegółowe określenie stężenia pierwiastków, należy rozumieć jako oznaczający taki stop, w którym wagowa zawartość określonego metalu jest procentowo wyższa niż jakiegokolwiek innego pierwiastka.

2B351 Systemy monitorowania i urządzenia do monitorowania gazów toksycznych i przeznaczone do nich części detekcyjne, inne niż wyszczególnione w pozycji 1A004, oraz detektory, czujniki oraz wymienne moduły czujnikowe do nich:

a. zaprojektowane do ciągłej pracy i wykorzystywane do wykrywania bojowych środków chemicznych lub środków chemicznych wyszczególnionych w pozycji 1C350, w stężeniach poniżej 0,3 mg/m3; lub

b. zaprojektowane do wykrywania aktywności wstrzymującej cholinoesterazę.

2B352 Następujący sprzęt do produkcji biologicznej i przeładunku:

a. następujące obudowy zabezpieczające i sprzęt z nimi związany;

1. kompletne obudowy zabezpieczające spełniające kryteria poziomów zabezpieczenia P3 lub P4 (BL3, BL4, L3, L4) wyszczególnione w instrukcji WHO dotyczącej bezpieczeństwa biologicznego laboratoriów (wydanie trzecie, Genewa 2004 r.);

2. następujący sprzęt zaprojektowany do instalacji na stałe w obudowach zabezpieczających wyszczególnionych w pozycji 2B352.a:

a. dwudrzwiowe autoklawy przelotowe do dekontaminacji;

b. prysznice do dekontaminacji kombinezonów ochronnych;

c. śluzy przelotowe z uszczelnieniem mechanicznym lub pneumatycznym;

b. kadzie fermentacyjne i ich części, takie jak:

1. kadzie fermentacyjne, pozwalające na namnażanie "mikroorganizmów" lub żywych komórek wykorzystywanych do wytwarzania wirusów lub toksyn, bez rozprzestrzeniania aerozoli, posiadające wewnętrzną pojemność całkowitą równą 20 litrom lub większą;

2. następujące części przeznaczone do kadzi fermentacyjnych wyszczególnionych w pozycji 2B352.b.1.:

a. komory do hodowli przeznaczone do sterylizacji i odkażania na miejscu;

b. urządzenia do chwytania w komorach do hodowli;

c. jednostki sterowania procesami umożliwiające jednoczesne monitorowanie i kontrolowanie dwóch lub większej liczby parametrów układu fermentacji (np. temperatury, pH, składników odżywczych, stopnia wzbudzenia, rozpuszczonego tlenu, natężenia przepływu powietrza, kontrola piany);

Uwaga techniczna:

Dla celów pozycji 2B352.b. do kadzi fermentacyjnych zalicza się bioreaktory, bioreaktory jednorazowego użytku, chemostaty oraz instalacje o przepływie ciągłym.

c. separatory odśrodkowe, zdolne do ciągłego oddzielania bez rozprzestrzeniania aerozoli, posiadające wszystkie niżej wymienione cechy:

1. natężenie przepływu powyżej 100 l/h;

2. wykonanie elementów z polerowanej stali nierdzewnej lub tytanu;

3. jedno lub więcej złączy uszczelnianych w obszarze występowania pary wodnej; oraz

4. przystosowane do wysterylizowania w stanie zamkniętym na miejscu;

Uwaga techniczna:

Do separatorów odśrodkowych zalicza się również dekantery.

d. sprzęt filtrujący o poprzecznym (stycznym) przepływie i jego podzespoły:

1. sprzęt filtrujący o poprzecznym (stycznym) przepływie, zdolny do ciągłego rozdzielania "mikroorganizmów", wirusów, toksyn i kultur komórkowych, posiadający wszystkie poniższe cechy:

a. całkowite pole powierzchni filtrującej równe lub większe niż 1 m2; oraz

b. spełniający którekolwiek z poniższych kryteriów:

1. może być wysterylizowany lub odkażony na miejscu; lub

2. działający przy wykorzystaniu elementów filtrujących jednorazowego użytku;

Uwaga techniczna:

W pozycji 2B352.d.1.b sterylizacja oznacza likwidację wszystkich żyjących mikroorganizmów ze sprzętu poprzez użycie czynnika fizycznego (np. para wodna) lub chemicznego. Odkażenie oznacza zniszczenie potencjalnego zagrożenia mikrobiologicznego sprzętu poprzez użycie czynników chemicznych o właściwościach bakteriobójczych. Odkażenie i sterylizacja różnią się od oczyszczania, które odnosi się do procedur oczyszczenia, zaprojektowanych w celu obniżenia składnika mikrobiologicznego w sprzęcie bez konieczności dokonania likwidacji wszystkich zagrożeń mikrobiologicznych lub utrzymujących się przy życiu mikroorganizmów.

Uwaga: Pozycja 2B352.d nie obejmuje kontrolą sprzętu do odwrotnej osmozy i hemodializy określonego jako taki przez producenta.

2. elementy do filtracji o poprzecznym (stycznym) przepływie (np. moduły, elementy, kasety, pojemniki, zespoły lub płyty) o powierzchni filtrującej równej lub większej niż 0,2 m2 dla każdego komponentu i zaprojektowane do użycia w sprzęcie do filtracji o poprzecznym (stycznym) przepływie wyszczególnionym w pozycji 2B352.d;

e. sterylizowany parą wodną lub gazem sprzęt do liofilizacji o wydajności kondensora wynoszącej co najmniej 10 kg lodu na dobę i mniejszej niż 1 000 kg lodu na dobę;

f. następujący sprzęt służący do zabezpieczania i fizycznego ograniczania:

1. pełne lub częściowe obudowy ochronne lub kołpaki uzależnione od dowiązanego zewnętrznego źródła powietrzna, pracujące pod nadciśnieniem;

Uwaga: Pozycja 2B352.f.1 nie obejmuje kontrolą kombinezonów zaprojektowanych do noszenia z niezależnym aparatem do oddychania.

2. komory biohermetyczne, izolatory lub komory bezpieczeństwa biologicznego posiadające wszystkie niżej wymienione cechy, do normalnej pracy:

a. posiadające całkowicie zamkniętą przestrzeń roboczą, w której operator jest oddzielony od obszaru roboczego fizyczną przegrodą;

b. zdolne do pracy pod ciśnieniem ujemnym;

c. posiadające możliwość bezpiecznego manipulowania obiektami w przestrzeni roboczej;

d. w których powietrze dostarczane do przestrzeni roboczej i usuwane z niej jest filtrowane filtrem HEPA;

Uwaga 1: Pozycja 2B352.f.2. obejmuje komory klasy III bezpieczeństwa biologicznego opisane w ostatnim wydaniu instrukcji WHO dotyczącej bezpieczeństwa biologicznego laboratoriów lub zbudowane zgodnie z krajowymi normami, regulacjami lub wytycznymi.

Uwaga 2: Pozycja 2B352.f.2. nie obejmuje izolatorów specjalnie zaprojektowanych do trzymania pacjentów w izolatce lub transportu zakażonych pacjentów.

g. następujący sprzęt do wdychania aerozoli zaprojektowany do testowania tożsamości aerozoli zawierających "mikroorganizmy", wirusy lub "toksyny":

1. komory inhalacyjne narażające cały organizm, o pojemności 1 m3 lub większej;

2. aparatura umożliwiająca narażenie wyłącznie przez nos, z wykorzystaniem bezpośredniego strumienia aerozolu i umożliwiająca poddanie działaniu:

a. 12 lub większej liczby gryzoni; lub

b. dwóch lub większej liczby zwierząt, innych niż gryzonie;

3. Rury unieruchamiające zwierzęta do stosowania z aparaturą umożliwiającą narażenie wyłącznie przez nos wykorzystującą bezpośredni strumień aerozolu;

h. urządzenia do suszenia rozpryskowego umożliwiające odwadnianie toksyn lub "mikroorganizmów" chorobotwórczych, posiadające wszystkie z następujących cech:

1. zdolność do odparowywania wody wynoszącą ≥ 0,4 kg/h i ≤ 400 kg/h;

2. zdolność do wytwarzania typowych cząstek produktu o średniej wielkości ≤ 10 μ m przy pomocy aktualnego wyposażenia lub po niewielkiej modyfikacji suszarki rozpryskowej przy pomocy dysz atomizujących, które umożliwiają wytwarzanie pożądanej wielkości cząstek; oraz

3. może być wysterylizowany lub odkażony na miejscu;

i. Asemblery i syntezatory kwasu nukleinowego, częściowo lub całkowicie zautomatyzowane i zaprojektowane do generowania ciągłych kwasów nukleinowych o długości większej niż 1,5 kpz przy poziomie błędu mniejszym niż 5 % w jednym cyklu.

2C Materiały

Żadne.

2D Oprogramowanie

2D001 "Oprogramowanie", inne niż wyszczególnione w pozycji 2D002, takie jak:

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do "rozwoju" lub "produkcji" urządzeń wyszczególnionych w pozycjach 2A001 lub 2B001;

b. "oprogramowanie" specjalnie opracowane lub zmodyfikowane z przeznaczeniem do "użytkowania" urządzeń wyszczególnionych w pozycjach 2A001.c, 2B001 lub 2B003 do 2B009;

Uwaga: Pozycja 2D001 nie obejmuje kontrolą "oprogramowania" do programowania części służącego do generowania kodów sterowania numerycznego" do obróbki różnych części,

2D002 "oprogramowanie" urządzeń elektronicznych, nawet rezydujące w elementach elektronicznych urządzenia lub systemu, pozwalające działać tym urządzeniom lub systemom jako jednostki "sterowania numerycznego", umożliwiające jednoczesną koordynację więcej niż czterech osi w celu "sterowania kształtowego".

Uwaga 1: Pozycja 2D002 nie obejmuje kontrolą "oprogramowania" specjalnie zaprojektowanego lub zmodyfikowanego do użytkowania obiektów niewyszczególnionych w kategorii 2.

Uwaga 2: Pozycja 2D002 nie obejmuje kontrolą "oprogramowania" do obiektów wyszczególnionych w pozycji 2B002. W odniesieniu do "oprogramowania" do obiektów wyszczególnionych w pozycji 2B002 zob. pozycja 2D001 oraz 2D003.

Uwaga 3: Pozycja 2D002 nie obejmuje kontrolą "oprogramowania", które jest wywożone wraz z obiektami niewyszczególnionymi w kategorii 2 i jest niezbędnym minimum dla ich funkcjonowania.

2D003 "Oprogramowanie" zaprojektowane lub zmodyfikowane do użytkowania urządzeń wyszczególnionych w pozycji 2B002, które przekształca układ optyczny, wymiary obrabianego przedmiotu i funkcje usuwania materiału w polecenia "sterowania numerycznego" służące uzyskiwaniu pożądanej formy obrabianego przedmiotu.

2D101 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" sprzętu wyszczególnionego w pozycjach 2B104, 2B105, 2B109, 2B116, 2B117 lub 2B119 do 2B122.

N.B. ZOB. TAKŻE POZYCJA 9D004.

2D201 "Oprogramowanie" specjalnie zaprojektowane do "użytkowania" sprzętu wyszczególnionego w pozycjach 2B204, 2B206, 2B207, 2B209, 2B219 lub 2B227.

2D202 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "rozwoju", "produkcji" lub "użytkowania" sprzętu wyszczególnionego w pozycji 2B201.

Uwaga: Pozycja 2D202 nie obejmuje kontrolą "oprogramowania" do programowania części służącego do generowania kodów "sterowania numerycznego", ale nieumożliwiającego bezpośredniego wykorzystania urządzeń do obróbki różnych części.

2D351 "Oprogramowanie", inne niż wyszczególnione w pozycji 1D003, specjalnie zaprojektowane do "użytkowania" sprzętu wyszczególnionego w pozycji 2B351.

2E Technologia

2E001 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" sprzętu lub "oprogramowania" wyszczególnionego w pozycjach 2 A, 2B lub 2D.

Uwaga: Pozycja 2E001 obejmuje "technologię" przeznaczoną do montowania systemów czujników w urządzenia do pomiaru współrzędnych wyszczególnione w pozycji 2B006.a.

2E002 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "produkcji" sprzętu wyszczególnionego w pozycjach 2 A lub 2B.

2E003 Inne "technologie", takie jak:

a. nieużywane;

b. "technologia" do procesów wytwórczych wykorzystujących obróbkę metali:

1. "technologia" projektowania narzędzi, form lub uchwytów specjalnie zaprojektowanych do jednego z następujących procesów:

a. "formowania w stanie nadplastycznym";

b. "zgrzewania dyfuzyjnego"; lub

c. 'bezpośredniego wytłaczania hydraulicznego';

2. dane techniczne, zawierające wymienione poniżej metody lub parametry procesu, wykorzystywane do sterowania następującymi procesami:

a. "formowanie w stanie nadplastycznym" stopów glinu, stopów tytanu lub "nadstopów":

1. przygotowanie powierzchni;

2. właściwości plastyczne;

3. temperatura;

4. ciśnienie;

b. "zgrzewanie dyfuzyjne" "nadstopów" lub stopów tytanu:

1. przygotowanie powierzchni;

2. temperatura;

3. ciśnienie;

c. 'bezpośrednie wytłaczanie hydrauliczne' stopów glinu lub tytanu:

1. ciśnienie;

2. czas cyklu;

d. 'izostatyczne zagęszczanie na gorąco' stopów tytanu, glinu lub "nadstopów":

1. temperatura;

2. ciśnienie;

3. czas cyklu;

Uwagi techniczne:

1. 'Bezpośrednie wytłaczanie hydrauliczne' oznacza technikę odkształcania, w której stosowana jest napełniona płynem odkształcalna poduszka, działająca bezpośrednio na powierzchnię obrabianego przedmiotu.

2. 'Izostatyczne zagęszczanie na gorąco' oznacza technikę ciśnieniowania odlewu w temperaturach powyżej 375 K (102 °C) w zamkniętej formie za pomocą różnych czynników (gaz, ciecz, cząstki stałe itp.), której celem jest wytworzenie jednakowej siły we wszystkich kierunkach w celu zmniejszenia lub wyeliminowania jam wewnętrznych w odlewie.

c. "technologia" do "rozwoju" lub "produkcji" obciągarek hydraulicznych i form do nich, wykorzystywanych do wytwarzania struktur płatowca;

d. nieużywane;

e. "technologia" do "rozwoju" zintegrowanego "oprogramowania" do wprowadzania systemów eksperckich do wspomagania procesu decyzyjnego pracy warsztatowej, przeznaczonego do urządzeń "sterowanych numerycznie";

f. "technologia" do nakładania powłok nieorganicznych lub powłok nieorganicznych modyfikowanych powierzchniowo (wyszczególnionych w kolumnie 3 poniższej tabeli) na podłoża nieelektroniczne (wyszczególnione w kolumnie 2 poniższej tabeli) za pomocą procesów wyszczególnionych w kolumnie 1 poniższej tabeli i zdefiniowanych w uwadze technicznej;

Uwaga: Tabela i uwaga techniczna znajdują się za pozycją 2E301.

N.B. Z tabeli należy korzystać w celu określenia konkretnej "technologii" powlekania tylko w przypadku, gdy powłoka wynikowa w kolumnie 3 znajduje się w polu bezpośrednio obok odnośnego podłoża w kolumnie 2. Na przykład dane techniczne procesu powlekania za pomocą osadzania z pary lotnej są podane w przypadku powlekania krzemkami podłoży z "materiałów kompozytowych" na "matrycy" węgiel-węgiel, ceramicznej i metalowej, lecz nie są podane w przypadku powlekania krzemkami podłoży będących 'spiekanymi węglikami wolframu' (16) lub 'węglikami krzemu' (18). W drugim przypadku powłoka wynikowa nie jest wymieniona w kolumnie 3 w polu bezpośrednio przylegającym do pola, w którym w kolumnie 2 znajdują się 'spiekane węgliki wolframu' (16) i 'węglik krzemu' (18).

2E101 "Technologia", zgodnie z uwagą ogólną do technologii, przeznaczona do "użytkowania" sprzętu lub "oprogramowania" wyszczególnionego w pozycjach 2B004, 2B009, 2B104, 2B109, 2B116, 2B119 do 2B122 lub 2D101.

2E201 "Technologia", zgodnie z uwagą ogólną do technologii, przeznaczona do "użytkowania" sprzętu lub "oprogramowania" wyszczególnionego w pozycjach 2A225, 2A226, 2B001, 2B006, 2B007.b, 2B007.c, 2B008, 2B009, 2B201, 2B204, 2B206, 2B207, 2B209, 2B225 do 2B233, 2D201 lub 2D202.

2E301 "Technologia", zgodnie z uwagą ogólną do technologii, przeznaczona do "użytkowania" towarów wyszczególnionych w pozycjach 2B350 do 2B352.

Tabela

Techniki osadzania

1. Technika powlekania (1) (*)2. Podłoże3. Powłoka wynikowa
A. Osadzanie z pary lotnej (CVD)"Nadstopy"Glinki na kanały wewnętrzne
Podłoża ceramiczne (19) i szkło o małym współczynniku rozszerzalności cieplnej (14)Krzemki

Węgliki

Warstwy dielektryczne (15)

Diament

Węgiel diamentopodobny (17)

"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejKrzemki

Węgliki

Metale ognioodporne

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Glinki

Glinki stopowe (2)

Azotek boru

Spiekany węglik wolframu (16), węglik krzemu (18)Węgliki

Wolfram

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Molibden i stopy molibdenuWarstwy dielektryczne (15)
Beryl i stopy beryluWarstwy dielektryczne (15)

Diament

Węgiel diamentopodobny (17)

Materiały na okienka wziernikowe (9)Warstwy dielektryczne (15)

Diament

Węgiel diamentopodobny (17)

Termiczne naparowywanie próżniowe (TE-PVD)
B.1. Naparowywanie próżniowe (PVD): wiązką elektronów (EB-PVD)"Nadstopy"Krzemki stopowe

Glinki stopowe (2)

MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Krzemki

Glinki

Mieszaniny powyższych (4)

Podłoża ceramiczne (19) i szkło o małym współczynniku rozszerzalności cieplnej (14)Warstwy dielektryczne (15)
Stale odporne na korozję (7)MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Mieszaniny powyższych (4)

"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejKrzemki

Węgliki

Metale ognioodporne

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Azotek boru

Spiekany węglik wolframu (16), węglik krzemu (18)Węgliki

Wolfram

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Molibden i stopy molibdenuWarstwy dielektryczne (15)
Beryl i stopy beryluWarstwy dielektryczne (15)

Borki

Beryl

Materiały na okienka wziernikowe (9)Warstwy dielektryczne (15)
Stopy tytanu (13)Borki Azotki
B.2. Napylanie techniką ogrzewania oporowego wspomaganego (PVD) (Pokrywanie jonowe)Podłoża ceramiczne (19)

i szkło o małym współczyn-

niku rozszerzalności cieplnej

Warstwy dielektryczne (15) Węgiel diamentopodobny (17)
"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejWarstwy dielektryczne (15)
Spiekany węglik wolframu (16), węglik krzemuWarstwy dielektryczne (15)
Molibden i stopy molibdenuWarstwy dielektryczne (15)
Beryl i stopy beryluWarstwy dielektryczne (15)
Materiały na okienka wziernikowe (9)Warstwy dielektryczne (15) Węgiel diamentopodobny (17)
B.3. Naparowywanie próżniowe (PVD): odparowywanie "laserowe"Podłoża ceramiczne (19) i szkło o małym współczynniku rozszerzalności cieplnej (14)Krzemki

Warstwy dielektryczne (15)

Węgiel diamentopodobny (17)

"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejWarstwy dielektryczne (15)
Spiekany węglik wolframu (16), węglik krzemuWarstwy dielektryczne (15)
Molibden i stopy molibdenuWarstwy dielektryczne (15)
Beryl i stopy beryluWarstwy dielektryczne (15)
Materiały na okienka wziernikowe (9)Warstwy dielektryczne (15) Węgiel diamentopodobny (17)
B.4. Naparowywanie próżniowe (PVD): za pomocą łuku katodowego"Nadstopy"Krzemki stopowe Glinki stopowe (2) MCrAlX (5)
"Polimery" (11) oraz "materiały kompozytowe" na "matrycy" organicznejBorki

Węgliki

Azotki

Węgiel diamentopodobny (17)

C. Osadzanie fluidyzacyjne (zob. A powyżej dla innych technik) (10)"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejKrzemki Węgliki Mieszaniny powyższych (4)
Stopy tytanu (13)Krzemki

Glinki

Glinki stopowe (2)

Metale i stopy ognioodporne (8)Krzemki Tlenki
D. Napylanie plazmowe"Nadstopy"MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Mieszaniny powyższych (4)

Materiał ścierny nikiel-grafit

Materiał ścierny Ni-Cr-Al

Materiał ścierny Al-Si-poliester

Glinki stopowe (2)

Stopy glinu (6)MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Krzemki

Mieszaniny powyższych (4)

Metale i stopy ognioodporne (8)Glinki Krzemki Węgliki
Stale odporne na korozję (7)MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Mieszaniny powyższych (4)

Stopy tytanu (13)Węgliki

Glinki

Krzemki

Glinki stopowe (2)

Materiał ścierny nikiel-grafit

Materiał ścierny Ni-Cr-Al

Materiał ścierny Al-Si-poliester

E. Powlekanie zawiesinoweMetale i stopy ognioodporne (8)Krzemki stopione

Glinki stopione z wyjątkiem elementów do

nagrzewania oporowego

"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejKrzemki Węgliki Mieszaniny powyższych (4)
F. Rozpylanie jonowe"Nadstopy"Krzemki stopowe

Glinki stopowe (2)

Glinki zmodyfikowane metalem szlachetnym (3)

MCrAlX (5)

Zmodyfikowany tlenek cyrkonowy (12)

Platyna

Mieszaniny powyższych (4)

Podłoża ceramiczne i szkło o małym współczynniku rozszerzalności cieplnej (14)Krzemki

Platyna

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Węgiel diamentopodobny (17)

Stopy tytanu (13)Borki

Azotki

Tlenki

Krzemki

Glinki

Glinki stopowe (2)

Węgliki

"Materiały kompozytowe" na "matrycy" węgiel-węgiel, ceramicznej i metalowejKrzemki

Węgliki

Metale ognioodporne

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Azotek boru

Spiekany węglik wolframu (16), węglik krzemu (18)Węgliki

Wolfram

Mieszaniny powyższych (4)

Warstwy dielektryczne (15)

Azotek boru

Molibden i stopy molibdenuWarstwy dielektryczne (15)
Beryl i stopy beryluBorki

Warstwy dielektryczne (15)

Beryl

Materiały na okienka wziernikowe (9)Warstwy dielektryczne (15) Węgiel diamentopodobny (17)
Metale i stopy ognioodporne (8)Glinki Krzemki Tlenki Węgliki
G. Implantacja jonówŻarowytrzymałe stale łożyskoweDodatki chromu, tantalu lub niobu
Stopy tytanu (13)Borki Azotki
Beryl i stopy beryluBorki
Spiekany węglik wolframu (16)Węgliki Azotki
(*) Indeksy w nawiasach odnoszą się do uwag zamieszczonych pod tabelą.

TABELA - TECHNIKI OSADZANIA - UWAGI

1. Termin 'technika powlekania' obejmuje zarówno naprawę i odnawianie powłok, jak i powłoki pierwotne.

2. Termin 'powłoka z glinku stopowego' obejmuje powłoki uzyskane w procesie jedno- lub wieloetapowym, w którym każdy pierwiastek lub pierwiastki są nakładane przed lub podczas nakładania powłoki glinkowej, nawet jeżeli pierwiastki te są nakładane podczas innego procesu powlekania. Nie obejmuje to jednak przypadku wieloetapowego stosowania jednostopniowych procesów osadzania fluidyzacyjnego, mającego na celu uzyskanie glinków stopowych.

3. Termin powłoka z 'glinku modyfikowanego metalem szlachetnym' obejmuje powłoki wytwarzane w procesie wieloetapowym, podczas którego przed położeniem powłoki z glinku na podłoże nakładany jest, w innym procesie powlekania, jeden lub kilka metali szlachetnych.

4. Termin 'mieszaniny powyższych' obejmuje przesycony materiał powłoki podłoża, części składowe pośrednie, materiał współosadzony oraz wielowarstwowy materiał osadzony uzyskane jedną lub kilkoma technikami powlekania wyszczególnionymi w tabeli.

5. Przez termin 'MCrAlX' należy rozumieć powłokę stopową, w której M oznacza kobalt, żelazo, nikiel lub ich kombinację, a X oznacza hafn, itr, krzem, tantal w dowolnych ilościach lub inne zamierzone dodatki w ilościach powyżej 0,01 % wagowo, w różnych proporcjach i kombinacjach, z wyjątkiem:

a. powłok CoCrAlY, w których znajduje się poniżej 22 % wagowo chromu, poniżej 7 % wagowo glinu i poniżej 2 % wagowo itru;

b. powłok CoCrAlY, w których znajduje się 22 do 24 % wagowo chromu, 10 do 12 % wagowo glinu i 0,5 do 0,7 % wagowo itru; lub

c. powłok NiCrAlY, w których znajduje się 21 do 23 % wagowo chromu, 10 do 12 % wagowo glinu i 0,9 do 1,1 % wagowo itru;

6. Termin 'stopy glinu' dotyczy stopów, których wytrzymałość na rozciąganie, mierzona w temperaturze 293 K (20 °C), wynosi 190 MPa lub więcej.

7. Termin 'stale odporne na korozję' odnosi się do stali serii 300 według AISI (American Iron and Steel Institute) lub równoważnych norm krajowych.

8. Termin 'metale i stopy ognioodporne' obejmuje następujące metale i ich stopy: niob, molibden, wolfram i tantal.

9. 'Materiały na okienka wziernikowe', takie jak: tlenek glinu, krzem, german, siarczek cynku, selenek cynku, arsenek galu, diament, fosforek galu, szafir oraz następujące halogenki metali: materiały na okienka wziernikowe o średnicy powyżej 40 mm z fluorku cyrkonu i fluorku hafnu.

10. Kategoria 2 nie obejmuje kontrolą "technologii" jednostopniowych procesów osadzania fluidyzacyjnego w przypadku litych profili aerodynamicznych.

11. 'Polimery', takie jak: poliimidy, poliestry, polisiarczki, poliwęglany i poliuretany.

12. Termin 'zmodyfikowany tlenek cyrkonowy' odnosi się do tlenku cyrkonowego z dodatkami innych tlenków metali (np. tlenku wapnia, tlenku magnezu, tlenku itru, tlenku hafnu, tlenków metali ziem rzadkich) dodanymi w celu stabilizacji pewnych faz krystalicznych i składników faz. Powłoki przeciwtermiczne wykonane z tlenku cyrkonowego modyfikowanego poprzez mieszanie lub stapianie z tlenkiem wapnia lub magnezu nie są objęte kontrolą.

13. Termin 'stopy tytanu' odnosi się jedynie do stopów stosowanych w technice kosmicznej i lotniczej, których wytrzymałość na rozciąganie, mierzona w temperaturze 293 K (20 °C), wynosi 900 MPa lub więcej.

14. Termin 'szkło o małym współczynniku rozszerzalności cieplnej' odnosi się do szkieł, dla których wartość współczynnika rozszerzalności cieplnej, mierzona w temperaturze 293 K (20 °C), wynosi 1 × 10-7 K-1 lub mniej.

15. Termin 'warstwy dielektryczne' odnosi się do powłok wielowarstwowych z materiałów izolacyjnych, w których interferencyjne właściwości konstrukcji złożonej z materiałów o różnych współczynnikach załamania są wykorzystywane do odbijania, przepuszczania lub pochłaniania fal o różnych długościach. Warstwy dielektryczne odnoszą się do materiałów składających się z więcej niż czterech warstw dielektrycznych lub warstw "kompozytów" dielektryk/ metal.

16. 'Spiekany węglik wolframu' nie obejmuje kontrolą materiałów na narzędzia skrawające i formujące wykonane z węglika wolframu/(kobaltu, niklu), węglika tytanu/(kobaltu, niklu), węglika chromu/niklu-chromu i węglika chromu/niklu.

17. Nie jest objęta kontrolą "technologia" nakładania węgla diamentopodobnego na którykolwiek z niżej wymienionych produktów:

dyski i głowice magnetyczne, urządzenia do wytwarzania produktów jednorazowych, zawory do kranów, membrany do głośników, części silników samochodowych, narzędzia tnące, matryce do tłoczenia-wykrawania, sprzęt do automatyzacji prac biurowych, mikrofony lub urządzenia lub formy medyczne służące do odlewu lub formowania tworzyw sztucznych, wykonane ze stopów zawierających mniej niż 5 % berylu.

18. 'Węglik krzemu' nie obejmuje kontrolą materiałów na narzędzia do cięcia i formowania.

19. Podłoża ceramiczne, w rozumieniu tej pozycji, nie obejmują materiałów ceramicznych zawierających wagowo 5 % lub więcej gliny lub cementu, zarówno w postaci oddzielnych składników, jak i ich kombinacji.

TABELA - TECHNIKI OSADZANIA - UWAGA TECHNICZNA

Definicje procesów wyszczególnionych w kolumnie 1 tabeli:

a. Osadzanie z pary lotnej (CVD) jest procesem nakładania powłoki lub modyfikacji powierzchni podłoża, polegającym na osadzaniu na rozgrzanym podłożu metalu, stopu, "kompozytu", dielektryka lub materiału ceramicznego. W sąsiedztwie podłoża następuje rozkład lub łączenie gazowych substratów reakcji, wskutek czego osadza się na nim pożądany pierwiastek, stop lub związek. Potrzebna do rozkładu związków lub do reakcji chemicznych energia może być dostarczana przez rozgrzane podłoże, plazmę z wyładowań jarzeniowych lub za pomocą promieniowania "lasera".

N.B.1 CVD obejmuje następujące procesy: osadzanie w ukierunkowanym przepływie gazów bez zanurzania w proszku, CVD pulsujące, rozkład termiczny z regulowanym zarodkowaniem (CNTD), CVD intensyfikowane lub wspomagane za pomocą plazmy.

N.B.2 Zanurzanie w proszku polega na zanurzaniu podłoża w mieszaninie sproszkowanych substancji.

N.B.3 Gazowe substraty reakcji, wykorzystywane w technice, w której nie stosuje się zanurzania w proszku, są wytwarzane podczas takich samych reakcji podstawowych i przy takich samych parametrach, jak w przypadku osadzania fluidyzacyjnego: z tym wyjątkiem, że powlekane podłoże nie styka się z mieszaniną proszku.

b. Termiczne naparowywanie próżniowe (TE-PVD) jest procesem powlekania w próżni przy ciśnieniach poniżej 0,1 Pa, w którym do odparowania materiału powlekającego używa się energii termicznej. Rezultatem tego procesu jest kondensacja lub osadzenie odparowanych składników na odpowiednio usytuowanych powierzchniach.

Zwykle proces ten jest modyfikowany poprzez wpuszczanie dodatkowych gazów do komory próżniowej podczas powlekania, co umożliwia wytwarzanie powłok o złożonym składzie.

Innym powszechnie stosowanym sposobem jego modyfikacji jest używanie wiązki jonów lub elektronów lub plazmy do intensyfikacji lub wspomagania osadzania powłoki. W technice tej można stosować monitory do bieżącego pomiaru parametrów optycznych i grubości powłoki.

Wyróżnia się poszczególne procesy TE-PVD, takie jak:

1. PVD z zastosowaniem wiązki elektronów - do rozgrzania i odparowania materiału, który ma stanowić powłokę, używa się wiązki elektronów;

2. PVD z ogrzewaniem oporowym - do wytwarzania odpowiedniego i równomiernego strumienia odparowanych składników powłokowych wykorzystywane są źródła elektrycznego ogrzewania oporowego w kombinacji z uderzającą wiązką jonów;

3. odparowanie "laserowe" wykorzystujące ciągłą lub impulsową wiązkę "laserową" do ogrzania materiału przeznaczonego na powłokę;

4. metoda osadzania za pomocą łuku katodowego wykorzystująca zużywającą się katodę wykonaną z materiału mającego stanowić powłokę; łuk wywoływany jest na powierzchni tego materiału poprzez chwilowy kontakt inicjujący. Kontrolowany ruch łuku powoduje erozję powierzchni katody, wytwarzając wysoko zjonizowaną plazmę. Anodę może stanowić stożek osadzony w izolatorze na obwodzie katody lub sama komora. Osadzanie w miejscach nieleżących na linii biegu wiązki uzyskuje się dzięki odpowiedniej polaryzacji podłoża.

N.B. Definicja ta nie obejmuje bezładnego osadzania wspomaganego łukiem katodowym w przypadku powierzchni niepolaryzowanych.

5. Powlekanie jonowe stanowi specjalną modyfikację procesu TE-PVD, w której do jonizacji osadzanych składników jest wykorzystywane źródło plazmy lub jonów, natomiast podłoże jest polaryzowane ujemnie, co ułatwia wychwytywanie z plazmy tych składników, które mają być osadzone. Do często spotykanych odmian tej techniki należą: wprowadzanie składników aktywnych, odparowywanie substancji stałych wewnątrz komory roboczej oraz bieżący pomiar parametrów optycznych i grubości powłok za pomocą monitorów.

c. Osadzanie fluidyzacyjne jest procesem powlekania lub modyfikacji powierzchni podłoża, w której podłoże jest zanurzane w mieszaninie proszków, składającej się z:

1. proszków metalicznych, które mają być osadzone (zazwyczaj glin, chrom, krzem lub ich kombinacje);

2. aktywatora (zazwyczaj sól halogenkowa); oraz

3. proszku obojętnego, najczęściej tlenku glinu.

Podłoże wraz z mieszaniną proszków znajduje się w retorcie, która jest podgrzewana do temperatury od 1 030 K (757 °C) do 1 375 K (1 102 °C) przez okres wystarczający do osadzenia powłoki.

d. Napylanie plazmowe jest procesem powlekania, w którym do pistoletu (palnika natryskowego) służącego do wytwarzania strumienia plazmy i sterowania nim jest doprowadzany materiał do powlekania w postaci proszku lub pręta. Pistolet topi materiał i wyrzuca go na podłoże, na którym powstaje silnie z nim związana powłoka. Odmianami tego procesu jest napylanie plazmowe niskociśnieniowe oraz napylanie plazmowe z wysoką prędkością.

N.B.1 Niskociśnieniowe oznacza pod ciśnieniem niższym od ciśnienia atmosferycznego otoczenia.

N.B.2 Wysoka prędkość odnosi się do prędkości gazów na wylocie z dyszy przekraczającej wartość 750 m/s w temperaturze 293 K (20 °C) i ciśnieniu 0,1 MPa.

e. Osadzanie zawiesinowe jest procesem powlekania lub modyfikacji powierzchni, w której stosowana jest zawiesina proszku metalicznego lub ceramicznego ze spoiwem organicznym w cieczy, nakładana na podłoże techniką natryskiwania, zanurzania lub malowania. Następnym etapem jest suszenie w powietrzu lub w piecu i obróbka cieplna, w wyniku czego powstaje powłoka o odpowiedniej charakterystyce.

f. Rozpylanie jonowe jest procesem powlekania, opartym na zjawisku przenoszenia pędu, w której naładowane dodatnio jony są przyspieszane przez pole elektryczne w kierunku powierzchni docelowej (materiał powłokowy). Energia kinetyczna padających jonów jest wystarczająca do wyrwania atomów z powierzchni materiału powłokowego i osadzenia ich na odpowiednio usytuowanej powierzchni podłoża.

N.B.1 Tabela dotyczy tylko rozpylania jonowego za pomocą triody, magnetronowego i reakcyjnego, które jest wykorzystywane do zwiększania przyczepności powłoki i wydajności osadzania oraz do rozpylania jonowego wspomaganego prądami wysokiej częstotliwości, wykorzystywanego do intensyfikacji odparowania niemetalicznych materiałów powłokowych.

N.B.2 Do aktywacji osadzania można zastosować wiązki jonów o niskiej energii (poniżej 5 keV).

g. Implantacja jonowa jest procesem modyfikacji powierzchni polegającym na jonizacji pierwiastka, który ma być stopiony, przyspieszaniu go za pomocą różnicy potencjałów i wstrzeliwaniu w odpowiedni obszar powierzchni podłoża. Technika ta może być stosowana równocześnie z napylaniem jonowym wspomaganym za pomocą wiązki elektronów lub rozpylaniem jonowym.

KATEGORIA 3 - ELEKTRONIKA

3A Systemy, urządzenia i części składowe

Uwaga 1: Poziom kontroli sprzętu i części składowych opisanych w pozycjach 3A001 lub 3A002, innych niż opisane w pozycji 3A001.a.3 do 3A001.a.10 lub 3A001.a.12 do 3A001.a.14, specjalnie do nich zaprojektowanych lub posiadających te same cechy funkcjonalne co inny sprzęt, jest taki sam jak poziom kontroli innego sprzętu.

Uwaga 2: Poziom kontroli układów scalonych opisanych w pozycjach 3A001.a.3 do 3A001.a.9 lub 3A001.a.12 do 3A001.a.14, zaprogramowanych na stałe bez możliwości wprowadzenia zmian lub zaprojektowanych do specjalnych funkcji dla innego sprzętu jest taki sam jak poziom kontroli innego sprzętu.

N.B. W razie gdy producent lub wnioskodawca nie jest w stanie określić poziomu kontroli innego sprzętu, poziom kontroli danych układów scalonych jest określony w pozycjach 3A001.a.3 do 3A001.a.9 oraz 3A001.a.12 do 3A001.a.14.

3A001 Następujące produkty elektroniczne:

a. następujące układy scalone ogólnego przeznaczenia:

Uwaga 1: Poziom kontroli płytek (gotowych lub niegotowych) posiadających wyznaczoną funkcję należy określać na podstawie parametrów podanych w pozycji 3A001.a.

Uwaga 2: Wśród układów scalonych rozróżnia się następujące typy:

- "monolityczne układy scalone";

- "hybrydowe układy scalone";

- "wieloukłady scalone";

- "układy scalone warstwowe", łącznie z układami scalonymi typu krzem na szafirze;

- "optyczne układy scalone";

- "trójwymiarowe układy scalone";

- "monolityczne mikrofalowe układy scalone" ("MMIC")

1. układy scalone zaprojektowane lub oznaczone znamionowo jako zabezpieczone przed promieniowaniem jonizującym, wytrzymujące którekolwiek z poniższych:

a. dawkę całkowitą 5 × 103 Gy (Si) lub wyższą;

b. wzrost dawki o 5 × 106 Gy (Si)/s lub większy; lub

c. fluencję (zintegrowany strumień) neutronów (ekwiwalent 1 MeV) o wartości 5 × 1013 n/cm2 lub większej na krzemie, lub jej ekwiwalent na innym materiale;

Uwaga: Pozycja 3A001.a.1.c nie obejmuje kontrolą struktur metal- izolator- półprzewodnik (MIS).

2. "układy mikroprocesorowe", "układy mikrokomputerowe" i układy do mikrosterowników, układy scalone pamięci wykonane z półprzewodników złożonych, przetworniki analogowo-cyfrowe, układy scalone zawierające przetworniki analogowo-cyfrowe i zapisujące lub przetwarzające dane przetworzone cyfrowo, przetworniki cyfrowoanalogowe, układy elektrooptyczne lub "optyczne układy scalone" do "przetwarzania sygnałów", sieci bramek programowalne przez użytkownika, robione na zamówienie układy scalone o nieznanej ich producentowi funkcji lub poziomie kontroli urządzenia, w którym miałyby być zainstalowane, procesory do Szybkiej Transformacji Fouriera (FFT), statyczne pamięci o dostępie swobodnym (SRAM) lub 'pamięci nieulotne', spełniające którekolwiek z poniższych kryteriów:

a. przystosowane do pracy w temperaturze otoczenia powyżej 398 K (125 °C),

b. przystosowane do pracy w temperaturze otoczenia poniżej 218 K (- 55 °C), lub

c. przystosowane do pracy w całym przedziale wartości temperatur od 218 K (- 55 °C) do 398 K (125 °C).

Uwaga: Pozycja 3A001.a.2 nie obejmuje kontrolą układów scalonych do silników pojazdów cywilnych ani kolejowych.

Uwaga techniczna:

'Pamięci nieulotne' oznaczają pamięci przechowujące dane w okresie po wyłączeniu zasilania.

3. "układy mikroprocesorowe", "układy mikrokomputerowe" i układy do mikrosterowników wykonane z półprzewodników złożonych, pracujące z częstotliwością zegara przekraczającą 40 MHz;

Uwaga: Pozycja 3A001.a.3 obejmuje cyfrowe procesory sygnałowe, cyfrowe procesory tablicowe i koprocesory cyfrowe.

4. nieużywane;

5. następujące przetworniki analogowo-cyfrowe (ADC) i przetworniki cyfrowoanalogowe (DAC) na układach scalonych:

a. przetworniki analogowo-cyfrowe spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJA 3A101.

1. rozdzielczość 8 bitów lub więcej, lecz poniżej 10 bitów i "częstotliwość próbkowania" większa niż 1,3 giga próbek/sek (GSPS);

2. rozdzielczość 10 bitów lub więcej, lecz poniżej 12 bitów i "częstotliwość próbkowania" większa niż 600 mega próbek/sek (MSPS);

3. rozdzielczość 12 bitów lub więcej, lecz poniżej 14 bitów i "częstotliwość próbkowania" większa niż 400 MSPS;

4. rozdzielczość 14 bitów lub więcej, lecz poniżej 16 bitów i "częstotliwość próbkowania" większa niż 250 MSPS; lub

5. rozdzielczość 16 bitów lub więcej i "częstotliwość próbkowania" większa niż 65 MSPS;

N.B. Odnośnie do układów scalonych, które zawierają przetworniki analogowo-cyfrowe i zapisują lub przetwarzają dane przetworzone cyfrowo, zob. pozycja 3A001.a.14.

Uwagi techniczne:

1. Rozdzielczość n bitów odpowiada kwantowaniu na 2n poziomach.

2. Rozdzielczość przetwornika ADC wyrażona jest liczbą bitów na wyjściu cyfrowym odpowiadającą pomiarowi na wejściu analogowym. Efektywnej liczby bitów (ENOB) nie stosuje się do określania rozdzielczości ADC.

3. W przypadku "wielokanałowych przetworników ADC" "częstotliwość próbkowania" nie jest agregowana i "częstotliwość próbkowania" jest maksymalną wielkością pojedynczego kanału.

4. W przypadku "przetworników ADC z przeplotem" lub w przypadku "wielokanałowych przetworników ADC", których specyfikacje przewidują tryb pracy z przeplotem, "częstotliwości próbkowania" są agregowane i "częstotliwość próbkowania" jest maksymalną łączną całkowitą częstotliwością wplecionych kanałów.

b. przetworniki cyfrowoanalogowe (przetworniki DAC) spełniające którekolwiek z poniższych kryteriów:

1. rozdzielczość 10 bitów lub większa przy 'skorygowanej prędkości aktualizacji' większej niż 3 500 MSPS; lub

2. rozdzielczość 12 bitów lub większa przy 'skorygowanej prędkości aktualizacji' większej niż 1 250 MSPS i spełniające którekolwiek z poniższych kryteriów:

a. czas ustalania krótszy niż 9 ns do osiągnięcia pełnej skali lub 0,024 % pełnej skali od pełnego stopnia skali; lub

b. 'zakres dynamiki wolny od zafałszowań' (SFDR) większy niż 68 dBc (nośna) przy syntetyzowaniu pełnoskalowego sygnału analogowego o częstotliwości 100 MHz lub najwyższej częstotliwości pełnoskalowego sygnału analogowego wyspecyfikowanej poniżej 100 MHz;

Uwagi techniczne:

1. 'Zakres dynamiki wolny od zafałszowań' (SFDR) jest definiowany jako stosunek średniej kwadratowej częstotliwości nośnej (maksymalny element składowy sygnału) na wejściu przetwornika DAC do średniej kwadratowej najbliższego dużego składnika szumu lub zniekształcenia harmonicznego na jego wyjściu.

2. SFDR określa się bezpośrednio z tabel specyfikacji lub z wykresów przedstawiających charakterystyki SFDR w funkcji częstotliwości.

3. Sygnał definiuje się jako pełnoskalowy, gdy jego amplituda jest większa niż -3 dBfs (pełna skala).

4. 'Skorygowana prędkość aktualizacji' dla przetwornika DAC:

a. w przypadku konwencjonalnych (nieinterpolujących) przetworników DAC 'skorygowana prędkość aktualizacji' jest to prędkość, z jaką sygnał cyfrowy jest przekształcany na sygnał analogowy i analogowe wartości wyjściowe są zmieniane przez przetwornik DAC. Przetworniki cyfrowoanalogowe, w których można obejść tryb interpolacji (współczynnik interpolacji wynoszący jeden), należy uznać za konwencjonalne przetworniki DAC (nieinterpolujące);

b. w przypadku przetworników DAC interpolujących (przetworniki DAC z oversamplingiem) 'skorygowana prędkość aktualizacji' jest definiowana jako prędkość aktualizacji przetwornika DAC podzielona przez najmniejszy współczynnik interpolacji. W przypadku interpolujących przetworników DAC 'skorygowana prędkość aktualizacji' bywa stosowana zamiennie z innymi terminami, w tym:

- prędkość przesyłania danych na wejściu,

- prędkość transmisji słów na wejściu,

- częstotliwość próbkowania na wejściu,

- maksymalna całkowita prędkość magistrali na wejściu,

- maksymalna częstotliwość cyklu zegara DAC dla danych wejściowych zegara DAC.

6. elektrooptyczne układy scalone lub "optyczne układy scalone" zaprojektowane do "przetwarzania sygnałów" i spełniające wszystkie poniższe kryteria:

a. jedna lub więcej wewnętrzna dioda "laserowa";

b. jeden lub więcej wewnętrzny element wykrywający światło; oraz

c. prowadnica światłowodowa;

7. programowalne przez użytkownika urządzenia logiczne spełniające którekolwiek z poniższych kryteriów:

a. maksymalna liczba asynchronicznych cyfrowych wejść/wyjść wynosząca ponad 700; lub

b. 'łączna jednokierunkowa szczytowa prędkość przesyłu danych nadajnika-odbiornika szeregowego' wynosząca 500 Gb/s lub więcej;

Uwaga: Pozycja 3A001.a.7 obejmuje:

- złożone programowalne urządzenia logiczne (CPLD),

- tablice bramek programowalne przez użytkownika (FPGA),

- tablice logiczne programowalne przez użytkownika (FPLA),

- połączenia wewnętrzne programowalne przez użytkownika (FPIC).

N.B. Odnośnie do układów scalonych posiadających programowalne przez użytkownika urządzenia logiczne, połączone z przetwornikiem analogowo-cyfrowym, zob. pozycja 3A001.a.14.

Uwagi techniczne:

1. Maksymalna liczba cyfrowych wejść/wyjść w pozycji 3A001.a.7.a jest również nazywana maksymalną liczbą wejść/wyjść użytkowników lub maksymalną liczbą dostępnych wejść/wyjść niezależnie od tego, czy obwód scalony jest obudowany czy surowy.

2. 'łączna jednokierunkowa szczytowa prędkość przesyłu danych nadajnika-odbiornika szeregowego' oznacza iloczyn jednokierunkowej szczytowej prędkości przesyłu danych nadajnika-odbiornika i liczby nadajników-odbiorników na tablicach bramek programowalnych przez użytkownika (FPGA).

8. nieużywane;

9. obwody scalone do sieci neuronowych;

10. wykonywane na zamówienie układy scalone o nieznanej ich producentowi funkcji lub poziomie kontroli sprzętu, w którym będzie zastosowany dany układ scalony, spełniające którekolwiek z poniższych kryteriów:

a. posiadające ponad 1 500 końcówek;

b. typowe "podstawowe opóźnienie przechodzenia sygnału przez bramkę" mniejsze niż 0,02 ns; lub

c. częstotliwość robocza powyżej 3 GHz;

11. cyfrowe układy scalone, różne od przedstawionych w pozycji 3A001.a.3 do 3A001.a.10 lub 3A001.a.12, oparte na dowolnym układzie półprzewodników złożonych oraz spełniające którekolwiek z poniższych kryteriów:

a. zastępcza liczba bramek powyżej 3 000 (bramki dwuwejściowe); lub

b. częstotliwość przełączania powyżej 1,2 GHz;

12. procesory do szybkiej transformacji Fouriera (FFT) posiadające nominalny czas realizacji dla N-punktowej zespolonej transformaty FFT poniżej (N log2 N)/20 480 ms, gdzie N jest liczbą punktów;

Uwaga techniczna:

Gdy N jest równe 1 024 punktom, wynik formuły w pozycji 3A001.a.12, określającej czas realizacji, wynosi 500 μs.

13. obwody scalone bezpośredniego syntezera cyfrowego (DDS) spełniające którekolwiek z poniższych kryteriów:

a. częstotliwość zegara przetwornika cyfrowoanalogowego (przetwornika DAC) wynosząca co najmniej 3,5 GHz i rozdzielczość przetwornika DAC wynosząca co najmniej 10 bitów, ale mniej niż 12 bitów; lub

b. częstotliwość zegara przetwornika DAC wynosząca co najmniej 1,25 GHz i rozdzielczość przetwornika DAC wynosząca co najmniej 12 bitów;

Uwaga techniczna:

Częstotliwość zegara przetwornika DAC można określić jako częstotliwość zegara głównego lub częstotliwość zegara wejścia.

14. układy scalone, które wykonują lub które można zaprogramować tak, by wykonywały wszystkie następujące funkcje:

a. przetwarzanie analogowo-cyfrowe spełniające dowolne z następujących kryteriów:

1. rozdzielczość 8 bitów lub więcej, lecz poniżej 10 bitów i "częstotliwość próbkowania" większa niż 1,3 giga próbek/sek (GSPS);

2. rozdzielczość 10 bitów lub więcej, lecz poniżej 12 bitów i "częstotliwość próbkowania" większa niż 1,0 GSPS;

3. rozdzielczość 12 bitów lub więcej, lecz poniżej 14 bitów i "częstotliwość próbkowania" większa niż 1,0 GSPS;

4. rozdzielczość 14 bitów lub więcej, lecz poniżej 16 bitów i "częstotliwość próbkowania" większa niż 400 mega próbek/sek (MSPS); lub

5. rozdzielczość 16 bitów lub więcej i "częstotliwość próbkowania" większa niż 180 MSPS; oraz

b. dowolne z następujących funkcji:

1. przechowywanie danych przetworzonych cyfrowo; lub

2. przetwarzanie danych przetworzonych cyfrowo.

N.B.1. Odnośnie do przetwornika analogowo-cyfrowego, zob. pozycja 3A001.a.5.a.

N.B.2. Odnośnie do programowalnych przez użytkownika urządzeń logicznych zob. pozycja 3A001.a.7.

Uwagi techniczne:

1. Rozdzielczość n bitów odpowiada kwantowaniu na 2n poziomach.

2. Rozdzielczość przetwornika ADC oznacza liczbę bitów wyjścia cyfrowego ADC odpowiadającą pomiarowi wejścia analogowego. Efektywnej liczby bitów (ENOB) nie stosuje się do określania rozdzielczości ADC.

3. W przypadku układów scalonych z nieprzeplatanymi "wielokanałowymi przetwornikami ADC" "częstotliwość próbkowania" nie jest agregowana i "częstotliwość próbkowania" jest maksymalną wielkością pojedynczego kanału.

4. W przypadku układów scalonych z "przetwornikami ADC z przeplotem" lub z "wielokanałowymi przetwornikami ADC", których specyfikacje przewidują tryb pracy z przeplotem, "częstotliwości próbkowania" są agregowane i "częstotliwość próbkowania" jest maksymalną łączną całkowitą częstotliwością wplecionych kanałów.

b. następujące produkty mikrofalowe lub pracujące na falach milimetrowych:

Uwagi techniczne:

1. Do celów pozycji 3A001.b. parametr mocy wyjściowej na granicy nasycenia może być również określany w arkuszu danych produktu jako moc wyjściowa, nasycona moc wyjściowa, maksymalna moc wyjściowa, szczytowa moc wyjściowa lub szczytowa wartość obwiedni mocy.

2. Do celów pozycji 3A001.b.1 'elektroniczne urządzenia próżniowe' oznaczają urządzenia elektroniczne oparte na interakcji wiązki elektronów z falą elektromagnetyczną rozchodzącą się w obwodzie próżniowym lub współdziałające z próżniowymi rezonatorami wnękowymi o częstotliwości radiowej. 'Elektroniczne urządzenia próżniowe' obejmują klistrony, lampy o fali bieżącej i ich pochodne.

1. następujące 'elektroniczne urządzenia próżniowe' i katodowe:

Uwaga 1: Pozycja 3A001.b.1 nie obejmuje kontrolą 'elektronicznych urządzeń próżniowych' zaprojektowanych lub przystosowanych do działania w jakimkolwiek paśmie częstotliwości i spełniających wszystkie poniższe kryteria:

a. szerokość pasma nie przekracza 31,8 GHz; oraz

b. jest "rozdzielone przez ITU" dla służb radiokomunikacyjnych, ale nie w celu namierzania radiowego.

Uwaga 2: Pozycja 3A001.b.1 nie obejmuje kontrolą 'elektronicznych urządzeń próżniowych' innych niż "klasy kosmicznej", spełniających wszystkie poniższe kryteria:

a. średnia moc wyjściowa równa lub mniejsza niż 50 W; oraz

b. zaprojektowane lub przystosowane do działania w jakimkolwiek paśmie częstotliwości i spełniające wszystkie poniższe kryteria:

1. szerokość pasma przekracza 31,8 GHz, lecz nie przekracza 43,5 GHz; oraz

2. jest "rozdzielone przez ITU" dla służb radiokomunikacyjnych, ale nie w celu namierzania radiowego.

a. następujące 'elektroniczne urządzenia próżniowe' o fali bieżącej, fali impulsowej lub ciągłej:

1. urządzenia pracujące na częstotliwościach powyżej 31,8 GHz;

2. urządzenia posiadające podgrzewacz katody, z czasem uzyskania mocy znamionowej w zakresie fal radiowych wynoszącym poniżej 3 sekund;

3. sprzężone urządzenia wnękowe lub ich pochodne o "ułamkowej szerokości pasma" powyżej 7 % lub mocy szczytowej powyżej 2,5 kW;

4. urządzenia oparte na obwodach z prowadnicami spiralnymi, składanymi lub w kształcie serpentyny lub ich pochodne, spełniające którekolwiek z poniższych kryteriów:

a. "chwilowa szerokość pasma" powyżej jednej oktawy oraz iloczyn mocy przeciętnej (wyrażonej w kW) i częstotliwości (wyrażonej w GHz) powyżej 0,5;

b. "chwilowa szerokość pasma" poniżej jednej oktawy oraz iloczyn mocy przeciętnej (wyrażonej w kW) i częstotliwości (wyrażonej w GHz) powyżej 1;

c. są "klasy kosmicznej"; lub

d. posiadają wyrzutnię elektronów z elektrodą siatkową;

5. urządzenia o "chwilowej szerokości pasma" równej lub większej niż 10 %, spełniające którekolwiek z poniższych kryteriów:

a. pierścieniowa wiązka elektronów;

b. niesymetryczna osiowo wiązka elektronów; lub

c. wielokrotne wiązki elektronów;

b. 'elektroniczne urządzenia próżniowe' wzmacniaczy o skrzyżowanych polach o wzmocnieniu powyżej 17 dB;

c. katody termoelektronowe zaprojektowane do 'elektronicznych urządzeń próżniowych', wytwarzające prąd emisyjny w znamionowych warunkach pracy o gęstości powyżej 5 A/cm2 lub prąd pulsacyjny (nieciągły) w znamionowych warunkach pracy o gęstości powyżej 10 A/cm2;

d. 'elektroniczne urządzenia próżniowe' zdolne do pracy 'w dwóch trybach'.

Uwaga techniczna:

'W dwóch trybach' oznacza, że w przypadku prądu wiązki 'elektronicznego urządzenia próżniowego' można poprzez użycie siatki przełączać między pracą w trybie fali ciągłej i pracą w trybie pulsacyjnym, przy czym szczytowa moc wyjściowa pulsacyjna jest wyższa od mocy wyjściowej w trybie fali ciągłej.

2. "monolityczne mikrofalowe układy scalone" ("MMIC") wzmacniaczy spełniające którekolwiek z poniższych kryteriów:

N.B. Odnośnie do wzmacniaczy "MMIC" posiadających wbudowany przesuwnik fazowy zob. pozycja 3A001.b.12.

a. przystosowane do pracy na częstotliwościach przewyższających 2,7 GHz, do 6,8 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 15 % i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 75 W (48,75 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,7 GHz do 2,9 GHz włącznie;

2. moc wyjściowa na granicy nasycenia powyżej 55 W (47,4 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,9 GHz do 3,2 GHz włącznie;

3. moc wyjściowa na granicy nasycenia powyżej 40 W (46 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,2 GHz do 3,7 GHz włącznie; lub

4. moc wyjściowa na granicy nasycenia powyżej 20 W (43 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,7 GHz do 6,8 GHz włącznie;

b. przystosowane do pracy na częstotliwościach przewyższających 6,8 GHz, do 16 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 10 % i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 10 W (40 dBm) przy dowolnej częstotliwości w zakresie powyżej 6,8 GHz do 8,5 GHz włącznie; lub

2. moc wyjściowa na granicy nasycenia powyżej 5 W (37 dBm) przy dowolnej częstotliwości w zakresie powyżej 8,5 GHz do 16 GHz włącznie;

c. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 3 W (34,77 dBm) na częstotliwościach przewyższających 16 GHz, do 31,8 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

d. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,1 nW (- 70 dBm) na częstotliwościach przewyższających 31,8 GHz, do 37 GHz włącznie;

e. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 1 W (30 dBm) na częstotliwościach przewyższających 37 GHz, do 43,5 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

f. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 31,62 mW (15 dBm) na częstotliwościach przewyższających 43,5 GHz, do 75 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

g. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 10 mW (10 dBm) na częstotliwościach przewyższających 75 GHz, do 90 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 5 %; lub

h. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,1 nW (- 70 dBm) na częstotliwościach przewyższających 90 GHz;

Uwaga 1: nieużywane.

Uwaga 2: Poziom kontroli "MMIC", których znamionowa częstotliwość robocza obejmuje częstotliwości zawarte w więcej niż jednym paśmie, zgodnie z definicjami w pozycjach 3A001.b.2.a do 3A001.b.2.h, jest określony przez najniższy próg mocy wyjściowej na granicy nasycenia.

Uwaga 3: Uwagi 1 i 2 w kategorii 3 A oznaczają, że pozycja 3A001.b.2 nie obejmuje kontrolą "MMIC", jeśli są one specjalnie zaprojektowane do innych zastosowań, np. telekomunikacyjnych, radiolokacyjnych, motoryzacyjnych.

3. dyskretne tranzystory mikrofalowe spełniające którekolwiek z poniższych kryteriów:

a. przystosowane do działania w zakresie częstotliwości powyżej 2,7 GHz i do 6,8 GHz włącznie i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 400 W (56 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,7 GHz do 2,9 GHz włącznie;

2. moc wyjściowa na granicy nasycenia powyżej 205 W (53,12 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,9 GHz do 3,2 GHz włącznie;

3. moc wyjściowa na granicy nasycenia powyżej 115 W (50,61 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,2 GHz do 3,7 GHz włącznie; lub

4. moc wyjściowa na granicy nasycenia powyżej 60 W (47,78 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,7 GHz do 6,8 GHz włącznie;

b. przystosowane do działania w zakresie częstotliwości powyżej 6,8 GHz i do 31,8 GHz włącznie i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 50 W (47 dBm) przy dowolnej częstotliwości w zakresie powyżej 6,8 GHz do 8,5 GHz włącznie;

2. moc wyjściowa na granicy nasycenia powyżej 15 W (41,76 dBm) przy dowolnej częstotliwości w zakresie powyżej 8,5 GHz do 12 GHz włącznie;

3. moc wyjściowa na granicy nasycenia powyżej 40 W (46 dBm) przy dowolnej częstotliwości w zakresie powyżej 12 GHz do 16 GHz włącznie; lub

4. moc wyjściowa na granicy nasycenia powyżej 7 W (38,45 dBm) przy dowolnej częstotliwości w zakresie powyżej 16 GHz do 31,8 GHz włącznie;

c. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,5 W (27 dBm) na częstotliwościach przewyższających 31,8 GHz, do 37 GHz włącznie;

d. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 1 W (30 dBm) na częstotliwościach przewyższających 37 GHz, do 43,5 GHz włącznie;

e. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,1 nW (- 70 dBm) na częstotliwościach przewyższających 43,5 GHz;

Uwaga 1: Poziom kontroli tranzystora, którego znamionowa częstotliwość robocza obejmuje częstotliwości zawarte w więcej niż jednym paśmie, zgodnie z definicjami w pozycjach 3A001.b.3.a do 3A001.b.3.e, jest określony przez najniższy próg mocy wyjściowej na granicy nasycenia.

Uwaga 2: Pozycja 3A001.b.3. obejmuje surowe płytki półprzewodnikowe, płytki zamontowane na nośnikach oraz płytki zamontowane w zestawach. Niektóre dyskretne tranzystory mogą być również określane jako wzmacniacze mocy, jednak status tych dyskretnych tranzystorów jest podany w pozycji 3A001.b.3.

4. mikrofalowe wzmacniacze półprzewodnikowe oraz mikrofalowe zespoły/moduły zawierające mikrofalowe wzmacniacze półprzewodnikowe spełniające którekolwiek z poniższych kryteriów:

a. przystosowane do pracy na częstotliwościach przewyższających 2,7 GHz, do 6,8 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 15 % i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 500 W (57 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,7 GHz do 2,9 GHz włącznie;

2. moc wyjściowa na granicy nasycenia powyżej 270 W (54,3 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,9 GHz do 3,2 GHz włącznie;

3. moc wyjściowa na granicy nasycenia powyżej 200 W (53 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,2 GHz do 3,7 GHz włącznie; lub

4. moc wyjściowa na granicy nasycenia powyżej 90 W (49,54 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,7 GHz do 6,8 GHz włącznie;

b. przystosowane do pracy na częstotliwościach przewyższających 6,8 GHz, do 31,8 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 10 % i spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 70 W (48,54 dBm) przy dowolnej częstotliwości w zakresie powyżej 6,8 GHz do 8,5 GHz włącznie;

2. moc wyjściowa na granicy nasycenia powyżej 50 W (47 dBm) przy dowolnej częstotliwości w zakresie powyżej 8,5 GHz do 12 GHz włącznie;

3. moc wyjściowa na granicy nasycenia powyżej 30 W (44,77 dBm) przy dowolnej częstotliwości w zakresie powyżej 12 GHz do 16 GHz włącznie; lub

4. moc wyjściowa na granicy nasycenia powyżej 20 W (43 dBm) przy dowolnej częstotliwości w zakresie powyżej 16 GHz do 31,8 GHz włącznie;

c. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,5 W (27 dBm) na częstotliwościach przewyższających 31,8 GHz, do 37 GHz włącznie;

d. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 2 W (33 dBm) na częstotliwościach przewyższających 37 GHz, do 43,5 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

e. przystosowane do pracy na częstotliwościach powyżej 43,5 GHz oraz spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa na granicy nasycenia powyżej 0,2 W (23 dBm) na częstotliwościach przewyższających 43,5 GHz, do 75 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

2. moc wyjściowa na granicy nasycenia powyżej 20 mW (13 dBm) na częstotliwościach przewyższających 75 GHz, do 90 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 5 %; lub

3. moc wyjściowa na granicy nasycenia powyżej 0,1 nW (- 70 dBm) na częstotliwościach przewyższających 90 GHz; lub

f. nieużywane;

N.B.1. Wzmacniacze "MMIC" - zob. pozycja 3A001.b.2.

N.B.2. Odnośnie do 'modułów nadawczych/odbiorczych' i 'modułów nadawczych' zob. pozycja 3A001.b.12.

N.B.3. Odnośnie do konwerterów i mieszaczy harmonicznych, zaprojektowanych do rozszerzania częstotliwości roboczej lub przedziału częstotliwości analizatorów sygnału, generatorów sygnałowych, analizatorów sieci lub kontrolnych odbiorników mikrofalowych, zob. pozycja 3A001.b.7.

Uwaga 1: nieużywane.

Uwaga 2: Poziom kontroli elementu, którego znamionowa częstotliwość robocza obejmuje częstotliwości zawarte w więcej niż jednym paśmie, zgodnie z definicjami w pozycjach 3A001.b.4.a do 3A001.b.4.e, jest określony przez najniższy próg mocy wyjściowej na granicy nasycenia.

5. filtry środkowoprzepustowe i środkowo-zaporowe, przestrajalne elektronicznie lub magnetycznie, posiadające więcej niż 5 przestrajalnych rezonatorów umożliwiających strojenie w zakresie pasma częstotliwości 1,5:1 (fmax/fmin) w czasie poniżej 10 μs i spełniające którekolwiek z poniższych kryteriów:

a. szerokość pasma środkowoprzepustowego powyżej 0,5 % częstotliwości nośnej; lub

b. szerokość pasma środkowo-zaporowego poniżej 0,5 % częstotliwości nośnej;

6. nieużywane;

7. konwertery i mieszacze harmoniczne spełniające którekolwiek z poniższych kryteriów:

a. zaprojektowane do rozszerzania przedziału częstotliwości "analizatorów sygnału" powyżej 90 GHz;

b. zaprojektowane do rozszerzania zakresu roboczego generatorów sygnału w następujący sposób:

1. powyżej 90 GHz;

2. do mocy wyjściowej większej niż 100 mW (20 dBm) w dowolnym punkcie zakresu częstotliwości przekraczającego 43,5 GHz, lecz nieprzekraczającego 90 GHz;

c. zaprojektowane do rozszerzania przedziału częstotliwości roboczej analizatorów sieci w następujący sposób:

1. powyżej 110 GHz;

2. do mocy wyjściowej większej niż 31,62 mW (15 dBm) w dowolnym punkcie zakresu częstotliwości przekraczającego 43,5 GHz, lecz nieprzekraczającego 90 GHz;

3. do mocy wyjściowej większej niż 1 mW (0 dBm) w dowolnym punkcie zakresu częstotliwości przekraczającego 90 GHz, lecz nieprzekraczającego 110 GHz; lub

d. zaprojektowane do rozszerzania przedziału częstotliwości kontrolnych odbiorników mikrofalowych powyżej 110 GHz;

8. mikrofalowe wzmacniacze mocy zawierające 'elektroniczne urządzenia próżniowe' wyszczególnione w pozycji 3A001.b.1 i spełniające wszystkie poniższe kryteria:

a. częstotliwości robocze powyżej 3 GHz;

b. średni stosunek mocy wyjściowej do masy większy niż 80 W/kg; oraz

c. objętość mniejsza niż 400 cm3;

Uwaga: Pozycja 3A001.b.8 nie obejmuje kontrolą sprzętu zaprojektowanego lub przystosowanego do działania w jakimkolwiek paśmie częstotliwości, które jest "przydzielane przez ITU" dla służb radiokomunikacyjnych, ale nie w celu namierzania radiowego.

9. mikrofalowe moduły mocy (MPM) składające się co najmniej z 'elektronicznego urządzenia próżniowego' o fali bieżącej, "monolitycznego mikrofalowego układu scalonego" ("MMIC") i zintegrowanego elektronicznego kondycjonera mocy i spełniające wszystkie poniższe kryteria:

a. 'czas włączania' od stanu wyłączenia do stanu całkowitej gotowości krótszy niż 10 sekund;

b. objętość mniejsza niż iloczyn maksymalnej mocy znamionowej w watach i 10 cm3/W; oraz

c. "chwilowa szerokość pasma" większa niż 1 oktawa (fmax > 2fmin) oraz spełniające którekolwiek z poniższych kryteriów:

1. dla częstotliwości równych lub mniejszych niż 18 GHz - moc wyjściowa w zakresie fal radiowych większa niż 100 W; lub

2. częstotliwość większa niż 18 GHz;

Uwagi techniczne:

1. Do obliczenia objętości w pozycji 3A001.b.9.b podaje się następujący przykład: dla maksymalnej mocy znamionowej wynoszącej 20 W objętość wyniosłaby: 20 W × 10 cm3/W = 200 cm3.

2. 'Czas włączania', o którym mowa w pozycji 3A001.b.9.a, odnosi się do czasu upływającego od stanu całkowitego wyłączenia do osiągnięcia całkowitej gotowości do pracy, a zatem obejmuje on również czas rozgrzewania MPM.

10. Oscylatory lub zespoły oscylatorów przewidziane do działania przy zakłóceniu fazowym pojedynczej wstęgi bocznej (SSB) w dBc/Hz mniejszym (lepszym) niż (- 126 + 20log10F - 20log10f) w dowolnym punkcie w zakresie 10 Hz ≤ F ≤ 10 kHz;

Uwaga techniczna:

W pozycji 3A001.b.10 F oznacza przesunięcie w stosunku do częstotliwości roboczej w Hz, a f oznacza częstotliwość roboczą w MHz.

11. "zespoły elektroniczne" będące 'syntezatorami częstotliwości', których "czas przełączania częstotliwości" określony jest przez którykolwiek z poniższych parametrów:

a. krótszy niż 143 ps;

b. krótszy niż 100 μs dla każdej zmiany częstotliwości przewyższającej 2,2 GHz w zakresie syntetyzowanych częstotliwości przekraczającym 4,8 GHz, ale nieprzekraczającym 31,8 GHz;

c. nieużywane;

d. krótszy niż 500 μs dla każdej zmiany częstotliwości przewyższającej 550 MHz w zakresie syntetyzowanych częstotliwości przekraczającym 31,8 GHz, ale nieprzekraczającym 37 GHz;

e. krótszy niż 100 μs dla każdej zmiany częstotliwości przewyższającej 2,2 GHz w zakresie syntetyzowanych częstotliwości przekraczającym 37 GHz, ale nieprzekraczającym 90 GHz; lub

f. nieużywane;

g. krótszy niż 1 ms w zakresie syntetyzowanych częstotliwości przekraczającym 90 GHz;

Uwaga techniczna:

"Syntetyzator częstotliwości" oznacza dowolny rodzaj źródła częstotliwości, bez względu na stosowaną technikę, zapewniający uzyskanie wielu równoczesnych lub naprzemiennych częstotliwości wyjściowych z jednego lub kilku wyjść, uzyskanych z mniejszej liczby częstotliwości wzorcowych (lub głównych) lub sterowanych lub regulowanych za ich pomocą.

N.B. Do zastosowań ogólnych "analizatory sygnału" - zob. poz. 3A002.c, generatory sygnałowe - 3A002.d, analizatory sieci - 3A002.e, kontrolne odbiorniki mikrofalowe - 3A002.f.

12. 'moduły nadawcze/odbiorcze', 'nadawcze/odbiorcze MMIC', 'moduły nadawcze' oraz 'nadawcze MMIC', przystosowane do pracy na częstotliwościach przewyższających 2,7 GHz i spełniające którekolwiek z poniższych kryteriów:

a. moc wyjściowa na granicy nasycenia (w watach), Psat, powyżej 505,62 dzielone przez maksymalną częstotliwość roboczą (w GHz) do kwadratu [Psat>505,62 W*GHz2/fGHz 2] na każdy kanał;

b. "ułamkowa szerokość pasma" wynosząca 5 % lub więcej na każdy kanał;

c. każda z płaskich stron o długości d (w cm) równej lub mniejszej niż 15 podzielonej przez najniższą częstotliwość roboczą w GHz [d ≤ 15cm*GHz*N/fGHz], gdzie N jest liczbą kanałów nadawczych lub kanałów nadawczych/odbiorczych; oraz

d. jeden regulowany elektronicznie przesuwnik fazowy na kanał.

Uwagi techniczne:

1. 'Moduł nadawczy/odbiorczy' to multifunkcjonalny "zespół elektroniczny" umożliwiający dwukierunkową regulację amplitudy i fazy dla nadawania i odbioru sygnałów.

2. 'Moduł nadawczy' to "zespół elektroniczny" umożliwiający regulację amplitudy i fazy dla nadawania sygnałów.

3. 'Nadawczy/odbiorczy MMIC' to multifunkcjonalny "MMIC" umożliwiający dwukierunkową regulację amplitudy i fazy dla nadawania i odbioru sygnałów.

4. 'Nadawczy MMIC' to "MMIC" umożliwiający regulację amplitudy i fazy dla nadawania sygnałów.

5. W przypadku modułów nadawczych/odbiorczych lub modułów nadawczych, których nominalny zakres częstotliwości roboczej wynosi poniżej 2,7 GHz, należy we wzorze określonym w pozycji 3A001.b.12.c jako dolna wartość graniczna częstotliwości roboczej (fGHz) zastosować 2,7 GHz [d≤ 15cm*GHz*N/2,7 GHz].

6. Pozycja 3A001.b.12 ma zastosowanie do 'modułów nadawczych/odbiorczych' lub 'modułów nadawczych', które mogą być wyposażone lub nie w radiator chłodzący. Wartość d w pozycji 3A001.b.12.c nie obejmuje żadnej części 'modułu nadawczego/odbiorczego' lub 'modułu nadawczego', która funkcjonuje jako radiator chłodzący.

7. 'Moduły nadawcze/odbiorcze' lub 'moduły nadawcze' lub 'nadawcze/odbiorcze MMIC' lub 'nadawcze MMIC' mogą mieć N wbudowanych emitujących elementów anteny, gdzie N jest liczbą kanałów nadawczych lub kanałów nadawczych/odbiorczych.

c. następujące urządzenia wykorzystujące fale akustyczne oraz specjalnie zaprojektowane do nich komponenty:

1. urządzenia wykorzystujące powierzchniowe fale akustyczne oraz szumiące powierzchniowo (płytkie) fale akustyczne, spełniające którekolwiek z poniższych kryteriów:

a. mające częstotliwość nośną powyżej 6 GHz;

b. mające częstotliwość nośną większą niż 1 GHz, ale nieprzekraczającą 6 GHz oraz spełniające którekolwiek z poniższych kryteriów:

1. 'tłumienie pasma bocznego częstotliwości' powyżej 65 dB;

2. iloczyn maksymalnego czasu zwłoki i szerokości pasma (czas w μs, a szerokość pasma w MHz) powyżej 100;

3. szerokość pasma większa niż 250 MHz; lub

4. opóźnienie dyspersyjne powyżej 10 μs; lub

c. mające częstotliwość nośną wynoszącą 1 GHz lub mniejszą oraz spełniające którekolwiek z poniższych kryteriów:

1. iloczyn maksymalnego czasu zwłoki i szerokości pasma (czas w μs, a szerokość pasma w MHz) powyżej 100;

2. opóźnienie dyspersyjne powyżej 10 μs; lub

3. 'tłumienie pasma bocznego częstotliwości' powyżej 65 dB i szerokość pasma większa niż 100 MHz;

Uwaga techniczna:

'Tłumienie pasma bocznego częstotliwości' oznacza maksymalną wartość tłumienia wyszczególnioną na arkuszu danych.

2. urządzenia wykorzystujące przestrzenne fale akustyczne, umożliwiające bezpośrednie przetwarzanie sygnałów z częstotliwościami powyżej 6 GHz;

3. urządzenia do "przetwarzania sygnałów" optyczno-akustycznych wykorzystujące oddziaływania pomiędzy falami akustycznymi (przestrzennymi lub powierzchniowymi) a falami świetlnymi do bezpośredniego przetwarzania sygnałów lub obrazów, łącznie z analizą widmową, korelacją lub splataniem;

Uwaga: Pozycja 3A001.c nie obejmuje kontrolą urządzeń wykorzystujących fale akustyczne ograniczone do pojedynczego filtra środkowoprzepustowego, filtra dolnoprzepustowego, filtra górnoprzepustowego, filtra antysprzężeniowego lub funkcji rezonacyjnej.

d. urządzenia i układy elektroniczne, zawierające części składowe wykonane z materiałów "nadprzewodzących", specjalnie zaprojektowane do pracy w temperaturach poniżej "temperatury krytycznej" co najmniej jednego z elementów "nadprzewodzących" i spełniające którekolwiek z poniższych kryteriów:

1. przełączanie prądowe dla obwodów cyfrowych za pomocą bramek "nadprzewodzących", dla którego iloczyn czasu zwłoki na bramkę (w sekundach) i rozproszenia mocy na bramkę (w watach) wynosi poniżej 10-14 J; lub

2. selekcja częstotliwości dla wszystkich częstotliwości za pomocą obwodów rezonansowych o wartościach Q przekraczających 10 000;

e. następujące urządzenia wysokoenergetyczne:

1. 'ogniwa', takie jak:

a. 'ogniwa pierwotne' spełniające którekolwiek z poniższych kryteriów w temperaturze 20 °C:

1. 'gęstość energii' powyżej 550 Wh/kg i 'ciągła gęstość mocy' powyżej 50 W/kg; lub

2. 'gęstość energii' powyżej 50 Wh/kg i 'ciągła gęstość mocy' powyżej 350 W/kg; lub

b. 'ogniwa wtórne' o 'gęstości energii' powyżej 350 Wh/kg w temperaturze 20 °C;

Uwagi techniczne:

1. Do celów pozycji 3A001.e.1 'gęstość energii' (Wh/kg) otrzymuje się, mnożąc napięcie znamionowe przez pojemność znamionową w amperogodzinach (Ah) i dzieląc powyższe przez masę w kilogramach. Jeżeli pojemność znamionowa nie jest podana, gęstość energii otrzymuje się przez podniesienie napięcia znamionowego do kwadratu, a następnie pomnożenie przez czas rozładowania wyrażony w godzinach oraz podzielenie przez obciążenie rozładowania wyrażone w omach i całkowitą masę ogniwa wyrażoną w kilogramach.

2. Do celów pozycji 3A001.e.1 'ogniwo' definiuje się jako urządzenie elektrochemiczne zawierające elektrody dodatnie i ujemne, elektrolit i będące źródłem energii elektrycznej. Jest to podstawowy element składowy baterii.

3. Do celów pozycji 3A001.e.1.a 'ogniwo pierwotne' jest 'ogniwem', które nie jest przeznaczone do ładowania z jakiegokolwiek innego źródła.

4. Do celów pozycji 3A001.e.1.b 'ogniwo wtórne' jest 'ogniwem', które jest przeznaczone do ładowania z zewnętrznego źródła energii elektrycznej.

5. Do celów pozycji 3A001.e.1.a 'ciągłą gęstość mocy' (W/kg) otrzymuje się, mnożąc napięcie znamionowe przez określony maksymalny ciągły prąd rozładowania w amperach (A) i dzieląc powyższe przez masę w kilogramach. 'Ciągła gęstość mocy' określana jest też jako moc specyficzna.

Uwaga: Pozycja 3A001.e.1 nie obejmuje kontrolą baterii, w tym również baterii pojedynczych.

2. wysokoenergetyczne kondensatory magazynujące, takie jak:

N.B. ZOB. TAKŻE pozycja 3A201.a. i wykaz uzbrojenia.

a. kondensatory o częstotliwości powtarzania poniżej 10 Hz (kondensatory jednokrotne) i spełniające wszystkie poniższe kryteria:

1. napięcie znamionowe równe lub wyższe niż 5 kV;

2. gęstość energii równa lub wyższa niż 250 J/kg; oraz

3. energia całkowita równa lub wyższa niż 25 kJ;

b. kondensatory o częstotliwości powtarzania 10 Hz lub wyższej (kondensatory powtarzalne) i spełniające wszystkie poniższe kryteria:

1. napięcie znamionowe równe lub wyższe niż 5 kV;

2. gęstość energii równa lub wyższa niż 50 J/kg;

3. energia całkowita równa lub wyższa niż 100 J; oraz

4. żywotność mierzona liczbą cykli ładowanie/rozładowanie wynosząca więcej niż 10 000;

3. "nadprzewodzące" elektromagnesy lub cewki, specjalnie zaprojektowane w sposób umożliwiający ich pełne ładowanie i rozładowanie w czasie mniejszym niż 1 s i spełniające wszystkie poniższe kryteria:

N.B. ZOB. TAKŻE POZYCJA 3A201.b.

Uwaga: Pozycja 3A001.e.3 nie obejmuje kontrolą elektromagnesów ani cewek "nadprzewodzących" specjalnie zaprojektowanych do aparatury obrazowania rezonansem magnetycznym (MRI), wykorzystywanej w medycynie.

a. energia dostarczona podczas wyładowania jest większa od 10 kJ w pierwszej sekundzie;

b. średnica wewnętrzna uzwojenia prądowego cewki wynosi powyżej 250 mm; oraz

c. zostały dostosowane do indukcji magnetycznej powyżej 8 T lub posiadają "całkowitą gęstość prądu" w uzwojeniu powyżej 300 A/mm2;

4. ogniwa słoneczne, zespoły ogniwo-łącznik-szkło osłonowe (CIC), panele słoneczne i baterie słoneczne klasy kosmicznej, mające minimalną średnią sprawność wyższą niż 20 % w temperaturze roboczej 301 K (28 °C) w symulowanym oświetleniu 'AM0' o irradiancji 1 367 watów na metr kwadratowy (W/m2);

Uwaga techniczna:

'AM0' lub 'masa powietrza zero' odpowiada irradiancji widmowej światła słonecznego w zewnętrznej atmosferze Ziemi przy odległości Ziemi od Słońca wynoszącej 1 jednostkę astronomiczną (AU).

f. urządzenia kodujące bezwzględne położenie o "dokładności" równej 1,0 sekundzie kątowej lub mniejszej (lepszej) oraz specjalnie do nich zaprojektowane kodujące pierścienie, tarcze lub skale;

g. półprzewodnikowe impulsowe tyrystorowe wyłączniki zasilania i 'moduły tyrystorowe' oparte na metodach wyłączania sterowanych elektrycznie, optycznie lub promieniowaniem elektronowym spełniające którekolwiek z poniższych kryteriów:

1. maksymalna szybkość narastania prądu włączenia (di/dt) większa niż 30 000 A/μs i napięcie w stanie wyłączenia większe niż 1 100 V; lub

2. maksymalna szybkość narastania prądu włączenia (di/dt) większa niż 2 000 A/μs i spełniające wszystkie poniższe kryteria:

a. napięcie szczytowe w stanie wyłączonym równe lub większe niż 3 000 V; oraz

b. prąd szczytowy (udarowy) równy lub większy niż 3 000 A.

Uwaga 1: Pozycja 3A001.g obejmuje:

- krzemowe prostowniki sterowane (SCR),

- tyrystory wyzwalane elektrycznie (ETT),

- tyrystory wyzwalane optycznie (LTT),

- tyrystory o komutowanej bramce (IGCT),

- tyrystory wyłączalne prądem bramki (GTO),

- tyrystory sterowane MOS (MCT),

- urządzenia typu Solidtron

Uwaga 2: Pozycja 3A001.g nie obejmuje kontrolą urządzeń tyrystorowych i 'modułów tyrystorowych' wbudowanych w urządzenia przeznaczone do zastosowań w kolejnictwie cywilnym lub "cywilnych statkach powietrznych".

Uwaga techniczna:

Do celów pozycji 3A001.g 'moduł tyrystorowy' zawiera co najmniej jedno urządzenie tyrystorowe.

h. półprzewodnikowe przełączniki mocy, diody mocy lub 'moduły' mocy spełniające wszystkie poniższe kryteria:

1. nominalna maksymalna temperatura robocza złącza wyższa niż 488 K (215 °C);

2. szczytowe powtarzalne napięcie w stanie wyłączonym (napięcie blokujące) przekraczające 300 V; oraz

3. prąd ciągły większy niż 1 A.

Uwaga 1: Szczytowe powtarzalne napięcie w stanie wyłączonym w pozycji 3A001.h obejmuje napięcie dren-źródło, napięcie kolektor-emiter, szczytowe powtarzalne napięcie wsteczne i szczytowe powtarzalne napięcie blokujące w stanie wyłączonym.

Uwaga 2: Pozycja 3A001.h obejmuje:

- tranzystory polowe złączowe (JFET),

- pionowe tranzystory polowe złączowe (VJFET),

- tranzystory polowe o strukturze metal-tlenek-półprzewodnik (MOSFET),

- podwójny dyfuzyjny tranzystor polowy o strukturze metal-tlenek-półprzewodnik (DMOSFET),

- tranzystor bipolarny z izolowaną bramką (IGBT),

- tranzystory z wysoką ruchliwością elektronów (HEMT),

- tranzystory bipolarne złączowe (BJT),

- tyrystory i krzemowe prostowniki sterowane (SCR),

- tyrystory wyłączalne prądem bramki (GTO),

- tyrystory wyłączalne emiterem (ETO),

- diody PiN

- diody Schottky'ego

Uwaga 3: Pozycja 3A001.h nie obejmuje kontrolą przełączników, diod ani 'modułów' znajdujących się w urządzeniach przeznaczonych do zastosowania w cywilnych pojazdach drogowych, cywilnych pojazdach kolejowych lub "cywilnych statkach powietrznych".

Uwaga techniczna:

Do celów pozycji 3A001.h 'moduły' zawierają jeden lub więcej półprzewodnikowych przełączników lub diod.

i. elektrooptyczne modulatory intensywności, amplitudy lub fazy, zaprojektowane do sygnałów analogowych i spełniające którekolwiek z poniższych kryteriów:

1. maksymalna częstotliwość robocza większa niż 10 GHz, ale mniejsza niż 20 GHz, optyczna tłumienność wtrąceniowa równa lub mniejsza niż 3 dB i spełniające którekolwiek z poniższych kryteriów:

a. 'napięcie półfalowe' ('Vπ') mniejsze niż 2,7 V przy pomiarze dla częstotliwości 1 GHz lub niższej; lub

b. 'Vπ' mniejsze niż 4 V przy pomiarze dla częstotliwości większej niż 1 GHz; lub

2. maksymalna częstotliwość robocza równa lub większa niż 20 GHz, optyczna tłumienność wtrąceniowa równa lub mniejsza niż 3 dB i spełniające którekolwiek z poniższych kryteriów:

a. 'Vπ' mniejsze niż 3,3 V przy pomiarze dla częstotliwości 1 GHz lub niższej; lub

b. 'Vπ' mniejsze niż 5 V przy pomiarze dla częstotliwości większej niż 1 GHz.

Uwaga: Pozycja 3A001.i obejmuje modulatory elektrooptyczne wyposażone w optyczne złącza wejściowe i wyjściowe (np. kable z włókien światłowodowych).

Uwaga techniczna:

Do celów pozycji 3A001.i. 'napięcie półfalowe' ('Vπ') oznacza zastosowane napięcie niezbędne do zmiany fazy o 180 stopni w długości fali świetlnej rozprzestrzenianej przez modulator optyczny.

3A002 Następujące "zespoły elektroniczne", moduły i sprzęt ogólnego przeznaczenia:

a. następujący sprzęt do rejestracji i oscyloskopy:

1. nieużywane;

2. nieużywane;

3. nieużywane;

4. nieużywane;

5. nieużywane;

6. cyfrowe rejestratory danych spełniające wszystkie poniższe kryteria:

a. posiadające trwałą 'przepustowość ciągłą' wyższą niż 6,4 Gbit/s do dysku lub napędu półprzewodnikowego; oraz

b. posiadające procesor, który przeprowadza analizę danych sygnału częstotliwości radiowych podczas ich rejestracji;

Uwagi techniczne:

1. W przypadku rejestratorów o równoległej architekturze szyn 'przepustowość ciągłą' określa się jako iloczyn największej prędkości transmisji słów i liczby bitów w słowie.

2. 'Przepustowość ciągła' oznacza największą prędkość rejestracji danych przez urządzenie na dysku lub w napędzie półprzewodnikowym, bez utraty informacji, z utrzymaniem prędkości cyfrowych danych wejściowych lub prędkości przetwarzania digitalizatora.

7. oscyloskopy czasu rzeczywistego, w których napięcie szumów średniokwadratowych (rms) ma wartość mniejszą niż 2 % pełnej skali przy nastawie skali pionowej zapewniającej najniższą wartość szumów dla któregokolwiek wejścia o paśmie 3-decybelowym równym 60GHz lub większym w kanale;

Uwaga: Pozycja 3A002.a.7. nie obejmuje kontrolą oscyloskopów pracujących w trybie próbkowania ekwiwalentnego (ETS).

b. nieużywane;

c. "analizatory sygnałów", takie jak:

1. "analizatory sygnałów", w których szerokość pasma o rozdzielczości 3 dB przekracza 40 MHz w dowolnym punkcie zakresu częstotliwości przekraczającego 31,8 GHz, lecz nieprzekraczającego 37 GHz;

2. "analizatory sygnałów", w których średni wyświetlany poziom szumu (DANL) jest mniejszy (lepszy) niż -150 dBm/Hz w dowolnym punkcie zakresu częstotliwości przekraczającego 43,5 GHz, lecz nieprzekraczającego 90 GHz;

3. "analizatory sygnałów" o częstotliwości powyżej 90 GHz;

4. "analizatory sygnałów" spełniające wszystkie poniższe kryteria:

a. "szerokość pasma" przekraczająca 170 MHz; oraz

b. spełniające którekolwiek z poniższych kryteriów:

1. 100 % prawdopodobieństwa odkrycia przy mniejszej niż 3 dB redukcji w stosunku do pełnej amplitudy w związku z przerwami lub okienkowaniem sygnałów o długości trwania wynoszącej 15 μs lub mniej; lub

2. posiadające funkcję 'wyzwalania maską częstotliwości' ze 100 % prawdopodobieństwem wyzwolenia (przechwycenia) dla sygnałów o długości trwania wynoszącej 15 μs lub mniej;

Uwagi techniczne:

1. 'Szerokość pasma czasu rzeczywistego' oznacza największy zakres częstotliwości, dla jakiego analizator może przekształcać w trybie ciągłym dane z domeny czasowej całkowicie w wyniki z domeny częstotliwości za pomocą transformacji Fouriera lub innej dyskretnej w czasie transformacji, która przetwarza każdy przychodzący punkt czasu bez powodowanego przez przerwy lub efekty okna (windowing) zmniejszania się mierzonej amplitudy o więcej niż 3 dB poniżej rzeczywistej amplitudy sygnału, i może jednocześnie wydać i wyświetlić przekształcone dane.

2. Prawdopodobieństwo odkrycia, o którym mowa w pozycji 3A002.c.4.b.1., określane jest również jako prawdopodobieństwo przechwycenia.

3. Do celów pozycji 3A002.c.4.b.1. czas trwania dla 100 % prawdopodobieństwa odkrycia równy jest minimalnej długości trwania sygnału niezbędnej dla określonej niepewności pomiaru poziomu.

4. 'Metoda wyzwalania maską częstotliwości' oznacza mechanizm, w którym funkcja wyzwalania jest zdolna do wybrania zakresu częstotliwości, który ma być wyzwalany, jako podzbioru odbieranej szerokości pasma, ignorując inne sygnały, które również mogą być obecne w tej samej odbieranej szerokości pasma. 'Metoda wyzwalania maską częstotliwości' może obejmować więcej niż jeden niezależny zbiór wartości granicznych.

Uwaga: Pozycja 3A002.c.4 nie obejmuje kontrolą analizatorów sygnałów", w których zastosowano jedynie filtry o stałoprocentowej szerokości pasma (znanych również jako filtry oktawowe lub ułamkowo-oktawowe).

5. nieużywane;

d. generatory sygnałów spełniające którekolwiek z poniższych kryteriów:

1. przewidziane według specyfikacji do generowania sygnałów modulowanych impulsowo spełniających wszystkie następujące kryteria, w dowolnym punkcie zakresu częstotliwości przekraczającego 31,8 GHz, lecz nieprzekraczającego 37 GHz:

a. 'czas trwania impulsu' krótszy niż 25 ns; oraz

b. stosunek on/off równy lub większy niż 65 dB;

2. moc wyjściowa przekraczająca 100 mW (20 dBm) w dowolnym punkcie zakresu częstotliwości przekraczającego 43,5 GHz, lecz nieprzekraczającego 90 GHz;

3. "czas przełączania częstotliwości" określony przez jeden z poniższych przypadków:

a. nieużywane;

b. krótszy niż 100 μs dla każdej zmiany częstotliwości przewyższającej 2,2 GHz w zakresie częstotliwości przekraczającym 4,8 GHz, ale nieprzekraczającym 31,8 GHz;

c. nieużywane;

d. krótszy niż 500 μs dla każdej zmiany częstotliwości przewyższającej 550 MHz w zakresie częstotliwości przekraczającym 31,8 GHz, ale nieprzekraczającym 37 GHz; lub

e. krótszy niż 100 μs dla każdej zmiany częstotliwości przewyższającej 2,2 GHz w zakresie częstotliwości przekraczającym 37 GHz, ale nieprzekraczającym 90 GHz;

f. nieużywane;

4. zakłócenie fazowe pojedynczej wstęgi bocznej (SSB) w dBc/Hz, spełniające którekolwiek z poniższych kryteriów:

a. mniejsze (lepsze) niż -(126 + 20log10F - 20log10f) w dowolnym punkcie w zakresie 10 Hz ≤ F ≤ 10 kHz w dowolnym punkcie zakresu częstotliwości przekraczającego 3,2 GHz lecz nieprzekraczającego 90 GHz; lub

b. mniejsze (lepsze) niż -(206- 20log10f) w dowolnym punkcie w zakresie 10 kHz < F ≤ 100 kHz w dowolnym punkcie zakresu częstotliwości przekraczającego 3,2 GHz lecz nieprzekraczającego 90 GHz; lub

Uwaga techniczna:

W pozycji 3A002.d.4 F oznacza przesunięcie w stosunku do częstotliwości roboczej w Hz, a f oznacza częstotliwość roboczą w MHz.

5. maksymalna częstotliwość przewyższająca 90 GHz;

Uwaga 1: Do celów pozycji 3A002.d generatory sygnałowe obejmują także generatory funkcji i przebiegów arbitralnych.

Uwaga 2: Pozycja 3A002.d nie obejmuje kontrolą sprzętu, w którym częstotliwość wyjściowa jest wytwarzana poprzez dodawanie lub odejmowanie dwóch lub więcej częstotliwości oscylatorów kwarcowych, lub poprzez dodawanie lub odejmowanie, a następnie mnożenie uzyskanego wyniku.

Uwagi techniczne:

1. Maksymalna częstotliwość generatora funkcji i przebiegów arbitralnych obliczana jest przez podzielenie częstotliwości próbkowania, w liczbie próbek na sekundę, przez współczynnik 2,5.

2. Do celów pozycji 3A002.d.1 'czas trwania impulsu' definiuje się jako czas upływający między momentem osiągnięcia przez zbocze narastające impulsu wartości 50 % amplitudy impulsu a momentem osiągnięcia przez zbocze opadające wartości 50 % amplitudy impulsu.

e. analizatory sieci spełniające którekolwiek z poniższych kryteriów:

1. moc wyjściowa przekraczająca 31,62 mW (15 dBm) w dowolnym punkcie zakresu częstotliwości roboczej przekraczającego 43,5 GHz, lecz nieprzekraczającego 90 GHz;

2. moc wyjściowa przekraczająca 1 mW (0 dBm) w dowolnym punkcie zakresu częstotliwości roboczej przekraczającego 90 GHz, lecz nieprzekraczającego 110 GHz;

3. 'funkcja pomiaru wektora nieliniowego' przy częstotliwościach przekraczających 50 GHz, ale nieprzekraczających 110 GHz; lub

Uwaga techniczna:

'Funkcja pomiaru wektora nieliniowego' to zdolność instrumentu do analizowania wyników testów urządzeń stosowanych w modelach wielkosygnałowych lub w zakresie zakłóceń nieliniowych.

4. maksymalna częstotliwość robocza przewyższająca 110 GHz;

f. kontrolne odbiorniki mikrofalowe spełniające wszystkie poniższe kryteria:

1. maksymalna częstotliwość robocza przewyższająca 110 GHz; oraz

2. posiadające możliwość jednoczesnego pomiaru amplitudy i fazy;

g. atomowe wzorce częstotliwości, które spełniają którekolwiek z poniższych kryteriów:

1. są "klasy kosmicznej";

2. są nierubidowe, a ich stabilność długookresowa jest mniejsza (lepsza) niż 1 × 10-11/miesiąc; lub

3. nie są "klasy kosmicznej" i spełniają wszystkie poniższe kryteria:

a. są rubidowymi wzorcami częstotliwości;

b. ich stabilność długookresowa jest mniejsza (lepsza) niż 1 × 10-11/miesiąc; oraz

c. ich całkowite zużycie energii jest niższe niż 1 W;

h. "Zespoły elektroniczne", moduły i sprzęt, przewidziane do wykonywania wszystkich następujących funkcji:

1. przetwarzanie analogowo-cyfrowe spełniające dowolne z następujących kryteriów:

a. rozdzielczość 8 bitów lub więcej, lecz poniżej 10 bitów i "częstotliwość próbkowania" większa niż 1,3 giga próbek/sek (GSPS);

b. rozdzielczość 10 bitów lub więcej, lecz poniżej 12 bitów i "częstotliwość próbkowania" większa niż 1,0 GSPS;

c. rozdzielczość 12 bitów lub więcej, lecz poniżej 14 bitów i "częstotliwość próbkowania" większa niż 1,0 GSPS;

d. rozdzielczość 14 bitów lub więcej, lecz poniżej 16 bitów i "częstotliwość próbkowania" większa niż 400 mega próbek/sek (MSPS); lub

e. rozdzielczość 16 bitów lub więcej i "częstotliwość próbkowania" większa niż 180 MSPS; oraz

2. dowolne z następujących funkcji:

a. wyjście danych przetworzonych cyfrowo;

b. przechowywanie danych przetworzonych cyfrowo; lub

c. przetwarzanie danych przetworzonych cyfrowo;

N.B. Cyfrowe rejestratory danych, oscyloskopy, "analizatory sygnału", generatory sygnału, analizatory sieci oraz kontrolne odbiorniki mikrofalowe są wyszczególnione odpowiednio w pozycjach 3A002.a.6., 3A002.a.7., 3A002.c., 3A002.d., 3A002.e. oraz 3A002.f.

Uwagi techniczne:

1. Rozdzielczość n bitów odpowiada kwantowaniu na 2n poziomach.

2. Rozdzielczość przetwornika ADC oznacza liczbę bitów wyjścia cyfrowego ADC odpowiadającą pomiarowi wejścia analogowego. Efektywnej liczby bitów (ENOB) nie stosuje się do określania rozdzielczości ADC.

3. W przypadku nieprzeplatanych wielokanałowych "zespołów elektronicznych", modułów lub sprzętu "częstotliwość próbkowania" nie jest agregowana i "częstotliwość próbkowania" jest maksymalną wielkością pojedynczego kanału.

4. W przypadku kanałów wplecionych w wielokanałowych "zespołach elektronicznych", modułach lub sprzęcie "częstotliwości próbkowania" są agregowane i "częstotliwość próbkowania" jest maksymalną łączną całkowitą częstotliwością wplecionych kanałów.

Uwaga: Pozycja 3A002.h.obejmuje karty ADC, przetworniki falowe, karty zbierania danych, tablice przyjmowania sygnału oraz rejestratory stanów przejściowych.

3A003 Systemy sterowania temperaturą z chłodzeniem natryskowym, wykorzystujące umieszczone w uszczelnionych obudowach urządzenia z zamkniętym obiegiem do transportu i regenerowania płynu, w których płyn dielektryczny jest przy użyciu specjalnie zaprojektowanych dysz rozpylany na elementy elektroniczne w celu utrzymania ich w dopuszczalnym przedziale temperatur pracy, a także specjalnie zaprojektowane do nich części składowe.

3A101 Sprzęt, przyrządy i elementy elektroniczne, inne niż wyszczególnione w pozycji 3A001, takie jak:

a. przetworniki analogowo-cyfrowe, wykorzystywane w "pociskach rakietowych", spełniające wymagania wojskowe dla urządzeń odpornych na wstrząsy;

b. akceleratory zdolne do generowania promieniowania elektromagnetycznego, wytwarzanego w wyniku hamowania elektronów o energii 2 MeV lub większej oraz systemy zawierające takie akceleratory.

Uwaga: Pozycja 3A101.b nie określa sprzętu specjalnie zaprojektowanego do zastosowań medycznych.

3A102 'Baterie termiczne' zaprojektowane lub zmodyfikowane dla 'pocisków rakietowych'

Uwagi techniczne:

1. W pozycji 3A102 'baterie termiczne' oznaczają baterie jednorazowego użycia zawierające jako elektrolit nieprzewodzący sól nieorganiczną w stanie stałym. Baterie te zawierają materiał pirolityczny, który po zapaleniu topi elektrolit i uruchamia baterię.

2. W pozycji 3A102 'pociski rakietowe' oznaczają kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych, o zasięgu przekraczającym 300 km.

3A201 Podzespoły elektroniczne, inne niż wyszczególnione w pozycji 3A001, takie jak:

a. kondensatory posiadające jeden z następujących zestawów cech:

1. a. napięcie znamionowe większe niż 1,4 kV;

b. zgromadzona energia większa niż 10 J;

c. reaktancja pojemnościowa większa niż 0,5 μF; oraz

d. indukcyjność szeregowa mniejsza niż 50 nH; lub

2. a. napięcie znamionowe większe niż 750 V;

b. reaktancja pojemnościowa większa niż 0,25 μF; oraz

c. indukcyjność szeregowa mniejsza niż 10 nH;

b. nadprzewodnikowe elektromagnesy solenoidalne posiadające wszystkie niżej wymienione cechy:

1. zdolne do wytwarzania pól magnetycznych o natężeniu większym niż 2 T;

2. o stosunku długości do średnicy wewnętrznej większym niż 2;

3. o średnicy wewnętrznej większej niż 300 mm; oraz

4. wytwarzające pole magnetyczne o równomierności rozkładu lepszej niż 1 % w zakresie środkowych 50 % objętości wewnętrznej.

Uwaga: Pozycja 3A201.b nie obejmuje kontrolą magnesów specjalnie zaprojektowanych i eksportowanych 'jako części' medycznych systemów do obrazowania metodą jądrowego rezonansu magnetycznego (NMR). Sformułowanie 'jako części' niekoniecznie oznacza fizyczną część wchodzącą w skład tej samej partii wysyłanego wyrobu; dopuszcza się możliwość oddzielnych wysyłek z różnych źródeł, pod warunkiem że w towarzyszącej im dokumentacji eksportowej wyraźnie określa się, że wysyłane wyroby są dostarczane 'jako część' systemu obrazowania.

c. generatory błyskowe promieniowania rentgenowskiego lub impulsowe akceleratory elektronów posiadające jeden z następujących zestawów cech:

1. a. energia szczytowa akceleratora elektronów równa 500 keV lub większa, ale mniejsza niż 25 MeV; oraz

b. 'współczynnik dobroci' (K) równy 0,25 lub większy; lub

2. a. energia szczytowa akceleratora elektronów równa 25 MeV lub większa; oraz

b. 'moc szczytowa' powyżej 50 MW.

Uwaga: Pozycja 3A201.c nie obejmuje kontrolą akceleratorów stanowiących elementy składowe urządzeń zaprojektowanych do innych celów niż wytwarzanie wiązek elektronów lub promieniowania rentgenowskiego (np. mikroskopy elektronowe) ani urządzeń zaprojektowanych do zastosowań medycznych.

Uwagi techniczne:

1. 'Współczynnik dobroci' K jest zdefiniowany jako:

K = 1,7 × 103V2,65Q

gdzie V jest szczytową energią elektronów w milionach elektronowoltów.

Jeżeli czas trwania impulsu wiązki akceleratora jest równy 1 μs lub krótszy, to Q jest całkowitym ładunkiem przyspieszanym, wyrażonym w kulombach. Jeżeli czas trwania impulsu wiązki akceleratora jest większy niż 1 μs, to Q jest maksymalnym ładunkiem przyspieszanym w 1 μs.

Q równa się całce z i po t, w przedziale o długości równym mniejszej z dwóch wartości: 1 μs lub czasu trwania impulsu wiązki (Q = ∫ idt), gdzie i jest prądem wiązki w amperach, a t jest czasem w sekundach;

2. 'Moc szczytowa' = (napięcie szczytowe w woltach) × (szczytowy prąd wiązki w amperach).

3. W maszynach bazujących na mikrofalowych akceleratorach rezonatorowych czas trwania impulsu wiązki jest mniejszą z następujących dwóch wartości: 1 μs lub czas emisji pakietu wiązek wynikających z jednego impulsu modulatora mikrofalowego.

4. W maszynach bazujących na mikrofalowych akceleratorach rezonatorowych szczytowa wartość prądu wiązki jest wartością średnią prądu podczas emisji pakietu wiązek.

3A225 Przemienniki częstotliwości lub generatory, inne niż wyszczególnione w pozycji 0B001.b.13, które mogą być używane jako napęd silnikowy zmiennej lub stałej częstotliwości, posiadające wszystkie niżej wymienione cechy:

N.B.1 "Oprogramowanie" specjalnie zaprojektowane w celu poprawy lub wykorzystania wydajności przemiennika częstotliwości lub generatora, tak by odpowiadały cechom pozycji 3A225 jest wymienione w pozycji 3D225.

N.B.2 "Technologia" w postaci kodów lub kluczy, służąca do poprawy lub wykorzystania wydajności przemiennika częstotliwości lub generatora, tak by odpowiadały cechom pozycji 3A225 jest wymieniona w pozycji 3E225.

a. wyjście wielofazowe zapewniające moc równą 40 W lub większą;

b. pracujące w zakresie częstotliwości równym lub większym niż 600 Hz; oraz

c. dokładność regulacji częstotliwości lepsza (mniejsza) niż 0,2 %.

Uwaga: Pozycja 3A225 nie obejmuje kontrolą przemienników częstotliwości lub generatorów, jeśli posiadają osprzęt, "oprogramowanie" lub "technologię", których pewne cechy ograniczają skuteczność bądź wydajność do poziomu niższego niż określony powyżej, pod warunkiem że spełniają którekolwiek z poniższych kryteriów:

1. w celu dokonania w nich ulepszeń lub zmniejszenia ograniczeń muszą zostać odesłane do pierwotnego producenta;

2. w celu poprawy lub wykorzystania wydajności, pozwalających na spełnienie wymogów wymienionych w pozycji 3A225 wymagają "oprogramowania" określonego w pozycji 3D225; lub

3. w celu poprawy lub wykorzystania wydajności, pozwalających na spełnienie wymogów wymienionych w pozycji 3A225 wymagają "technologii" w postaci kluczy lub kodów określonej w pozycji 3E225;

Uwagi techniczne:

1. Przemienniki częstotliwości w pozycji 3A225 nazywane są również konwerterami lub inwerterami.

2. Przemienniki częstotliwości w pozycji 3A225 mogą być wprowadzane na rynek jako generatory, elektroniczne urządzenia testowe, zasilacze prądu zmiennego, napędy silnikowe zmiennej prędkości, napędy zmiennej prędkości (VSD), falowniki, napędy z regulowaną częstotliwością (AFD) lub napędy z regulowaną prędkością (ASD).

3A226 Wysokonapięciowe zasilacze prądu stałego, inne niż wyszczególnione w pozycji 0B001.j.6, posiadające obydwie niżej wymienione cechy:

a. zdolność do ciągłego wytwarzania, przez okres 8 godzin, napięcia 100 V lub większego z wyjściem prądowym 500 A lub większym; oraz

b. stabilność prądu lub napięcia, przez okres 8 godzin, lepsza niż 0,1 %.

3A227 Wysokoenergetyczne zasilacze prądu stałego, inne niż wyszczególnione w pozycji 0B001.j.5, posiadające obydwie niżej wymienione cechy:

a. zdolność do ciągłego wytwarzania, przez okres 8 godzin, napięcia 20 kV lub większego z wyjściem prądowym 1 A lub większym; oraz

b. stabilność prądu lub napięcia, przez okres 8 godzin, lepsza niż 0,1 %.

3A228 Następujące urządzenia przełączające:

a. lampy elektronowe o zimnej katodzie, bez względu na to, czy są napełnione gazem, czy też nie, pracujące podobnie do iskiernika i posiadające wszystkie niżej wymienione cechy:

1. składające się z trzech lub więcej elektrod;

2. szczytowa wartość napięcia anody 2,5 kV lub więcej;

3. szczytowa wartość natężenia prądu anodowego równa 100 A lub więcej; oraz

4. czas zwłoki dla anody równy 10 μs lub mniej;

Uwaga: Pozycja 3A228 obejmuje gazowe lampy kriotronowe i próżniowe lampy sprytronowe.

b. iskierniki wyzwalane, posiadające obydwie niżej wymienione cechy:

1. czas zwłoki dla anody równy 15 μs lub mniej; oraz

2. przystosowane do znamionowych prądów szczytowych równych 500 A lub większych;

c. moduły lub zespoły do szybkiego przełączania funkcji, inne niż wyszczególnione w pozycji 3A001.g lub 3A001.h, posiadające wszystkie niżej wymienione cechy:

1. szczytowa wartość napięcia anody równa 2 kV lub więcej;

2. szczytowa wartość natężenia prądu anodowego równa 500 A lub więcej; oraz

3. czas włączania równy 1 μs lub mniej.

3A229 Generatory impulsów wysokoprądowych, takie jak:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

a. Zestawy zapłonowe do detonatorów (zapalniki, zapłonniki), w tym zestawy zapłonowe uruchamiane elektronicznie, eksplozją i optycznie, inne niż te wymienione w pozycji 1A007.a., zaprojektowane do uruchamiania kontrolowanych detonatorów wielokrotnych wymienionych w pozycji 1A007.b.;

b. modułowe generatory impulsów elektrycznych (impulsatory) posiadające wszystkie niżej wymienione cechy:

1. zaprojektowane do urządzeń przenośnych, przewoźnych lub innych narażonych na wstrząsy;

2. zdolne do dostarczenia swojej energii w czasie krótszym niż 15 μs przy obciążeniu poniżej 40 Ω;

3. posiadające wyjście prądowe powyżej 100 A;

4. żaden z wymiarów nie przekracza 30 cm;

5. masa mniejsza niż 30 kg; oraz

6. zaprojektowane do pracy w rozszerzonym zakresie temperatur 223 K (-50 °C) do 373 K (100 °C) lub nadające się do stosowania w przestrzeni powietrznej.

Uwaga: Pozycja 3A229.b obejmuje wzbudnice ksenonowych lamp błyskowych.

c. jednostki mikrowyładowcze posiadające wszystkie z następujących cech:

1. żaden z wymiarów nie przekracza 35 mm;

2. napięcie znamionowe równe lub większe niż 1 kV; oraz

3. reaktancja pojemnościowa równa lub większa niż 100 nF.

3A230 Szybkie generatory impulsowe oraz ich 'głowice impulsowe', posiadające obydwie niżej wymienione cechy:

a. napięcie wyjściowe większe niż 6 V, przy obciążeniu rezystancyjnym mniejszym niż 55 Ω; oraz

b. 'czas narastania impulsów' mniejszy niż 500 ps.

Uwagi techniczne:

1. W pozycji 3A230 'czas narastania impulsów' definiuje się jako przedział czasowy pomiędzy 10 % a 90 % amplitudy napięcia.

2. 'Głowice impulsowe' oznaczają sieci formowania impulsów zaprojektowane do przyjmowania funkcji skokowej napięcia i kształtowania różnych przebiegów, np. prostokątnych, trójkątowych, skokowych, impulsowych lub wykładniczych. 'Głowice impulsowe' mogą stanowić integralną część generatora impulsów, moduł podłączany do urządzenia lub też zewnętrznie podłączane urządzenie.

3A231 Generatory neutronów, w tym lampy, mające obie następujące właściwości:

a. zaprojektowane do pracy bez zewnętrznych instalacji próżniowych; oraz

b. wykorzystujące którekolwiek z poniższych:

1. przyspieszanie elektrostatyczne do wzbudzania reakcji jądrowej trytu z deuterem, lub

2. przyspieszanie elektrostatyczne do wzbudzania reakcji jądrowej deuteru z deuterem i pozwalające uzyskać wynik 3 × 109 neutronów/s lub większy.

3A232 Następujące wielopunktowe instalacje inicjujące, inne niż wymienione w pozycji 1A007:

N.B. ZOB. TAKŻE WYKAZ UZBROJENIA.

N.B. Zob. pozycja 1A007.b w odniesieniu do detonatorów.

a. nieużywane;

b. instalacje z detonatorami pojedynczymi lub wielokrotnymi, przeznaczone do prawie równoczesnego inicjowania wybuchów na obszarze większym niż 5 000 mm2 za pomocą pojedynczego sygnału zapłonowego przy opóźnieniu synchronizacji na całej powierzchni mniejszym niż 2,5 μs.

Uwaga: Pozycja 3A232 nie obejmuje kontrolą zapłonników wykorzystujących wyłącznie inicjujące materiały wybuchowe, takie jak azydek ołowiawy.

3A233 Następujące spektrometry masowe, inne niż wyszczególnione w pozycji 0B002.g, zdolne do pomiaru mas jonów o wartości 230 jednostek masy atomowej lub większej oraz posiadające rozdzielczość lepszą niż 2 części na 230, oraz źródła jonów do tych urządzeń:

a. plazmowe spektrometry masowe ze sprzężeniem indukcyjnym (ICP/MS);

b. jarzeniowe spektrometry masowe (GDMS);

c. termojonizacyjne spektrometry masowe (TIMS);

d. spektrometry masowe z zespołami do bombardowania elektronami posiadające obydwie poniższe cechy:

1. układ wlotowy wiązki molekularnej, który wprowadza skolimowaną wiązkę molekuł do celów analitycznych w rejon źródła jonów, gdzie molekuły są jonizowane przez wiązkę elektronów; oraz

2. co najmniej jedną 'wymrażarkę', którą można schłodzić do temperatury 193 K (- 80 °C);

e. nieużywane;

f. spektrometry masowe ze źródłem jonów do mikrofluoryzacji zaprojektowane do pracy w obecności aktynowców lub fluorków aktynowców.

Uwagi techniczne:

1. Spektrometry masowe z zespołami do bombardowania elektronami wymienione w pozycji 3A233.d. znane są również jako spektrometry masowe z jonizacją strumieniem elektronów lub spektrometry masowe z jonizacją elektronową.

2. W pozycji 3A233.d.2. 'wymrażarka' jest urządzeniem, które przechwytuje molekuły gazu, kondensując je lub zamrażając na zimnych powierzchniach. Do celów pozycji 3A233.d.2. kriogeniczna pompa próżniowa z zamkniętym obwodem helu w stanie gazowym nie jest 'wymrażarką'.

3A234 Linie paskowe zapewniające ścieżkę o małej indukcyjności do detonatorów, posiadające następujące cechy:

a. napięcie znamionowe większe niż 2 kV; oraz

b. indukcyjność mniejsza niż 20 nH.

3B Urządzenia testujące, kontrolne i produkcyjne

3B001 Sprzęt do wytwarzania urządzeń lub materiałów półprzewodnikowych oraz specjalnie zaprojektowane do niego części składowe i akcesoria, w tym:

N.B. ZOB. TAKŻE POZYCJA 2B226.

a. następujący sprzęt zaprojektowany do osadzania warstwy epitaksjalnej:

1. sprzęt zaprojektowany lub zmodyfikowany do wytwarzania powłok o równomiernej grubości z materiałów różnych od krzemu, wykonanych z dokładnością poniżej ± 2,5 % na odcinku o długości 75 mm lub większym;

Uwaga: Pozycja 3B001.a.1 obejmuje urządzenia do epitaksji warstw atomowych.

2. reaktory do osadzania z par lotnych związków metaloorganicznych (MOCVD), specjalnie zaprojektowane do wytwarzania warstw epitaksjalnych półprzewodników z materiałów posiadających co najmniej dwa następujące pierwiastki: glin, gal, ind, arsen, fosfor, antymon lub azot;

3. sprzęt wykorzystujący wiązkę molekularną do wytwarzania warstw epitaksjalnych z surowca gazowego lub stałego;

b. sprzęt zaprojektowany do implantacji jonów i spełniający którekolwiek z poniższych kryteriów:

1. nieużywane;

2. zaprojektowany i optymalizowany do działania z energią wiązki wynoszącą 20 keV lub więcej i prądem wiązki o wartości 10 mA lub więcej w celu implantacji wodoru, deuteru lub helu;

3. zdolność bezpośredniego zapisu;

4. posiadający energię wiązki wynoszącą 65 keV lub większą oraz natężenie wiązki równe 45 mA lub większe, w celu wysokoenergetycznej implantacji tlenu w podgrzany półprzewodnikowy materiał "podłoża"; lub

5. zaprojektowany i optymalizowany do działania z energią wiązki wynoszącą 20 keV lub więcej i prądem wiązki o wartości 10 mA lub więcej w celu implantacji krzemu w półprzewodnikowy materiał "podłoża" podgrzany do temperatury 600 °C lub wyższej;

c. nieużywane;

d. nieużywane;

e. automatycznie ładujące się, wielokomorowe, centryczne systemy do wytwarzania płytek elektronicznych spełniające wszystkie poniższe kryteria:

1. interfejsy wejściowe i wyjściowe do płytek, zaprojektowane z myślą o podłączeniu więcej niż dwóch pełniących różne funkcje 'urządzeń do produkcji półprzewodników' wymienionych w poz. 3B001.a.1., 3B001.a.2., 3B001.a.3 lub 3B001.b.; oraz

2. zaprojektowane do tworzenia zintegrowanego systemu, działającego w warunkach próżni, do 'sekwencyjnego wytwarzania płytek metodą powielania';

Uwaga: Pozycja 3B001.e nie obejmuje kontrolą automatycznych zrobotyzowanych systemów wytwarzania płytek elektronicznych, specjalnie zaprojektowanych do równoległego wytwarzania płytek.

Uwagi techniczne:

1. Do celów poz. 3B001.e 'urządzenia do produkcji półprzewodników' to urządzenia modularne umożliwiające zachodzenie procesów fizycznych wymaganych do wytwarzania półprzewodników; pełnią one różne funkcje, takie jak: osadzanie, implantacja lub obróbka cieplna.

2. Do celów poz. 3B001.e 'sekwencyjne wytwarzanie płytek metodą powielania' oznacza zdolność do obrabiania każdej płytki w innym 'urządzeniu wytwarzającym półprzewodniki', np. przez przeniesienie każdej płytki z jednego urządzenia do drugiego i do kolejnego przy pomocy automatycznego wielokomorowego centralnego systemu podawania płytek.

f. następujący sprzęt litograficzny:

1. sprzęt do wytwarzania płytek elektronicznych poprzez pozycjonowanie, naświetlanie oraz powielanie (bezpośredni krok na płytkę) lub skanowanie (skaner), z wykorzystaniem metody fotooptycznej lub promieni rentgenowskich, spełniający którekolwiek z poniższych kryteriów:

a. źródło światła o długości fali krótszej niż 193 nm; lub

b. zdolny do wytwarzania wzorów o 'rozmiarze minimalnej rozdzielczości wymiarowej' (MRF) 45 nm lub mniejszej;

Uwaga techniczna:

'Rozmiar minimalnej rozdzielczości wymiarowej' (MRF) obliczany jest według poniższego wzoru:

gdzie współczynnik K = 0,35

2. urządzenia do litografii nanodrukowej zdolne do drukowania elementów o wielkości 45 nm lub mniejszych;

Uwaga: Pozycja 3B001.f.2 obejmuje:

- narzędzia do mikrodruku kontaktowego,

- narzędzia do wytłaczania na gorąco,

- narzędzia do litografii nanodrukowej,

- narzędzia do litografii "step-and-fash" (S-FIL).

3. sprzęt specjalnie zaprojektowany do wytwarzania masek, spełniający wszystkie poniższe kryteria:

a. posiadający odchylaną, zogniskowaną wiązkę elektronów, jonów lub wiązkę "laserową"; oraz

b. spełniający którekolwiek z poniższych kryteriów:

1. apertura plamki dla szerokości piku w połowie jego wysokości poniżej 65 nm i umiejscowienie obrazu poniżej 17 nm (średnia + 3 sigma); lub

2. nieużywane;

3. błąd nakładania drugiej warstwy mniejszy niż 23 nm (średnia + 3 sigma) na maskę;

4. Sprzęt zaprojektowany do wytwarzania przyrządów wykorzystujący metody bezpośredniego nadruku i spełniający wszystkie poniższe kryteria:

a. wykorzystujący odchylaną, zogniskowaną wiązkę elektronów; oraz

b. spełniający którekolwiek z poniższych kryteriów:

1. minimalny rozmiar wiązki równy lub mniejszy niż 15 nm; lub

2. błąd nakładania warstwy mniejszy niż 27 nm (średnia + 3 sigma);

g. maski i siatki optyczne zaprojektowane do układów scalonych wyszczególnionych w pozycji 3A001;

h. maski wielowarstwowe z warstwą z przesunięciem fazowym niewyszczególnione w pozycji 3B001.g. i spełniające którekolwiek z poniższych kryteriów:

1. wykonane na masce "półprodukt podłoży" ze szkła, którego dwójłomność zgodnie ze specyfikacją wynosi poniżej 7 nm/cm; lub

2. zaprojektowane do stosowania w urządzeniach litograficznych, w których długość fali źródła światła jest mniejsza niż 245 nm;

Uwaga: Pozycja 3B001.h nie obejmuje kontrolą wielowarstwowych masek z warstwą z przesunięciem fazowym, zaprojektowanych do wytwarzania urządzeń pamięciowych, niewymienionych w pozycji 3A001.

i. szablony do litografii nanodrukowej układów scalonych wyszczególnionych w pozycji 3A001.

j. "półprodukty podłoży" maski z wielowarstwową strukturą reflektora składającą się z molibdenu i krzemu oraz spełniające wszystkie poniższe kryteria:

1. specjalnie zaprojektowane do litografii w paśmie 'ekstremalny nadfiolet' ('EUV'); oraz

2. zgodne ze standardem SEMI P37.

Uwaga techniczna:

'Ekstremalny nadfiolet' ('EUV') odnosi się do długości fali widma fal elektromagnetycznych większej niż 5 nm i mniejszej niż 124 nm.

3B002 Następujący sprzęt testujący specjalnie zaprojektowany do testowania gotowych i niegotowych elementów półprzewodnikowych oraz specjalnie zaprojektowane do niego części składowe i akcesoria:

a. do testowania S-parametrów produktów wyszczególnionych w pozycji 3A001.b.3.

b. nieużywane;

c. do testowania produktów wyszczególnionych w pozycji 3A001.b.2.

3C Materiały

3C001 Materiały heteroepitaksjalne składające się z "podłoża" i wielu nałożonych epitaksjalnie warstw z któregokolwiek z poniższych:

a. krzemu (Si);

b. germanu (Ge);

c. węglika krzemu (SiC); lub

d. "związków III/V" galu lub indu.

Uwaga: Pozycja 3C001.d. nie obejmuje kontrolą "podłoża" posiadającego co najmniej jedną warstwę epitaksjalną typu P z GaN, InGaN, AlGaN, InAlN, InAlGaN, GaP, GaAs, AlGaAs, InP, InGaP, AlInP lub InGaAlP, bez względu na kolejność pierwiastków, z wyjątkiem sytuacji, gdy warstwa epitaksjalna typu P znajduje się między warstwami typu N.

3C002 Następujące materiały fotorezystywne i "podłoża" powlekane następującymi materiałami ochronnymi:

a. następujące materiały fotorezystywne zaprojektowane do litografii półprzewodnikowej:

1. materiały fotorezystywne pozytywowe wyregulowane (zoptymalizowane) do stosowania w zakresie długości fali poniżej 193 nm, ale równej lub powyżej 15 nm;

2. materiały fotorezystywne wyregulowane (zoptymalizowane) do stosowania w zakresie długości fali poniżej 15 nm, ale większej niż 1 nm;

b. wszystkie materiały fotorezystywne zaprojektowane do użytku z wiązkami elektronowymi lub jonowymi, o czułości 0,01 μC/mm2 lub lepszej;

c. nieużywane;

d. wszystkie materiały fotorezystywne zoptymalizowane do technologii tworzenia obrazów powierzchniowych;

e. wszystkie materiały fotorezystywne zaprojektowane lub zoptymalizowane do użytku z urządzeniami do litografii nanodrukowej wyszczególnionymi w pozycji 3B001.f.2 wykorzystującymi proces termiczny lub proces fotoutwardzania.

3C003 Związki organiczno-nieorganiczne, takie jak:

a. związki metaloorganiczne glinu, galu lub indu o czystości (na bazie metalu) powyżej 99,999 %;

b. związki arsenoorganiczne, antymonoorganiczne i fosforoorganiczne o czystości (na bazie składnika nieorganicznego) powyżej 99,999 %.

Uwaga: Pozycja 3C003 obejmuje kontrolą wyłącznie związki, w których składnik metalowy, częściowo metalowy lub składnik niemetalowy jest bezpośrednio związany z węglem w organicznym składniku molekuły.

3C004 Wodorki fosforu, arsenu lub antymonu o czystości powyżej 99,999 %, nawet rozpuszczone w gazach obojętnych lub w wodorze.

Uwaga: Pozycja 3C004 nie obejmuje kontrolą wodorków zawierających molowo 20 %, lub więcej, gazów obojętnych lub wodoru.

3C005 Następujące materiały o wysokiej rezystywności:

a. "Podłoża" półprzewodnikowe z węglika krzemu (SiC), azotku galu (GaN), azotku glinu (AlN) lub z azotku galu i glinu (AlGaN), lub wlewki, monokryształy lub inne preformy tych materiałów o rezystywności powyżej 10 000 Ω-cm w temperaturze 20 °C;

b. "Podłoża" polikrystaliczne lub ceramiczne "podłoża" polikrystaliczne, o rezystywności powyżej 10 000 Ω-cm w temperaturze 20 °C, posiadające co najmniej jedną nieepitaksjalną monokrystaliczną warstwę z krzemu (Si), węglika krzemu (SiC), azotku galu (GaN), azotku glinu (AlN) lub azotku galu i glinu (AlGaN) na powierzchni "podłoża".

3C006 Materiały, niewymienione w pozycji 3C001, składające się z "podłoża" wyszczególnionego w pozycji 3C005 z co najmniej jedną warstwą epitaksjalną z węglika krzemu, azotku galu, azotku glinu lub azotku galu i glinu.

3D Oprogramowanie

3D001 "Oprogramowanie" specjalnie zaprojektowane do "rozwoju" lub "produkcji" sprzętu objętego kontrolą, wymienionego w pozycji 3A001.b do 3A002.h, lub 3B.

3D002 "Oprogramowanie" specjalnie zaprojektowane do "użytkowania" sprzętu wymienionego w pozycjach 3B001.a do 3B001.f, w pozycji 3B002 lub w pozycji 3A225.

3D003 "Oprogramowanie" symulacyjne, 'bazujące na fizyce', specjalnie zaprojektowane do "rozwoju" procesów litografii, wytrawiania lub osadzania w celu przekształcenia maskujących kształtów w konkretną topografię obszarów przewodzących, dielektrycznych lub półprzewodnikowych.

Uwaga techniczna:

'Bazujące na fizyce' w pozycji 3D003 oznacza wykorzystanie obliczeń do określenia sekwencji przyczyn fizycznych oraz skutków zdarzeń, opierających się na właściwościach fizycznych (np. temperatura, ciśnienie, stałe dyfuzji oraz właściwości materiałów półprzewodnikowych).

Uwaga: Biblioteki, związane z nimi atrybuty i inne dane służące do projektowania urządzeń półprzewodnikowych lub układów scalonych są postrzegane jako "technologia".

3D004 "Oprogramowanie" specjalnie zaprojektowane do "rozwoju" sprzętu wymienionego w pozycji 3A003.

3D101 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" sprzętu wymienionego w pozycji 3A101.b.

3D22 "Oprogramowanie" specjalnie zaprojektowane w celu poprawy lub wykorzystania wydajności przemienników częstotliwości lub generatorów, tak by odpowiadały cechom wymienionym w pozycji 3A225.

3E Technologia

3E001 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" sprzętu lub materiałów wyszczególnionych w pozycji 3A, 3B lub 3C.

Uwaga 1: Pozycja 3E001 nie obejmuje kontrolą "technologii" dotyczącej sprzętu lub części składowych wyszczególnionych w pozycji 3A003.

Uwaga 2: Pozycja 3E001 nie obejmuje kontrolą "technologii" dotyczącej układów scalonych wyszczególnionych w pozycji 3A001.a.3 do 3A001.a.12 spełniających wszystkie poniższe kryteria:

a. zastosowanie "technologii" na poziomie 0,130 μm lub powyżej; oraz

b. posiadające strukturę wielowarstwową z nie więcej niż trzema warstwami metalu.

Uwaga 3: Pozycja 3E001 nie obejmuje kontrolą 'narzędzi projektowania procesów' ('PDK'), chyba że obejmują one biblioteki wdrażające funkcje lub technologie dla produktów wymienionych w pozycji 3A001.

Uwaga techniczna:

'Narzędzie projektowania procesów' ('PDK') oznacza oprogramowanie dostarczane przez producenta półprzewodnika w celu zapewnienia uwzględnienia wymaganych praktyk i zasad projektowania, aby pomyślnie wyprodukować określony model układu scalonego w określonym procesie produkcji półprzewodników, zgodnie z ograniczeniami technologicznymi i produkcyjnymi (każdy proces wytwarzania półprzewodników ma swój własny 'PDK').

3E002 "Technologia", zgodnie z uwagą ogólną do technologii, inna niż wyszczególnione w pozycji 3E001, do "rozwoju" lub "produkcji" "układu mikroprocesorowego", "układu mikrokomputerowego" lub rdzenia układu mikrosterowników posiadającego jednostkę arytmetyczno-logiczną z szyną dostępu na 32 bity lub więcej i którąkolwiek z poniższych właściwości:

a. 'procesor wektorowy' zaprojektowany do jednoczesnego wykonywania więcej niż dwu operacji na wektorach zmiennoprzecinkowych (jednowymiarowych tablicach złożonych z liczb 32-bitowych lub dłuższych);

Uwaga techniczna:

'Procesor wektorowy' jest zdefiniowany jako procesor wyposażony w wewnętrzne instrukcje pozwalające równocześnie wykonywać wielokrotne operacje na wektorach zmiennoprzecinkowych (jednowymiarowych tablicach złożonych z liczb 32-bitowych lub dłuższych), posiadający co najmniej jedną jednostkę wektorową arytmetyczno-logiczną i rejestry wektorów, z których każdy posiada co najmniej 32 elementy.

b. zaprojektowany do wykonywania w jednym cyklu więcej niż czterech wyników operacji zmiennoprzecinkowych na liczbach 64-bitowych lub dłuższych; lub

c. zaprojektowany do wykonywania w jednym cyklu więcej niż ośmiu wyników operacji stałoprzecinkowych typu multiply-accumulate na liczbach 16-bitowych (np. obróbka cyfrowa informacji analogowych, które uprzednio zostały przekształcone na postać cyfrową, znana również jako cyfrowe "przetwarzanie sygnału").

Uwaga 1: Pozycja 3E002 nie obejmuje kontrolą "technologii" do rozszerzeń multimedialnych.

Uwaga 2: Pozycja 3E002 nie obejmuje kontrolą "technologii" dotyczącej rdzeni mikroprocesorów spełniających wszystkie poniższe kryteria:

a. zastosowanie "technologii" na poziomie 0,130 μm lub powyżej; oraz

b. wykorzystywanie struktur wielowarstwowych o co najwyżej pięciu warstwach metalu.

Uwaga 3: Pozycja 3E002 obejmuje "technologię" do "rozwoju" lub "produkcji" procesorów sygnałowych i procesorów macierzowych.

3E003 Inna "technologia" do "rozwoju" lub "produkcji" następujących produktów:

a. próżniowych urządzeń mikroelektronicznych;

b. heterostrukturalnych elektronicznych urządzeń półprzewodnikowych, takich jak tranzystory o wysokiej ruchliwości elektronów (HEMT), tranzystory heterobipolarne (HBT), urządzenia nadstrukturalne oraz ze studnią kwantową;

Uwaga: Pozycja 3E003.b nie obejmuje kontrolą "technologii" dla tranzystorów o wysokiej ruchliwości elektronów (HEMT), pracujących na częstotliwościach niższych od 31,8 GHz oraz tranzystorów heterobipolarnych (HBT), pracujących na częstotliwościach niższych od 31,8 GHz.

c. urządzeń elektronicznych opartych na "Nadprzewodnikach";

d. podłoży folii diamentowych do podzespołów elektronicznych;

e. podłoży typu "krzem na izolatorze" (SOI) do układów scalonych, gdzie izolatorem jest dwutlenek krzemu;

f. podłoży z węglika krzemu do części elektronicznych;

g. 'elektronicznych urządzeń próżniowych', pracujących na częstotliwościach równych 31,8 GHz lub wyższych.

3E101 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "użytkowania" sprzętu lub "oprogramowania" wymienionego w pozycji 3A001.a.1 lub 3A001.a.2, 3A101, 3A102 lub 3D101.

3E102 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" "oprogramowania" wymienionego w pozycji 3D101.

3E201 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "użytkowania" sprzętu wymienionego w pozycji 3A001.e.2, 3A001.e.3, 3A001.g, 3A201, 3A225 do 3A234.

3E225 "Technologia" w postaci kodów lub kluczy, służąca do poprawy lub wykorzystania wydajności przemienników częstotliwości lub generatorów, tak by odpowiadały cechom wymienionym w pozycji 3A225.

KATEGORIA 4 - KOMPUTERY

Uwaga 1: Komputery, towarzyszące im sprzęt i "oprogramowanie" wypełniające funkcje telekomunikacyjne lub działające w ramach "lokalnej sieci komputerowej" muszą również być analizowane pod kątem spełniania charakterystyk przynależnych do kategorii 5 część 1 - Telekomunikacja.

Uwaga 2: Jednostki sterujące podłączone bezpośrednio do szyn lub łączy jednostek centralnych, 'pamięci operacyjnych' lub sterowników dysków nie są uważane za urządzenia telekomunikacyjne ujęte w kategorii 5 część 1 - Telekomunikacja.

N.B. Dla ustalenia poziomu kontroli "oprogramowania" specjalnie zaprojektowanego do komutacji pakietów, zob. pozycja 5D001.

Uwaga techniczna:

'Pamięć operacyjna' oznacza podstawową pamięć na dane lub instrukcje, szybko dostępną dla jednostki centralnej. Składa się z pamięci wewnętrznej "komputera cyfrowego" oraz jednej z dodatkowych pamięci o strukturze hierarchicznej, takich jak pamięć podręczna (cache) lub pamięć dodatkowa z dostępem niesekwencyjnym.

4A Systemy, urządzenia i części składowe

4A001 Komputery elektroniczne i towarzyszący im sprzęt spełniające którekolwiek z poniższych kryteriów i "zespoły elektroniczne" oraz specjalnie do nich zaprojektowane części składowe:

N.B. ZOB. TAKŻE POZYCJA 4A101.

a. specjalnie zaprojektowane, aby spełniać którekolwiek z poniższych kryteriów:

1. możliwość działania w temperaturze otoczenia poniżej 228 K (- 45 °C) lub powyżej 358 K (85 °C); lub

Uwaga: Pozycja 4A001.a.1 nie obejmuje kontrolą komputerów specjalnie zaprojektowanych do zastosowania w samochodach cywilnych, kolejnictwie lub "cywilnych statkach powietrznych".

2. zabezpieczone przed promieniowaniem jonizującym, o następujących parametrach minimalnych:

a. dawka całkowita 5 × 103 Gy (Si);

b. narastanie natężenia 5 × 106 Gy (Si)/s; lub dawki

c. pojedyncze przypadkowe zakłócenie 1 × 10-8 błędów/bit/dzień;

Uwaga: Pozycja 4A001.a.2 nie obejmuje kontrolą komputerów specjalnie zaprojektowanych do zastosowania w "cywilnych statkach powietrznych".

b. nieużywane.

4A003 Następujące "komputery cyfrowe", "zespoły elektroniczne" i sprzęt im towarzyszący oraz specjalnie zaprojektowane dla nich części składowe:

Uwaga 1: Pozycja 4A003 obejmuje:

- 'procesory wektorowe',

- procesory tablicowe,

- cyfrowe procesory sygnałowe,

- procesory logiczne,

- sprzęt zaprojektowany do "wzmacniania obrazów".

Uwaga 2: Poziom kontroli "komputerów cyfrowych" i towarzyszącego im sprzętu opisany w pozycji 4A003 wynika z poziomu kontroli innego sprzętu lub systemów, pod warunkiem że:

a. "komputery cyfrowe" lub towarzyszący im sprzęt mają zasadnicze znaczenie dla działania innego sprzętu lub systemów;

b. "komputery cyfrowe" lub towarzyszący im sprzęt nie są "elementem o podstawowym znaczeniu" innego sprzętu lub systemów; oraz

N.B.1: Poziom kontroli sprzętu do "przetwarzania sygnałów" lub "wzmacniania obrazów", specjalnie zaprojektowanego do innego sprzętu i ograniczonego funkcjonalnie do wymogów pracy tego sprzętu wynika z poziomu kontroli innego sprzętu, nawet, gdy wykracza to poza kryterium "elementu o podstawowym znaczeniu".

N.B.2: W przypadku poziomu kontroli "komputerów cyfrowych" lub towarzyszącego im sprzętu do sprzętu telekomunikacyjnego zob. kategoria 5 część 1 - Telekomunikacja.

c. "technologia" do "komputerów cyfrowych" i towarzyszącego im sprzętu jest określona przez pozycję 4E.

a. nieużywane;

b. "komputery cyfrowe" posiadające "skorygowaną wydajność szczytową" ("APP") powyżej 29 teraflopsów ważonych (WT);

c. "zespoły elektroniczne", specjalnie zaprojektowane lub zmodyfikowane w celu polepszenia mocy obliczeniowej poprzez agregację procesorów, w taki sposób, że "APP" agregatu przekracza wartość graniczną określoną w pozycji 4A003.b;

Uwaga 1: Pozycja 4A003.c obejmuje kontrolą wyłącznie "zespoły elektroniczne" i programowane połączenia, których moc obliczeniowa nie wykracza poza wartości graniczne określone w pozycji 4A003.b, w przypadku dostarczania ich jako "zespoły elektroniczne" w stanie rozłożonym.

Uwaga 2: Pozycja 4A003.c nie obejmuje kontrolą "zespołów elektronicznych", specjalnie zaprojektowanych do wyrobu lub rodziny wyrobów, których maksymalna konfiguracja nie wykracza poza ograniczenia wyszczególnione w pozycji 4A003.b.

d. nieużywane;

e. nieużywane;

f. nieużywane;

g. sprzęt specjalnie zaprojektowany w celu łączenia wydajności "komputerów cyfrowych" przez nawiązywanie połączeń zewnętrznych pozwalających na wymianę danych z szybkościami przekraczającymi 2,0 GB/s w jednym kierunku dla każdego połączenia.

Uwaga: Pozycja 4A003.g nie obejmuje kontrolą sprzętu zapewniającego połączenia wewnętrzne (np. tablice połączeń, szyny), urządzeń łączących o charakterze pasywnym, "sterowników dostępu do sieci" ani "sterowników torów telekomunikacyjnych".

4A004 Następujące komputery i specjalnie do nich zaprojektowany sprzęt towarzyszący, "zespoły elektroniczne" i ich części składowe:

a. 'komputery z dynamiczną modyfikacją zestawu procesorów';

b. 'komputery neuronowe';

c. 'komputery optyczne'.

Uwagi techniczne:

1. 'Komputery z dynamiczną modyfikacją tablic' oznaczają komputery, w których przepływ i modyfikacja danych są dynamicznie sterowane przez użytkownika na poziomie bramek logicznych.

2. "Komputery neuronowe' oznaczają urządzenia obliczeniowe zaprojektowane lub zmodyfikowane z przeznaczeniem do naśladowania działalności neuronu lub zbioru neuronów, tj. urządzenia obliczeniowe wyróżniające się możliwością sprzętowego modulowania znaczenia i liczby połączeń pomiędzy wieloma elementami obliczeniowymi w oparciu o poprzednie dane.

3. 'Komputery optyczne' oznaczają komputery zaprojektowane lub zmodyfikowane z przeznaczeniem do używania światła jako nośnika danych oraz takie, których elementy obliczeniowo-logiczne działają bezpośrednio na sprzężonych urządzeniach optycznych.

4A005 Systemy, wyposażenie i ich części składowe, specjalnie zaprojektowane lub zmodyfikowane do tworzenia "złośliwego oprogramowania", zarządzania i sterowania nim lub dostarczania takiego oprogramowania.

4A101 Komputery analogowe, "komputery cyfrowe" lub cyfrowe analizatory różniczkowe, inne niż wyszczególnione w pozycji 4A001.a.1, zabezpieczone przed narażeniami mechanicznymi lub podobnymi i specjalnie zaprojektowane lub zmodyfikowane do użycia w kosmicznych pojazdach nośnych, wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104.

4A102 "Komputery hybrydowe", specjalnie zaprojektowane do modelowania, symulowania lub integrowania konstrukcyjnego kosmicznych pojazdów nośnych wyszczególnionych w pozycji 9A004 lub rakiet meteorologicznych wyszczególnionych w pozycji 9A104.

Uwaga: Kontrola dotyczy wyłącznie takich sytuacji, w których sprzęt jest dostarczany z "oprogramowaniem" wymienionym w pozycji 7D103 lub 9D103.

4B Urządzenia testujące, kontrolne i produkcyjne

Żadne.

4C Materiały

Żadne.

4D Oprogramowanie

Uwaga: Poziom kontroli "oprogramowania" do urządzeń opisanych w innych kategoriach wynika z odpowiedniej kategorii.

4D001 Następujące "oprogramowanie":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "rozwoju" lub "produkcji" sprzętu lub "oprogramowania" wyszczególnionych w pozycji 4A001 do 4A004 lub 4D;

b. "oprogramowanie", inne niż wyszczególnione w pozycji 4D001.a, specjalnie zaprojektowane lub zmodyfikowane do "rozwoju" lub "produkcji" następującego sprzętu:

1. "komputery cyfrowe" posiadające "skorygowaną wydajność szczytową" ("APP") powyżej 15 teraflopsów ważonych (WT);

2. "zespoły elektroniczne", specjalnie zaprojektowane lub zmodyfikowane w celu polepszenia mocy obliczeniowej poprzez agregację procesorów, w taki sposób, że "APP" agregatu przekracza wartość graniczną określoną w pozycji 4D001.b.1.

4D002 nieużywane.

4D003 nieużywane.

4D004 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do tworzenia "złośliwego oprogramowania", zarządzania i sterowania nim lub dostarczania takiego oprogramowania.

Uwaga: Pozycja 4D004 nie obejmuje kontrolą "oprogramowania" specjalnie zaprojektowanego i ograniczonego do udostępniania aktualizacji lub modernizacji "oprogramowania" spełniającego wszystkie poniższe kryteria:

a. aktualizacja lub modernizacja następują wyłącznie za zgodą użytkownika lub administratora systemu otrzymującego; oraz

b. po aktualizacji lub modernizacji zaktualizowane lub zmodernizowane "oprogramowanie" nie jest żadnym z poniższych:

1. "oprogramowaniem" wymienionym w pozycji 4D004; lub

2. "złośliwym oprogramowaniem".

4E Technologia

4E001 a. "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju", "produkcji" lub "użytkowania" sprzętu lub "oprogramowania" wyszczególnionych w pozycji 4A lub 4D;

b. "technologia", zgodnie z uwagą ogólną do technologii, inna niż wyszczególniona w pozycji 4E001.a, do "rozwoju" lub "produkcji" następującego sprzętu:

1. "komputery cyfrowe" posiadające "skorygowaną wydajność szczytową" ("APP") powyżej 15 teraflopsów ważonych (WT);

2. "zespoły elektroniczne", specjalnie zaprojektowane lub zmodyfikowane w celu polepszenia mocy obliczeniowej poprzez agregację procesorów, w taki sposób, że "APP" agregatu przekracza wartość graniczną określoną w pozycji 4E001.b.1.

c. "technologia" służąca do "opracowywania" "złośliwego oprogramowania".

Uwaga 1: Pozycje 4E001.a i 4E001.c nie obejmują kontrolą 'ujawniania luk w zabezpieczeniach' ani 'reagowania na cyberincydenty'.

Uwaga 2: Uwaga 1 nie ogranicza praw właściwego organu państwa członkowskiego, w którym eksporter ma siedzibę, do sprawdzenia zgodności z pozycjami 4E001.a. i 4E001.c.

Uwagi techniczne:

1. 'Ujawnianie luk w zabezpieczeniach' oznacza proces stwierdzenia i zgłoszenia luki w zabezpieczeniach, informowania o takiej luce oraz analizy takiej luki z osobami lub organizacjami odpowiedzialnymi za prowadzenie lub koordynację działań zaradczych w celu usunięcia luki.

2. 'Reagowanie na cyberincydenty' oznacza proces wymiany niezbędnych informacji na temat cyberincydentu związanego z bezpieczeństwem z osobami lub organizacjami odpowiedzialnymi za prowadzenie lub koordynację działań zaradczych w celu zapewnienia reakcji na taki cyberincydent.

UWAGA TECHNICZNA DOTYCZĄCA "SKORYGOWANEJ WYDAJNOŚCI SZCZYTOWEJ" ("APP")

"APP" oznacza skorygowaną największą prędkość, z jaką "komputery cyfrowe" wykonują zmiennoprzecinkowe operacje dodawania i mnożenia na liczbach 64-bitowych lub dłuższych.

"APP" wyraża się w teraflopsach ważonych (WT), w jednostkach wynoszących 1012 skorygowanych operacji zmiennoprzecinkowych na sekundę.

Skróty stosowane w niniejszej uwadze technicznej

n liczba procesorów w "komputerze cyfrowym"

i numer procesora (i,...n)

ti czas cyklu procesora (ti = 1/Fi)

Fi częstotliwość procesora

Ri szczytowa szybkość obliczeniowa dla operacji zmiennoprzecinkowych

Wi współczynnik korygujący związany z architekturą systemu

Omówienie sposobu obliczania "APP"

1. Dla każdego procesora i określić szczytową liczbę operacji zmiennoprzecinkowych (FPOi) na liczbach 64-bitowych lub dłuższych wykonywanych w jednym cyklu przez każdy procesor "komputera cyfrowego".

Uwaga Określając FPO, należy brać pod uwagę wyłącznie zmiennoprzecinkowe operacje dodawania lub mnożenia na liczbach 64-bitowych lub dłuższych. Wszystkie operacje zmiennoprzecinkowe muszą być wyrażone w operacjach na cykl procesora; operacje wymagające wielu cykli można wyrażać w postaci wyniku ułamkowego na jeden cykl. W przypadku procesorów niezdolnych do wykonywania operacji na argumentach zmiennoprzecinkowych o długości 64 bitów lub dłuższych efektywna szybkość obliczeniowa R wynosi zero.

2. Obliczyć szybkość operacji zmiennoprzecinkowych R dla każdego procesora, Ri = FPOi/ti.

3. Obliczyć "APP" z wzoru "APP" = W1 × R1 + W2 × R2 + ... + Wn × Rn.

4. Dla 'procesorów wektorowych' Wi = 0,9. Dla procesorów niebędących 'procesorami wektorowymi' Wi = 0,3.

Uwaga 1 W przypadku procesorów wykonujących w jednym cyklu operacje złożone, takie jak dodawanie i mnożenie, liczy się każda operacja.

Uwaga 2 W przypadku procesora działającego w trybie potokowym jako efektywną szybkość obliczeniową R przyjmuje się większą z następujących prędkości: prędkość w trybie potokowym przy pełnym wykorzystaniu potoku i prędkość w trybie niepotokowym.

Uwaga 3 Do celów obliczenia "APP" całego zespołu przyjmuje się dla każdego procesora składowego jego maksymalną teoretycznie możliwą szybkość obliczeniową R. Przyjmuje się, że zachodzi równoczesne wykonywanie operacji, jeżeli producent komputera stwierdza w broszurze lub podręczniku użytkownika, że komputer przetwarza dane w sposób współbieżny, równoległy lub równoczesny.

Uwaga 4 Przy obliczaniu "APP" nie uwzględnia się procesorów, których rola ogranicza się do funkcji wejścia/wyjścia i peryferyjnych (np. w napędzie dysków, urządzeniach komunikacyjnych i wyświetlaczu wideo).

Uwaga 5 Nie oblicza się wartości "APP" dla zespołów procesorów połączonych (ze sobą i z innymi) w ramach "lokalnych sieci komputerowych", rozległych sieci komputerowych (WAN), dzielonych wspólnych połączeń lub urządzeń wejścia/wyjścia, kontrolerów wejścia/wyjścia oraz we wszelkich połączeniach komunikacyjnych implementowanych przez "oprogramowanie".

Uwaga 6 Konieczne jest obliczenie wartości "APP" dla zespołów procesorów zawierających procesory specjalnie zaprojektowane w celu zwiększenia wydajności poprzez agregację, równoczesne działanie i współdzielenie pamięci;

Uwaga techniczna:

1. Łącznie wszystkie procesory i akceleratory działające równocześnie i znajdujące się na tej samej płytce.

2. Zespoły procesorów współdzielą pamięć, gdy dowolny procesor jest w stanie uzyskać dostęp do pamięci w dowolnej lokalizacji w systemie poprzez transmisję sprzętową linii pamięci podręcznej lub słów maszynowych w pamięci, bez angażowania żadnego mechanizmu opartego na oprogramowaniu, który to efekt może zostać uzyskany w drodze wykorzystania "zespołów elektronicznych" wymienionych w pozycji 4A003.c.

Uwaga 7 'Procesor wektorowy' jest zdefiniowany jako procesor wyposażony w wewnętrzne instrukcje pozwalające równocześnie wykonywać wielokrotne operacje na wektorach zmiennoprzecinkowych (jednowymiarowych tablicach złożonych z liczb 64-bitowych lub dłuższych), posiadający co najmniej dwie funkcjonalne jednostki wektorowe i co najmniej 8 rejestrów wektorowych, każdy o pojemności co najmniej 64 elementów.

KATEGORIA 5 - TELEKOMUNIKACJA I "OCHRONA INFORMACJI"

Część 1 - TELEKOMUNIKACJA

Uwaga 1: W pozycjach kategorii 5 część 1 ujęto poziom kontroli części składowych, sprzętu testującego i "produkcyjnego" oraz "oprogramowania" do nich, specjalnie zaprojektowanych do sprzętu lub systemów telekomunikacyjnych.

N.B. "Lasery" specjalnie zaprojektowane do urządzeń i systemów telekomunikacyjnych - zob. poz. 6A005.

Uwaga 2: "Komputery cyfrowe", towarzyszący im sprzęt lub "oprogramowanie", mające zasadniczy wpływ na działanie i wspomaganie działań sprzętu telekomunikacyjnego przedstawionego w niniejszej kategorii, są traktowane jako specjalnie opracowane komponenty, pod warunkiem że są to modele standardowe, dostarczane przez producenta na zamówienie klienta. Dotyczy to komputerowych systemów eksploatacji, administrowania, utrzymania, obsługi technicznej lub księgowych.

5A1 Systemy, urządzenia i części składowe

5A001 Następujące systemy telekomunikacyjne, urządzenia telekomunikacyjne, części składowe i osprzęt:

a. dowolny typ sprzętu telekomunikacyjnego, posiadający jedną z niżej wymienionych cech lub właściwości lub realizujący jedną z wymienionych funkcji:

1. specjalnie zabezpieczone przed skutkami przejściowych zjawisk elektronicznych lub impulsu elektromagnetycznego, powstających w wyniku wybuchu jądrowego;

2. specjalnie zabezpieczone przed promieniowaniem gamma, neutronowym lub jonizacyjnym;

3. specjalnie zaprojektowane do eksploatacji w temperaturze poniżej 218 K (- 55 °C); lub

4. specjalnie zaprojektowane do eksploatacji w temperaturze powyżej 397 K (124 °C);

Uwaga 1: Pozycje 5A001.a.3 i 5A001.a.4 obejmują kontrolą wyłącznie sprzęt elektroniczny.

Uwaga 2: Pozycje 5A001.a.2, 5A001.a.3 i 5A001.a.4 nie obejmują kontrolą sprzętu zaprojektowanego lub zmodyfikowanego do stosowania w satelitach.

b. systemy i urządzenia telekomunikacyjne oraz specjalnie do nich zaprojektowane części składowe i osprzęt, posiadające którąkolwiek z niżej wymienionych cech i właściwości lub realizujące którąkolwiek z wymienionych poniżej funkcji:

1. będące bezprzewodowymi systemami komunikacji podwodnej spełniającymi którekolwiek z poniższych kryteriów:

a. akustyczna częstotliwość nośna poza przedziałem 20 kHz do 60 kHz;

b. działające w zakresie elektromagnetycznej częstotliwości nośnej poniżej 30 kHz;

c. działające z wykorzystaniem technik sterowania za pomocą wiązki elektronów; lub

d. działające z wykorzystaniem "laserów" lub diod elektroluminescencyjnych (LED) o fali wyjściowej, której długość przekracza 400 nm, lecz nie osiąga 700 nm, w "lokalnej sieci komputerowej";

2. będące sprzętem radiowym działającym w paśmie od 1,5 do 87,5 MHz i spełniające wszystkie z poniższych kryteriów:

a. automatyczne przewidywanie i wybieranie częstotliwości oraz "całkowite szybkości transmisji danych cyfrowych" na kanał, umożliwiające optymalizację transmisji; oraz

b. zaopatrzenie w liniowy wzmacniacz mocy umożliwiający równoczesną obróbkę wielu sygnałów przy mocy wyjściowej 1 kW lub wyższej, w zakresie częstotliwości od 1,5 do 30 MHz, lub 250 W lub wyższej w zakresie częstotliwości od 30 do 87,5 MHz, w zakresie "pasma chwilowego" o szerokości jednej oktawy lub większej oraz z wyjściem o zniekształceniach harmonicznych lub innych lepszych niż -80 dB;

3. będące sprzętem radiowym, w którym zastosowano techniki "widma rozproszonego" w tym "rozrzucanie częstotliwości", poza wyszczególnionymi w pozycji 5A001.b.4, i spełniające którekolwiek z poniższych kryteriów:

a. programowane przez użytkownika kody rozpraszania; lub

b. całkowita szerokość przesyłanego pasma 100 lub więcej razy większa od szerokości pasma dowolnego z kanałów informacyjnych w nadmiarze 50 kHz;

Uwaga: Pozycja 5A001.b.3.b nie obejmuje kontrolą sprzętu radiowego specjalnie zaprojektowanego do stosowania w którychkolwiek z poniższych:

a. sieciach telekomunikacyjnych w układzie terytorialnym (komórkowym) działających w zakresie pasm cywilnych; lub

b. stałych lub ruchomych naziemnych stacjach satelitarnych do zastosowań w komercyjnych cywilnych systemach telekomunikacji.

Uwaga: Pozycja 5A001.b.3 nie obejmuje kontrolą urządzeń o mocy wyjściowej 1 W lub mniejszej.

4. będące sprzętem radiowym, w którym zastosowano ultraszerokopasmowe techniki modulacji, posiadające programowane przez użytkownika kody przydzielania kanałów, szyfrowania (scrambling) lub identyfikacji sieci i spełniające którekolwiek z poniższych kryteriów:

a. szerokość pasma przekraczająca 500 MHz; lub

b. "ułamkowa szerokość pasma" wynosząca 20 % lub więcej;

5. będące sterowanymi cyfrowo odbiornikami radiowymi, które spełniają wszystkie poniższe kryteria:

a. posiadają ponad 1 000 kanałów;

b. charakteryzują się 'czasem przełączania kanałów' niższym od 1 ms;

c. umożliwiają automatyczne przeszukiwanie lub skanowanie części widma fal elektromagnetycznych; oraz

d. umożliwiają identyfikację odbieranych sygnałów lub typu nadajnika; lub

Uwaga: Pozycja 5A001.b.5 nie obejmuje kontrolą sprzętu specjalnie zaprojektowanego do komórkowych radiowych sieci telekomunikacyjnych, działających w zakresie pasm cywilnych.

Uwaga techniczna:

'Czas przełączania kanałów' oznacza czas (tj. opóźnienie) do zmiany z jednej częstotliwości odbiorczej na inną, by osiągnąć zgodną ze specyfikacjami końcową częstotliwość odbiorczą na poziomie zadanym lub w przedziale ± 0,05 % wokół tego poziomu. Produkty, których zgodna ze specyfikacjami częstotliwość mieści się w przedziale węższym niż ± 0,05 % wokół ich częstotliwości środkowej, definiowane są jako niezdolne do przełączania częstotliwości kanałów.

6. będące urządzeniami wykorzystującymi funkcje cyfrowego "przetwarzania sygnałów" dla realizacji 'kodowania mowy' z szybkością poniżej 700 bitów/s;

Uwagi techniczne:

1. Dla zmiennych współczynników 'kodowania mowy' pozycja 5A001.b.6 dotyczy 'kodowania mowy' w odniesieniu do wyjścia ciągłego sygnału głosowego.

2. Do celów pozycji 5A001.b.6 'kodowanie mowy' określa się jako technikę próbkowania głosu ludzkiego, a następnie przetwarzania próbek na sygnał cyfrowy, z uwzględnieniem cech szczególnych mowy ludzkiej.

c. światłowody o długości ponad 500 m i określone przez producenta jako mogące się oprzeć podczas 'testu kontrolnego' naprężeniom rozciągającym wynoszącym 2 × 109 N/m2 lub większe;

N.B. Dla kabli startowych (pępowinowych) zob. także pozycja 8A002.a.3.

Uwaga techniczna:

'Test kontrolny': prowadzona na bieżąco (on line) lub poza linią produkcyjną (off-line) kontrola zupełna, podczas której wszystkie włókna są obciążane dynamicznie z góry określonymi naprężeniami rozciągającymi, działającymi na odcinek światłowodu o długości od 0,5 do 3 m, przeciągany z szybkością 2 do 5 m/s pomiędzy bębnami nawijającymi o średnicy około 150 mm. Temperatura otoczenia powinna wynosić 293 K (20 °C), a wilgotność względna 40 %. Testy kontrolne można przeprowadzić według równoważnych norm krajowych.

d. następujące 'elektronicznie sterowane fazowane układy antenowe':

1. przystosowane do działania w zakresie częstotliwości powyżej 31,8 GHz, ale nieprzekraczającej 57 GHz i posiadające efektywną moc wypromieniowaną (ERP) równą lub większą niż +20 dBm (efektywną moc wypromieniowaną izotropowo (EIRP) równą lub większą 22,15 dBm);

2. przystosowane do działania w zakresie częstotliwości powyżej 57 GHz, ale nieprzekraczającej 66 GHz i posiadające ERP równą lub większą niż +24 dBm (EIRP 26,15 dBm);

3. przystosowane do działania w zakresie częstotliwości powyżej 66 GHz, ale nieprzekraczającej 90 GHz i posiadające ERP równą lub większą niż +20 dBm (EIRP 22,15 dBm);

4. przystosowane do działania w zakresie częstotliwości powyżej 90 GHz;

Uwaga 1: Pozycja 5A001.d nie obejmuje kontrolą 'elektronicznie sterowanych fazowanych układów antenowych' do systemów kontroli lądowania oprzyrządowanych według wymagań norm ICAO obejmujących mikrofalowe systemy kontroli lądowania (MLS).

Uwaga 2: Pozycja 5A001.d nie obejmuje kontrolą anten specjalnie zaprojektowanych do którychkolwiek z poniższych:

a. sieci telekomunikacyjnych w układzie terytorialnym (komórkowym lub lokalna sieć radiowa) działających w zakresie pasm cywilnych;

b. IEEE 802.15 lub bezprzewodowe HDMI; lub

c. stałych lub ruchomych naziemnych stacjach satelitarnych do zastosowań w komercyjnych cywilnych systemach telekomunikacji.

Uwaga techniczna:

Do celów pozycji 5A001.d 'elektronicznie sterowane fazowane układy antenowe' oznaczają antenę kształtującą wiązkę za pomocą sprzężenia fazowego (tj. kierunek wiązki jest utrzymywany za pomocą elementów promieniujących o złożonych współczynnikach wzbudzenia), przy czym kierunek takiej wiązki (azymut lub podniesienie kątowe) można zmieniać za pomocą sygnału elektrycznego, zarówno dla nadawania, jak i odbioru.

e. sprzęt radiowy do namierzania kierunku działający na częstotliwościach powyżej 30 MHz i spełniający wszystkie poniższe kryteria, jak również specjalnie zaprojektowane podzespoły do tego sprzętu:

1. "chwilowa szerokość pasma" wynosząca 10 MHz lub więcej; oraz

2. zdolność określania namiaru na niewspółpracujące nadajniki radiowe emitujące sygnał o czasie trwania krótszym niż 1 ms;

f. następujące urządzenia przechwytujące lub zakłócające telekomunikacji mobilnej i urządzenia monitorujące do nich oraz specjalnie zaprojektowane do nich części składowe:

1. urządzenia przechwytujące zaprojektowane do ekstrahowania głosu lub danych, transmitowanych przez interfejs radiowy;

2. urządzenia przechwytujące niewymienione w pozycji 5A001.f.1, zaprojektowane do ekstrahowania identyfikatorów urządzeń klientów lub abonentów (np. IMSI, TIMSI lub IMEI), sygnałów lub innych metadanych transmitowanych przez interfejs radiowy;

3. sprzęt zakłócający zaprojektowany lub zmodyfikowany specjalnie na potrzeby celowego i selektywnego zakłócania, blokowania, utrudniania, pogarszania jakości lub wprowadzania w błąd systemów usług telekomunikacyjnych w sieciach ruchomych i wypełniający którekolwiek z poniższych kryteriów:

a. zdolność symulowania funkcji sprzętu sieci dostępu radiowego (RAN);

b. wykrywanie i wykorzystywanie cech szczególnych stosowanego protokołu telekomunikacji ruchomej (np. GSM); lub

c. wykorzystywanie cech szczególnych stosowanego protokołu telekomunikacji ruchomej (np. GSM);

4. urządzenia do monitorowania częstotliwości radiowych zaprojektowane lub zmodyfikowane do wykrywania działania podzespołów określonych w pozycjach 5A001.f.1, 5A001.f.2 lub 5A001.f.3;

Uwaga: Pozycje 5A001.f.1 i 5A001.f.2 nie obejmują kontrolą żadnych z poniższych:

a. urządzeń zaprojektowanych specjalnie do przechwytywania analogowych prywatnych systemów radiowej łączności ruchomej (PMR), IEEE 802.11 WLAN;

b. urządzeń zaprojektowanych na potrzeby operatorów sieci telekomunikacji mobilnej; lub

c. urządzeń zaprojektowanych do "rozwoju" lub "produkcji" urządzeń lub systemów telekomunikacji mobilnej.

N.B.1. Zob. także WYKAZ UZBROJENIA.

N.B.2. Odbiorniki radiowe - zob. pozycja 5A001.b.5.

g. systemy lub urządzenia do pasywnej koherentnej lokacji (PCL) specjalnie zaprojektowane do wykrywania i śledzenia obiektów ruchomych za pomocą pomiaru odbić emisji częstotliwości radiowych z otoczenia, pochodzących od nadajników nieradarowych;

Uwaga techniczna:

Nadajniki nieradarowe mogą obejmować stacje bazowe radiowe, telewizyjne i telefonii komórkowej.

Uwaga: Pozycja 5A001.g nie obejmuje kontrolą żadnych z poniższych:

a. urządzeń radioastronomicznych; lub

b. systemów lub urządzeń wymagających, aby cel nadawał jakikolwiek sygnał radiowy.

h. następujące urządzenia do unieszkodliwiania improwizowanych urządzeń wybuchowych (IED) i powiązany sprzęt:

1. urządzenia do transmisji w częstotliwości radiowej (RF), niewyszczególnione w pozycji 5A001.f, zaprojektowane lub zmodyfikowane do przedwczesnej aktywacji lub zapobiegania inicjacji improwizowanych urządzeń wybuchowych;

2. urządzenia wykorzystujące techniki zaprojektowane w celu umożliwienia komunikacji radiowej na tych samych kanałach częstotliwości, na których transmitują urządzenia towarzyszące określone w pozycji 5A001.h.1.

N.B. Zob. także WYKAZ UZBROJENIA.

i. nieużywane;

j. Systemy lub urządzenia do nadzorowania komunikacji w sieci z wykorzystaniem protokołu IP oraz specjalnie zaprojektowane do nich części składowe, spełniające wszystkie poniższe kryteria:

1. wykonujące wszystkie poniższe działania w sieci IP klasy operatorskiej (np. krajowa sieć szkieletowa IP):

a. analiza w warstwie aplikacji (np. warstwa 7 modelu OSI (Open Systems Interconnection) (ISO/IEC 7498-1));

b. ekstrakcja wybranych metadanych i zawartości aplikacji (np. głos, obraz wideo, wiadomości, załączniki); oraz

c. indeksowanie wyekstrahowanych danych; oraz

2. specjalnie zaprojektowane do wykonywania wszystkich następujących czynności:

a. przeprowadzania wyszukiwania w oparciu o 'twarde parametry'; oraz

b. mapowanie sieci powiązań pojedynczej osoby lub grupy ludzi.

Uwaga: Pozycja 5A001.j nie obejmuje kontrolą systemów lub sprzętu specjalnie zaprojektowanego do którychkolwiek z poniższych:

a. cel rynkowy;

b. sieciowa jakość usługi (QoS); lub

c. postrzegalna jakość usług (QoE);

Uwaga techniczna:

'Twarde parametry' oznaczają dane lub zestaw danych powiązanych z daną osobą (np. nazwisko, imię, adres email, adres zamieszkania, numer telefonu lub powiązania grupowe).

5A101 Sprzęt do zdalnego przekazywania wyników pomiarów i do zdalnego sterowania, w tym sprzęt naziemny, zaprojektowany lub zmodyfikowany do użycia w 'pociskach rakietowych'.

Uwaga techniczna:

W pozycji 5A101 'pocisk rakietowy' oznacza kompletne systemy rakietowe oraz systemy bezzałogowych statków powietrznych, zdolnych do pokonania odległości przekraczającej 300 km.

Uwaga: Pozycja 5A101 nie obejmuje kontrolą:

a. sprzętu zaprojektowanego lub zmodyfikowanego do załogowych statków powietrznych lub satelitów;

b. sprzętu naziemnego, zaprojektowanego lub zmodyfikowanego do zastosowań lądowych lub morskich;

c. sprzętu zaprojektowanego do celów usług GNSS (np. integralności danych, bezpieczeństwa lotów) o charakterze komercyjnym, cywilnym lub dla 'ratowania życia'.

5B1 Urządzenia testujące, kontrolne i produkcyjne

5B001 Następujące telekomunikacyjne urządzenia testujące, kontrolne i produkcyjne, części składowe i osprzęt:

a. sprzęt i specjalnie zaprojektowane do niego elementy i akcesoria, specjalnie zaprojektowane do "rozwoju" lub "produkcji" urządzeń, funkcji lub właściwości ujętych w pozycji 5A001;

Uwaga: Pozycja 5B001.a nie obejmuje kontrolą sprzętu do cechowania światłowodów.

b. sprzęt i specjalnie zaprojektowane do niego części składowe i osprzęt, specjalnie zaprojektowane do "rozwoju" następujących telekomunikacyjnych urządzeń przesyłowych lub przełączających:

1. nieużywane;

2. sprzęt wykorzystujący "laser" i spełniający którekolwiek z poniższych kryteriów:

a. długość fali nadawczej przekraczająca 1 750 nm; lub

b. nieużywane;

c. nieużywane;

d. stosujący techniki analogowe i posiadający szerokość pasma przekraczającą 2,5 GHz; lub

Uwaga: Pozycja 5B001.b.2.d nie obejmuje kontrolą sprzętu specjalnie zaprojektowanego do "rozwoju" komercyjnych systemów telewizji.

3. nieużywane;

4. sprzęt radiowy wykorzystujący technikę modulacji kwadraturowej (QAM), powyżej poziomu 1 024;

5. nieużywane.

5C1 Materiały

Żadne.

5D1 Oprogramowanie

5D001 Następujące "oprogramowanie":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "rozwoju", "produkcji" lub "użytkowania" sprzętu, funkcji lub właściwości wyszczególnionych w pozycji 5A001;

b. nieużywane;

c. specyficzne "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane w celu umożliwienia sprzętowi osiągnięcia cech charakterystycznych, funkcji lub właściwości wyszczególnionych w pozycji 5A001 lub 5B001;

d. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "rozwoju" następującego sprzętu transmisji telekomunikacyjnych oraz przełączającego:

1. nieużywane;

2. sprzęt wykorzystujący "laser" i spełniający którekolwiek z poniższych kryteriów:

a. długość fali nadawczej przekraczająca 1 750 nm; lub

b. stosujący techniki analogowe i posiadający szerokość pasma przekraczającą 2,5 GHz; lub

Uwaga: Pozycja 5D001.d.2.b nie obejmuje kontrolą "oprogramowania" specjalnie zaprojektowanego do "rozwoju" komercyjnych systemów telewizji.

3. nieużywane;

4. sprzęt radiowy wykorzystujący technikę modulacji kwadraturowej (QAM), powyżej poziomu 1 024.

5D101 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" sprzętu wymienionego w pozycji 5A101.

5E1 Technologia

5E001 Następujące "technologie":

a. "technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" lub "użytkowania" (wyłączając obsługiwanie) sprzętu, funkcji lub właściwości wyszczególnionych w pozycji 5A001 lub "oprogramowania" wymienionego w pozycji 5D001.a;

b. "technologie" specjalne, takie jak:

1. "technologie" "niezbędne" do "rozwoju" lub "produkcji" sprzętu telekomunikacyjnego zaprojektowanego specjalnie do instalowania w satelitach;

2. "technologie" służące do "rozwoju" lub "użytkowania" "laserowych" technik komunikacyjnych z możliwością automatycznego wykrywania, ustalania pochodzenia i śledzenia sygnałów oraz utrzymywania komunikacji w egzoatmosferze lub w środowisku podpowierzchniowym (podwodnym);

3. "technologie" służące do "rozwoju" komórkowych cyfrowych systemów radiowych, których możliwości odbiorcze pozwalają na multi-pasmowe, multi-kanałowe, multi-trybowe, multi-kodowe algorytmy lub multi-protokołowe użytkowanie, które może być modyfikowane poprzez zmiany w "oprogramowaniu";

4. "technologie" służące do "rozwoju" technik "widma rozproszonego", łącznie z technikami "rozrzucania częstotliwości";

Uwaga: Pozycja 5E001.b.4 nie obejmuje kontrolą "technologii" "rozwoju" któregokolwiek z poniższych:

a. sieci telekomunikacyjnych w układzie terytorialnym (komórkowym) działających w zakresie pasm cywilnych; lub

b. stałych lub ruchomych naziemnych stacji satelitarnych do zastosowań w komercyjnych cywilnych systemach telekomunikacji.

c. "technologia" stosownie do uwagi ogólnej do technologii w odniesieniu do "rozwoju" lub "produkcji" któregokolwiek z poniższych:

1. nieużywane;

2. sprzęt wykorzystujący "laser" i spełniający którekolwiek z poniższych kryteriów:

a. długość fali nadawczej przekraczająca 1 750 nm; lub

b. nieużywane;

c. nieużywane;

d. wykorzystujący techniki zwielokrotniania poprzez rozdzielanie fal nośników optycznych w odstępie mniejszym niż 100 GHz; lub

e. stosujący techniki analogowe i posiadający szerokość pasma przekraczającą 2,5 GHz;

Uwaga: Pozycja 5E001.c.2.e nie obejmuje kontrolą "technologii" służącej komercyjnych systemów telewizji.

N.B. Jeżeli chodzi o "technologię" służącą do "rozwoju" lub "produkcji" urządzeń nietelekomunikacyjnych wykorzystujących laser, zob. pozycja 6E.

3. sprzęt wykorzystujący "komutację optyczną", którego czas komutacji jest krótszy niż 1 ms;

4. sprzęt radiowy spełniający którekolwiek z poniższych kryteriów:

a. wykorzystujący technikę modulacji kwadraturowej (QAM) powyżej poziomu 1 024;

b. pracujący z częstotliwościami, wejściową lub wyjściową, powyżej 31,8 GHz; lub

Uwaga: Pozycja 5E001.c.4.b nie obejmuje kontrolą "technologii" sprzętu zaprojektowanego lub zmodyfikowanego do pracy w pasmach "przydzielonych przez ITU" dla służb radiokomunikacyjnych, ale nie do namierzania radiowego.

c. pracujący w paśmie 1,5 MHz do 87,5 MHz i stosujący techniki adaptacyjne zapewniające tłumienie sygnałów zakłócających na poziomie większym niż 15 dB; lub

5. nieużywane;

6. sprzęt mobilny spełniający wszystkie poniższe kryteria:

a. działający na fali optycznej dłuższej niż lub równej 200 nm i krótszej lub równej 400 nm; oraz

b. działający jako "sieć lokalna";

d. "technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" "monolitycznych mikrofalowych układów scalonych" ("MMIC") wzmacniaczy specjalnie zaprojektowanych dla telekomunikacji i spełniających którekolwiek z poniższych kryteriów:

Uwaga techniczna:

Do celów pozycji 5E001.d parametr mocy wyjściowej na granicy nasycenia może być również określany w arkuszu danych produktu jako moc wyjściowa, nasycona moc wyjściowa, maksymalna moc wyjściowa, szczytowa moc wyjściowa lub szczytowa wartość obwiedni mocy.

1. przystosowane do działania w zakresie częstotliwości powyżej 2,7 GHz i do 6,8 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 15 % i spełniające którekolwiek z poniższych kryteriów:

a. moc wyjściowa na granicy nasycenia powyżej 75 W (48,75 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,7 GHz do 2,9 GHz włącznie;

b. moc wyjściowa na granicy nasycenia powyżej 55 W (47,4 dBm) przy dowolnej częstotliwości w zakresie powyżej 2,9 GHz do 3,2 GHz włącznie;

c. moc wyjściowa na granicy nasycenia powyżej 40 W (46 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,2 GHz do 3,7 GHz włącznie; lub

d. moc wyjściowa na granicy nasycenia powyżej 20 W (43 dBm) przy dowolnej częstotliwości w zakresie powyżej 3,7 GHz do 6,8 GHz włącznie;

2. przystosowane do działania w zakresie częstotliwości powyżej 6,8 GHz i do 16 GHz włącznie, o "ułamkowej szerokości pasma" powyżej 10 % i spełniające którekolwiek z poniższych kryteriów:

a. moc wyjściowa na granicy nasycenia powyżej 10 W (40 dBm) przy dowolnej częstotliwości w zakresie powyżej 6,8 GHz do 8,5 GHz włącznie; lub

b. moc wyjściowa na granicy nasycenia powyżej 5 W (37 dBm) przy dowolnej częstotliwości w zakresie powyżej 8,5 GHz do 16 GHz włącznie;

3. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 3 W (34,77 dBm) przy dowolnej częstotliwości w zakresie powyżej 16 GHz do 31,8 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

4. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,1 nW (- 70 dBm) przy dowolnej częstotliwości w zakresie powyżej 31,8 GHz do 37 GHz włącznie;

5. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 1 W (30 dBm) przy dowolnej częstotliwości w zakresie powyżej 37 GHz do 43,5 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

6. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 31,62 mW (15 dBm) przy dowolnej częstotliwości w zakresie powyżej 43,5 GHz do 75 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 10 %;

7. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 10 mW (10 dBm) przy dowolnej częstotliwości w zakresie powyżej 75 GHz do 90 GHz włącznie, i przy "ułamkowej szerokości pasma" wynoszącej powyżej 5 %; lub

8. przystosowane do pracy z mocą wyjściową na granicy nasycenia powyżej 0,1 nW (- 70 dBm) przy dowolnej częstotliwości w zakresie powyżej 90 GHz;

e. "technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" urządzeń lub układów elektronicznych specjalnie zaprojektowanych dla telekomunikacji, zawierających części składowe wykonane z materiałów "nadprzewodzących", specjalnie zaprojektowane do pracy w temperaturach poniżej "temperatury krytycznej" co najmniej jednego z elementów "nadprzewodzących" i spełniające którekolwiek z poniższych kryteriów:

1. przełączanie prądowe dla obwodów cyfrowych za pomocą bramek "nadprzewodzących", dla którego iloczyn czasu zwłoki na bramkę (w sekundach) i rozproszenia mocy na bramkę (w watach) wynosi poniżej 10-14 J; lub

2. selekcję częstotliwości dla wszystkich częstotliwości za pomocą obwodów rezonansowych o wartościach Q przekraczających 10 000.

5E101 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju", "produkcji" lub "użytkowania" sprzętu wymienionego w pozycji 5A101.

Część 2 - "OCHRONA INFORMACJI"

Uwaga 1: nieużywane.

Uwaga 2: Kategoria 5 - część 2 nie obejmuje kontrolą wyrobów towarzyszących użytkownikowi dla jego osobistego użytku.

Uwaga 3: Uwaga kryptograficzna

Pozycje 5A002, 5D002.a.1, 5D002.b i 5D002.c.1 nie obejmują kontrolą następujących produktów:

a. produktów spełniających wszystkie następujące kryteria:

1. są ogólnie dostępne dla klientów poprzez ich sprzedaż bez ograniczeń z magazynów punktów sprzedaży detalicznej w jakikolwiek z wymienionych niżej sposobów:

a. bezpośrednie transakcje sprzedaży;

b. transakcje realizowane na zamówienie pocztowe;

c. transakcje zawierane drogą elektroniczną; lub

d. transakcje realizowane na zamówienie telefoniczne;

2. ich funkcjonalność kryptograficzna nie może być łatwo zmieniona przez użytkownika;

3. są przeznaczone do zainstalowania przez użytkownika bez dalszej, znaczącej pomocy ze strony dostawcy; oraz

4. w przypadku konieczności, szczegóły techniczne tych towarów są dostępne i zostaną dostarczone, na żądanie, właściwym organom państwa członkowskiego, w którym eksporter ma siedzibę, w celu potwierdzenia zgodności z warunkami określonymi w punktach od 1 do 3 powyżej;

b. części składowych osprzętu lub 'wykonywalnego oprogramowania' istniejących towarów opisanych w pkt a. niniejszej uwagi, które zostały zaprojektowane do tych istniejących towarów, spełniające wszystkie następujące kryteria:

1. "ochrona informacji" nie jest główną funkcją lub zestawem funkcji części składowej lub 'wykonywalnego oprogramowania';

2. część składowa ani 'wykonywalne oprogramowanie' nie zmienia żadnego elementu funkcjonalności kryptograficznej istniejących towarów ani nie dodaje elementów funkcjonalności kryptograficznej do istniejących towarów;

3. budowa części składowej lub 'wykonywalnego oprogramowania' jest stała i nie jest projektowana lub zmieniana wg specyfikacji klienta; oraz

4. tam, gdzie jest to konieczne, jeśli zostanie to ustalone przez właściwe organy państwa członkowskiego, w którym znajduje się siedziba eksportera, szczegółowe dane części składowej lub 'wykonywalnego oprogramowania' oraz szczegółowe dane odpowiednich produktów końcowych są dostępne i zostaną przekazane właściwym organom na ich wniosek w celu potwierdzenia zgodności z opisanymi powyżej warunkami.

Uwaga techniczna:

Do celów uwagi kryptograficznej, 'wykonywalne oprogramowanie' oznacza "oprogramowanie" w formie wykonywalnej z istniejącej części składowej osprzętu wykluczonej z pozycji 5A002 przez uwagę kryptograficzną.

Uwaga: 'Wykonywalne oprogramowanie' nie obejmuje kompletnych binarnych obrazów "oprogramowania" pracującego w produkcie końcowym.

Uwaga do uwagi kryptograficznej:

1. Aby spełnione zostały warunki określone w pkt a. uwagi 3, zastosowanie muszą znaleźć wszystkie poniższe kryteria:

a. towar może cieszyć się zainteresowaniem szerokiego kręgu osób fizycznych i przedsiębiorstw; oraz

b. cenę oraz informacje na temat głównej funkcjonalności towaru można uzyskać przed zakupem bez potrzeby konsultowania się ze sprzedawcą lub dostawcą. Zwykłe zapytanie o cenę nie jest uznawane za konsultację.

2. Podczas ustalania kwalifikowalności pkt a. uwagi 3 właściwe organy mogą wziąć pod uwagę odpowiednie czynniki, takie jak ilość, cena, wymagane umiejętności techniczne, istniejące kanały sprzedaży, typowi klienci, typowe zastosowanie lub wszelkie nietypowe praktyki dostawcy.

5A2 Systemy, urządzenia i części składowe

5A002 Następujące systemy i urządzenia związane z "ochroną informacji" oraz części składowe:

N.B. Sterowanie urządzeniami odbiorczymi globalnych systemów nawigacji satelitarnej (GNSS) zawierającymi lub wykorzystującymi funkcję deszyfrowania - zob. 7A005. Powiązane deszyfrujące "oprogramowanie" i "technologia" - zob. 7D005 i 7E001.

a. następujące zaprojektowane lub zmodyfikowane w celu zastosowania 'kryptografii do celów poufności danych' 'o symetrycznej długości klucza przekraczającej 56 bitów lub równoważnej', jeżeli ta funkcja kryptograficzna nadaje się do zastosowania, została aktywowana lub może zostać aktywowana za pomocą "aktywacji kryptograficznej" bez zastosowania bezpiecznego mechanizmu:

1. produkty, których podstawową funkcją jest "ochrona informacji";

2. cyfrowe systemy komunikacji i systemy sieciowe, sprzęt i części składowe niewymienione w pozycji 5A002.a.1;

3. komputery lub inne produkty, których podstawową funkcją jest przechowywanie lub przetwarzanie informacji, oraz ich części składowe, niewymienione w pozycjach 5A002.a.1 lub 5A002.a.2;

N.B. W odniesieniu do systemów operacyjnych zob. także pozycje 5D002.a.1 oraz 5D002.c.1.

4. produkty niewymienione w pozycjach od 5A002.a.1 do 5A002.a.3, w przypadku gdy 'kryptografia do celów poufności danych' 'o symetrycznej długości klucza przekraczającej 56 bitów lub równoważnej' spełnia wszystkie poniższe kryteria:

a. służy funkcji produktu niebędącej funkcją podstawową; oraz

b. jest wykonywana przez zainstalowany sprzęt lub "oprogramowanie", które jako samodzielny produkt byłyby wyszczególnione w kategorii 5 - część 2.

Uwagi techniczne:

1. Do celów pozycji 5A002.a 'kryptografia do celów poufności danych' oznacza "kryptografię", która wykorzystuje techniki cyfrowe i realizuje jakiekolwiek funkcje kryptograficzne inne niż następujące:

a. "uwierzytelnienie";

b. podpis cyfrowy;

c. spójność danych;

d. niezaprzeczalność;

e. zarządzanie prawami cyfrowymi, w tym wykonywanie "oprogramowania" zabezpieczonego przed kopiowaniem;

f. szyfrowanie lub deszyfrowanie służące do celów rozrywki, komercyjnych transmisji masowych lub zarządzania dokumentacją medyczną; lub

g. zarządzanie kluczami służące do którejkolwiek z funkcji opisanych w pkt a-f powyżej.

2. Do celów pozycji 5A002.a 'o symetrycznej długości klucza przekraczającej 56 bitów lub równoważnej' oznacza jedno z następujących:

a. "algorytm symetryczny" wykorzystujący długość klucza przekraczającą 56 bitów, nie wliczając bitów parzystości; lub

b. "algorytm asymetryczny", w którym bezpieczeństwo stosowania algorytmu bazuje na jakiejkolwiek z poniższych właściwości:

1. faktoryzacji liczb całkowitych powyżej 512 bitów (np. RSA);

2. zliczaniu dyskretnych logarytmów w multiplikatywnej grupie pola o skończonej wielkości większej niż 512 bitów (np. Diffie-Helman z Z/pZ); lub

3. dyskretnych logarytmach w grupie innej niż wspomniana w pkt b.2 większej niż 112 bitów (np. Diffie-Helman na krzywej eliptycznej).

Uwaga 1: Jeżeli to konieczne, szczegóły produktu muszą być dostępne właściwemu organowi kraju eksportera i przedłożone mu na jego żądanie, zgodnie z określonymi przez niego zasadami, by stwierdzić jedną z następujących okoliczności:

a. czy produkt spełnia kryteria pozycji od 5A002.a.1 do 5A002.a.4; lub

b. czy wykorzystanie funkcji kryptograficznych do celów poufności danych określona w pozycji 5A002.a nadaje się do zastosowania bez "aktywacji kryptograficznej".

Uwaga 2: Pozycja 5A002.a nie obejmuje kontrolą żadnych z poniższych produktów ani specjalnie do nich zaprojektowanych części składowych służących do "ochrony danych":

a. następujących kart elektronicznych i 'urządzeń do odczytu/zapisu' kart elektronicznych:

1. karta elektroniczna lub dokument osobisty do odczytu elektronicznego (np. żeton, paszport biometryczny), spełniające którekolwiek z poniższych kryteriów:

a. wykorzystanie funkcji kryptograficznych spełnia wszystkie następujące kryteria:

1. jest ograniczone do zastosowania w następujących urządzeniach lub systemach:

a. urządzenia lub systemy nieopisane w pozycjach od 5A002.a.1 do 5A002.a.4;

b. urządzenia lub systemy niestosujące 'kryptografii do celów poufności danych' 'o symetrycznej długości klucza przekraczającej 56 bitów lub równoważnej'; lub

c. urządzenia lub systemy wyłączone z pozycji 5A002.a na podstawie pkt b - f niniejszej uwagi; oraz

2. nie ma możliwości ich przeprogramowania do innego zastosowania; lub

b. spełniające wszystkie z poniższych kryteriów:

1. specjalnie zaprojektowane i ograniczone do ochrony przechowywanych na nich 'danych osobowych';

2. zawierające dane służące do celów transakcji publicznych lub handlowych lub do ustalenia tożsamości lub umożliwiające umieszczenie na nich wyłącznie takich danych; oraz

3. nieumożliwiające użytkownikowi dostępu do funkcji kryptograficznych;

Uwaga techniczna:

'Dane osobowe' obejmują wszelkie dane charakteryzujące daną osobę lub podmiot, takie jak kwota przechowywanych pieniędzy i dane niezbędne do "uwierzytelnienia".

2. 'urządzenia do odczytu/zapisu' specjalnie zaprojektowane lub przekształcone i ograniczone do stosowania w przedmiotach wymienionych w pkt a.1 niniejszej uwagi;

Uwaga techniczna:

'Urządzenia do odczytu/zapisu' obejmują sprzęt, który łączy się z kartami elektronicznymi lub dokumentami do odczytu elektronicznego za pośrednictwem sieci.

b. sprzętu kryptograficznego specjalnie zaprojektowanego i ograniczonego do zastosowań bankowych lub 'transakcji pieniężnych';

Uwaga techniczna:

'Transakcje pieniężne' w ramach uwagi 2.b do pozycji 5A002.a. obejmują pobieranie i rozliczanie opłat za przejazd lub funkcje kredytowe.

c. przewoźnych lub przenośnych radiotelefonów do zastosowań cywilnych (np. do zastosowania w cywilnych systemach radiokomunikacji komórkowej), w których nie ma możliwości przekazywania zaszyfrowanych danych bezpośrednio do innego radiotelefonu lub sprzętu (innych niż sprzęt sieci dostępu radiowego - RAN) ani przekazywania zaszyfrowanych danych przez sprzęt sieci dostępu radiowego (np. sterownik sieci radiowej - RNC, sterownik stacji bazowej - BSC);

d. sprzętu telefonii bezprzewodowej niezdolnego do szyfrowania typu "end-to-end", w którym, zgodnie z danymi producenta, maksymalny skuteczny zasięg działania bezprzewodowego bez dodatkowego wzmocnienia (tj. pojedyncza, bez pośrednictwa przekaźnika, odległość między terminalem a domową stacją bazową) wynosi mniej niż 400 m;

e. przewoźnych lub przenośnych radiotelefonów i podobnych bezprzewodowych urządzeń typu klient do zastosowań cywilnych, które wykorzystują wyłącznie opublikowane lub znajdujące się w sprzedaży standardy kryptograficzne (z wyjątkiem funkcji mających na celu zwalczanie piractwa, które nie muszą być publikowane) i spełniają przepisy pkt a.2 do a.4 uwagi kryptograficznej (kategoria 5 część 2, uwaga 3), które z myślą o konkretnym zastosowaniu w przemyśle cywilnym zostały na zamówienie wyposażone w funkcje niemające wpływu na funkcjonalność kryptograficzną oryginalnych urządzeń niewyposażonych w te funkcje;

f. produktów, w przypadku których funkcja "ochrony informacji" jest ograniczona do funkcji bezprzewodowej "sieci osobistej", spełniających wszystkie poniższe kryteria:

1. wykorzystują wyłącznie publiczne lub komercyjne standardy kryptograficzne; oraz

2. funkcje kryptograficzne są w nich ograniczone do nominalnego zasięgu działania nieprzekraczającego 30 metrów zgodnie ze specyfikacją producenta lub nieprzekraczającego 100 metrów zgodnie ze specyfikacjami producenta w odniesieniu do urządzeń, które nie mogą łączyć się z więcej niż siedmioma urządzeniami;

g. urządzeń sieci radiowej wykorzystywanych w telekomunikacji mobilnej przeznaczonych do zastosowań cywilnych, które spełniają również warunki określone w pkt a.2 do a.4 uwagi kryptograficznej (uwaga 3 w kategorii 5, część 2), posiadające moc wyjściową RF ograniczoną do 0,1 W (20 dBm) lub mniej i obsługujące nie więcej niż 16 bieżących użytkowników.

h. routerów, przełączników lub przekaźników, w przypadku których funkcje "ochrony informacji" są ograniczone do zadań z zakresu "eksploatacji, administrowania lub utrzymywania" ("EAU") i wykorzystują wyłącznie publiczne lub komercyjne standardy kryptograficzne; lub

i. sprzętu obliczeniowego lub serwerów ogólnego przeznaczenia, w przypadku których funkcje "ochrony informacji" spełniają wszystkie następujące kryteria:

1. wykorzystują wyłącznie publiczne lub komercyjne standardy kryptograficzne; oraz

2. spełniają którekolwiek z poniższych kryteriów:

a. stanowią integralną część CPU, które spełnia warunki określone w uwadze 3 do kategorii 5 - część 2;

b. stanowią integralną część systemu operacyjnego, który nie jest wymieniony w pozycji 5D002; lub

c. są ograniczone do "EAU" sprzętu.

b. zaprojektowane lub zmodyfikowane do konwersji, za pomocą "aktywacji kryptograficznej", produktu niewymienionego w kategorii 5, część 2 na produkt wymieniony w pozycjach 5A002.a. lub 5D002.c.1., i niezwolnionego w uwadze kryptograficznej (uwaga 3 w kategorii 5, część 2), lub do umożliwienia, za pomocą "aktywacji kryptograficznej", dodatkowej funkcji wymienionej w pozycji 5A002.a. w przypadku produktu już wymienionego w kategorii 5, część 2;

c. zaprojektowane lub zmodyfikowane do wykorzystania "kryptografii kwantowej";

Uwaga techniczna:

"Kryptografia kwantowa" bywa również określana jako kwantowa wymiana klucza (QKD).

d. zaprojektowane lub zmodyfikowane do wykorzystania technik kryptograficznych w celu generowania kodów przydzielania kanałów, szyfrowania (scrambling) lub identyfikacji sieci w systemach stosujących techniki modulacji ultraszerokopasmowej i spełniające którekolwiek z poniższych kryteriów:

1. szerokość pasma przekraczająca 500 MHz; lub

2. "ułamkowa szerokość pasma" wynosząca 20 % lub więcej;

e. zaprojektowane lub zmodyfikowane do wykorzystania technik kryptograficznych w celu generowania kodu rozpraszającego dla "widma rozproszonego", poza określonymi w pozycji 5A002.d., wraz z kodem rozrzucającym dla systemów z "rozrzucaniem częstotliwości";

5A003 następujące systemy, urządzenia i części składowe zaprojektowane do celów niekryptograficznej "ochrony informacji":

a. kablowe systemy telekomunikacyjne zaprojektowane lub zmodyfikowane z zastosowaniem środków mechanicznych, elektrycznych lub elektronicznych w celu wykrywania włamań do sieci teleinformatycznych;

Uwaga: Pozycja 5A003.a. obejmuje kontrolą jedynie bezpieczeństwo warstwy fizycznej. Do celów pozycji 5A003.a, warstwa fizyczna obejmuje warstwę 1 modelu odniesienia OSI (ISO/IEC 7498-1).

b. specjalnie zaprojektowane lub zmodyfikowane do redukcji przypadkowego przekazywania sygnałów noszących informację poza tym, co jest niezbędne ze względów zdrowotnych, bezpieczeństwa pracy i ochrony przed zakłóceniami elektromagnetycznymi;

5A004 następujące systemy, urządzenia i części składowe zaprojektowane do celów zwalczania, osłabiania lub obchodzenia "ochrony informacji":

a. zaprojektowane lub zmodyfikowane dla realizacji 'funkcji kryptoanalitycznych'.

Uwaga: Pozycja 5A004.a. obejmuje systemy lub urządzenia zaprojektowane lub zmodyfikowane tak, by realizowały 'funkcje kryptoanalityczne' z wykorzystaniem inżynierii odwrotnej.

Uwaga techniczna:

'Funkcje kryptoanalityczne' oznaczają funkcje zaprojektowane do łamania mechanizmów kryptograficznych w celu uzyskania tajnych informacji lub wrażliwych danych, włączając w to tekst jawny, hasła lub klucze kryptograficzne.

5B2 Urządzenia testujące, kontrolne i produkcyjne

5B002 Następujące urządzenia testujące, kontrolne i "produkcyjne" związane z "ochroną informacji":

a. sprzęt specjalnie zaprojektowany do "rozwoju" lub "produkcji" sprzętu wyszczególnionego w pozycjach 5A002, 5A003, 5A004 lub 5B002.b;

b. sprzęt pomiarowy specjalnie zaprojektowany do oceny i analizy funkcji "ochrony informacji" sprzętu wyszczególnionego w pozycji 5A002, 5A003 lub 5A004 lub "oprogramowania" wyszczególnionego w pozycjach 5D002.a lub 5D002.c.

5C2 Materiały

Żadne.

5D2 Oprogramowanie

5D002 Następujące "oprogramowanie":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do celów "rozwoju", "produkcji" lub "użytkowania" któregokolwiek z następujących sprzętów:

1. sprzętu wyszczególnionego w pozycji 5A002 lub "oprogramowania" wyszczególnionego w pozycji 5D002.c.1;

2. sprzętu wyszczególnionego w pozycji 5A003 lub "oprogramowania" wyszczególnionego w pozycji 5D002.c.2; lub

3. sprzętu wyszczególnionego w pozycji 5A004 lub "oprogramowania" wyszczególnionego w pozycji 5D002.c.3;

b. "oprogramowanie" zaprojektowane lub zmodyfikowane do konwersji, za pomocą "aktywacji kryptograficznej", produktu niewymienionego w kategorii 5, część 2 na produkt wymieniony w pozycjach 5A002.a. lub 5D002.c.1., i niezwolnionego w uwadze kryptograficznej (uwaga 3 w kategorii 5, część 2), lub do umożliwienia, za pomocą "aktywacji kryptograficznej", dodatkowej funkcji wymienionej w pozycji 5A002.a. w przypadku produktu już wymienionego w kategorii 5, część 2;

c. "oprogramowanie" posiadające takie same właściwości lub realizujące lub symulujące funkcje takie same jak, którekolwiek z poniższych:

1. sprzęt wyszczególniony w pozycjach 5A002.a, 5A002.c., 5A002.d. lub 5A002.e.;

Uwaga: Pozycja 5D002.c.1 nie obejmuje kontrolą "oprogramowania" ograniczonego do zadań "EAU" wykorzystujących wyłącznie publiczne lub komercyjne standardy kryptograficzne.

2. sprzęt wyszczególniony w pozycji 5A003; lub

3. sprzęt wyszczególniony w pozycji 5A004.

d. nieużywane.

5E2 Technologia

5E002 Następujące "technologie":

a. "technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" lub "użytkowania" sprzętu wymienionego w pozycji 5A002, 5A003, 5A004 lub 5B002 lub "oprogramowania" wymienionego w pozycji 5D002.a lub 5D002.c;

b. "technologia" zaprojektowana lub zmodyfikowana do konwersji, za pomocą "aktywacji kryptograficznej", produktu niewymienionego w kategorii 5, część 2 na produkt wymieniony w pozycjach 5A002.a. lub 5D002.c.1., i niezwolnionego w uwadze kryptograficznej (uwaga 3 w kategorii 5, część 2), lub do umożliwienia, za pomocą "aktywacji kryptograficznej", dodatkowej funkcji wymienionej w pozycji 5A002.a. w przypadku produktu już wymienionego w kategorii 5, część 2.

Uwaga: Pozycja 5E002 obejmuje dane techniczne "ochrony informacji" wynikające z procedur przeprowadzonych w celu oceny lub ustalenia wdrożenia funkcji, właściwości lub technik wymienionych w kategorii 5-część 2.

KATEGORIA 6 - CZUJNIKI I LASERY

6A Systemy, urządzenia i części składowe

6A001 Następujące systemy, urządzenia i części akustyczne:

a. następujące okrętowe systemy akustyczne, urządzenia lub specjalnie do nich zaprojektowane części składowe:

1. następujące systemy aktywne (nadajniki lub nadajniki-odbiorniki), urządzenia i specjalnie do nich zaprojektowane części składowe:

Uwaga: Pozycja 6A001.a.1 nie obejmuje kontrolą następujących urządzeń:

a. sond do pomiaru głębokości pracujących w pionie pod aparaturą, niemających możliwości przeszukiwania w zakresie szerszym niż ± 20°, których działanie jest ograniczone do pomiaru głębokości wody, odległości do zanurzonych lub zagrzebanych obiektów lub do wykrywania ławic ryb;

b. następujących pław lub staw akustycznych:

1. akustycznych pław lub staw ostrzegawczych;

2. sonarów impulsowych specjalnie zaprojektowanych do przemieszczenia się lub powrotu do położenia podwodnego.

a. następujące urządzenia do akustycznego badania dna morskiego:

1. urządzenia dla statków nawodnych zaprojektowane do sporządzania map topograficznych dna morskiego i spełniające wszystkie poniższe kryteria:

a. przeznaczenie do dokonywania pomiarów pod kątem większym niż 20° w stosunku do pionu;

b. przeznaczenie do pomiarów topografii dna morskiego położonego na głębokościach większych niż 600 m;

c. 'rozdzielczość sondowania' mniejsza niż 2; oraz

d. 'zwiększenie' dokładności określania głębokości poprzez kompensację w odniesieniu do wszystkich poniższych:

1. ruch czujnika akustycznego;

2. rozchodzenie się fali w wodzie w kierunku od czujnika do dna morskiego i z powrotem; oraz

3. prędkość dźwięku przy czujniku;

Uwagi techniczne:

1. 'Rozdzielczość sondowania' oznacza szerokość pola omiatania (w stopniach) podzieloną przez liczbę sondowań na jedno omiecenie.

2. 'Zwiększenie' obejmuje zdolność kompensowania z wykorzystaniem środków zewnętrznych.

2. podwodne urządzenia zaprojektowane do sporządzania map topograficznych dna morskiego i spełniające którekolwiek z poniższych kryteriów:

Uwaga techniczna:

Wartość ciśnienia czujnika akustycznego określa wartość głębokości urządzeń wymienionych w pozycji 6A001.a.1.a.2.

a. spełniające wszystkie z poniższych kryteriów:

1. a. zaprojektowane lub zmodyfikowane do pracy na głębokościach przekraczających 300 m; oraz

2. 'wskaźnik sondowania' większy niż 3 800 m/s; lub

Uwaga techniczna:

'Wskaźnik sondowania' jest iloczynem maksymalnej prędkości (w m/s), z jaką może pracować czujnik i maksymalnej liczby sondowań na jedno omiecenie, przy założeniu 100 % pokrycia. W przypadku systemów, które prowadzą sondowanie w dwóch kierunkach (sonary 3D) należy zastosować maksymalny wskaźnik sondowania, bez względu na jego kierunek.

b. urządzenia zaprojektowane do sporządzania map topograficznych, niewymienione w pozycji 6A001.a.1.a.2.a., spełniające wszystkie poniższe kryteria:

1. a. zaprojektowane lub zmodyfikowane do pracy na głębokościach przekraczających 100 m;

2. przeznaczenie do dokonywania pomiarów pod kątem większym niż 20° w stosunku do pionu;

3. spełniające którekolwiek z poniższych kryteriów:

a. częstotliwość robocza poniżej 350 kHz; lub

b. zaprojektowane do dokonywania pomiarów topografii dna morskiego w zasięgu przekraczającym 200 m przy pomocy czujnika akustycznego; oraz

4. 'zwiększenie' "dokładności" określania głębokości poprzez kompensację w odniesieniu do wszystkich poniższych:

a. ruch czujnika akustycznego;

b. rozchodzenie się fali w wodzie w kierunku od czujnika do dna morskiego i z powrotem; oraz

c. prędkość dźwięku przy czujniku;

3. boczny sonar skanujący (SSS) lub sonar z syntezą apertury (SAS) zaprojektowany do obrazowania dna morskiego i spełniające wszystkie poniższe kryteria:

a. zaprojektowany lub zmodyfikowany do pracy na głębokościach przekraczających 500 m;

b. 'wskaźnik pokrycia obszaru' większy niż 570 m2/s podczas pracy przy maksymalnym zasięgu, z jakim może pracować, z 'rozdzielczością wzdłużną' mniejszą niż 15 cm; oraz

c. 'rozdzielczość poprzeczna' mniejsza niż 15 cm;

Uwagi techniczne:

1. 'Wskaźnik pokrycia powierzchni' (w m2/s) stanowi dwukrotność iloczynu zakresu sonaru (w

m) oraz maksymalnej prędkości (w m/s), z jaką może pracować czujnik przy tym zakresie.

2. 'Rozdzielczość wzdłużna' (w cm) - wyłącznie w odniesieniu do SSS, jest iloczynem azymutowej (poziomej) szerokości wiązki (w stopniach), zakresu sonaru (w m) i liczby 0,873.

3. 'Rozdzielczość poprzeczna' (w cm) jest ilorazem liczby 75 i szerokości pasma sygnału (w kHz).

b. Systemy lub matryce nadawcze lub odbiorcze, zaprojektowane do wykrywania lub lokalizacji obiektów, spełniające którekolwiek z poniższych kryteriów:

1. częstotliwość nośna poniżej 10 kHz;

2. poziom ciśnienia akustycznego powyżej 224 dB (poziom odniesienia 1 μΡa na 1 m) w odniesieniu do urządzeń z częstotliwością roboczą w paśmie od 10 kHz do 24 kHz włącznie;

3. poziom ciśnienia akustycznego powyżej 235 dB (poziom odniesienia 1 μΡa na 1 m) w odniesieniu do urządzeń z częstotliwością roboczą w paśmie od 24 kHz do 30 kHz;

4. kształtujące wiązki o kącie rozproszenia poniżej 1o względem dowolnej osi i posiadające częstotliwość roboczą poniżej 100 kHz;

5. umożliwiające jednoznaczny pomiar odległości do obiektów w zakresie powyżej 5 120 m; lub

6. skonstruowane w ten sposób, że w normalnych warunkach pracy są wytrzymałe na ciśnienia na głębokości większej niż 1 000 m i są zaopatrzone w przetworniki spełniające którekolwiek z poniższych kryteriów:

a. z dynamiczną kompensacją ciśnienia; lub

b. w których elementem przetwarzającym nie jest cyrkonian/tytanian ołowiu;

c. reflektory akustyczne (łącznie z przetwornikami) wyposażone w elementy piezoelektryczne, magnetostrykcyjne, elektrostrykcyjne, elektrodynamiczne lub hydrauliczne, działające indywidualnie lub w odpowiedniej kombinacji zespołowej i spełniające którekolwiek z poniższych kryteriów:

Uwaga 1: Poziom kontroli reflektorów akustycznych, łącznie z przetwornikami, specjalnie zaprojektowanych do innych urządzeń niewymienionych w pozycji 6A001, wynika z poziomu kontroli tych innych urządzeń.

Uwaga 2: Pozycja 6A001.a.1.c nie obejmuje kontrolą elektronicznych źródeł kierujących dźwięk tylko w pionie ani źródeł mechanicznych (np. pistolety powietrzne lub parowe) lub chemicznych (np. materiały wybuchowe).

Uwaga 3: Elementy piezoelektryczne wymienione w pozycji 6A001.a.1.c. obejmują elementy wykonane z pojedynczych kryształów piezoelektrycznych niobianu ołowiu i magnezu/tytanianu ołowiu (Pb(Mg1/3Nb2/3)O3-PbTiO3, lub PMN-PT) wytworzonych z roztworu stałego lub pojedynczych kryształów piezoelektrycznych niobianu ołowiu i indu/niobianu ołowiu i magnezu/tytanianu ołowiu (Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3, lub PIN-PMN-PT) wytworzonych z roztworu stałego.

1. działające w zakresie częstotliwości poniżej 10 kHz i spełniające którekolwiek z poniższych kryteriów:

a. nie są zaprojektowane do ciągłej pracy przez 100 % cyklu roboczego i mają promieniowany 'poziom mocy źródła w polu swobodnym (SLRMS)' przekraczający (10log(f) + 169,77) dB (odniesienie 1 μPa przy 1 m), gdzie f oznacza częstotliwość w hercach maksymalnej odpowiedzi na pobudzenie napięciowe (TVR) poniżej 10kHz; lub

b. są zaprojektowane do ciągłej pracy przez 100 % cyklu roboczego i mają stale promieniowany 'poziom mocy źródła w polu swobodnym (SLRMS)' przez 100 % cyklu roboczego przekraczający (10log(f) + 159,77) dB (odniesienie 1 μPa przy 1 m), gdzie f oznacza częstotliwość w hercach maksymalnej odpowiedzi na pobudzenie napięciowe (TVR) poniżej 10kHz; lub

Uwaga techniczna:

'Poziom mocy źródła w polu swobodnym (SLRMS)' jest określany wzdłuż osi maksymalnej odpowiedzi i w części pola w dużej odległości od źródła promieniowania projektora dźwiękowego. Może on zostać obliczony na podstawie odpowiedzi na pobudzenie napięciowe przy zastosowaniu następującego równania: SLRMS = (TVR + 20log VRMS) dB (ref 1μPa przy 1 m), gdzie SLRMS oznacza poziom mocy źródła, TVR oznacza odpowiedź na pobudzenie napięciowe, a VRMS oznacza napięcie sterowania projektora.

2. nieużywane;

3. tłumienie pasma bocznego częstotliwości powyżej 22 dB;

d. systemy akustyczne i urządzenia do określania położenia statków nawodnych lub pojazdów podwodnych spełniające wszystkie poniższe kryteria oraz elementy zaprojektowane specjalnie do nich:

1. zasięg wykrywania powyżej 1 000 m; oraz

2. błąd wyznaczonego położenia z dokładnością poniżej 10 m (wartość średnia kwadratowa) w przypadku pomiaru w zasięgu do 1 000 m;

Uwaga: Pozycja 6A001.a.1.d obejmuje:

a. urządzenia, w których zastosowano koherentne "przetwarzanie sygnałów" pomiędzy dwiema lub większą liczbą boi kierunkowych a hydrofonem na statku nawodnym lub w pojeździe podwodnym;

b. urządzenia mające możliwość automatycznego korygowania błędów prędkości rozchodzenia się dźwięku w celu obliczenia położenia obiektu.

e. aktywne pojedyncze sonary, specjalnie zaprojektowane lub zmodyfikowane w celu wykrywania, ustalania położenia i automatycznej klasyfikacji pływaków lub nurków, spełniające wszystkie poniższe kryteria oraz specjalnie do nich zaprojektowane nadawcze i odbiorcze akustyczne zestawy matrycowe:

1. zasięg wykrywania powyżej 530 m;

2. błąd wyznaczonego położenia z dokładnością poniżej 15 m (wartość średnia kwadratowa) w przypadku pomiaru w zasięgu do 530 m; oraz

3. szerokość pasma przekazywanego impulsu powyżej 3 kHz;

N.B. Systemy wykrywania nurków specjalnie zaprojektowane lub zmodyfikowane do zastosowań wojskowych - zob. wykaz uzbrojenia.

Uwaga: W przypadku pozycji 6A001.a.1.e, jeśli określono wiele zasięgów wykrywania w zależności od środowiska, zastosowanie ma największy zasięg.

2. następujące pasywne urządzenia i systemy oraz specjalnie do nich zaprojektowane elementy:

a. hydrofony spełniające którekolwiek z poniższych kryteriów:

Uwaga: Poziom kontroli hydrofonów specjalnie zaprojektowanych do innych urządzeń wynika z poziomu kontroli tych innych urządzeń.

Uwaga techniczna:

Hydrofony składają się z co najmniej jednego elementu czujnikowego wytwarzającego pojedynczy akustyczny kanał wyjścia. Te, które zawierają kilka elementów, mogą być określane jako grupa hydrofonów.

1. wyposażone w ciągłe, elastyczne zespoły czujnikowe;

2. złożone z dyskretnych elementów czujnikowych o średnicy lub długości poniżej 20 mm znajdujących się od siebie w odległości mniejszej niż 20 mm;

3. wyposażone w jeden z następujących elementów czujnikowych:

a. światłowody;

b. 'piezoelektryczne powłoki polimerowe' inne niż polifluorek winylidenu (PVDF) i jego kopolimery {P(VDF-TrFE) i P(VDF-TFE)};

c. 'elastyczne kompozyty piezoelektryczne';

d. pojedyncze kryształy piezoelektryczne niobianu ołowiu i magnezu/tytanianu ołowiu (tj. Pb(Mg1/3Nb2/3)O3-PbTiO3, lub PMN-PT) wytworzone z roztworu stałego; lub

e. pojedyncze kryształy piezoelektryczne niobianu ołowiu i indu/niobianu ołowiu i magnezu/ tytanianu ołowiu (tj. Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3, lub PIN-PMN-PT) wytworzone z roztworu stałego;

4. 'czułość hydrofonów' lepsza niż -180 dB na każdej głębokości bez kompensacji przyspieszeniowej;

5. zaprojektowane do pracy na głębokościach większych niż 35 m z kompensacją przyspieszeniową; lub

6. zaprojektowane do działania na głębokościach większych niż 1 000 m;

Uwagi techniczne:

1. Elementy czujnikowe typu 'piezoelektryczne powłoki polimerowe' składają się ze spolaryzowanej powłoki polimerowej, rozpiętej i przymocowanej do ramy lub szpuli (trzpienia).

2. Elementy czujnikowe typu 'elastyczne kompozyty piezoelektryczne' składają się z piezoelektrycznych cząstek lub włókien ceramicznych połączonych z elektrycznie izolującym, akustycznie przejrzystym tworzywem gumowym, polimerowym lub epoksydowym, przy czym tworzywo to jest integralną częścią elementów czujnikowych.

3. 'Czułość hydrofonu' definiuje się jako dwadzieścia logarytmów przy podstawie 10 ze stosunku napięcia skutecznego po sprowadzeniu do napięcia skutecznego 1 V, po umieszczeniu czujnika hydrofonowego, bez przedwzmacniacza, w polu akustycznych fal płaskich o ciśnieniu skutecznym 1 μΡa. Na przykład hydrofon o czułości -160 dB (poziom odniesienia 1 V na μΡa) daje w takim polu napięcie wyjściowe 10-8 V, natomiast hydrofon o czułości -180 dB daje w takim samym polu napięcie wyjściowe tylko 10-9 V. Zatem hydrofon o czułości -160 dB jest lepszy od hydrofonu o czułości -180 dB.

b. holowane zestawy matrycowe hydrofonów akustycznych spełniające którekolwiek z poniższych kryteriów:

Uwaga techniczna:

Zespoły hydrofonów składają się z kilku hydrofonów zapewniających szereg akustycznych kanałów wyjścia.

1. odległość pomiędzy grupami hydrofonów wynosi poniżej 12,5 m; lub 'umożliwia modyfikację' tak, żeby odległość pomiędzy grupami hydrofonów była mniejsza niż 12,5 m;

2. zaprojektowane lub 'umożliwiające modyfikację' do działania na głębokościach większych niż 35 m;

Uwaga techniczna:

Wspomniana w pozycji 6A001.a.2.b.1 i 2 'możliwość modyfikowania' oznacza, że są zaopatrzone w elementy umożliwiające zmianę przewodów lub połączeń w celu zmiany odległości pomiędzy grupami hydrofonów lub granicznych głębokości roboczych. Do elementów takich zalicza się: zapasowe przewody w ilości przewyższającej o 10 % liczbę przewodów używanych, bloki umożliwiające zmianę odległości pomiędzy grupami hydrofonów lub wewnętrzne regulowane urządzenia limitujące głębokość lub urządzenia sterujące umożliwiające sterowanie więcej niż jedną grupą hydrofonów.

3. czujniki kursowe objęte kontrolą według pozycji 6A001.a.2.d;

4. sieci węży ze wzmocnieniem podłużnym;

5. wyposażenie w układ zespołowy o średnicy mniejszej niż 40 mm;

6. nieużywane;

7. wyposażenie w hydrofony o właściwościach określonych w pozycji 6A001.a.2.a; lub

8. wykorzystujące akcelerometr czujniki hydroakustyczne określone w pozycji 6A001.a.2.g.;

c. urządzenia przetwarzające, specjalnie zaprojektowane do holowanych zestawów (matryc) hydrofonów akustycznych posiadające "możliwość programowania przez użytkownika" oraz możliwość przetwarzania i korelacji w funkcji czasu lub częstotliwości, łącznie z analizą spektralną, filtrowaniem cyfrowym i kształtowaniem wiązki za pomocą szybkiej transformaty Fouriera lub innych transformat lub procesów;

d. czujniki kursowe spełniające wszystkie poniższe kryteria:

1. "dokładność" powyżej 0,5°; oraz

2. zaprojektowane do pracy na głębokościach większych niż 35 m lub wyposażone w regulowane lub możliwe do demontażu czujniki głębokości z przeznaczeniem do pracy na głębokościach większych niż 35 m;

N.B. Inercyjne układy informujące o kursie - zob. pozycja 7A003.c.

e. holowane zestawy matrycowe hydrofonów akustycznych z dennymi lub międzywręgowymi układami kablowymi spełniające którekolwiek z poniższych kryteriów:

1. wykorzystujące hydrofony z pozycji 6A001.a.2.a;

2. zawierające moduły multipleksowe sygnałów grup hydrofonów, spełniające wszystkie poniższe kryteria:

a. zaprojektowane do pracy na głębokościach większych niż 35 m lub wyposażone w regulowane lub możliwe do demontażu czujniki głębokości z przeznaczeniem do pracy na głębokościach większych niż 35 m; oraz

b. mogące pracować wymiennie z modułami holowanych zestawów hydrofonów akustycznych; lub

3. wyposażone w wykorzystujące akcelerometr czujniki hydroakustyczne określone w pozycji 6A001.a.2.g.;

f. urządzenia przetwarzające, specjalnie zaprojektowane do kablowych układów dennych lub międzywręgowych, posiadające "możliwość programowania przez użytkownika" oraz umożliwiające przetwarzanie i korelację w dziedzinie czasu lub częstotliwości, w tym analizę widmową, filtrowanie cyfrowe oraz cyfrowe kształtowanie wiązki za pomocą szybkiej transformaty Fouriera lub innych transformat lub procesów;

g. wykorzystujące akcelerometr czujniki hydroakustyczne spełniające wszystkie poniższe kryteria:

1. składające się z trzech akcelerometrów rozmieszczonych wzdłuż trzech różnych osi;

2. posiadające ogólną 'wrażliwość na przyspieszenie' powyżej 48 dB (odniesienie 1 000 mV rms/g);

3. zaprojektowane do działania na głębokościach większych niż 35 m; oraz

4. częstotliwość robocza poniżej 20 kHz;

Uwaga: Pozycja 6A001.a.2.g. nie obejmuje kontrolą czujników prędkości cząsteczek ani geofonów.

Uwagi techniczne:

1. Wykorzystujące akcelerometr czujniki hydroakustyczne określane są również jako czujniki wektorowe.

2. 'Wrażliwość na przyspieszenie' definiuje się jako dwadzieścia logarytmów przy podstawie 10 ze stosunku napięcia skutecznego po sprowadzeniu do napięcia skutecznego 1 V, po umieszczeniu czujnika hydroakustycznego, bez przedwzmacniacza, w polu akustycznych fal płaskich o przyspieszeniu 1 g (i.e., 9,81 m/s2).

Uwaga: Pozycja 6A001.a.2 obejmuje kontrolą również urządzenia odbiorcze powiązane lub niepowiązane w warunkach normalnego użytkowania z odrębnymi urządzeniami aktywnymi oraz specjalnie do nich zaprojektowane podzespoły.

b. następujące urządzenia sonarowe posługujące się logami korelacyjnymi i dopplerowskimi przeznaczone do pomiaru prędkości poziomej obiektu, na którym się znajdują, względem dna morza:

1. urządzenia sonarowe posługujące się logami korelacyjnymi i spełniające którekolwiek z poniższych kryteriów:

a. przeznaczenie do pracy w przypadku odległości obiektu od dna przekraczającej 500 m; lub

b. "dokładność" pomiaru prędkości większa niż 1 %;

2. urządzenia sonarowe posługujące się logami dopplerowskimi umożliwiające określenie prędkości z "dokładnością" lepszą niż 1 %;

Uwaga 1: Pozycja 6A001.b nie obejmuje kontrolą sond do pomiaru głębokości, które ograniczone są do którejkolwiek z poniższych funkcji:

a. pomiar głębokości wody;

b. pomiar odległości do zanurzonych lub zagrzebanych obiektów; lub

c. wykrywanie ławic ryb.

Uwaga 2: Pozycja 6A001.b nie obejmuje kontrolą urządzeń specjalnie zaprojektowanych do zainstalowania na statkach nawodnych.

c. nieużywane.

6A002 Następujące czujniki optyczne lub sprzęt i ich części składowe:

N.B. ZOB. TAKŻE POZYCJA 6A102.

a. następujące detektory optyczne:

1. następujące detektory półprzewodnikowe "klasy kosmicznej":

Uwaga: Do celów pozycji 6A002.a.1 detektory półprzewodnikowe obejmują "matryce detektorowe płaszczyzny ogniskowej".

a. detektory półprzewodnikowe "klasy kosmicznej" spełniające wszystkie poniższe kryteria:

1. reakcja szczytowa w zakresie długości fal z przedziału powyżej 10 nm, ale nieprzekraczającej 300 nm; oraz

2. w zakresie fal o długości powyżej 400 nm reakcja słabsza niż 0,1 % reakcji szczytowej;

b. detektory półprzewodnikowe "klasy kosmicznej" spełniające wszystkie poniższe kryteria:

1. reakcja szczytowa w zakresie długości fal z przedziału powyżej 900 nm, ale nieprzekraczającej 1 200 nm; oraz

2. "stała czasowa" reakcji 95 ns lub poniżej;

c. detektory półprzewodnikowe "klasy kosmicznej" posiadające reakcję szczytową w zakresie długości fal powyżej 1 200 nm, ale nieprzekraczającej 30 000 nm;

d. "matryce detektorowe płaszczyzny ogniskowej" "klasy kosmicznej" mające więcej niż 2 048 elementów na zespół i reakcję szczytową w paśmie fal o długości powyżej 300 nm, ale nieprzekraczającej 900 nm;

2. następujące lampowe wzmacniacze obrazu i specjalnie do nich zaprojektowane elementy:

Uwaga: Pozycja 6A002.a.2 nie obejmuje kontrolą nieobrazowych lamp fotopowielaczowych wyposażonych w znajdujący się w próżni czujnik elektronowy ograniczony wyłącznie do jakiegokolwiek z poniższych:

a. pojedyncza anoda metalowa; lub

b. anody metalowe o odległości między środkami otworków większej niż 500 μm.

Uwaga techniczna:

'Powielanie ładunków' oznacza formę wzmacniania obrazów elektronicznych i zdefiniowane jest jako wytwarzanie nośników ładunków w wyniku procesu jonizacji strumieniem. Czujniki 'powielania ładunków' mogą mieć postać lampowego wzmacniacza obrazu, detektora półprzewodnikowego lub "matrycy detektorowej płaszczyzny ogniskowej".

a. lampowe wzmacniacze obrazu spełniające wszystkie poniższe kryteria:

1. reakcja szczytowa w zakresie długości fal z przedziału powyżej 400 nm, ale nieprzekraczającej 1 050 nm;

2. wzmacnianie obrazów elektronicznych z wykorzystaniem którychkolwiek z poniższych:

a. elektrody mikrokanalikowej z otworkami w odstępach (odległość pomiędzy środkami otworków) 12 μm lub mniejszych; lub

b. czujników elektronowych o rozmiarach pojedynczego niełączonego piksela 500 μm lub mniej specjalnie zaprojektowanych lub zmodyfikowanych, by uzyskać 'powielanie ładunków' w sposób inny niż za pomocą elektrody mikrokanalikowej; oraz

3. dowolnej z poniższych fotokatod:

a. fotokatody alkaliczne wielopierwiastkowe (np. S-20 i S-25) o czułości świetlnej przekraczającej 350 μΑ/lm;

b. fotokatody GaAs lub GaInAs; lub

c. inne fotokatody półprzewodnikowe oparte na "związkach III/V" o maksymalnej "czułości promieniowania" powyżej 10 mA/W;

b. lampowe wzmacniacze obrazu spełniające wszystkie poniższe kryteria:

1. reakcja szczytowa w zakresie długości fal z przedziału powyżej 1 050 nm, ale nieprzekraczającej 1 800 nm;

2. wzmacnianie obrazów elektronicznych z wykorzystaniem którychkolwiek z poniższych:

a. elektrody mikrokanalikowej z otworkami w odstępach (odległość pomiędzy środkami otworków) 12 μm lub mniejszych; lub

b. czujników elektronowych o rozmiarach pojedynczego niełączonego piksela 500 μm lub mniej specjalnie zaprojektowanych lub zmodyfikowanych, by uzyskać 'powielanie ładunków' w sposób inny niż za pomocą elektrody mikrokanalikowej; oraz

3. fotokatody półprzewodnikowe (np. GaAs lub GaInAs) oparte na "związkach III/V" oraz fotokatody o elektronach przeniesionych, o maksymalnej "czułości promieniowania" powyżej 15 mA/W;

c. następujące specjalnie opracowane elementy:

1. elektrody mikrokanalikowe do wzmacniania obrazów z otworkami w odstępach (odległość pomiędzy środkami otworków) nie większych niż 12 μm;

2. czujniki elektronowe o rozmiarach pojedynczego niełączonego piksela 500 μm lub mniej specjalnie zaprojektowane lub zmodyfikowane, by uzyskać 'powielanie ładunków' w sposób inny niż za pomocą elektrody mikrokanalikowej;

3. fotokatody półprzewodnikowe (np. GaAs lub GaInAs) oparte na "związkach III/V" oraz fotokatody o elektronach przeniesionych;

Uwaga: Pozycja 6A002.a.2.c.3 nie obejmuje kontrolą fotokatod półprzewodnikowych związkowych zaprojektowanych tak, by osiągały maksymalnie którąkolwiek z poniższych "czułości promieniowania":

a. 10 mA/W lub mniej przy reakcji szczytowej w zakresie długości fal z przedziału powyżej 400 nm, ale nie więcej niż 1 050 nm; lub

b. 15 mA/W lub mniej przy reakcji szczytowej w zakresie długości fal z przedziału powyżej 1 050 nm, ale nie więcej niż 1 800 nm;

3. następujące, inne niż "klasy kosmicznej" "matryce detektorowe płaszczyzny ogniskowej":

N.B. 'Mikrobolometryczne' "matryce detektorowe płaszczyzny ogniskowej", inne niż "klasy kosmicznej" są wymienione jedynie w pozycji 6A002.a.3.f.

Uwaga techniczna:

"Matryce detektorowe płaszczyzny ogniskowej" to liniowe lub dwuwymiarowe wieloelementowe zespoły detektorów.

Uwaga 1: Pozycja 6A002.a.3 obejmuje kontrolą zespoły fotoprzewodzące i fotowoltaiczne.

Uwaga 2: Pozycja 6A002.a.3. nie obejmuje kontrolą:

a. wieloelementowych (nie więcej niż 16 elementów) komórek fotoelektrycznych w obudowie, zawierających siarczek lub selenek ołowiu;

b. detektorów piroelektrycznych, w których zastosowano którekolwiek z poniższych:

1. siarczan triglicyny i jego odmiany;

2. tytanian ołowiu-lantanu-cyrkonu i jego odmiany;

3. tantalan litu;

4. polifluorek winylidenu i jego odmiany; lub

5. niobian strontu-baru i jego odmiany;

c. "matryc detektorowych płaszczyzny ogniskowej" specjalnie zaprojektowanych lub zmodyfikowanych tak, by uzyskać 'powielanie ładunków', oraz ograniczonych projektowo tak, by ich maksymalna "czułość promieniowania" wynosiła 10 mA/W lub mniej przy długości fal powyżej 760 nm, spełniających wszystkie poniższe kryteria:

1. wyposażonych w mechanizm ograniczenia reakcji, zaprojektowany w sposób nieprzewidujący jego usuwania ani modyfikowania; oraz

2. spełniających którekolwiek z poniższych kryteriów:

a. mechanizm ograniczenia reakcji jest zintegrowany z elementem detekcyjnym lub połączony z nim; lub

b. "matryca detektorowa płaszczyzny ogniskowej" działa wyłącznie wtedy, gdy zainstalowany jest mechanizm ograniczenia reakcji.

Uwaga techniczna:

Mechanizm ograniczenia reakcji, w jaki wyposażony jest element detekcyjny, jest zaprojektowany tak, by w przypadku jego usunięcia lub modyfikacji detektor przestawał działać.

d. Stosy termoelektryczne posiadające mniej niż 5 130 elementów

Uwaga techniczna:

'Powielanie ładunków' oznacza formę wzmacniania obrazów elektronicznych i zdefiniowane jest jako wytwarzanie nośników ładunków w wyniku procesu jonizacji strumieniem. Czujniki 'powielania ładunków' mogą mieć postać lampowego wzmacniacza obrazu, detektora półprzewodnikowego lub "matrycy detektorowej płaszczyzny ogniskowej".

a. inne niż "klasy kosmicznej" "matryce detektorowe płaszczyzny ogniskowej" spełniające wszystkie poniższe kryteria:

1. pojedyncze elementy o reakcji szczytowej w zakresie długości fal z przedziału powyżej 900 nm, ale nieprzekraczającej 1 050 nm; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. "stała czasowa" reakcji poniżej 0,5 ns; lub

b. specjalnie zaprojektowane lub zmodyfikowane, by uzyskać 'powielanie ładunków', i mające maksymalną "czułość promieniowania" powyżej 10 mA/W;

b. inne niż "klasy kosmicznej" "matryce detektorowe płaszczyzny ogniskowej" spełniające wszystkie poniższe kryteria:

1. pojedyncze elementy o reakcji szczytowej w zakresie długości fal z przedziału powyżej 1 050 nm, ale nieprzekraczającej 1 200 nm; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. "stała czasowa" reakcji 95 ns lub poniżej; lub

b. specjalnie zaprojektowane lub zmodyfikowane, by uzyskać 'powielanie ładunków', i mające maksymalną "czułość promieniowania" powyżej 10 mA/W;

c. inne niż "klasy kosmicznej" nieliniowe (dwuwymiarowe) "matryce detektorowe płaszczyzny ogniskowej" posiadające reakcję szczytową poszczególnych elementów w zakresie długości fal z przedziału powyżej 1 200 nm, ale nieprzekraczającej 30 000 nm;

N.B. 'Mikrobolometryczne' "matryce detektorowe płaszczyzny ogniskowej", inne niż "klasy kosmicznej", wykonane na bazie krzemu lub innych materiałów są wymienione jedynie w pozycji 6A002.a.3.f.

d. inne niż "klasy kosmicznej" liniowe (jednowymiarowe) "matryce detektorowe płaszczyzny ogniskowej" spełniające wszystkie poniższe kryteria:

1. pojedyncze elementy o reakcji szczytowej w zakresie długości fal z przedziału powyżej 1 200 nm, ale nieprzekraczającej 3 000 nm; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. stosunek wymiaru 'kierunku przeszukiwania' elementu detekcyjnego do wymiaru 'poprzecznego kierunku przeszukiwania' elementu detekcyjnego poniżej 3,8; lub

b. przetwarzanie sygnałów w elementach detekcyjnych;

Uwaga: Pozycja 6A002.a.3.d nie obejmuje kontrolą "matryc detektorowych płaszczyzny ogniskowej" (nieprzekraczających 32 elementów), w których elementy detekcyjne są wykonane wyłącznie z germanu.

Uwaga techniczna:

Do celów pozycji 6A002.a.3.d 'poprzeczny kierunek przeszukiwania' jest określany jako oś równoległa do liniowego układu elementów detekcyjnych, a 'kierunek przeszukiwania' jest określany jako oś prostopadła do liniowego układu elementów detekcyjnych.

e. inne niż "klasy kosmicznej" liniowe (jednowymiarowe) "matryce detektorowe płaszczyzny ogniskowej" posiadające reakcję szczytową poszczególnych elementów w zakresie długości fal z przedziału powyżej 3 000 nm, ale nieprzekraczającej 30 000 nm;

f. inne niż "klasy kosmicznej" nieliniowe (dwuwymiarowe) "matryce detektorowe płaszczyzny ogniskowej" w zakresie promieniowania podczerwonego oparte na materiale 'mikrobolometrycznym' posiadające niefiltrowaną reakcję poszczególnych elementów w zakresie długości fal z przedziału powyżej 8 000 nm, ale nieprzekraczającej 14 000 nm;

Uwaga techniczna:

Do celów 6A002.a.3.f 'mikrobolometr' jest określany jako obrazowy detektor termalny, który w wyniku zmiany temperatury w detektorze spowodowanej przez absorpcję promieniowania podczerwonego generuje nadające się do wykorzystania sygnały.

g. inne niż "klasy kosmicznej" "matryce detektorowe płaszczyzny ogniskowej" spełniające wszystkie poniższe kryteria:

1. oddzielne elementy detekcyjne o reakcji szczytowej w zakresie długości fal z przedziału powyżej 400 nm, ale nieprzekraczającej 900 nm;

2. specjalnie zaprojektowane lub zmodyfikowane, by uzyskać 'powielanie ładunków' i mające maksymalną "czułość promieniowania" powyżej 10 mA/W przy długości fal powyżej 760 nm; oraz

3. mające powyżej 32 elementów;

b. "monospektralne czujniki obrazowe" i "wielospektralne czujniki obrazowe" przeznaczone do zdalnego wykrywania obiektów i spełniające którekolwiek z poniższych kryteriów:

1. chwilowe pole widzenia (IFOV) poniżej 200 μrad (mikroradianów); lub

2. przeznaczenie do działania w zakresie fal o długości powyżej 400 nm, ale nieprzekraczającej 30 000 nm oraz mające wszystkie następujące własności:

a. dostarczanie wyjściowych danych obrazowych w postaci cyfrowej; oraz

b. spełniające którekolwiek z poniższych kryteriów:

1. są "klasy kosmicznej"; lub

2. przeznaczenie do zastosowań lotniczych i zaopatrzenie w czujniki inne niż krzemowe oraz posiadające IFOV poniżej 2,5 miliradianów;

Uwaga: Pozycja 6A002.b.1 nie obejmuje kontrolą "monospektralnych czujników obrazowych" o reakcji szczytowej w paśmie fal o długości powyżej 300 nm, ale nieprzekraczającej 900 nm i obejmujących wyłącznie którykolwiek z poniższych detektorów innych niż "klasy kosmicznej" lub "matryc detektorowych płaszczyzny ogniskowej" innych niż "klasy kosmicznej":

1. matryce CCD, niezaprojektowane ani niezmodyfikowane do osiągnięcia 'powielania ładunków'; lub

2. matryce CMOS, niezaprojektowane ani niezmodyfikowane do osiągnięcia 'powielania ładunków'.

c. urządzenia do 'bezpośredniego widzenia' wyposażone w którekolwiek z poniższych:

1. lampowe wzmacniacze obrazu wyszczególnione w pozycji 6A002.a.2.a lub 6A002.a.2.b;

2. "matryce detektorowe płaszczyzny ogniskowej" wyszczególnione w pozycji 6A002.a.3; lub

3. detektory półprzewodnikowe wyszczególnione w pozycji 6A002.a.1;

Uwaga techniczna:

Termin 'bezpośrednie widzenie' odnosi się do urządzeń tworzących obrazy przedstawiające widzialny dla człowieka obraz bez jego przetwarzania na sygnał elektroniczny przekazywany na ekran telewizyjny, niemogących zarejestrować ani utrwalić obrazu na drodze fotograficznej, elektronicznej ani żadnej innej.

Uwaga: Pozycja 6A002.c nie obejmuje kontrolą poniższych urządzeń, jeżeli są wyposażone w fotokatody inne niż z GaAs lub GaInAs:

a. przemysłowych lub cywilnych systemów alarmowych, systemów kontroli ruchu drogowego lub przemysłowego ani systemów zliczających;

b. urządzeń medycznych;

c. urządzeń przemysłowych stosowanych do kontroli, sortowania lub analizy właściwości materiałów;

d. wykrywaczy płomieni do pieców przemysłowych;

e. urządzeń specjalnie zaprojektowanych do celów laboratoryjnych.

d. następujące specjalne elementy pomocnicze do czujników optycznych:

1. chłodnice kriogeniczne "klasy kosmicznej";

2. następujące chłodnice kriogeniczne inne niż "klasy kosmicznej", posiadające źródło chłodzenia o temperaturze poniżej 218 K (- 55 °C):

a. pracujące w obiegu zamkniętym i charakteryzujące się średnim czasem do awarii (MTTF) lub średnim czasem międzyawaryjnym (MTBF) powyżej 2 500 godzin;

b. samoregulujące się minichłodnice Joula-Thomsona (JT) z otworkami o średnicy (na zewnątrz) poniżej 8 mm;

3. czujnikowe włókna optyczne o specjalnym składzie lub konstrukcji lub zmodyfikowane techniką powlekania, w celu nadania im właściwości umożliwiających reagowanie na fale akustyczne, promieniowanie termiczne, siły bezwładności, promieniowanie elektromagnetyczne lub jądrowe;

Uwaga: Pozycja 6A002.d.3 nie obejmuje kontrolą czujnikowych włókien optycznych w obudowie specjalnie zaprojektowanych do stosowania jako czujniki w odwiertach.

e. nieużywane.

f. 'układy odczytujące' ('ROIC') specjalnie zaprojektowane do "matryc detektorowych płaszczyzny ogniskowej" określonych w pozycji 6A002.a.3.

Uwaga: Pozycja 6A002.f. nie obejmuje kontrolą 'układów odczytujących' specjalnie zaprojektowanych do zastosowań cywilnych w motoryzacji.

Uwaga techniczna:

'Układ odczytujący' ('ROIC') oznacza układ scalony zaprojektowany jako podstawa lub element połączony "matrycy detektorowej płaszczyzny ogniskowej" ("FPA") i stosowany do odczytu (tj. odczytywania i rejestrowania) sygnałów wytwarzanych przez elementy detekcyjne. 'ROIC' co najmniej odczytuje ładunek z elementów detekcyjnych, ekstrahując ładunek i stosując funkcję multipleksową w sposób, który zachowuje informacje dotyczące względnej pozycji w przestrzeni i orientacji elementów detekcyjnych do przetwarzania w ramach 'ROIC' lub poza nim.

6A003 Następujące kamery filmowe, systemy lub urządzenia oraz elementy do nich:

N.B. ZOB. TAKŻE POZYCJA 6A203.

a. następujące kamery rejestrujące i specjalnie do nich zaprojektowane elementy:

Uwaga: Kamery rejestrujące, określone w poz.6A003.a.3 do 6A003.a.5, o budowie modułowej powinny być oceniane wg ich maksymalnych możliwości przy wykorzystaniu "zespołów wtykanych" zgodnie ze specyfikacją producenta kamery.

1. nieużywane;

2. nieużywane;

3. elektroniczne kamery smugowe o rozdzielczości czasowej lepszej niż 50 ns;

4. elektroniczne kamery obrazowe o szybkości powyżej 1 000 000 klatek na sekundę;

5. kamery elektroniczne spełniające wszystkie poniższe kryteria:

a. szybkość działania migawki elektronicznej (bramkowania) poniżej 1 μs na pełną klatkę; oraz

b. czas odczytu umożliwiający szybkość powyżej 125 pełnych klatek na sekundę;

6. "zespoły wtykane" spełniające wszystkie poniższe kryteria:

a. specjalnie zaprojektowane do kamer rejestrujących, które mają strukturę modułową i które zostały wyszczególnione w pozycji 6A003.a; oraz

b. umożliwiające tym kamerom realizowanie właściwości wymienionych w pozycjach 6A003.a.3, 6A003.a.4 lub 6A003.a.5, zgodnie z danymi technicznymi producenta;

b. następujące kamery obrazowe:

Uwaga: Pozycja 6A003.b nie obejmuje kontrolą kamer telewizyjnych ani wideokamer przeznaczonych specjalnie dla stacji telewizyjnych.

1. wideokamery z czujnikami półprzewodnikowymi posiadające reakcję szczytową w przedziale długości fal powyżej 10 nm, ale nie więcej niż 30 000 nm, oraz spełniające wszystkie poniższe kryteria:

a. spełniające którekolwiek z poniższych kryteriów:

1. powyżej 4 × 106 "aktywnych pikseli" na półprzewodnikową siatkę dla kamer monochromatycznych (czarno-białych);

2. powyżej 4 × 106 "aktywnych pikseli" na półprzewodnikową siatkę dla kamer kolorowych z trzema siatkami półprzewodnikowymi; lub

3. powyżej 12 × 106 "aktywnych pikseli" na półprzewodnikową siatkę dla kamer kolorowych z jedną siatką półprzewodnikową; oraz

b. spełniające którekolwiek z poniższych kryteriów:

1. zwierciadła optyczne wyszczególnione w pozycji 6A004.a;

2. urządzenia do sterowania optyką wyszczególnione w pozycji 6A004.d; lub

3. zdolność do nanoszenia wytwarzanych wewnętrznie 'ścieżek danych o kamerze';

Uwagi techniczne:

1. Na użytek niniejszego punktu wideokamery cyfrowe powinny być oceniane na podstawie maksymalnej liczby "aktywnych pikseli" wykorzystywanych do rejestrowania obrazów ruchomych.

2. Na użytek niniejszego punktu 'ścieżki danych o kamerze' stanowią informacje niezbędne do określenia orientacji widzenia kamery względem ziemi. Należą do nich: 1) kąt poziomy osi widzenia kamery względem kierunku pola magnetycznego ziemi oraz; 2) kąt pionowy pomiędzy osią widzenia kamery a horyzontem ziemi.

2. kamery skaningowe i systemy kamer skaningowych spełniające wszystkie poniższe kryteria:

a. reakcja szczytowa w zakresie długości fal z przedziału powyżej 10 nm, ale nieprzekraczającej 30 000 nm;

b. liniowe siatki detekcyjne posiadające powyżej 8 192 elementów na siatkę; oraz

c. mechaniczne przeszukiwanie w jednym kierunku;

Uwaga: Pozycja 6A003.b.2 nie obejmuje kontrolą kamer skaningowych ani systemów kamer skaningowych specjalnie zaprojektowanych do któregokolwiek z poniższych:

a. fotokopiarki przemysłowe lub cywilne;

b. skanery specjalnie zaprojektowane do skanowania w zastosowaniach cywilnych, stacjonarnych, z małych odległości (np. powielanie obrazów lub druku zawartych w dokumentach, dziełach sztuki lub fotografiach); lub

c. sprzęt medyczny.

3. kamery obrazowe wyposażone we wzmacniacze obrazów wyszczególnione w pozycji 6A002.a.2.a lub 6A002.a.2.b;

4. kamery obrazowe zawierające "matryce detektorowe płaszczyzny ogniskowej" wyposażone w którekolwiek z poniższych:

a. "matryce detektorowe płaszczyzny ogniskowej" wymienione w pozycjach 6A002.a.3.a do 6A002.a.3.e;

b. "matryce detektorowe płaszczyzny ogniskowej" wyszczególnione w pozycji 6A002.a.3.f; lub

c. "matryce detektorowe płaszczyzny ogniskowej" wyszczególnione w pozycji 6A002.a.3.g;

Uwaga 1: Kamery obrazowe wyszczególnione w pozycji 6A003.b.4 zawierają "matryce detektorowe płaszczyzny ogniskowej" połączone z odpowiednią elektroniką "przetwarzania sygnałów", poza układem odczytującym, w celu umożliwienia przynajmniej wyjścia sygnału analogowego lub cyfrowego po podłączeniu zasilania.

Uwaga 2: Pozycja 6A003.b.4.a nie obejmuje kontrolą kamer obrazowych wykorzystujących liniowe "matryce detektorowe płaszczyzny ogniskowej" o 12 elementach lub mniejszej ich liczbie, nierealizujących w elementach funkcji opóźnienia czasowego ani integracji i przeznaczonych do któregokolwiek z poniższych:

a. przemysłowe lub cywilne systemy alarmowe, systemy kontroli ruchu drogowego lub przemysłowego lub systemy zliczające;

b. urządzenia przemysłowe stosowane do kontroli lub monitorowania wypływu ciepła w budynkach, urządzeniach lub procesach przemysłowych;

c. urządzenia przemysłowe stosowane do nadzoru, sortowania lub analizy właściwości materiałów;

d. urządzenia specjalnie zaprojektowane do zastosowań laboratoryjnych; lub

e. sprzęt medyczny.

Uwaga 3: Pozycja 6A003.b.4.b nie obejmuje kontrolą kamer obrazowych spełniających którekolwiek z poniższych kryteriów:

a. maksymalna szybkość analizy obrazów równa lub niższa niż 9 Hz;

b. spełniające wszystkie z poniższych kryteriów:

1. poziome lub pionowe minimalne 'chwilowe pole widzenia (IFOV)' wynoszące co najmniej 10 mrad/piksel (miliradianów/piksel);

2. wyposażone w stałą soczewkę ogniskującą, która została zaprojektowana w sposób uniemożliwiający jej usunięcie;

3. brak wizjera 'bezpośredniego widzenia', oraz

4. spełniające którekolwiek z poniższych kryteriów:

a. brak możliwości uzyskania widzialnego obrazu wykrytego pola widzenia; lub

b. zaprojektowanie kamery dla jednego rodzaju zastosowania, bez możliwości modyfikowania jej funkcji przez użytkownika; lub

c. kamery specjalne zaprojektowane do instalacji w cywilnych pasażerskich pojazdach lądowych i spełniające wszystkie poniższe kryteria:

1. umiejscowienie i konfiguracja kamery w pojeździe służy wyłącznie wsparciu kierowcy w bezpiecznej obsłudze pojazdu;

2. działające tylko wówczas, gdy kamera jest zainstalowana w którymkolwiek z poniższych:

a. cywilny pasażerski pojazd lądowy, do którego była przeznaczona, o ciężarze mniejszym niż 4 500 kg (ciężar brutto pojazdu); lub

b. specjalnie zaprojektowane, autoryzowane urządzenie do testów konserwacyjnych; oraz

3. posiadające aktywny mechanizm, który powoduje zaprzestanie działania kamery, gdy jest ona zdjęta z pojazdu, do którego została przeznaczona.

Uwagi techniczne:

1. 'Chwilowe pole widzenia (IFOV)' określone w pozycji 6.A003.b.4 Uwaga 3.b jest mniejszą z wartości 'poziomego IFOV' lub 'pionowego IFOV'.

'Poziome IFOV' = poziome pole widzenia (FOV)/liczba poziomych elementów detekcyjnych

'Pionowe IFOV' = pionowe pole widzenia (FOV)/liczba pionowych elementów detekcyjnych

2. Termin 'widzenie bezpośrednie' określony w pozycji 6A003.b.4. Uwaga 3.b odnosi się do kamery obrazowej działającej w zakresie fal podczerwonych, która wytwarza obraz widzialny dla człowieka będącego obserwatorem, wykorzystując mikrowyświetlacz bliski oku wyposażony w dowolny mechanizm zabezpieczenia przed światłem.

Uwaga 4: Pozycja 6A003.b.4.c nie obejmuje kontrolą kamer obrazowych spełniających którekolwiek z poniższych kryteriów:

a. spełniających wszystkie z poniższych kryteriów:

1. specjalnie zaprojektowanych do zainstalowania jako zintegrowany element systemów i urządzeń wewnętrznych i korzystających z zasilania z zewnętrznej sieci energetycznej, które zostały zaprojektowane w sposób ograniczający ich zastosowanie do jednego z poniższych:

a. monitorowanie procesów przemysłowych, kontrola jakości lub analiza właściwości materiałów;

b. sprzęt laboratoryjny zaprojektowany specjalnie do badań naukowych;

c. urządzenia medyczne;

d. sprzęt służący do wykrywania nadużyć finansowych; oraz

2. działających tylko wówczas, gdy kamera jest zainstalowana w którymkolwiek z poniższych:

a. w układach lub sprzęcie, do których jest przeznaczona; lub

b. w specjalnie zaprojektowanych i dopuszczonych do obrotu systemach obsługowych; oraz

3. wyposażonych w aktywny mechanizm, który powoduje, że kamera nie działa, gdy zostaje usunięta z systemu, systemów lub urządzeń, do których jest przeznaczona;

b. w przypadku gdy kamera jest zaprojektowana specjalnie do montażu w cywilnych pasażerskich pojazdach lądowych oraz na promach pasażerskich i samochodowych i spełnia wszystkie poniższe kryteria:

1. umiejscowienie i konfiguracja kamery w pojeździe lub na promie służy wyłącznie wsparciu kierowcy lub operatora w bezpiecznej obsłudze pojazdu lub promu;

2. kamera działa tylko wówczas, gdy jest zainstalowana w którymkolwiek z poniższych:

a. cywilny pasażerski pojazd lądowy, do którego była przeznaczona, o ciężarze mniejszym niż 4 500 kg (ciężar brutto pojazdu);

b. na promie pasażerskim lub samochodowym, do którego była przeznaczona, o długości całkowitej (LOA) wynoszącej co najmniej 65 m; lub

c. w specjalnie zaprojektowanym, autoryzowanym urządzeniu do testów konserwacyjnych; oraz

3. posiada aktywny mechanizm, który powoduje zaprzestanie działania kamery, gdy zostaje ona zdjęta z pojazdu, do którego była przeznaczona;

c. zaprojektowanych tak, by ich maksymalna "czułość promieniowania" wynosiła 10 mA/W lub mniej przy długości fal powyżej 760 nm, spełniających wszystkie poniższe kryteria:

1. wyposażonych w mechanizm ograniczenia reakcji, zaprojektowany w sposób nieprzewidujący jego usuwania ani modyfikowania;

2. wyposażonych w aktywny mechanizm, który powoduje, że kamera nie działa, gdy mechanizm ograniczenia reakcji zostanie usunięty; oraz

3. niezaprojektowanych ani niezmodyfikowanych specjalnie do stosowania pod wodą; lub

d. spełniających wszystkie z poniższych kryteriów:

1. niewyposażonych w 'widzenie bezpośrednie' ani elektroniczny wyświetlacz obrazu;

2. niewyposażonych w urządzenie umożliwiające uzyskanie widzialnego obrazu wykrytego pola widzenia;

3. "matryca detektorowa płaszczyzny ogniskowej" działa tylko wówczas, gdy jest zainstalowana w kamerze, do której jest przeznaczona; oraz

4. "matryca detektorowa płaszczyzny ogniskowej" jest wyposażona w aktywny mechanizm, który na stałe uniemożliwia działanie tego zespołu, jeżeli zostanie on usunięty z kamery, do której jest przeznaczony;

5. kamery obrazowe wyposażone w detektory półprzewodnikowe wyszczególnione w pozycji 6A002.a.1.

6A004 Następujące urządzenia optyczne i elementy:

a. następujące zwierciadła optyczne (reflektory):

Uwaga techniczna:

Do celów pozycji 6A004.a. próg uszkodzeń wywołanych laserem (Laser Induced Damage Threshold - LIDT) mierzony jest zgodnie z normą ISO 21254-1:2011.

N.B. Zwierciadła optyczne specjalnie zaprojektowane do urządzeń litograficznych - zob. pozycja 3B001.

1. 'zwierciadła odkształcalne' posiadające aktywną aperturę optyczną większą niż 10 mm i spełniające którekolwiek z poniższych kryteriów oraz specjalnie zaprojektowane do nich komponenty;

a. spełniające wszystkie z poniższych kryteriów:

1. posiadające częstotliwość rezonansu mechanicznego równą lub większą niż 750 Hz; oraz

2. posiadające ponad 200 siłowników; lub

b. których próg uszkodzeń wywołanych laserem (LIDT) spełnia którekolwiek z poniższych kryteriów:

1. przekracza 1 kW/ cm2 przy zastosowaniu "lasera z falą ciągłą"; lub

2. przekracza 2 J/ cm2 przy zastosowaniu impulsów "lasera" o długości 20 ns przy częstotliwości powtarzania wynoszącej 20 Hz;

Uwaga techniczna:

'Zwierciadła odkształcalne' oznaczają zwierciadła spełniające którekolwiek z poniższych kryteriów:

a. jedną ciągłą odbijającą powierzchnię optyczną, którą można dynamicznie odkształcać za pomocą pojedynczych momentów lub sił, kompensując w ten sposób zniekształcenia fal optycznych padających na zwierciadło; lub

b. wiele odbijających elementów optycznych, które można oddzielnie i dynamicznie przemieszczać w inne położenie za pomocą działających na nie momentów lub sił, kompensując w ten sposób zniekształcenia fal optycznych padających na zwierciadło.

'Zwierciadła odkształcalne' określane są również jako zwierciadła piezoelektryczne.

2. lekkie zwierciadła monolityczne o przeciętnej "gęstości zastępczej" poniżej 30 kg/m2 i masie całkowitej powyżej 10 kg;

Uwaga: Pozycja 6A004.a.2 nie obejmuje kontrolą zwierciadeł specjalnie zaprojektowanych do odbijania bezpośredniego promieniowania słonecznego w naziemnych instalacjach heliostatycznych.

3. lekkie konstrukcje zwierciadlane z materiałów "kompozytowych" lub spienionych o przeciętnej "gęstości zastępczej" poniżej 30 kg/m2 i masie całkowitej powyżej 2 kg;

Uwaga: Pozycja 6A004.a.3 nie obejmuje kontrolą zwierciadeł specjalnie zaprojektowanych do odbijania bezpośredniego promieniowania słonecznego w naziemnych instalacjach heliostatycznych.

4. zwierciadła specjalnie zaprojektowane do oprawek do zwierciadeł sterujących wiązką wyszczególnionych w pozycji 6A004.d.2.a. o płaskości wynoszącej λ/10 lub lepszej (λ równa się 633 nm) i spełniające którekolwiek z poniższych kryteriów:

a. średnica lub długość osi głównej wynosząca co najmniej 100 mm; lub

b. spełniające wszystkie z poniższych kryteriów:

1. średnica lub długość osi głównej większa niż 50 mm, ale mniejsza niż 100 mm; oraz

2. których próg uszkodzeń wywołanych laserem (LIDT) spełnia którekolwiek z poniższych kryteriów:

a. przekracza 10 kW/cm2 przy zastosowaniu "lasera z falą ciągłą"; lub

b. przekracza 20 J/cm2 przy zastosowaniu impulsów "lasera" o długości 20 ns przy częstotliwości powtarzania wynoszącej 20 Hz;

b. elementy optyczne z selenku cynku (ZnSe) lub siarczku cynku (ZnS) z możliwością transmisji w zakresie długości fal powyżej 3 000 nm, ale nie większej niż 25 000 nm i spełniające którekolwiek z poniższych kryteriów:

1. objętość powyżej 100 cm3; lub

2. średnica lub długość osi głównej powyżej 80 mm oraz grubość (głębokość) powyżej 20 mm;

c. następujące elementy "klasy kosmicznej" do systemów optycznych:

1. o "gęstości zastępczej" elementów obniżonej o 20 % w porównaniu z masywnym wyrobem o takiej samej aperturze i grubości;

2. podłoża surowe, podłoża powlekane powierzchniowo (z powłoką jednowarstwową lub wielowarstwową, metaliczną lub dielektryczną, przewodzącą, półprzewodzącą lub izolującą) lub pokryte błoną ochronną;

3. segmenty lub zespoły zwierciadeł przeznaczone do montażu z nich w przestrzeni kosmicznej systemów optycznych, mające sumaryczną aperturę równoważną lub większą niż pojedynczy element optyczny o średnicy 1 metra;

4. elementy wykonane z materiałów "kompozytowych" o współczynniku liniowej rozszerzalności termicznej w kierunku dowolnej współrzędnej równym lub mniejszym niż 5 × 10-6;

d. następujące urządzenia do sterowania elementami optycznymi:

1. urządzenia specjalnie zaprojektowane do utrzymywania kształtu lub orientacji powierzchni elementów "klasy kosmicznej" objętych kontrolą według pozycji 6A004.c.1 lub 6A004.c.3;

2. następujące urządzenia do sterowania, śledzenia, stabilizacji lub strojenia rezonatora:

a. oprawki do zwierciadeł sterujących wiązką zaprojektowane do podtrzymywania zwierciadeł o średnicy (lub długości osi głównej) większej niż 50 mm i spełniające wszystkie następujące kryteria, oraz specjalnie zaprojektowane do nich elektroniczne urządzenia sterujące:

1. maksymalne przesunięcie kątowe wynoszące ± 26 mrad lub więcej;

2. częstotliwość rezonansu mechanicznego równa lub większa niż 500 Hz; oraz

3. "dokładność" kątowa równa 10 μrad (mikroradianów) lub mniejsza (lepsza);

b. urządzenia do strojenia rezonatora o szerokości pasma równej lub większej niż 100 Hz oraz "dokładności" 10 μrad (mikroradianów) lub mniejszej (lepszej);

3. zawieszenia kardanowe spełniające wszystkie poniższe kryteria:

a. maksymalny kąt wychylenia powyżej 5°;

b. szerokość pasma równa lub większa niż 100 Hz;

c. możliwość ustawiania kątowego z dokładnością równą lub lepszą niż 200 μrad (mikroradianów); oraz

d. spełniające którekolwiek z poniższych kryteriów:

1. średnica lub długość osi głównej powyżej 0,15 m, ale nie większa niż 1 m i możliwość zmiany położenia kątowego z przyspieszeniami powyżej 2 rad (radianów)/s2; lub

2. średnica lub długość osi głównej powyżej 1 m i możliwość zmiany położenia kątowego z przyspieszeniami powyżej 0,5 rad (radianów)/s2;

4. nieużywane;

e. 'asferyczne elementy optyczne' spełniające wszystkie poniższe kryteria:

1. największy wymiar apertury optycznej jest większy niż 400 mm;

2. nierówność powierzchni jest mniejsza niż 1 nm (średnia wartość kwadratowa) dla długości próbkowania równej lub większej niż 1 mm; oraz

3. wartość absolutna współczynnika liniowej rozszerzalności termicznej przy 25 °C jest mniejsza niż 3 × 10-6/K.

Uwagi techniczne:

1. 'Asferycznym elementem optycznym' jest taki element, stosowany w systemach optycznych, którego powierzchnia lub powierzchnie czynne są zaprojektowane jako odbiegające od kształtu idealnej kuli.

2. Od producentów nie jest wymagany pomiar nierówności, o którym mowa w 6A004.e.2, jeżeli element optyczny nie został zaprojektowany lub wykonany z zamiarem dotrzymania lub przekroczenia parametru kontrolnego.

Uwaga: Pozycja 6A004.e. nie obejmuje kontrolą 'asferycznych elementów optycznych' spełniających którekolwiek z poniższych kryteriów:

a. największy wymiar apertury optycznej mniejszy niż 1 m i stosunek długości ogniskowej do apertury równy lub większy niż 4,5:1;

b. największy wymiar apertury optycznej równy lub większy niż 1 m i stosunek długości ogniskowej do apertury równy lub większy niż 7:1;

c. zaprojektowany jako element Fresnela, oko muchy, pasek, pryzmat lub element dyfrakcyjny;

d. wykonany ze szkła borokrzemowego mającego współczynnik rozszerzalności liniowej większy niż 2,5 × 10-6/K przy 25 °C; lub

e. będący elementem optyki rentgenowskiej, mającym właściwości zwierciadła wewnętrznego (np. zwierciadła typu rurowego).

N.B. Jeżeli chodzi o 'asferyczne elementy optyczne' specjalnie zaprojektowane dla urządzeń litograficznych, zob. 3B001.

f. dynamiczne urządzenia pomiarowe do czoła fali spełniające wszystkie z poniższych kryteriów:

1. 'szybkość analizy obrazów' równa lub wyższa niż 1 kHz; oraz

2. dokładność pomiaru czoła fali równa lub mniejsza (lepsza) niż λ/20 dla określonej długości fali.

Uwaga techniczna:

Do celów pozycji 6A004.f. 'szybkość analizy obrazów' oznacza częstotliwość, z jaką wszystkie "aktywne piksele" na "matrycy detektorowej płaszczyzny ogniskowej" są scalane do rejestrowania obrazów wyświetlanych przez optykę czujnika czoła fali.

6A005 Następujące "lasery", ich elementy i urządzenia optyczne do nich, inne niż wymienione w pozycjach 0B001.g.5 lub 0B001.h.6:

N.B. ZOB. TAKŻE POZYCJA 6A205.

Uwaga 1: Do "laserów" impulsowych zalicza się lasery z falą ciągłą (CW), z nakładanymi na nią impulsami.

Uwaga 2: "Lasery" ekscymerowe, półprzewodnikowe, chemiczne, CO, CO2 i neodymowo-szklane 'o niepowtarzających się impulsach' wymienione są wyłącznie w pozycji 6A005.d.

Uwaga techniczna:

'O niepowtarzających się impulsach' dotyczy "laserów" wytwarzających jeden impuls wyjściowy lub "laserów", w których odcinek czasowy między impulsami wynosi powyżej jednej minuty.

Uwaga 3: Pozycja 6A005 obejmuje "lasery" włóknowe.

Uwaga 4: Poziom kontroli "laserów" wykorzystujących przetworzenie częstotliwości (tzn. zmianę długości fali) w inny sposób niż przez "pompowanie" jednego lasera innym "laserem" określony jest przez zastosowanie parametrów kontroli zarówno do wyjścia "lasera" źródłowego, jak i do wyjścia optycznego o przekształconej częstotliwości.

Uwaga 5: Pozycja 6A005 nie obejmuje kontrolą następujących "laserów":

a. rubinowy o energii wyjściowej poniżej 20 J;

b. azotowy;

c. kryptonowy.

Uwaga techniczna:

W pozycji 6A005 'sprawność całkowitą' definiuje się jako stosunek mocy wyjściowej "lasera" (lub "średniej mocy wyjściowej") do całkowitej mocy wejściowej wymaganej do funkcjonowania "lasera", w tym zasilania/kondycjonowania mocy oraz kondycjonowania termicznego/wymiennika ciepła.

a. "nieprzestrajalne" "lasery" z falą ciągłą spełniające którekolwiek z poniższych kryteriów:

1. długość fali wyjściowej poniżej 150 nm i moc wyjściowa powyżej 1 W;

2. długość fali wyjściowej równa lub większa niż 150 nm, ale nie większa niż 510 nm i moc wyjściowa powyżej 30 W;

Uwaga: Pozycja 6A005.a.2 nie obejmuje kontrolą "laserów" argonowych o mocy wyjściowej równej lub mniejszej niż 50 W.

3. długość fali wyjściowej przekraczająca 510 nm, ale nie większa niż 540 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i moc wyjściowa przekraczająca 50 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i moc wyjściowa przekraczająca 150 W;

4. długość fali wyjściowej większa niż 540 nm, ale nie większa niż 800 nm i moc wyjściowa powyżej 30 W;

5. długość fali wyjściowej przekraczająca 800 nm, ale nie większa niż 975 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i moc wyjściowa przekraczająca 50 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i moc wyjściowa przekraczająca 80 W;

6. długość fali wyjściowej przekraczająca 975 nm, ale nie większa niż 1 150 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i moc wyjściowa przekraczająca 500 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

1. 'sprawność całkowita' powyżej 18 % i moc wyjściowa powyżej 500 W; lub

2. moc wyjściowa powyżej 2 kW;

Uwaga 1: Pozycja 6A005.a.6.b nie obejmuje kontrolą "laserów" przemysłowych działających w trybie z pojedynczym przejściem poprzecznym o mocy wyjściowej powyżej 2 kW, ale nieprzekraczającej 6 kW i o masie całkowitej większej niż 1 200 kg. Do celów niniejszej uwagi masa całkowita obejmuje wszystkie części składowe wymagane do funkcjonowania "lasera", tzn. "laser", zasilacz, wymiennik ciepła, natomiast nie obejmuje kontrolą zewnętrznych urządzeń optycznych do kondycjonowania lub wysyłania wiązki.

Uwaga 2: Pozycja 6A005.a.6.b nie obejmuje kontrolą "laserów" przemysłowych działających w trybie z pojedynczym przejściem poprzecznym spełniających którekolwiek z poniższych kryteriów:

a. moc wyjściowa większa niż 500 W, ale nieprzekraczająca 1 kW oraz spełniające wszystkie z poniższych kryteriów:

1. iloczyn parametrów wiązki (BPP) przekraczający 0,7 mm*mrad; oraz

2. 'jasność' nieprzekraczająca 1 024 W/(mm*mrad)2;

b. moc wyjściowa większa niż 1 kW, ale nieprzekraczająca 1,6 kW oraz których wartość BPP przekracza 1,25 mm*mrad;

c. moc wyjściowa większa niż 1,6 kW, ale nieprzekraczająca 2,5 kW oraz których wartość BPP przekracza 1,7 mm*mrad;

d. moc wyjściowa większa niż 2,5 kW, ale nieprzekraczająca 3,3 kW oraz których wartość BPP przekracza 2,5 mm*mrad;

e. moc wyjściowa większa niż 3,3 kW, ale nieprzekraczająca 4 kW oraz których wartość BPP przekracza 3,5 mm*mrad;

f. moc wyjściowa większa niż 4 kW, ale nieprzekraczająca 5 kW oraz których wartość BPP przekracza 5 mm*mrad;

g. moc wyjściowa większa niż 5 kW, ale nieprzekraczająca 6 kW oraz których wartość BPP przekracza 7,2 mm*mrad;

h. moc wyjściowa większa niż 6 kW, ale nieprzekraczająca 8 kW oraz których wartość BPP przekracza 12 mm*mrad; lub

i. moc wyjściowa większa niż 8 kW, ale nieprzekraczająca 10 kW oraz których wartość BPP przekracza 24 mm*mrad;

Uwaga techniczna:

Dla celów pozycji 6A005.a.6.b. uwaga 2.a., 'jasność' definiowana jest jako moc wyjściowa "lasera" podzielona przez iloczyn parametrów wiązki (BPP) do kwadratu, tj. (moc wyjściowa)/BPP2.

7. długość fali wyjściowej przekraczająca 1 150 nm, ale nie większa niż 1 555 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i moc wyjściowa przekraczająca 50 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i moc wyjściowa przekraczająca 80 W;

8. długość fali wyjściowej przekraczająca 1 555 nm, ale nie większa niż 1 850 nm i moc wyjściowa powyżej 1 W;

9. długość fali wyjściowej przekraczająca 1 850 nm, ale nie większa niż 2 100 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i moc wyjściowa przekraczająca 1 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i moc wyjściowa przekraczająca 120 W; lub

10. długość fali wyjściowej przekraczająca 2 100 nm i moc wyjściowa powyżej 1 W;

b. "nieprzestrajalne" "lasery impulsowe", spełniające którekolwiek z poniższych kryteriów:

1. długość fali wyjściowej poniżej 150 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 50 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

b. "przeciętna moc wyjściowa" powyżej 1 W;

2. długość fali wyjściowej 150 nm lub większa, ale nieprzekraczająca 510 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 1,5 J na impuls i "szczytowa moc" impulsu powyżej 30 W; lub

b. "przeciętna moc wyjściowa" powyżej 30 W;

Uwaga: Pozycja 6A005.b.2.b nie obejmuje kontrolą "laserów" argonowych mających "przeciętną moc wyjściową" równą lub większą 50 W.

3. długość fali wyjściowej przekraczająca 510 nm, ale nie większa niż 540 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 1,5 J na impuls i "szczytowa moc" impulsu powyżej 50 W; lub

2. "przeciętna moc wyjściowa" powyżej 50 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 1,5 J na impuls i "szczytowa moc" impulsu powyżej 150 W; lub

2. "przeciętna moc wyjściowa" powyżej 150 W;

4. długość fali wyjściowej przekraczająca 540 nm, ale nie większa niż 800 nm oraz którykolwiek z poniższych parametrów:

a. "czas trwania impulsu" poniżej 1 ps i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 0,005 J na impuls i "szczytowa moc" impulsu powyżej 5 GW; lub

2. "przeciętna moc wyjściowa" powyżej 20 W; lub

b. "czas trwania impulsu" równy lub przekraczający 1 ps i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 1,5 J na impuls i "szczytowa moc" impulsu powyżej 30 W; lub

2. "przeciętna moc wyjściowa" powyżej 30 W;

5. długość fali wyjściowej przekraczająca 800 nm, ale nie większa niż 975 nm oraz którykolwiek z poniższych parametrów:

a. "czas trwania impulsu" poniżej 1 ps i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 0,005 J na impuls i "szczytowa moc" impulsu powyżej 5 GW; lub

2. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 20 W;

b. "czas trwania impulsu" równy lub przekraczający 1 ps i nieprzekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 0,5 J na impuls i "szczytowa moc" impulsu powyżej 50 W;

2. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 20 W; lub

3. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 50 W; lub

c. "czas trwania impulsu" przekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 2 J na impuls i "szczytowa moc" impulsu powyżej 50 W;

2. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 50 W; lub

3. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 80 W;

6. długość fali wyjściowej przekraczająca 975 nm, ale nie większa niż 1 150 nm oraz którykolwiek z poniższych parametrów:

a. "czas trwania impulsu" poniżej 1 ps i którekolwiek z poniższych kryteriów:

1. wyjściowa "moc szczytowa" powyżej 2 GW na impuls;

2. "przeciętna moc wyjściowa" powyżej 30 W; lub

3. energia wyjściowa większa niż 0,002 J na impuls;

b. "czas trwania impulsu" równy lub przekraczający 1 ps i krótszy niż 1 ns i którekolwiek z poniższych kryteriów:

1. wyjściowa "moc szczytowa" powyżej 5 GW na impuls;

2. "przeciętna moc wyjściowa" powyżej 50 W; lub

3. energia wyjściowa większa niż 0,1 J na impuls;

c. "czas trwania impulsu" równy lub przekraczający 1 ns, ale nieprzekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

a. "moc szczytowa" przekraczająca 100 MW;

b. "przeciętna moc wyjściowa" przekraczająca 20 W, ograniczona projektowo do maksymalnej częstotliwości powtarzania impulsów mniejszej niż lub równej 1 kHz;

c. 'sprawność całkowita' przekraczająca 12 %, "przeciętna moc wyjściowa" przekraczająca 100 W i zdolne do pracy przy częstotliwości powtarzania impulsów większej niż 1 kHz;

d. "przeciętna moc wyjściowa" przekraczająca 150 W i zdolne do pracy przy częstotliwości powtarzania impulsów większej niż 1 kHz; lub

e. energia wyjściowa większa niż 2 J na impuls; lub

2. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

a. "moc szczytowa" przekraczająca 400 MW;

b. 'sprawność całkowita' przekraczająca 18 % i "przeciętna moc wyjściowa" przekraczająca 500 W;

c. "przeciętna moc wyjściowa" powyżej 2 kW; lub

d. energia wyjściowa większa niż 4 J na impuls; lub

d. "czas trwania impulsu" przekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

a. "moc szczytowa" przekraczająca 500 kW;

b. 'sprawność całkowita' przekraczająca 12 % i "przeciętna moc wyjściowa" przekraczająca 100 W; lub

c. "przeciętna moc wyjściowa" powyżej 150 W; lub

2. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

a. "moc szczytowa" przekraczająca 1 MW;

b. 'sprawność całkowita' przekraczająca 18 % i "przeciętna moc wyjściowa" przekraczająca 500 W; lub

c. "przeciętna moc wyjściowa" powyżej 2 kW;

7. długość fali wyjściowej przekraczająca 1 150 nm, ale nie większa niż 1 555 nm oraz którykolwiek z poniższych parametrów:

a. "czas trwania impulsu" nieprzekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 0,5 J na impuls i "szczytowa moc" impulsu powyżej 50 W;

2. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 20 W; lub

3. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 50 W; lub

b. "czas trwania impulsu" przekraczający 1 μs i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 2 J na impuls i "szczytowa moc" impulsu powyżej 50 W;

2. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 50 W; lub

3. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i "przeciętna moc wyjściowa" powyżej 80 W;

8. długość fali wyjściowej przekraczająca 1 555 nm, ale nie większa niż 1 850 nm oraz którykolwiek z poniższych parametrów:

a. energia wyjściowa powyżej 100 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

b. "przeciętna moc wyjściowa" powyżej 1 W;

9. długość fali wyjściowej przekraczająca 1 850 nm, ale nie większa niż 2 100 nm oraz którykolwiek z poniższych parametrów:

a. sygnał wyjściowy w trybie pojedynczego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 100 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

2. "przeciętna moc wyjściowa" powyżej 1 W; lub

b. sygnał wyjściowy w trybie wielokrotnego przejścia poprzecznego i którekolwiek z poniższych kryteriów:

1. energia wyjściowa powyżej 100 mJ na impuls i "szczytowa moc" impulsu powyżej 10 kW; lub

2. "przeciętna moc wyjściowa" powyżej 120 W; lub

10. długość fali wyjściowej przekraczająca 2 100 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 100 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

b. "przeciętna moc wyjściowa" powyżej 1 W;

c. "lasery" "przestrajalne", spełniające którekolwiek z poniższych kryteriów:

1. długość fali wyjściowej poniżej 600 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 50 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

b. przeciętna lub ciągła (CW) moc wyjściowa powyżej 1 W;

Uwaga: Pozycja 6A005.c.1 nie obejmuje kontrolą "laserów" barwnikowych ani innych "laserów" cieczowych z wielomodalnym sygnałem wyjściowym i o długości fali wynoszącej 150 nm lub więcej, ale nieprzekraczającej 600 nm, i spełniających wszystkie z poniższych kryteriów:

1. energia wyjściowa poniżej 1,5 J na impuls i "moc szczytowa" poniżej 20 W; oraz

2. przeciętna lub ciągła (CW) moc wyjściowa poniżej 20 W.

2. długość fali wyjściowej 600 nm lub większa, ale nieprzekraczająca 1 400 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 1 J na impuls i "szczytowa moc" impulsu powyżej 20 W; lub

b. przeciętna lub ciągła (CW) moc wyjściowa powyżej 20 W; lub

3. długość fali wyjściowej przekraczająca 1 400 nm i którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 50 mJ na impuls i "szczytowa moc" impulsu powyżej 1 W; lub

b. przeciętna lub ciągła (CW) moc wyjściowa powyżej 1 W;

d. następujące inne "lasery", niewymienione w pozycjach 6A005.a, 6A005.b, lub 6A005.c:

1. następujące "lasery" półprzewodniko4we:

Uwaga 1: Pozycja 6A005.d.1 obejmuje "lasery" półprzewodnikowe wyposażone w optyczne złącza wyjściowe (np. kable z włókien światłowodowych).

Uwaga 2: Poziom kontroli "laserów" półprzewodnikowych zaprojektowanych specjalnie do innych urządzeń wynika z poziomu kontroli tych innych urządzeń.

a. indywidualne "lasery" półprzewodnikowe działające w trybie z pojedynczym przejściem poprzecznym spełniające którekolwiek z poniższych kryteriów:

1. długość fali równa lub mniejsza niż 1 510 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 1,5 W; lub

2. długość fali większa niż 1 510 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 500 mW;

b. indywidualne "lasery" półprzewodnikowe działające w trybie z wielokrotnym przejściem poprzecznym spełniające którekolwiek z poniższych kryteriów:

1. długość fali poniżej 1 400 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 15 W;

2. długość fali równa lub większa niż 1 400 nm, ale mniejsza niż 1 900 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 2,5 W; lub

3. długość fali równa lub większa niż 1 900 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 1 W;

c. indywidualne 'szeregi' "laserów" półprzewodnikowych spełniające którekolwiek z poniższych kryteriów:

1. długość fali poniżej 1 400 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 100 W;

2. długość fali równa lub większa niż 1 400 nm, ale mniejsza niż 1 900 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 25 W; lub

3. długość fali równa lub większa niż 1 900 nm oraz przeciętna lub ciągła (CW) moc wyjściowa powyżej 10 W;

d. 'macierze' "laserów" półprzewodnikowych (układy dwuwymiarowe) spełniające którekolwiek z poniższych kryteriów:

1. mające długość fali mniejszą niż 1 400 nm i spełniające którekolwiek z poniższych kryteriów:

a. przeciętna lub ciągła (CW) całkowita moc wyjściowa mniejsza niż 3 kW oraz przeciętna lub ciągła (CW) wyjściowa 'gęstość mocy' powyżej 500 W/cm2;

b. przeciętna lub ciągła (CW) całkowita moc wyjściowa nie mniejsza niż 3 kW, lecz nie większa niż 5 kW oraz przeciętna lub ciągła (CW) wyjściowa 'gęstość mocy' powyżej 350 W/cm2;

c. przeciętna lub ciągła (CW) całkowita moc wyjściowa powyżej 5 kW;

d. szczytowa 'gęstość mocy' impulsu powyżej 2 500 W/cm2; lub

Uwaga: Pozycja 6A005.d.1.d.1.d. nie obejmuje kontrolą epitaksjalnie wyprodukowanych urządzeń monolitycznych.

e. przestrzennie koherentna przeciętna lub ciągła (CW) całkowita moc wyjściowa powyżej 150 W;

2. mające długość fali nie mniejszą niż 1 400 nm, lecz mniejszą niż 1 900 nm i spełniające którekolwiek z poniższych kryteriów:

a. przeciętna lub ciągła (CW) całkowita moc wyjściowa mniejsza niż 250 W oraz przeciętna lub ciągła (CW) wyjściowa 'gęstość mocy' powyżej 150 W/cm2;

b. przeciętna lub ciągła (CW) całkowita moc wyjściowa nie mniejsza niż 250 W, lecz nie większa niż 500 W oraz przeciętna lub ciągła (CW) wyjściowa 'gęstość mocy' powyżej 50 W/cm2;

c. przeciętna lub ciągła (CW) całkowita moc wyjściowa powyżej 500 W;

d. szczytowa 'gęstość mocy' impulsu powyżej 500 W/cm2; lub

Uwaga: Pozycja 6A005.d.1.d.2.d. nie obejmuje kontrolą epitaksjalnie wyprodukowanych urządzeń monolitycznych.

e. przestrzennie koherentna przeciętna lub ciągła (CW) całkowita moc wyjściowa powyżej 15 W;

3. mające długość fali nie mniejszą niż 1 900 nm i spełniające którekolwiek z poniższych kryteriów:

a. przeciętna lub ciągła (CW) wyjściowa 'gęstość mocy' powyżej 50 W/cm2;

b. przeciętna lub ciągła (CW) moc wyjściowa powyżej 10 W; lub

c. przestrzennie koherentna przeciętna lub ciągła (CW) całkowita moc wyjściowa powyżej 1,5 W; lub

4. posiadające przynajmniej jeden 'szereg' "laserów" określony w pozycji 6A005.d.1.c;

Uwaga techniczna:

Do celów pozycji 6A005.d.1.d 'gęstość mocy' oznacza całkowitą moc wyjściową "lasera" podzieloną przez powierzchnię emitera 'macierzy'.

e. 'macierze' "laserów" półprzewodnikowych inne niż wymienione w pozycji 6A005.d.1.d spełniające wszystkie z poniższych kryteriów:

1. specjalnie zaprojektowane lub zmodyfikowane z myślą o łączeniu ich z innymi 'macierzami' w celu utworzenia większej 'macierzy'; oraz

2. mające zintegrowane połączenia, wspólne zarówno dla układów elektronicznych, jak i układów chłodzenia;

Uwaga 1: 'Macierze' utworzone przez połączenie 'macierzy' "laserów" półprzewodnikowych opisanych w poz. 6A005.d.1.e, które nie są zaprojektowane z myślą o dalszym łączeniu lub modyfikacji, są wyszczególnione w pozycji 6A005.d.1.d.

Uwaga 2: 'Macierze' utworzone przez połączenie 'macierzy' "laserów" półprzewodnikowych opisanych w poz. 6A005.d.1.e, które są zaprojektowane z myślą o dalszym łączeniu lub modyfikacji, są wyszczególnione w pozycji 6A005.d.1.e.

Uwaga 3: Pozycja 6A005.d.1.e nie obejmuje kontrolą modularnych zespołów pojedynczych 'szeregów' zaprojektowanych do montowania jako liniowe układy szeregów.

Uwagi techniczne:

1. "Lasery" półprzewodnikowe są powszechnie nazywane diodami "laserowymi".

2. 'Szereg' (zwany także 'szeregiem' "laserów" półprzewodnikowych, 'szeregiem' diod "laserowych" lub 'szeregiem' diod) składa się z wielu półprzewodnikowych "laserów" w układzie jednowymiarowym.

3. 'Macierz' składa się z wielu 'szeregów' tworzących dwuwymiarowy układ "laserów" półprzewodnikowych.

2. "lasery" na tlenku węgla (CO) spełniające którekolwiek z poniższych kryteriów:

a. energia wyjściowa powyżej 2 J na impuls i "szczytowa moc" impulsu powyżej 5 kW; lub

b. przeciętna lub ciągła (CW) moc wyjściowa powyżej 5 kW;

3. "lasery" na dwutlenku węgla (CO2) spełniające którekolwiek z poniższych kryteriów:

a. ciągła (CW) moc wyjściowa powyżej 15 kW;

b. wyjście impulsowe z "czasem trwania impulsu" powyżej 10 μs oraz którykolwiek z poniższych parametrów:

1. "przeciętna moc wyjściowa" powyżej 10 kW; lub

2. "moc szczytowa" przekraczająca 100 kW; lub

c. wyjście impulsowe o "szerokości impulsu" równej lub mniejszej niż 10 μs oraz którykolwiek z poniższych parametrów:

1. energia impulsu powyżej 5 J na impuls; lub

2. "przeciętna moc wyjściowa" powyżej 2,5 kW;

4. "lasery" ekscymerowe spełniające którekolwiek z poniższych kryteriów:

a. długość fali wyjściowej nieprzekraczająca 150 nm oraz którekolwiek z poniższych kryteriów:

1. energia wyjściowa większa niż 50 mJ na impuls; lub

2. "przeciętna moc wyjściowa" powyżej 1 W;

b. długość fali wyjściowej przekraczająca 150 nm, ale nie większa niż 190 nm oraz którykolwiek z poniższych parametrów:

1. energia wyjściowa większa niż 1,5 J na impuls; lub

2. "przeciętna moc wyjściowa" powyżej 120 W;

c. długość fali wyjściowej przekraczająca 190 nm, ale nie większa niż 360 nm oraz którykolwiek z poniższych parametrów:

1. energia wyjściowa większa niż 10 J na impuls; lub

2. "przeciętna moc wyjściowa" powyżej 500 W; lub

d. długość fali wyjściowej powyżej 360 nm i którekolwiek z poniższych kryteriów:

1. energia wyjściowa większa niż 1,5 J na impuls; lub

2. "przeciętna moc wyjściowa" powyżej 30 W;

N.B. W przypadku "laserów" ekscymerowych specjalnie zaprojektowanych dla urządzeń litograficznych zob. pozycję 3B001.

5. następujące "lasery chemiczne":

a. "lasery" fluorowodorowe (HF);

b. "lasery" na fluorku deuteru (DF);

c. następujące 'lasery z przekazaniem energii':

1. "lasery" tlenowo-jodowe (O2-I);

2. "lasery" na mieszaninie fluorku deuteru i dwutlenku węgla (DF-CO2);

Uwaga techniczna:

"Lasery z przekazaniem energii" oznaczają "lasery", w których czynnik emitujący promieniowanie laserowe jest wzbudzany dzięki transferowi energii wskutek zderzeń atomów lub molekuł, niebiorących udziału w akcji laserowej, z atomami lub molekułami czynnika emitującego promieniowanie laserowe.

6. "lasery" neodymowo-szklane 'o niepowtarzających się impulsach' spełniające którekolwiek z poniższych kryteriów:

a. "czas trwania impulsu" nieprzekraczający 1 μs oraz energia wyjściowa powyżej 50 J na impuls; lub

b. "czas trwania impulsu" przekraczający 1 μs oraz energia wyjściowa powyżej 100 J na impuls;

Uwaga: 'O niepowtarzających się impulsach' dotyczy "laserów" wytwarzających jeden impuls wyjściowy lub "laserów", w których odcinek czasowy między impulsami wynosi powyżej jednej minuty.

e. następujące części składowe:

1. zwierciadła 'chłodzone czynnie' lub za pomocą termicznej chłodnicy rurkowej;

Uwaga techniczna:

'Chłodzenie czynne' jest techniką chłodzenia elementów optycznych za pomocą cieczy przepływającej pomiędzy powierzchnią optyczną a dodatkową (zazwyczaj znajdującą się w odległości poniżej 1 mm od powierzchni optycznej), wskutek czego następuje odprowadzenie ciepła z powierzchni optycznej.

2. zwierciadła optyczne lub przepuszczalne lub częściowo przepuszczalne elementy optyczne lub elektrooptyczne, inne niż bezpiecznikowe stożkowe złączki światłowodowe i wielowarstwowe siatki dielektryczne, specjalnie zaprojektowane do wymienionych "laserów";

Uwaga: złączki światłowodowe i wielowarstwowe siatki dielektryczne są wyszczególnione w pozycji 6A005.e.3.

3. następujące elementy "laserów" włóknowych:

a. bezpiecznikowe stożkowe złączki światłowodowe do łączenia światłowodów wielomodowych spełniające wszystkie poniższe kryteria:

1. tłumienność wtrąceniowa mniejsza (lepsza) lub równa 0,3 dB utrzymywana przy znamionowej łącznej przeciętnej lub ciągłej mocy wyjściowej (z wyłączeniem mocy wyjściowej przekazywanej przez rdzeń jednomodowy, jeśli istnieje) przekraczającej 1 000 W; oraz

2. liczba włókien wejściowych równa lub większa niż 3;

b. bezpiecznikowe stożkowe złączki światłowodowe do łączenia światłowodów jednomodowych ze światłowodami wielomodowymi spełniające wszystkie poniższe kryteria:

1. tłumienność wtrąceniowa mniejsza (lepsza) niż 0,5 dB utrzymywana przy znamionowej łącznej przeciętnej lub ciągłej mocy wyjściowej przekraczającej 4 600 W;

2. liczba włókien wejściowych równa lub większa niż 3; oraz

3. spełniające którekolwiek z poniższych kryteriów:

a. iloczyn parametrów wiązki (BPP) mierzony na wyjściu nieprzekraczający 1,5 mm mrad dla liczby włókien wejściowych nie większej niż 5; lub

b. iloczyn parametrów wiązki (BPP) mierzony na wyjściu nieprzekraczający 2,5 mm mrad dla liczby włókien wejściowych większej niż 5;

c. wielowarstwowe siatki dielektryczne posiadające wszystkie poniższe cechy:

1. zaprojektowane w celu sterowania wiązką widmową lub koherentną pięciu lub większej liczby laserów włóknowych; oraz

2. próg uszkodzeń wywołanych laserem z falą ciągłą (LIDT) jest większy lub równy 10 kW/cm2.

f. następujące urządzenia optyczne:

N.B. Odnośnie do elementów optycznych z dzieloną aperturą, zdolnych do pracy w "laserach super wysokiej mocy" ("SHPL") zob. także wykaz uzbrojenia.

1. nieużywane;

2. "laserowe" urządzenia diagnostyczne specjalnie zaprojektowane do dynamicznego pomiaru błędów sterowania położeniem kątowym "systemów laserowych super wysokiej mocy" ("SHPL") z "dokładnością" kątową równą 10 μrad (mikroradianów) lub mniejszą (lepszą);

3. urządzenia optyczne i elementy specjalnie zaprojektowane do systemów "SHPL" w formie zespołów fazowanych w celu sterowania wiązkami koherentnymi i spełniające którekolwiek z poniższych kryteriów:

a. "dokładność" wynosząca 0,1 μm lub mniejsza dla długości fali większej niż 1 μm; lub

b. "dokładność" wynosząca λ/10 lub mniejsza (lepsza) dla określonej długości fali, dla długości fali równej 1 μm lub mniejszej.

4. teleskopy projekcyjne specjalnie zaprojektowane do systemów SHPL;

g. 'laserowe urządzenia do detekcji akustycznej' spełniające wszystkie z poniższych kryteriów:

1. ciągła moc wyjściowa "lasera" z falą ciągłą równa lub przewyższająca 20 mW;

2. stabilność częstotliwości "lasera" równa lub lepsza (mniejsza) niż 10 MHz;

3. długość fali "lasera" równa lub przewyższająca 1 000 nm, ale nie przewyższająca 2 000 nm;

4. rozdzielczość układu optycznego lepsza (mniejsza) niż 1 nm; oraz

5. stosunek sygnału optycznego do szumu równy lub przewyższający 103.

Uwaga techniczna:

'Laserowe urządzenia do detekcji akustycznej' są czasami określane nazwą mikrofonu "laserowego" lub mikrofonu wykrywającego przepływ cząstek.

6A006 Następujące "magnetometry", "mierniki gradientu magnetycznego", "mierniki gradientu magnetycznego właściwego", podwodne czujniki pola elektrycznego, "systemy kompensacji" i specjalnie do nich zaprojektowane elementy:

N.B. ZOB. TAKŻE POZYCJA 7A103.d.

Uwaga: Pozycja 6A006 nie obejmuje kontrolą instrumentów specjalnie zaprojektowanych do pomiarów biomagnetycznych do celów zastosowań w rybołówstwie lub diagnostyce medycznej.

a. następujące "magnetometry" i podukłady:

1. "magnetometry" wykorzystujące "technologie" materiałów "nadprzewodzących" (SQUID) i spełniające którekolwiek z poniższych kryteriów:

a. systemy SQUID przeznaczone do działania nieruchomego bez specjalnie zaprojektowanych podukładów do zmniejszenia szumu w ruchu i charakteryzujące się 'czułością' równą lub niższą (lepszą) niż 50 fT (rms) na pierwiastek kwadratowy Hz przy częstotliwości 1 Hz; lub

b. systemy SQUID mające magnetometr ruchu i charakteryzujące się 'czułością' równą lub niższą (lepszą) niż 20 pT (średnia wartość kwadratowa) na pierwiastek kwadratowy Hz przy częstotliwości 1 Hz i specjalnie zaprojektowane do zmniejszenia szumu w ruchu;

2. "magnetometry", w których zastosowano technologię pompowania optycznego lub precesji jądrowej (proton/Overhauser), charakteryzujące się 'czułością' mniejszą (lepszą) niż 20 pT (średnia wartość kwadratowa) na pierwiastek kwadratowy Hz przy częstotliwości 1 Hz;

3. "magnetometry", w których zastosowano "technologię" bramkowania strumienia, charakteryzujące się 'czułością' równą lub mniejszą (lepszą) niż 10 pT (średnia wartość kwadratowa) na pierwiastek kwadratowy Hz przy częstotliwości 1 Hz;

4. "magnetometry" z cewką indukcyjną, charakteryzujące się 'czułością' mniejszą (lepszą) niż którakolwiek z poniższych:

a. 0,05 nT rms na pierwiastek kwadratowy Hz [(średnia wartość kwadratowa) na pierwiastek kwadratowy z Hz] w zakresie częstotliwości poniżej 1 Hz;

b. 1 × 10-3 nT rms na pierwiastek kwadratowy Hz [(średnia wartość kwadratowa) na pierwiastek kwadratowy z Hz] w zakresie częstotliwości 1 Hz lub powyżej, ale nieprzekraczających 10 Hz; lub

c. 1 × 10-4 nT rms na pierwiastek kwadratowy Hz w zakresie częstotliwości powyżej 10 Hz;

5. "magnetometry" światłowodowe charakteryzujące się 'czułością' mniejszą (lepszą) niż 1 nT (średnia wartość kwadratowa) na pierwiastek kwadratowy z Hz;

b. podwodne czujniki pola elektrycznego charakteryzujące się 'czułością' mniejszą (lepszą) niż 8 nano-woltów na metr na pierwiastek kwadratowy z Hz dla częstotliwości 1 Hz;

c. następujące "mierniki gradientu magnetycznego":

1. "mierniki gradientu magnetycznego", w których zastosowano pewną liczbę "magnetometrów" objętych kontrolą według pozycji 6A006.a;

2. światłowodowe "mierniki gradientu magnetycznego właściwego" charakteryzujące się 'czułością' gradientu pola magnetycznego mniejszą (lepszą) niż 0,3 nT/m (średnia wartość kwadratowa) na pierwiastek kwadratowy Hz;

3. "mierniki gradientu magnetycznego właściwego", w których zastosowano inną "technologię" niż światłowodowa, charakteryzujące się 'czułością' gradientu pola magnetycznego mniejszą (lepszą) niż 0,015 nT/m rms na pierwiastek kwadratowy Hz;

d. "systemy kompensacji" do czujników magnetycznych lub podwodnych czujników pola elektrycznego o parametrach odpowiadających parametrom wymienionym w pozycjach 6A006.a, 6A006.b lub 6A006.c lub przewyższających je;

e. podwodne odbiorniki elektromagnetyczne zawierające czujniki pola magnetycznego wyszczególnione w pozycji 6A006.a lub podwodne czujniki pola elektrycznego wyszczególnione w pozycji 6A006.b.

Uwaga techniczna:

Do celów pozycji 6A006 'czułość' (poziom szumu) oznacza średni pierwiastek kwadratowy ograniczonego przez urządzenie progu szumu, który jest najniższym sygnałem dającym się zmierzyć.

6A007 Następujące grawimetry i mierniki gradientu pola grawitacyjnego:

N.B. ZOB. TAKŻE POZYCJA 6A107.

a. grawimetry zaprojektowane lub zmodyfikowane z przeznaczeniem do pomiarów naziemnych i mające "dokładność" statyczną poniżej (lepszą niż) 10 μGal;

Uwaga: Pozycja 6A007.a nie obejmuje kontrolą grawimetrów do pomiarów naziemnych z elementem kwarcowym (Wordena).

b. grawimetry do stosowania na ruchomych platformach, spełniające wszystkie poniższe kryteria:

1. "dokładność" statyczna poniżej (lepsza niż) 0,7 mGal; oraz

2. "dokładność" eksploatacyjna (robocza) poniżej (lepsza niż) 0,7 mGal przy "czasie do ustalenia warunków rejestracji" poniżej 2 minut bez względu na sposób kompensacji oddziaływań ubocznych i wpływu ruchu;

c. mierniki gradientu pola grawitacyjnego.

6A008 Systemy, urządzenia i zespoły radarowe spełniające którekolwiek z poniższych kryteriów oraz specjalnie do nich zaprojektowane elementy:

N.B. ZOB. TAKŻE POZYCJA 6A108.

Uwaga: Pozycja 6A008 nie obejmuje kontrolą następujących obiektów:

- pomocniczych radarów kontroli rejonu (SSR),

- cywilnych radarów samochodowych,

- wyświetlaczy i monitorów stosowanych w kontroli ruchu powietrznego,

- radarów meteorologicznych (do obserwacji pogody),

- urządzeń radiolokacyjnych dokładnej kontroli podejścia do lądowania (PAR) odpowiadających standardom ICAO oraz wyposażonych w sterowalne układy liniowe (jednowymiarowe) lub ustawiane mechaniczne anteny pasywne.

a. działające w zakresie częstotliwości od 40 GHz do 230 GHz i spełniające którekolwiek z poniższych kryteriów:

1. przeciętna moc wyjściowa powyżej 100 mW; lub

2. "dokładność" namierzania o zakresie równym 1 m lub mniejszym (lepszym) lub o azymucie równym 0,2 stopnia lub mniejszym (lepszym);

b. umożliwiające przestrajanie pasma częstotliwości w zakresie powyżej ± 6,25 % od 'środkowej częstotliwości roboczej';

Uwaga techniczna:

'Środkowa częstotliwość robocza' równa się połowie sumy najwyższej i najniższej nominalnej częstotliwości roboczej.

c. zdolne do równoczesnego działania na dwóch lub więcej częstotliwościach nośnych;

d. zdolne do działania w trybie z syntezą apertury (SAR), z odwróconą syntezą apertury (ISAR) lub jako radiolokatory pokładowe obserwacji bocznej (SLAR);

e. zaopatrzone w skanowany elektronicznie układ antenowy;

Uwaga techniczna:

Skanowany elektronicznie układ antenowy jest też określany jako sterowany elektronicznie układ antenowy.

f. zdolne do określania wysokości niepowiązanych ze sobą celów;

g. specjalnie zaprojektowane dla lotnictwa (zainstalowane na balonach lub samolotach) i mające możliwość "przetwarzania sygnałów" dopplerowskich w celu wykrywania obiektów ruchomych;

h. zdolne do przetwarzania sygnałów radiolokacyjnych i wykorzystujące którekolwiek z poniższych:

1. techniki "rozproszonego widma radiolokacyjnego"; lub

2. techniki "regulacji częstotliwości sygnałów radiolokacyjnych";

i. zapewniające działania naziemne o maksymalnym "zasięgu roboczym" powyżej 185 km;

Uwaga: Pozycja 6A008.i nie obejmuje kontrolą:

a. radarów kontroli łowisk rybackich;

b. radarowych instalacji naziemnych specjalnie zaprojektowanych do kierowania ruchem lotniczym i spełniających wszystkie poniższe kryteria:

1. maksymalny "zasięg roboczy" nie większy niż 500 km;

2. skonfigurowanych w taki sposób, że umożliwiają transmisję danych o celach radarowych tylko w jedną stronę, od miejsca zainstalowania radaru do jednego lub więcej cywilnych ośrodków ATC (kierowania ruchem lotniczym);

3. niezawierających żadnych elementów umożliwiających zdalne sterowanie szybkością przeszukiwania radaru z ośrodka ATC; oraz

4. zainstalowanych na stałe.

c. meteorologicznych, balonowych radiolokatorów śledzących;

j. radary "laserowe" lub optyczne (LIDAR) spełniające którekolwiek z poniższych kryteriów:

1. są "klasy kosmicznej";

2. wykorzystujące koherentne heterodynowe lub homodynowe techniki wykrywania obiektów oraz posiadające rozdzielczość kątową niższą (lepszą niż) 20 μrad (mikroradianów); lub

3. przeznaczone do przeprowadzania z powietrza przybrzeżnych pomiarów batymetrycznych zgodnie ze standardem rzędu 1a Międzynarodowej Organizacji Hydrograficznej (5. wydanie luty 2008 r.) dla pomiarów hydrograficznych lub lepszym, przy użyciu jednego lub kilku "laserów" o długości fali przekraczającej 400 nm, ale nieprzekraczającej 600 nm.

Uwaga 1: Urządzenia LIDAR specjalnie zaprojektowane do celów geodezyjnych są wyszczególnione wyłącznie w pozycji 6A008.j.3.

Uwaga 2: Pozycja 6A008.j nie obejmuje kontrolą urządzeń LIDAR specjalnie zaprojektowanych do obserwacji meteorologicznych.

Uwaga 3: Parametry standardu rzędu 1a Międzynarodowej Organizacji Hydrograficznej 5. wydanie luty 2008 r. są podsumowane następująco:

- dokładność pozioma określenia pozycji (na poziomie ufności 95 %) = 5 m + 5 % głębokości;

- dokładność określenia głębokości zredukowanej (na poziomie ufności 95 %) = ±√ (a2+(b*d)2), gdzie:

a = 0,5 m = stały błąd głębokości,

tj. suma wszystkich stałych błędów głębokości

b = 0,013 = współczynnik błędu zależnego od głębokości

b × d = błąd zależny od głębokości,

tj. suma wszystkich błędów zależnych od głębokości

d = głębokość

- wykrywanie obiektów = obiekty kubaturowe > 2 m na głębokości do 40 m; 10 % głębokości na głębokości przekraczającej 40 m;

k. wyposażone w podukłady do "przetwarzania sygnałów" techniką "kompresji impulsów" i spełniające którekolwiek z poniższych kryteriów:

1. wskaźnik "kompresji impulsów" powyżej 150; lub

2. szerokość impulsu poniżej 200 ns; lub

Uwaga: Pozycja 6A008.k.2. nie obejmuje kontrolą dwuwymiarowych 'radarów morskich' ani radarów do 'obsługi ruchu statków' spełniających wszystkie poniższe kryteria:

a. wskaźnik "kompresji impulsów" nieprzekraczający 150;

b. szerokość impulsu powyżej 30 ns;

c. pojedyncza i obrotowa mechanicznie sterowana antena radarowa;

d. szczytowa moc wyjściowa nieprzekraczająca 250 W; oraz

e. niezdolne do "rozrzucania częstotliwości".

l. wyposażone w podukłady do przetwarzania danych i spełniające którekolwiek z poniższych kryteriów:

1. 'automatyczne śledzenie celu' zapewniające, przy dowolnym położeniu kątowym anteny, przewidzenie położenia celu w okresie pomiędzy kolejnymi przejściami wiązki radiolokacyjnej; lub

Uwaga: Pozycja 6A008.l.1 nie obejmuje kontrolą układów ostrzegających przed możliwością zderzenia, wchodzących w skład systemów kontroli ruchu powietrznego lub 'radaru morskiego'.

Uwaga techniczna:

'Automatyczne śledzenie celu' oznacza technikę przetwarzania umożliwiającą automatyczne określanie i podawanie na wyjściu w czasie rzeczywistym ekstrapolowanej wartości najbardziej prawdopodobnego położenia celu.

2. nieużywane;

3. nieużywane;

4. skonfigurowane tak, aby zapewniać superpozycję (nakładanie) i korelację lub scalanie danych o celu w ciągu sześciu sekund z dwóch lub więcej 'rozrzuconych geograficznie' czujników radarowych, aby dzięki temu połączonemu działaniu uzyskać wyniki lepsze niż z pojedynczego czujnika wyszczególnione w pozycji 6A008.f lub 6A008.i.

Uwaga techniczna:

Czujniki uznaje się za "rozrzucone geograficznie", kiedy każdy element znajduje się w odległości większej niż 1 500 m od innego w dowolnym kierunku. Czujniki ruchome są zawsze traktowane jako 'rozrzucone geograficznie'.

N.B. Zob. także wykaz uzbrojenia.

Uwaga: Pozycja 6A008.l.4 nie obejmuje kontrolą systemów, urządzeń lub zespołów używanych do 'obsługi ruchu statków'.

Uwagi techniczne:

1. Do celów pozycji 6A008 'radar morski' oznacza radar, który jest wykorzystywany przy nawigacji po morzach i wodach śródlądowych oraz w strefach przybrzeżnych.

2. Do celów pozycji 6A008 'obsługa ruchu statków' oznacza usługę monitorowania i kontroli podobną do kierowania ruchem lotniczym w przypadku "statków powietrznych".

6A102 'Detektory' zabezpieczone przed promieniowaniem, inne niż wyszczególnione w pozycji 6A002, specjalnie zaprojektowane lub zmodyfikowane do ochrony przed skutkami wybuchów jądrowych (np. impulsów elektromagnetycznych (EMP), promieniowania rentgenowskiego, kombinowanych efektów podmuchu i udaru termicznego) i znajdujące zastosowanie w "pociskach rakietowych", skonstruowane lub przystosowane w taki sposób, że są w stanie wytrzymać łączną dawkę promieniowania o wartości 5 × 105 radów (Si).

Uwaga techniczna:

W pozycji 6A102 przez pojęcie 'detektora' należy rozumieć urządzenie mechaniczne, elektryczne, optyczne lub chemiczne do automatycznej identyfikacji i rejestracji takich bodźców, jak zmiany warunków otoczenia, np. ciśnienie lub temperatura, sygnał elektryczny lub elektromagnetyczny lub promieniowanie materiału radioaktywnego. Obejmuje to urządzenia, które wykrywają bodziec poprzez jednorazowe zadziałanie lub uszkodzenie się.

6A107 Następujące grawimetry i podzespoły do mierników grawitacji i mierników gradientu pola grawitacyjnego:

a. grawimetry inne niż wyszczególnione w pozycji 6A007.b, zaprojektowane lub zmodyfikowane do stosowania w lotnictwie lub w warunkach morskich, mające dokładność statyczną lub eksploatacyjną (roboczą) równą lub niższą (lepszą) niż 0,7 miligala (mGal), przy czasie do ustalenia warunków rejestracji równym lub krótszym od 2 minut;

b. specjalnie zaprojektowane podzespoły do grawimetrów wymienionych w pozycjach 6A007.b lub 6A107.a oraz do mierników gradientu pola grawitacyjnego wyszczególnionych w pozycji 6A007.c.

6A108 Następujące instalacje radarowe i śledzące, inne niż wyszczególnione w pozycji 6A008:

a. instalacje radarowe lub laserowe zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104;

Uwaga: Pozycja 6A108.a obejmuje następujące obiekty:

a. urządzenia do wykonywania map konturowych terenu;

b. urządzenia do wykonywania i korelacji obrazów terenu (analogowe i cyfrowe);

c. urządzenia do radarowej nawigacji dopplerowskiej;

d. interferometry pasywne;

e. czujniki do tworzenia obrazów (zobrazowania) (aktywne i pasywne);

b. następujące precyzyjne instalacje do śledzenia torów obiektów, znajdujące zastosowanie w 'pociskach rakietowych':

1. instalacje do śledzenia torów, wyposażone w translatory kodów współpracujące z instalacjami naziemnymi lub nadziemnymi lub satelitarnymi instalacjami nawigacyjnymi w celu pomiaru w czasie rzeczywistym położeń i prędkości obiektów w locie;

2. radary kontroli obszaru powietrznego współpracujące z instalacjami śledzenia obiektów w zakresie optycznym i podczerwonym, mające wszystkie wymienione poniżej cechy:

a. rozdzielczość kątową lepszą niż 1,5 miliradiana;

b. zasięg 30 km lub większy z rozdzielczością odległości lepszą niż 10 m (średnia kwadratowa); oraz

c. dokładność ustalania prędkości lepszą niż 3 m/s.

Uwaga techniczna:

Termin 'pocisk rakietowy' w pozycji 6A108.b oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

6A202 Lampy fotopowielaczowe mające wszystkie następujące cechy:

a. powierzchnię fotokatody powyżej 20 cm2; oraz

b. czas narastania impulsu katody poniżej 1 ns.

6A203 Następujące kamery filmowe i ich podzespoły, inne niż określone w pozycji 6A003:

N.B.1. "Oprogramowanie" specjalnie zaprojektowane w celu poprawy lub wykorzystania wydajności kamery lub urządzenia obrazowego, tak by odpowiadały cechom pozycji 6A203.a., 6A203.b. lub 6A203.c., jest wymienione w pozycji 6D203.

N.B.2. "Technologia" w postaci kodów lub kluczy, służąca do poprawy lub wykorzystania wydajności kamery lub urządzenia obrazowego, tak by odpowiadały cechom pozycji 6A203.a., 6A203.b. lub 6A203.c., jest wymieniona w pozycji 6E203.

Uwaga: Pozycje 6A203.a. do 6A203.c. nie obejmują kontrolą kamer lub urządzeń obrazowych, jeśli posiadają osprzęt, "oprogramowanie" lub "technologię", których pewne cechy ograniczają skuteczność bądź wydajność do poziomu niższego niż określony poniżej, pod warunkiem że spełniają którekolwiek z poniższych kryteriów:

1. w celu dokonania w nich ulepszeń lub zmniejszenia ograniczeń należy je odesłać do pierwotnego producenta;

2. w celu poprawy lub wykorzystania wydajności, pozwalających na spełnienie wymogów wymienionych w pozycji 6D203 wymagają "oprogramowania" określonego w pozycji 6A203; lub

3. w celu poprawy lub wykorzystania wydajności, pozwalających na spełnienie wymogów wymienionych w pozycji 6E203, wymagają "technologii" w postaci kluczy lub kodów określonych w pozycji 6A203;

a. następujące kamery smugowe i specjalnie do nich zaprojektowane elementy:

1. kamery smugowe z prędkościami zapisu powyżej 0,5 mm na mikrosekundę;

2. elektroniczne kamery smugowe o rozdzielczości czasowej 50 ns lub mniejszej;

3. lampy smugowe do kamer wyszczególnionych w pozycji 6A203.a.2;

4. zespoły wtykane specjalnie zaprojektowane do kamer rejestrujących, które mają strukturę modułową i które pozwalają na osiągnięcie parametrów wymienionych w pozycjach 6A203.a.1. lub 6A203.a.2.;

5. elektroniczne elementy synchronizujące oraz specjalne zespoły wirników składające się z turbinek, zwierciadeł i łożysk specjalnie zaprojektowane do stosowania w kamerach wymienionych w pozycji 6A203.a.1.;

b. następujące kamery obrazowe i specjalnie do nich zaprojektowane elementy:

1. kamery filmowe z kadrowaniem z szybkością powyżej 225 000 klatek zdjęciowych na sekundę;

2. kamery obrazowe o czasie naświetlania 50 ns lub krótszym;

3. lampy obrazowe oraz półprzewodnikowe urządzenia obrazowe o czasie bramkowania szybkich obrazów (czasie działania migawki) wynoszącym 50 ns lub mniej, specjalnie zaprojektowane do kamer wyszczególnionych w pozycji 6A203.b.1. lub 6A203.b.2.;

4. zespoły wtykane specjalnie zaprojektowane do kamer obrazowych, które mają strukturę modułową i które pozwalają na osiągnięcie parametrów wymienionych w pozycjach 6A203.b.1. lub 6A203.b.2.;

5. elektroniczne elementy synchronizujące oraz specjalne zespoły wirników składające się z turbinek, zwierciadeł i łożysk specjalnie zaprojektowane do stosowania w kamerach wymienionych w pozycji 6A203.b.1. lub 6A203.b.2.;

Uwaga techniczna:

W pozycji 6A203.b. szybkie kamery jednoklatkowe mogą być używane samodzielnie do wytworzenia pojedynczego obrazu dynamicznego zdarzenia lub kilka takich kamer może być łączonych w sekwencyjnie uruchamiany układ w celu wytworzenia szeregu obrazów zdarzenia.

c. następujące kamery półprzewodnikowe lub z lampami elektronowymi i specjalnie do nich zaprojektowane elementy:

1. kamery półprzewodnikowe lub z lampami elektronowymi o czasie bramkowania szybkich obrazów (czasie działania migawki) wynoszącym 50 ns lub mniej;

2. półprzewodnikowe urządzenia obrazowe i lampowe wzmacniacze obrazu o czasie bramkowania szybkich obrazów (czasie działania migawki) wynoszącym 50 ns lub mniej, specjalnie zaprojektowane do kamer wymienionych w pozycji 6A203.c.1.;

3. migawki elektrooptyczne z fotokomórkami działającymi na zasadzie efektu Kerra lub Pockela o czasie bramkowania szybkich obrazów (czasie działania migawki) wynoszącym 50 ns lub mniej;

4. zespoły wtykane specjalnie zaprojektowane do kamer, które mają strukturę modułową i które pozwalają na osiągnięcie parametrów wymienionych w pozycji 6A203.c.1;

d. kamery telewizyjne zabezpieczone przed promieniowaniem oraz soczewki do nich, skonstruowane lub przystosowane w taki sposób, że są w stanie wytrzymać promieniowanie o natężeniu powyżej 50 × 103 Gy (Si) [5 × 106 rad (Si)] bez pogorszenia własności eksploatacyjnych.

Uwaga techniczna:

Termin Gy (Si) odnosi się do energii w dżulach na kilogram pochłoniętej przez nieekranowaną próbkę krzemu poddaną promieniowaniu jonizującemu.

6A205 Następujące "lasery", wzmacniacze "laserowe" i oscylatory, inne niż wymienione w pozycjach 0B001.g.5, 0B001.h.6 i 6A005:

N.B. W odniesieniu do laserów na parach miedzi zob. pozycja 6A005.b.

a. "lasery" na jonach argonu mające obydwie wymienione poniżej cechy:

1. pracujące w przedziale długości fal od 400 nm do 515 nm; oraz

2. przeciętną moc wyjściową powyżej 40 W;

b. przestrajalne, impulsowe oscylatory na laserach barwnikowych pracujące w trybie pojedynczym, mające wszystkie następujące cechy:

1. pracujące w przedziale długości fal od 300 nm do 800 nm;

2. przeciętną moc wyjściową powyżej 1 W;

3. częstotliwości powtarzania powyżej 1 kHz; oraz

4. impuls o szerokości poniżej 100 ns;

c. przestrajalne, impulsowe wzmacniacze i oscylatory na laserach barwnikowych, mające wszystkie następujące cechy:

1. pracujące w przedziale długości fal od 300 nm do 800 nm;

2. przeciętną moc wyjściową powyżej 30 W;

3. częstotliwości powtarzania powyżej 1 kHz; oraz

4. impuls o szerokości poniżej 100 ns;

Uwaga: Pozycja 6A205.c nie obejmuje kontrolą oscylatorów pracujących w trybie pojedynczym.

d. impulsowe "lasery" na dwutlenku węgla (CO2), mające wszystkie następujące cechy:

1. pracujące w przedziale długości fal od 9 000 nm do 11 000 nm;

2. częstotliwości powtarzania powyżej 250 Hz;

3. przeciętną moc wyjściową powyżej 500 W; oraz

4. impuls o szerokości poniżej 200 ns;

e. przekształtniki na parawodorze działające w paśmie Ramana, przeznaczone do pracy na fali o długości 16 μm z częstotliwością powtarzania powyżej 250 Hz;

f. "lasery" domieszkowane neodymem (inne niż na szkle), o wyjściowej długości fali pomiędzy 1 000 nm a 1 100 nm, mające którykolwiek z poniższych parametrów:

1. wzbudzane impulsowo i modulowane dobrocią o czasie trwania impulsu równym lub większym niż 1 ns, mające którykolwiek z poniższych parametrów:

a. wyjście w trybie jednokrotnego przejścia poprzecznego ze średnią mocą wyjściową ponad 40 W; lub

b. wyjście w trybie wielokrotnego przejścia poprzecznego ze średnią mocą wyjściową ponad 50 W; lub

2. zawierające podwojenie częstotliwości, aby otrzymać wyjściową długość fali pomiędzy 500 nm a 550 nm, z przeciętną mocą wyjściową ponad 40 W.

g. impulsowe "lasery" na tlenku węgla (CO) inne niż wymienione w pozycji 6A005.d.2., mające wszystkie następujące cechy:

1. pracujące w przedziale długości fal od 5 000 nm do 6 000 nm;

2. częstotliwości powtarzania powyżej 250 Hz;

3. przeciętną moc wyjściową powyżej 200 W; oraz

4. impuls o szerokości poniżej 200 ns;

6A225 Interferometry do pomiaru prędkości w zakresie powyżej 1 km/s w odstępach czasowych poniżej 10 mikrosekund.

Uwaga: Pozycja 6A225 obejmuje interferometry do pomiaru prędkości, takie jak VISAR (interferometr do punktowego pomiaru prędkości powierzchni dowolnego rodzaju), DLI (interferometr laserowy) i PDV (urządzenia do pomiaru prędkości dźwięku w powietrzu na podstawie efektu Dopplera).

6A226 Następujące czujniki ciśnienia:

a. manometry wstrząsowe zdolne do mierzenia ciśnienia powyżej 10 GPa, w tym przyrządy pomiarowe wykonane z wykorzystaniem manganu, iterbu oraz polifluorku winylidenu (PVBF) / difluorku poliwinylu (PVF2);

b. kwarcowe przetworniki ciśnień do pomiarów ciśnień powyżej 10 GPa.

6B Urządzenia testujące, kontrolne i produkcyjne

6B004 Następujące urządzenia optyczne:

a. urządzenia do pomiaru absolutnego współczynnika odbicia z "dokładnością" równą lub lepszą niż 0,1 % wartości odbicia;

b. urządzenia różne od optycznych urządzeń do pomiaru rozpraszania powierzchni, mające nieprzysłoniętą aperturę o wielkości powyżej 10 cm, specjalnie zaprojektowane do bezstykowych pomiarów optycznych figur o przestrzennych (nieplanarnych) powierzchniach optycznych (profili) z "dokładnością" 2 nm lub większą (lepszą) na danym profilu.

Uwaga: Pozycja 6B004 nie obejmuje kontrolą mikroskopów.

6B007 Urządzenia do produkcji, strojenia i wzorcowania grawimetrów lądowych o "dokładności" statycznej lepszej niż 0,1 mGal.

6B008 Systemy do impulsowych pomiarów radarowego przekroju czynnego o szerokościach impulsu przesyłowego 100 ns lub mniejszych oraz specjalnie dla nich przeznaczone elementy.

N.B. ZOB. TAKŻE POZYCJA 6B108.

6B108 Systemy specjalnie zaprojektowane do pomiarów radarowego przekroju czynnego znajdujące zastosowanie w 'pociskach rakietowych' i ich podzespołach, inne niż wyszczególnione w pozycji 6B008.

Uwaga techniczna:

Termin 'pocisk rakietowy' w pozycji 6B108 oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

6C Materiały

6C002 Następujące materiały do czujników optycznych:

a. tellur pierwiastkowy (Te) o poziomie czystości równym lub wyższym niż 99,9995 %;

b. pojedyncze kryształy którychkolwiek z poniższych (łącznie z epitaksjalnymi płytkami):

1. tellurku kadmu i cynku (kadmowo-cynkowego) (CdZnTe), o zawartości cynku mniejszej niż 6 % w 'ułamku molowym';

2. tellurku kadmu (CdTe) o dowolnym poziomie czystości; lub

3. tellurku kadmu i rtęci (kadmowo-rtęciowego) (HgCdTe) o dowolnym poziomie czystości.

Uwaga techniczna:

'Ułamek molowy' definiowany jest jako stosunek moli ZnTe do sumy moli CdTe i ZnTe znajdujących się w krysztale.

6C004 Następujące materiały optyczne:

a. "półprodukty podłoży" z selenku cynku (ZnSe) i siarczku cynku (ZnS) wytwarzane techniką osadzania z par lotnych i spełniające którekolwiek z poniższych kryteriów:

1. objętość powyżej 100 cm3; lub

2. średnica większa niż 80 mm i grubość równa 20 mm lub większa;

b. następujące materiały elektrooptyczne i nieliniowe materiały optyczne:

1. arsenian potasu i tytanylu (potasowo-tytanylowy) (KTA) (CAS 59400-80-5);

2. selenek srebra i galu (srebrowo-galowy) (AgGaSe2, znany również pod nazwą AGSE) (CAS 12002-67-4);

3. selenek talu i arsenu (talowo-arsenowy) (Tl3AsSe3, znany również pod nazwą TAS) (CAS 16142-89-5);

4. fosforek cynku i germanu (ZnGeP2, znany również jako ZGP); lub

5. selenek galu (GaSe) (CAS 12024-11-2);

c. nieliniowe materiały optyczne, inne niż wyszczególnione w pozycji 6C004.b., spełniające którekolwiek z poniższych kryteriów:

1. spełniające wszystkie z poniższych kryteriów:

a. dynamiczna (zwana również niestacjonarną) nieliniowa wrażliwość trzeciego rzędu (χ(3), chi 3) równa 10-6 m2/V2 lub lepsza; oraz

b. czas reakcji poniżej 1 ms; lub

2. nieliniowa wrażliwość drugiego rzędu (χ(2), chi 2) równa 3,3 × 10-11 m/V lub lepsza;

d. "półprodukty podłoży" z osadzonym węglikiem krzemu lub beryl-beryl (Be/Be) o średnicy lub długości osi głównej powyżej 300 mm;

e. szkło, łącznie ze stopioną krzemionką, szkło fosforanowe, fluorofosforanowe, z fluorku cyrkonu (ZrF4) (CAS 7783-64-4) i fluorku hafnu (HfF4) (CAS 13709-52-9) spełniające wszystkie poniższe kryteria:

1. stężenie jonów hydroksylowych (OH-) poniżej 5 ppm;

2. zawartość wtrąceń metalicznych poniżej 1 ppm; oraz

3. wysoka jednorodność (wahania współczynnika załamania światła) poniżej 5 × 10-6;

f. wytwarzany syntetycznie materiał diamentowy o współczynniku pochłaniania poniżej 10-5 cm-1 dla fal o długościach powyżej 200 nm, ale nie dłuższych niż 14 000 nm.

6C005 Następujące materiały "laserowe":

a. następujące półprodukty do "laserów" na kryształach syntetycznych:

1. szafir domieszkowany tytanem;

2. nieużywane;

b. włókna z podwójnym płaszczem z dodatkiem metali ziem rzadkich spełniające którekolwiek z poniższych kryteriów:

1. nominalna długość fali "lasera" w przedziale od 975 nm do 1 150 nm oraz wszystkie poniższe parametry:

a. przeciętna średnica rdzenia równa lub większa niż 25 μm; oraz

b. 'apertura numeryczna' rdzenia mniejsza niż 0,065; lub

Uwaga: Pozycja 6C005.b.1. nie obejmuje kontrolą włókien z podwójnym płaszczem, w których wewnętrzny płaszcz szklany ma średnicę przekraczającą 150 μm i nieprzekraczającą 300 μm.

2. nominalna długość fali "lasera" powyżej 1 530 nm oraz wszystkie poniższe parametry:

a. przeciętna średnica rdzenia równa lub większa niż 20 μm; oraz

b. 'apertura numeryczna' rdzenia mniejsza niż 0,1.

Uwagi techniczne:

1. Do celów pozycji 6C005 'apertura numeryczna' rdzenia jest mierzona na emitowanych długościach fali włókna.

2. Pozycja 6C005.b. obejmuje włókna montowane z końcówkami.

6D Oprogramowanie

6D001 "Oprogramowanie" specjalnie zaprojektowane do "rozwoju" lub "produkcji" urządzeń objętych kontrolą według pozycji 6A004, 6A005, 6A008 lub 6B008.

6D002 "Oprogramowanie" specjalnie zaprojektowane do "użytkowania" urządzeń objętych kontrolą według pozycji 6A002.b lub 6A008, lub 6B008.

6D003 Następujące inne "oprogramowanie":

a. następujące "oprogramowanie":

1. "oprogramowanie" specjalnie zaprojektowane do kształtowania wiązek akustycznych do "przetwarzania w czasie rzeczywistym" danych akustycznych pochodzących z pasywnego odbioru za pomocą holowanego zespołu hydrofonów;

2. "kod źródłowy" do "przetwarzania w czasie rzeczywistym" danych akustycznych pochodzących z pasywnego odbioru za pomocą holowanego zespołu hydrofonów;

3. "oprogramowanie" specjalnie opracowane do formowania wiązek akustycznych do "przetwarzania w czasie rzeczywistym" danych akustycznych w celu biernej detekcji za pomocą dennych lub międzywręgowych układów kablowych;

4. "kod źródłowy" do "przetwarzania w czasie rzeczywistym" danych akustycznych dla biernej detekcji dla dennych lub międzywręgowych układów kablowych;

5. "oprogramowanie" lub "kod źródłowy" specjalnie zaprojektowane do wszystkich poniższych celów:

a. "przetwarzanie w czasie rzeczywistym" danych akustycznych pochodzących z systemów sonarowych wyszczególnionych w pozycji 6A001.a.1.e; oraz

b. automatyczne wykrywanie, klasyfikacja i ustalanie położenia nurków lub pływaków;

N.B. Systemy wykrywania nurków specjalnie zaprojektowane lub zmodyfikowane do zastosowań wojskowych - zob. wykaz uzbrojenia.

b. nieużywane;

c. "oprogramowanie" zaprojektowane lub zmodyfikowane dla kamer zawierających zaprojektowane "matryce detektorowe płaszczyzny ogniskowej" wyszczególnione w pozycji 6A002.a.3.f i zaprojektowane lub zmodyfikowane tak, by znieść ograniczenie szybkości analizy obrazów i zezwolić kamerze na przekroczenie szybkości analizy obrazów wymienionej w pozycji 6A003.b.4. Uwaga 3.a.

d. "oprogramowanie" specjalnie zaprojektowane do utrzymywania ustawienia i fazowania podzielonych układów zwierciadeł składających się z segmentów zwierciadeł o średnicy lub długości osi głównej wynoszącej co najmniej 1 m;

e. nieużywane;

f. następujące "oprogramowanie":

1. "oprogramowanie" specjalnie zaprojektowane do "systemów kompensacji" pola magnetycznego i elektrycznego do czujników magnetycznych przeznaczonych do pracy na ruchomych platformach;

2. "oprogramowanie" specjalnie zaprojektowane do wykrywania anomalii pola magnetycznego i elektrycznego na ruchomych platformach;

3. "oprogramowanie" specjalnie zaprojektowane do "przetwarzania w czasie rzeczywistym" danych elektromagnetycznych z wykorzystaniem podwodnych odbiorników elektromagnetycznych wyszczególnionych w pozycji 6A006.e;

4. "kod źródłowy" do "przetwarzania w czasie rzeczywistym" danych elektromagnetycznych z wykorzystaniem podwodnych odbiorników elektromagnetycznych wyszczególnionych w pozycji 6A006.e;

g. "oprogramowanie" specjalnie zaprojektowane do korygowania wpływu oddziaływań związanych z ruchem na grawimetry i mierniki gradientu pola grawitacyjnego;

h. następujące "oprogramowanie":

1. "programy" aplikacyjne "oprogramowania" do kontroli ruchu powietrznego (ATC) zaprojektowane do zainstalowania na komputerach ogólnego przeznaczenia w centrach kontroli ruchu powietrznego, umożliwiające przyjmowanie danych radiolokacyjnych o obiektach z więcej niż czterech radarów pierwotnych;

2. "oprogramowanie" do projektowania lub "produkcji" kopuł anten radiolokatorów spełniające wszystkie poniższe kryteria:

a. specjalnie zaprojektowane do ochrony skanowanych elektronicznie układów antenowych wyszczególnionych w pozycji 6A008.e; oraz

b. wpływające na charakterystykę promieniowania anteny tak, że ma ona 'przeciętny poziom listków bocznych' wynoszący ponad 40 dB poniżej wartości szczytowych wiązki głównej.

Uwaga techniczna:

'Przeciętny poziom listków bocznych' w pozycji 6D003.h.2.b mierzony jest dla całego układu, z pominięciem rozpiętości kątowej wiązki głównej i pierwszych dwóch listków bocznych z każdej strony.

6D102 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" towarów wyszczególnionych w pozycji 6A108.

6D103 "Oprogramowanie" do obróbki (po zakończeniu lotu) danych zebranych podczas lotu, umożliwiające określenie położenia pojazdu w każdym punkcie toru jego lotu, specjalnie zaprojektowane lub zmodyfikowane dla 'pocisków rakietowych'.

Uwaga techniczna:

Termin 'pocisk rakietowy' w pozycji 6D103 oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

6D203 "Oprogramowanie" specjalnie zaprojektowane w celu poprawy lub wykorzystania wydajności kamer lub urządzeń obrazowych, tak by odpowiadały cechom pozycji 6A203.a. do 6A203.c.

6E Technologia

6E001 "Technologie" według uwagi ogólnej do technologii do "rozwoju" urządzeń, materiałów lub "oprogramowania" objętych kontrolą według pozycji 6 A, 6B, 6C lub 6D.

6E002 "Technologie" według uwagi ogólnej do technologii do "produkcji" urządzeń lub materiałów objętych kontrolą według pozycji 6 A, 6B lub 6C.

6E003 Inne "technologie", takie jak:

a. następujące "technologie":

1. "technologie" "niezbędne" do wytwarzania i obróbki powłok na powierzchniach optycznych w celu osiągnięcia 'grubości optycznej' o jednorodności 99,5 % lub lepszej na powłokach optycznych o średnicy lub długości osi głównej wynoszącej 500 mm lub więcej i całkowitego współczynnika strat (pochłanianie i rozpraszanie) poniżej 5 × 10-3;

N.B. Zob. także pozycja 2E003.f.

Uwaga techniczna:

'Grubość optyczna' jest iloczynem wskaźnika refrakcji i fizycznej grubości powłoki.

2. "technologie" wytwarzania elementów optycznych wykorzystujące jednoostrzowe techniki diamentowania, umożliwiające wygładzanie powierzchni z "dokładnością" lepszą niż 10 nm (wartość średnia kwadratowa) na powierzchniach niepłaskich o polu powyżej 0,5 m2;

b. "technologie" "niezbędne" do "rozwoju", "produkcji" lub "użytkowania" specjalnie zaprojektowanych instrumentów diagnostycznych lub obiektów w urządzeniach testujących specjalnie zaprojektowanych do testowania instalacji "urządzeń laserowych bardzo wysokiej mocy" (SHPL) lub testowania lub oceny materiałów napromienionych wiązką z tych systemów.

6E101 "Technologie" według uwagi ogólnej do technologii do "użytkowania" urządzeń lub "oprogramowania" objętych kontrolą według pozycji 6A002, 6A007.b i c, 6A008, 6A102, 6A107, 6A108, 6B108, 6D102 lub 6D103.

Uwaga: Pozycja 6E101 obejmuje kontrolą wyłącznie "technologie" do obiektów wyszczególnionych w pozycjach 6A002, 6A007 i 6A008 w razie ich przeznaczenia do stosowania w lotnictwie i możliwości zastosowania w "pociskach rakietowych".

6E201 "Technologie" według uwagi ogólnej do technologii do "użytkowania" urządzeń wymienionych w pozycjach 6A003, 6A005.a.2, 6A005.b.2, 6A005.b.3, 6A005.b.4, 6A005.b.6, 6A005.c.2, 6A005.d.3.c, 6A005.d.4.c, 6A202, 6A203, 6A205, 6A225 lub 6A226.

Uwaga 1: Pozycja 6E201 obejmuje kontrolą wyłącznie "technologie" do kamer wyszczególnionych w pozycji 6A003, jeśli kamery są również wyszczególnione przez którykolwiek z parametrów kontroli w pozycji 6A203.

Uwaga 2: Pozycja 6E201 obejmuje kontrolą wyłącznie "technologie" do laserów wyszczególnionych w pozycji 6A005.b.6, które są domieszkowane neodymem i są wyszczególnione przez którykolwiek z parametrów kontroli w pozycji 6A205.f.

6E203 "Technologia" w postaci kodów lub kluczy, służąca do poprawy lub wykorzystania wydajności kamer lub urządzeń obrazowych, tak by odpowiadały cechom pozycji 6A203.a. do 6A203.c.

KATEGORIA 7 - NAWIGACJA I AWIONIKA

7A Systemy, urządzenia i części składowe

N.B. W przypadku automatycznych pilotów do pływających jednostek podwodnych zob. także kategoria 8.

W przypadku radarów zob. także kategoria 6.

7A001 Następujące akcelerometry i specjalnie zaprojektowane do nich podzespoły:

N.B. ZOB. TAKŻE POZYCJA 7A101.

N.B. Akcelerometry kątowe lub obrotowe - zob. pozycja 7A001.b.

a. akcelerometry liniowe spełniające którekolwiek z poniższych kryteriów:

1. przeznaczone do działania w warunkach przyspieszeń liniowych mniejszych niż lub równych 15 g i spełniające którekolwiek z poniższych kryteriów:

a. "stabilność" "wychylenia wstępnego" poniżej (lepszą niż) 130 mikro g względem ustalonej wartości wzorcowej w okresie jednego roku; lub

b. "stabilność" "współczynnika skalowania" poniżej (lepszą niż) 130 ppm względem ustalonej wartości wzorcowej w okresie jednego roku;

2. przeznaczone do działania w warunkach przyspieszeń liniowych o wartościach na poziomie wyższym niż 15 g, ale mniejszym niż lub równym 100 g i spełniające wszystkie poniższe kryteria:

a. "stabilność" "wychylenia wstępnego" poniżej (lepszą niż) 1 250 mikro g względem ustalonej wartości wzorcowej w okresie jednego roku; oraz

b. "stabilność" "współczynnika skalowania" poniżej (lepszą niż) 1 250 ppm względem ustalonej wartości wzorcowej w okresie jednego roku; lub

3. zaprojektowane do użytkowania w inercyjnych systemach nawigacji lub naprowadzania i przeznaczone do działania w warunkach przyspieszeń liniowych o wartościach na poziomie wyższym niż 100 g;

Uwaga: Pozycje 7A001.a.1 i 7A001.a.2 nie obejmują kontrolą akcelerometrów ograniczonych do pomiarów wyłącznie wibracji lub wstrząsów.

b. akcelerometry kątowe lub obrotowe przeznaczone do działania w warunkach przyspieszeń liniowych o wartościach na poziomie wyższym niż 100 g.

7A002 Żyroskopy lub czujniki prędkości kątowej spełniające którekolwiek z poniższych kryteriów oraz specjalnie do nich zaprojektowane podzespoły.

N.B. ZOB. TAKŻE POZYCJA 7A102.

N.B. Akcelerometry kątowe lub obrotowe - zob. pozycja 7A001.b.

a. przeznaczone do działania w warunkach przyspieszeń liniowych mniejszych niż lub równych 100 g i spełniające którekolwiek z poniższych kryteriów:

1. zakres pomiaru mniejszy niż 500 stopni na sekundę i spełniające którekolwiek z poniższych kryteriów:

a. "stabilność" "wychylenia wstępnego" wynosząca mniej (lepiej) niż 0,5° na godzinę mierzona w warunkach przyspieszenia równego 1 g w okresie jednego miesiąca i w odniesieniu do ustalonej wartości wzorcowej; lub

b. "kąt błądzenia losowego" mniejszy (lepszy) lub równy 0,0035° na pierwiastek kwadratowy godziny; lub

Uwaga: Pozycja 7A002.a.1.b nie obejmuje kontrolą "żyroskopów wirujących".

2. zakres pomiaru większy lub równy 500° na sekundę i spełniające którekolwiek z poniższych kryteriów:

a. "stabilność" "wychylenia wstępnego" wynosząca poniżej (lepiej niż) 4o na godzinę, mierzona w warunkach przyspieszenia równego 1 g w okresie trzech minut i w odniesieniu do ustalonej wartości wzorcowej; lub

b. "kąt błądzenia losowego" mniejszy (lepszy) lub równy 0,1o na pierwiastek kwadratowy godziny; lub

Uwaga: Pozycja 7A002.a.2.b nie obejmuje kontrolą "żyroskopów wirujących".

b. przeznaczone do działania w warunkach przyspieszeń liniowych o wartościach na poziomie powyżej 100 g.

7A003 'Inercyjne urządzenia lub systemy pomiarowe' spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJA 7A103.

Uwaga 1: 'Inercyjne urządzenia lub systemy pomiarowe' obejmują akcelerometry lub żyroskopy do mierzenia zmian prędkości i orientacji, które po ustawieniu nie wymagają zewnętrznych punktów odniesienia do określenia lub utrzymania kierunku lub pozycji. 'Inercyjne urządzenia lub systemy pomiarowe' obejmują:

- układy informujące o położeniu i kursie (AHRS);

- kompasy żyroskopowe;

- inercyjne jednostki pomiarowe (IMU);

- inercyjne systemy nawigacyjne (INS);

- inercyjne systemy odniesienia (IRS);

- inercyjne jednostki odniesienia (IRU).

Uwaga 2: Pozycja 7A003 nie obejmuje kontrolą 'inercyjnych urządzeń lub systemów pomiarowych' certyfikowanych do stosowania w "cywilnych statkach powietrznych" przez organy lotnictwa cywilnego co najmniej jednego państwa członkowskiego UE lub państwa uczestniczącego w porozumieniu z Wassenaar.

Uwaga techniczna:

'Urządzenia wspierające służące określaniu pozycji' niezależnie określają pozycję i obejmują:

a. globalne systemy nawigacji satelitarnej (GNSS);

b. nawigację opartą na informacjach z bazy danych (DBRN).

a. zaprojektowane do "statków powietrznych", pojazdów lądowych i statków, określające pozycję bez wykorzystywania 'urządzeń wspierających służących określaniu pozycji', o następującej "dokładności" pozycjonowania będącej wynikiem normalnego ustawienia:

1. "krąg równego prawdopodobieństwa" ("CEP") wynoszący 0,8 mili morskiej na godzinę (nm/hr) lub mniej (lepiej);

2. "krąg równego prawdopodobieństwa" ("CEP") wynoszący 0,5 % przebytego dystansu lub mniej (lepiej); lub

3. łączny dryf o wartości "kręgu równego prawdopodobieństwa" ("CEP") wynoszącego 1 milę morską lub mniej (lepiej) w okresie 24 godzin;

Uwaga techniczna:

Parametry określone w pozycjach 7A003.a.1., 7A003.a.2. i 7A003.a.3. zazwyczaj stosują się do 'inercyjnych urządzeń lub systemów pomiarowych' zaprojektowanych odpowiednio do "statków powietrznych", pojazdów i statków. Parametry te są wynikiem wykorzystywania specjalistycznych urządzeń wspierających niesłużących określaniu pozycji (np. wysokościomierza, hodometru, prędkościomierza). Co za tym idzie, podanych wartości nie można dowolnie konwertować między tymi parametrami. Urządzenia zaprojektowane dla różnych platform są oceniane w odniesieniu do każdej mającej zastosowanie pozycji 7A003.a.1., 7A003.a.2., lub 7A003.a.3.

b. zaprojektowane do "statków powietrznych", pojazdów lądowych lub statków, z wbudowanym 'urządzeniem wspierającym służącym określaniu pozycji' i wskazujące pozycję po utracie wszystkich 'urządzeń wspierających służących określaniu pozycji' przez okres do 4 minut, o "dokładności" mniejszej (lepszej) niż "krąg równego prawdopodobieństwa" ("CEP") wynoszący 10 metrów;

Uwaga techniczna:

Pozycja 7A003.b odnosi się do systemów, w których 'inercyjne systemy lub urządzenia pomiarowe' i inne niezależne 'urządzenia wspierające służące określaniu pozycji' są wbudowane w jeden zespół w celu uzyskania poprawy parametrów.

c. zaprojektowane do "statków powietrznych", pojazdów lądowych lub statków, pozwalające określić kierunek lub północ geograficzną i posiadające którąkolwiek z następujących cech:

1. Maksymalna robocza prędkość kątowa mniejsza (niższa) niż 500 deg/s, a "dokładność" kierunku bez stosowania 'urządzeń wspierających służących określaniu pozycji' równa lub mniejsza (lepsza) niż 0,07 deg sec(Lat) (odpowiednik 6 minut kątowych na 45 stopniach szerokości geograficznej); lub

2. Maksymalna robocza prędkość kątowa równa lub większa (wyższa) niż 500 deg/s, a "dokładność" kierunku bez stosowania 'urządzeń wspierających służących określaniu pozycji' równa lub mniejsza (lepsza) niż 0,2 deg sec(Lat) (odpowiednik 17 minut kątowych na 45 stopniach szerokości geograficznej); lub

d. wykonujące pomiary przyspieszenia lub pomiary prędkości kątowej, w więcej niż jednym wymiarze, i posiadające którąkolwiek z następujących cech:

1. parametry określone w pozycji 7A001 lub 7A002 wzdłuż dowolnej osi, bez użycia żadnych urządzeń wspierających; lub

2. są klasy kosmicznej i wykonują pomiary prędkości kątowej, w których "kąt błądzenia losowego" wzdłuż dowolnej osi jest mniejszy (lepszy) lub równy 0,1o na pierwiastek kwadratowy godziny.

Uwaga: Pozycja 7A003.d.2. nie obejmuje kontrolą 'inercyjnych urządzeń lub systemów pomiarowych', w których "żyroskop wirujący" jest jedynym rodzajem żyroskopu.

7A004 Następujące 'szukacze gwiazd' i ich elementy:

N.B. ZOB. TAKŻE POZYCJA 7A104.

a. 'szukacze gwiazd' o określonej "dokładności" pomiaru azymutu równej lub mniejszej (lepszej) niż 20 sekund łuku przez określony czas użytkowania urządzeń;

b. następujące elementy specjalnie zaprojektowane do urządzeń wymienionych w pozycji 7A004.a.:

1. optyczne głowice lub przegrody;

2. jednostki przetwarzania danych.

Uwaga techniczna:

'Szukacze gwiazd' nazywane są również czujnikami kierowania gwiezdnego lub żyro-astrokompasami.

7A005 Urządzenia odbiorcze globalnych systemów nawigacji satelitarnej (GNSS) spełniające którekolwiek z poniższych kryteriów oraz specjalnie do nich zaprojektowane podzespoły:

N.B. ZOB. TAKŻE POZYCJA 7A105.

N.B. W przypadku urządzeń zaprojektowanych specjalnie do zastosowań wojskowych zob. wykaz uzbrojenia.

a. wyposażenie w algorytm deszyfrujący specjalnie zaprojektowany lub zmodyfikowany do wykorzystania przez służby rządowe w celu uzyskania dostępu do ciągów rozpraszających pozwalających określić pozycję i czas; lub

b. wyposażenie w 'systemy anten adaptacyjnych'.

Uwaga: Pozycja 7A005.b nie obejmuje kontrolą urządzeń odbiorczych GNSS wyposażonych wyłącznie w elementy służące filtrowaniu, przełączaniu lub łączeniu sygnałów z wielu anten dookólnych, w których nie zastosowano technik anten adaptacyjnych.

Uwaga techniczna:

Do celów poz. 7A005.b 'systemy anten adaptacyjnych' dynamicznie wytwarzają jedną przestrzenną wartość zerową lub większą ich liczbę w szyku antenowym przez przetwarzanie sygnału w domenie czasu lub częstotliwości.

7A006 Wysokościomierze lotnicze działające poza pasmem częstotliwości od 4,2 do 4,4 GHz łącznie i spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJA 7A106.

a. 'sterowanie mocą'; lub

b. wyposażenie w zespoły do modulacji z przesunięciem fazy.

Uwaga techniczna:

'Sterowanie mocą' oznacza zmianę mocy sygnału nadawanego przez wysokościomierz w taki sposób, żeby moc odbierana w "statku powietrznym" na danej wysokości była zawsze na minimalnym poziomie niezbędnym do określenia wysokości.

7A008 Systemy sonarowe do nawigacji podwodnej, posługujące się logami dopplerowskimi lub logami korelacyjnymi zintegrowane z czujnikiem kierunku i mające dokładność pozycjonowania równą lub mniejszą (lepszą) niż 3 % przebytej odległości "kręgu równego prawdopodobieństwa" ("CEP") oraz specjalnie do nich zaprojektowane podzespoły.

Uwaga: Pozycja 7A008 nie obejmuje kontrolą systemów specjalnie zaprojektowanych do zainstalowania na statkach nawodnych lub systemów wymagających pław lub boi akustycznych do dostarczania danych pozycyjnych.

N.B. Zob. pozycja 6A001.a dla systemów akustycznych oraz pozycja 6A001.b dla urządzeń sonarowych z logami korelacyjnymi i logami dopplerowskimi.

Zob. pozycja 8A002 dla innych systemów okrętowych.

7A101 Akcelerometry liniowe, inne niż wyszczególnione w pozycji 7A001, zaprojektowane do stosowania w inercyjnych systemach nawigacyjnych lub w dowolnego typu systemach naprowadzania nadających się do zastosowania w 'pociskach rakietowych', mające wszystkie z poniższych cech, oraz specjalnie do nich zaprojektowane zespoły:

a. "powtarzalność" "wychylenia wstępnego" mniejsza (lepsza) niż 1 250 μg; oraz

b. "powtarzalność" "współczynnika skalowania" mniejsza (lepsza) niż 1 250 ppm.

Uwaga: Pozycja 7A101 nie obejmuje kontrolą akcelerometrów specjalnie zaprojektowanych i opracowanych jako czujniki MWD (Measurement While Drilling - pomiar podczas wiercenia) stosowanych podczas prac wiertniczych.

Uwagi techniczne:

1. W pozycji 7A101 'pocisk rakietowy' oznacza kompletne systemy rakietowe oraz systemy bezzałogowych statków powietrznych, zdolnych do pokonania odległości przekraczającej 300 km.

2. W pozycji 7A101 pomiar "wychylenia wstępnego" i "współczynnika skalowania" odnosi się do odchylenia standardowego wielkości 1 sigma w odniesieniu do ustalonej wartości wzorcowej w okresie jednego roku.

7A102 Wszystkie typy żyroskopów, inne niż wyszczególnione w pozycji 7A002, nadające się do stosowania w 'pociskach rakietowych', o 'stabilności' "współczynnika dryftu" poniżej 0,5° (1 sigma lub średnia kwadratowa) na godzinę w warunkach przyspieszenia 1 g oraz specjalnie do nich zaprojektowane podzespoły.

Uwagi techniczne:

1. W pozycji 7A102 'pocisk rakietowy' oznacza kompletne systemy rakietowe oraz systemy bezzałogowych statków powietrznych, zdolnych do pokonania odległości przekraczającej 300 km.

2. W pozycji 7A102 'stabilność' jest zdefiniowana jako miara zdolności określonego mechanizmu lub współczynnika osiągu, która pozostaje niezmienna w stałym warunku roboczym (IEEE STD 528-2001 ust. 2247).

7A103 Następujące instrumenty, urządzenia i systemy nawigacyjne, inne niż wyszczególnione w pozycji 7A003, oraz specjalnie do nich zaprojektowane podzespoły:

a. 'inercyjne urządzenia lub systemy pomiarowe', w których zastosowano poniższe akcelerometry lub żyroskopy:

1. akcelerometry wymienione w pozycjach 7A001.a.3, 7A001.b, 7A101 lub żyroskopy wymienione w pozycjach 7A002, 7A102; lub

Uwaga: Pozycja 7A103.a.1. nie obejmuje kontrolą urządzeń zawierających akcelerometry wymienione w pozycji 7A001.a.3, które są zaprojektowane do pomiarów drgań i wstrząsów.

2. akcelerometry wymienione w pozycjach 7A001.a.1. lub 7A001.a.2., zaprojektowane do wykorzystania w inercyjnych systemach nawigacyjnych lub w dowolnego typu systemach naprowadzania nadających się do zastosowania w 'pociskach rakietowych';

Uwaga: Pozycja 7A103.a.2. nie obejmuje kontrolą urządzeń zawierających akcelerometry wymienione w pozycji 7A001.a.1. lub 7A001.a.2. oraz zaprojektowane i opracowane jako czujniki MWD (Measurement While Drilling - pomiar podczas wiercenia) stosowane podczas prac wiertniczych.

Uwaga techniczna:

'Inercyjne urządzenia lub systemy pomiarowe' wymienione w pozycji 7A103.a obejmują akcelerometry lub żyroskopy do mierzenia zmian prędkości i orientacji, które po ustawieniu nie wymagają zewnętrznych punktów odniesienia do określenia lub utrzymania kierunku lub pozycji.

Uwaga: 'Inercyjne urządzenia lub systemy pomiarowe' w pozycji 7A103.a. obejmują:

- układy informujące o położeniu i kursie (AHRS);

- kompasy żyroskopowe;

- inercyjne jednostki pomiarowe (IMU);

- inercyjne systemy nawigacyjne (INS);

- inercyjne systemy odniesienia (IRS);

- inercyjne jednostki odniesienia (IRU).

b. zintegrowane systemy samolotowych przyrządów pokładowych zawierające stabilizatory żyroskopowe lub automatycznego pilota, zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w 'pociskach rakietowych';

c. 'zintegrowane systemy nawigacyjne' zaprojektowane lub zmodyfikowane do zastosowania w 'pociskach rakietowych' i zdolne do zapewniania dokładności nawigacyjnej dla kręgu równego prawdopodobieństwa wynoszącej 200 m lub mniej;

Uwaga techniczna:

W skład 'zintegrowanego systemu nawigacyjnego' zazwyczaj wchodzą następujące elementy składowe:

1. inercyjne urządzenie pomiarowe (np. system wyznaczania położenia i kursu, inercyjny zespół odniesienia lub inercyjny system nawigacyjny);

2. jeden lub więcej czujników zewnętrznych używanych do aktualizowania położenia lub prędkości, albo okresowo lub w sposób ciągły w trakcie lotu (np. satelitarny odbiornik nawigacyjny, wysokościomierze radarowy lub radar dopplerowski); oraz

3. sprzęt i oprogramowanie scalające.

d. trójosiowe magnetyczne czujniki kursowe, zaprojektowane lub zmodyfikowane w celu ich zintegrowania z systemami sterowania lotem i systemami nawigacji, innymi niż wymienione w pozycji 6A006, mające wszystkie poniższe cechy charakterystyczne, oraz specjalnie do nich zaprojektowane podzespoły:

1. wewnętrzna kompensacja nachylenia wzdłuż osi poprzecznej (+/- 90 stopni) i osi podłużnej (+/- 180 stopni);

2. dokładność azymutowa lepsza (mniejsza) niż 0,5 stopni rms na szerokości +/- 80 stopni w odniesieniu do lokalnego pola magnetycznego.

Uwaga: Systemy sterowania lotem i systemy nawigacji w pozycji 7A103.d obejmują stabilizatory żyroskopowe, automatycznego pilota oraz inercyjne systemy nawigacji.

Uwaga techniczna:

W pozycji 7A103 'pocisk rakietowy' oznacza kompletne systemy rakietowe oraz systemy bezzałogowych statków powietrznych, zdolnych do pokonania odległości przekraczającej 300 km.

7A104 Żyro-astrokompasy i inne urządzenia, inne niż wyszczególnione w pozycji 7A004, umożliwiające określanie położenia lub orientację przestrzenną za pomocą automatycznego śledzenia ciał niebieskich lub satelitów oraz specjalnie do nich zaprojektowane podzespoły.

7A105 Urządzenia odbiorcze 'systemów nawigacji satelitarnej', inne niż wymienione w pozycji 7A005, spełniające którekolwiek z poniższych kryteriów oraz specjalnie zaprojektowane do nich zespoły:

a. zaprojektowane lub zmodyfikowane do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004, rakietach meteorologicznych wyszczególnionych w pozycji 9A104 lub w bezzałogowych statkach powietrznych wyszczególnionych w pozycji 9A012 lub 9A112.a; lub

b. zaprojektowane lub zmodyfikowane do zastosowań lotniczych i spełniające którekolwiek z poniższych kryteriów:

1. zdolne do dostarczania danych nawigacyjnych przy prędkościach powyżej 600 m/s;

2. stosujące deszyfrowanie, zaprojektowane lub zmodyfikowane do zadań wojskowych lub rządowych, w celu uzyskania dostępu do zabezpieczonych sygnałów/danych 'systemu nawigacji satelitarnej'; lub

3. specjalnie zaprojektowane do stosowania elementów przeciwzakłóceniowych (np. bezmodemowa antena sterująca lub antena sterowana elektronicznie) do działania w warunkach, w których występuje aktywne lub bierne przeciwdziałanie.

Uwaga: Pozycje 7A105.b.2 i 7a105.b.3 nie obejmują kontrolą urządzeń przeznaczonych do komercyjnego, cywilnego lub 'ratunkowego' dostępu do 'systemu nawigacji satelitarnej' (np. integracja danych, bezpieczeństwo lotów).

Uwaga techniczna:

W pozycji 7A105 'system nawigacji satelitarnej' obejmuje globalne systemy nawigacji satelitarnej (GNSS; np. GPS, GLONASS, Galileo lub BeiDou) oraz regionalne systemy nawigacji satelitarnej (RNSS; np. NavIC, QZSS).

7A106 Wysokościomierze, inne niż wyszczególnione w pozycji 7A006, typu radarowego lub laserowego, zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104.

7A115 Pasywne czujniki do określania namiaru na określone źródła fal elektromagnetycznych (namierniki) lub właściwości terenu, zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004 lub w rakietach meteorologicznych wyszczególnionych w pozycji 9A104.

Uwaga: Urządzenia wyszczególnione w pozycjach 7A105, 7A106 i 7A115 obejmują następujące rodzaje:

a. urządzenia do wykonywania map konturowych terenu;

b. urządzenia do wykonywania i korelacji obrazów terenu (analogowe i cyfrowe);

c. urządzenia do radarowej nawigacji doplerowskiej;

d. interferometry pasywne;

e. czujniki do tworzenia obrazów (zobrazowania) (aktywne i pasywne);

7A116 Następujące systemy sterowania lotem i serwozawory, zaprojektowane lub zmodyfikowane z przeznaczeniem do kosmicznych pojazdów nośnych wyszczególnionych w pozycji 9A004, do rakiet meteorologicznych wyszczególnionych w pozycji 9A104 lub "pocisków rakietowych".

a. pneumatyczne, hydrauliczne, mechaniczne, elektrooptyczne lub elektromechaniczne systemy sterowania lotem (w tym systemy "fly-by-wire" i "fly-by-light");

b. urządzenia do sterowania położeniem;

c. serwozawory do sterowania lotem zaprojektowane lub zmodyfikowane do systemów określonych w pozycjach 7A116.a lub 7A116.b oraz zaprojektowane lub zmodyfikowane do działania w środowisku wibracyjnym o parametrach powyżej 10 g (wartość średnia kwadratowa) pomiędzy 20 Hz i 2 kHz.

Uwaga: Do celów przekształcenia załogowych statków powietrznych do funkcjonowania jako "pociski rakietowe" pozycja 7A116 obejmuje systemy, urządzenia lub zawory zaprojektowane lub zmodyfikowane w celu umożliwienia funkcjonowania załogowych statków powietrznych jako bezzałogowe statki powietrzne.

7A117 "Instalacje do naprowadzania", znajdujące zastosowanie w "pociskach rakietowych", umożliwiające uzyskanie dokładności instalacji 3,33 % zasięgu lub lepszej (np. "CEP" [Krąg Równego Prawdopodobieństwa] 10 km lub mniej w zasięgu 300 km).

7B Urządzenia testujące, kontrolne i produkcyjne

7B001 Urządzenia do testowania, wzorcowania lub strojenia, specjalnie zaprojektowane do urządzeń objętych kontrolą według pozycji 7A.

Uwaga: Pozycja 7B001 nie obejmuje kontrolą urządzeń do testowania, wzorcowania lub strojenia specjalnie zaprojektowanych do 'poziomu obsługi I' i 'poziomu obsługi II'.

Uwagi techniczne:

1. 'Poziom obsługi I'

Wykrycie awarii urządzenia nawigacji inercyjnej w "statku powietrznym" i jej sygnalizowanie przez Jednostkę Sterowania i Wyświetlania (CDU) lub komunikat statusowy z odpowiedniego podukładu. Na podstawie instrukcji producenta można zlokalizować przyczyny awarii na poziomie wadliwego funkcjonowania liniowego elementu wymiennego (LRU). Następnie operator demontuje LRU i zastępuje go częścią zapasową.

2. 'Poziom obsługi II'

Uszkodzony LRU przekazuje się do warsztatu technicznego (u producenta lub operatora odpowiedzialnego za obsługę techniczną na poziomie II). W warsztacie technicznym LRU poddaje się testom za pomocą różnych, odpowiednich do tego urządzeń, w celu sprawdzenia i lokalizacji uszkodzonego modułu zespołu dającego się wymienić w warsztacie (SRA) odpowiedzialnego za awarię. Następnie demontuje się wadliwy SRA i zastępuje go zespołem zapasowym. Uszkodzony SRA (albo też kompletny LRU) wysyła się do producenta. Na 'poziomie obsługi II' nie przewiduje się demontażu ani naprawy akcelerometrów ani też czujników żyroskopowych objętych kontrolą.

7B002 Następujące urządzenia specjalnie zaprojektowane do określania parametrów zwierciadeł do pierścieniowych żyroskopów "laserowych":

N.B. ZOB. TAKŻE POZYCJA 7B102.

a. urządzenia do pomiaru rozproszenia z "dokładnością" do 10 ppm lub mniej (lepszą);

b. profilometry o "dokładności" pomiarowej 0,5 nm (5 angstremów) lub mniej (lepszej).

7B003 Urządzenia specjalnie zaprojektowane do "produkcji" urządzeń ujętych w pozycji 7A.

Uwaga: Pozycja 7B003 obejmuje:

- stanowiska testowe do regulacji żyroskopów,

- stanowiska do dynamicznego wyważania żyroskopów,

- stanowiska do testowania silniczków do żyroskopów,

- stanowiska do usuwania powietrza i napełniania żyroskopów,

- uchwyty odśrodkowe do łożysk do żyroskopów,

- stanowiska do regulacji pozycji osi akcelerometrów,

- nawijarki zwojów do światłowodów.

7B102 Reflektometry specjalnie zaprojektowane do wyznaczania charakterystyk zwierciadeł do żyroskopów "laserowych", mające dokładność pomiarową 50 ppm lub mniej (lepszą).

7B103 Następujące "instalacje produkcyjne" i "urządzenia produkcyjne":

a. specjalnie opracowane "instalacje produkcyjne" do urządzeń określonych w pozycji 7A117;

b. "urządzenia produkcyjne" i inne urządzenia do testowania, wzorcowania lub strojenia, inne niż wymienione w pozycjach 7B001 do 7B003, zaprojektowane lub zmodyfikowane do urządzeń wyszczególnionych w pozycji 7A.

7C Materiały

Żadne.

7D Oprogramowanie

7D001 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do "rozwoju" lub "produkcji" urządzeń wyszczególnionych w pozycji 7A lub 7B.

7D002 "Kod źródłowy" do obsługi lub konserwacji wszelkich urządzeń do nawigacji inercyjnej lub układów informujących o położeniu i kursie ('AHRS') łącznie z inercyjnymi urządzeniami niewyszczególnionymi w pozycji 7A003 lub 7A004.

Uwaga: Pozycja 7D002 nie obejmuje kontrolą "kodów źródłowych" do "użytkowania" zawieszonych kardanowo układów 'AHRS'.

Uwaga techniczna:

Układy 'AHRS' w istotny sposób różnią się od inercyjnych systemów nawigacji (INS), ponieważ układy te ('AHRS') dostarczają podstawowych informacji o położeniu i kursie, i zazwyczaj nie dostarczają informacji o przyspieszeniu, prędkości i pozycji, jakich dostarcza układ INS.

7D003 Następujące inne "oprogramowanie":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane w celu poprawy parametrów eksploatacyjnych lub zmniejszenia błędów nawigacyjnych systemów do poziomu określonego w pozycjach 7A003, 7A004 lub 7A008;

b. "kod źródłowy" do hybrydowych układów scalonych poprawiający parametry eksploatacyjne lub zmniejszający błędy nawigacyjne systemu do poziomu określonego w pozycji 7A003 lub 7A008 poprzez ciągłą syntezę danych dotyczących kursu z którymikolwiek z następujących:

1. prędkością określaną za pomocą radaru lub sonaru dopplerowskiego;

2. porównywaniem z danymi z globalnego systemu nawigacji satelitarnej (GNSS); lub

3. informacjami z "bazy danych o terenie";

c. nieużywane;

d. nieużywane;

e. "oprogramowanie" do komputerowo wspomaganego projektowania (CAD), specjalnie opracowane do "rozwoju" "układów aktywnego sterowania lotem", sterowników helikopterowych wieloosiowych systemów sterowania elektronicznego i światłowodowego lub helikopterowych "cyrkulacyjnych układów równoważenia momentu lub cyrkulacyjnych układów sterowania kierunkiem", których technologie są wymienione w pozycjach 7E004.b.1, 7E004.b.3 do 7E004.b.5, 7E004.b.7, 7E004.b.8, 7E004.c.1 lub 7E004.c.2.

7D004 "Kod źródłowy" obejmujący "rozwój" i "technologię" określone w pozycjach 7E004.a.2, 7E004.a.3, 7E004.a.5, 7E004.a.6 lub 7E004.b, w odniesieniu do dowolnego z poniższych:

a. cyfrowych systemów sterowania lotem umożliwiających "kompleksowe sterowanie lotem";

b. zintegrowanych systemów sterowania napędem i lotem;

c. systemów sterowania elektronicznego (fly-by-wire) i systemów sterowania światłowodowego (fly-by-light);

d. "aktywnych systemów sterowania lotem", tolerujących błędy pilotażu lub mających możliwość samoczynnej rekonfiguracji;

e. nieużywane;

f. systemów przyrządów pokładowych dostarczających danych dotyczących parametrów powietrza w locie na podstawie pomiarów powierzchniowych parametrów statycznych; lub

g. trójwymiarowych wyświetlaczy.

Uwaga: Pozycja 7D004. nie obejmuje kontrolą "kodu źródłowego" związanego z popularnymi elementami i funkcjami komputerów (np. przyjmowanie sygnału wejściowego, transmisja sygnału wyjściowego, ładowanie programu komputerowego i danych, wbudowany test, mechanizmy planowania zadań) niezapewniającego określonej funkcji kontroli lotu.

7D005 "Oprogramowanie" specjalnie zaprojektowane do deszyfrowania ciągów rozpraszających globalnych systemów nawigacji satelitarnej (GNSS) zaprojektowanego do zastosowań rządowych.

7D101 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" urządzeń wymienionych w pozycjach 7A001 do 7A006, 7A101 do 7A106, 7A115, 7A116.a, 7A116.b, 7B001, 7B002, 7B003, 7B102 lub 7B103.

7D102 "Oprogramowanie" scalające, jak następuje:

a. "oprogramowanie" scalające do urządzeń wyszczególnionych w pozycji 7A103.b;

b. "oprogramowanie" scalające specjalnie zaprojektowane do urządzeń wymienionych w pozycjach 7A003 lub 7A103.a;

c. "oprogramowanie" scalające specjalnie zaprojektowane lub zmodyfikowane do urządzeń wyszczególnionych w pozycji 7A103.c.

Uwaga: Powszechnie spotykaną postacią "oprogramowania" scalającego jest filtrowanie Kalmana.

7D103 "Oprogramowanie" specjalnie zaprojektowane do modelowania lub symulowania działania "instalacji do naprowadzania" wyszczególnionych w pozycji 7A117 lub do ich integrowania konstrukcyjnego z kosmicznymi pojazdami nośnymi wyszczególnionymi w pozycji 9A004 lub z rakietami meteorologicznymi wyszczególnionymi w pozycji 9A104.

Uwaga: "Oprogramowanie" wyszczególnione w pozycji 7D103 podlega kontroli, jeśli jest specjalnie zaprojektowane do sprzętu wymienionego w pozycji 4A102.

7D104 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do celów obsługi lub konserwacji "instalacji do naprowadzania" wymienionych w pozycji 7A117.

Uwaga: Pozycja 7D104 obejmuje "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do zwiększenia skuteczności "instalacji do naprowadzania" w celu osiągnięcia lub przekroczenia dokładności określonej w pozycji 7A117.

7E Technologia

7E001 "Technologie" według uwagi ogólnej do technologii do "rozwoju" urządzeń lub "oprogramowania" określonych w pozycjach 7 A, 7B, 7D001, 7D002, 7D003, 7D005 i 7D101 do 7D103.

Uwaga: Pozycja 7E001 obejmuje "technologię" zarządzania kluczem wyłącznie odnośnie do urządzeń wymienionych w pozycji 7A005.a.

7E002 "Technologie" według uwagi ogólnej do technologii do "produkcji" urządzeń wymienionych w pozycjach 7A lub 7B.

7E003 "Technologie" według uwagi ogólnej do technologii do naprawy, regeneracji lub remontowania urządzeń wymienionych w pozycjach 7A001 do 7A004.

Uwaga: Pozycja 7E003 nie obejmuje kontrolą "technologii" obsługi technicznej bezpośrednio związanych z wzorcowaniem, usuwaniem lub wymianą uszkodzonych lub nienadających się do użytku liniowych elementów wymiennych (LRU) i warsztatowych zespołów wymiennych (SRA) w "cywilnych statkach powietrznych" zgodnie z opisem w 'poziomie obsługi I' lub w 'poziomie obsługi II'.

N.B. Zob. uwagi techniczne do pozycji 7B001.

7E004 Inne "technologie", takie jak:

a. technologie do "rozwoju" lub "produkcji" któregokolwiek z poniższych:

1. nieużywane;

2. systemów działających w oparciu o dane dotyczące parametrów powietrza w oparciu wyłącznie o pomiary powierzchniowych parametrów statycznych, tj. dostarczane z konwencjonalnych sond do pomiarów parametrów powietrza;

3. trójwymiarowych wyświetlaczy do "statków powietrznych";

4. nieużywane;

5. serwomotorów elektrycznych (tj. elektromechanicznych, elektrohydrostatycznych i zintegrowanych) specjalnie opracowanych dla "podstawowego sterowania lotem";

Uwaga techniczna:

'Podstawowe sterowanie lotem' oznacza sterowanie stabilnością i manewrowością "statku powietrznego" za pomocą generatorów siły lub momentu, tj. za pomocą aerodynamicznych powierzchni sterujących lub sterowania wektorem ciągu.

6. 'układów czujników optycznych sterowania lotem' specjalnie opracowanych dla "aktywnych układów sterowania lotem"; lub

Uwaga techniczna:

'Układ czujników optycznych sterowania lotem' oznacza układ rozproszonych czujników optycznych, wykorzystujący promień "lasera" do dostarczania w czasie rzeczywistym danych dotyczących sterowania lotem w celu ich przetwarzania na pokładzie.

7. systemów "DBRN" zaprojektowanych do nawigacji podwodnej przy użyciu sonaru lub baz danych grawitacyjnych zapewniających "dokładność" pozycjonowania równą 0,4 mil morskich lub mniejszą (lepszą);

b. następujące "technologie" "rozwoju" "aktywnych systemów sterowania lotem" (łącznie z "systemami elektronicznymi" lub "światłowodowymi") do:

1. "technologii" fotonicznej do wykrywania stanu elementów sterujących "statku powietrznego" lub lotu, przesyłania danych kontroli lotu lub sterowania ruchem urządzenia uruchamiającego, "wymaganego" w "aktywnych systemach sterowania lotem" opartych na "światłowodach";

2. nieużywane;

3. algorytmów używanych w czasie rzeczywistym do analizowania informacji z czujnika części składowych w celu przewidywania i prewencyjnego ograniczania zbliżającego się zużycia i awarii części składowych w "aktywnym systemie sterowania lotem";

Uwaga: Pozycja 7E004.b.3. nie obejmuje kontrolą algorytmów stosowanych do celów obsługi w trybie offline.

4. algorytmów używanych w czasie rzeczywistym do identyfikowania awarii części składowych i przekonfigurowywania elementów sterowania siłą i momentem w celu ograniczania zużycia i awarii "aktywnego systemu sterowania lotem";

Uwaga: Pozycja 7E004.b.4. nie obejmuje kontrolą algorytmów służących eliminowaniu skutków błędów poprzez porównanie źródeł redundantnych danych lub odpowiedzi wstępnie zaplanowanych offline z przewidywanymi awariami.

5. integracji systemu sterowania cyfrowego, danych z systemu nawigacyjnego i napędowego w jeden system cyfrowego kierowania lotem dla "kompleksowego sterowania lotem";

Uwaga: Pozycja 7E004.b.5 nie obejmuje kontrolą:

a. "technologii" integracji cyfrowych systemów sterowania lotem, danych nawigacyjnych i danych kontrolnych układu napędowego do systemu cyfrowego kierowania lotem w celu 'optymalizacji toru lotu';

b. "technologii" przyrządów kontroli lotu dla "statków powietrznych", zintegrowanych wyłącznie z systemami nawigacyjnymi i podchodzenia do lądowania, takimi jak VOR, DME, ILS lub MLS.

Uwaga techniczna:

'Optymalizacja toru lotu' jest to procedura minimalizująca odchylenia od czterowymiarowego (przestrzeń i czas) wymaganego toru lotu, oparta na maksymalnym wykorzystaniu pracy lub efektywności w realizacji zadania.

6. nieużywane;

7. "technologii" "wymaganych" do sformułowania wymogów funkcjonalnych dotyczących "systemów sterowania elektronicznego" spełniających wszystkie poniższe kryteria:

a. sterowanie stabilnością płatowca z wykorzystaniem 'pętli wewnętrznej' wymagające częstotliwości zamykania pętli o wartości co najmniej 40 Hz; oraz

Uwaga techniczna:

'Pętla wewnętrzna' odnosi się do funkcji "aktywnych systemów sterowania lotem", które automatyzują sterowanie stabilnością płatowca.

b. spełnianie któregokolwiek z poniższych kryteriów:

1. korygowanie aerodynamicznie niestabilnego płatowca, mierzonego w dowolnym punkcie projektowej obwiedni osiągów, który utraciłby odzyskiwalną sterowność, gdyby korekta nie nastąpiła w ciągu 0,5 sekundy;

2. łączenie sterowania w dwóch lub większej liczbie osi, przy równoczesnym kompensowaniu 'nieprawidłowych zmian stanu statku powietrznego';

Uwaga techniczna:

'Nieprawidłowe zmiany stanu statku powietrznego' obejmują uszkodzenie strukturalne w trakcie lotu, utratę ciągu silnika, unieruchomienie powierzchni sterującej lub destabilizujące zmiany ułożenia ładunku.

3. wykonywanie funkcji określonych w pozycji 7E004.b.5.; lub

Uwaga: Pozycja 7E004.b.7.b.3. nie obejmuje kontrolą automatycznych pilotów.

4. umożliwianie "statkowi powietrznemu" prowadzenie stabilnego kontrolowanego lotu, poza startem lub lądowaniem, pod kątem natarcia większym niż 18 stopni, przy ślizgu bocznym pod kątem 15 stopni, przy pochyleniu lub odchyleniu o 15 stopni/sekundę, lub przy prędkości kątowej podczas wykonywania beczki wynoszącej 90 stopni/sekundę;

8. "technologii" "wymaganych" do sformułowania wymogów funkcjonalnych dotyczących "systemów sterowania elektronicznego", by spełniły wszystkie poniższe kryteria:

a. zachowanie kontroli nad "statkiem powietrznym" w przypadku sekwencji dwóch pojedynczych awarii w "systemie sterowania elektronicznego"; oraz

b. prawdopodobieństwo utraty kontroli nad "statkiem powietrznym" mniejsze (lepsze) niż 1 × 10-9 awarii na godzinę lotu;

Uwaga: Pozycja 7E004.b. nie obejmuje kontrolą "technologii" związanej z popularnymi elementami i funkcjami komputerów (np. przyjmowanie sygnału wejściowego, transmisja sygnału wyjściowego, ładowanie programu komputerowego i danych, wbudowany test, mechanizmy planowania zadań) niezapewniającej określonej funkcji kontroli lotu.

c. następujące "technologie" do "rozwoju" systemów do śmigłowców:

1. wieloosiowe systemy sterowania elektronicznego i światłowodowego, w których połączono funkcje co najmniej dwóch z wymienionych poniżej systemów w jeden zespół sterowania:

a. system sterowania skokiem ogólnym;

b. system sterowania skokiem okresowym łopat;

c. system kierowania odchyleniem kursowym;

2. "sterowane cyrkulacyjnie (opływowo) systemy kompensacji momentu lub sterowania kierunkiem lotu";

3. łopatki wirnika z 'profilami o zmiennej geometrii' opracowane do systemów umożliwiających niezależne sterowanie poszczególnymi łopatami.

Uwaga techniczna:

'Profile o zmiennej geometrii' oznaczają profile, w których zastosowano klapy lub inne płaszczyzny na krawędzi spływu lub sloty lub osadzone przegubowo noski na krawędzi natarcia, którymi można sterować w locie.

7E101 "Technologie" według uwagi ogólnej do technologii do "użytkowania" urządzeń wymienionych w pozycjach 7A001 do 7A006, 7A101 do 7A106, 7A115 do 7A117, 7B001, 7B002, 7B003, 7B102, 7B103, 7D101 do 7D103.

7E102 Następujące "technologie" do zabezpieczania podzespołów awioniki i elektrycznych przed impulsem elektromagnetycznym (EMP) i zagrożeniem zakłóceniami elektromagnetycznymi ze źródeł zewnętrznych:

a. "technologie" projektowania ekranowania;

b. "technologie" projektowania dla konfigurowania odpornych obwodów elektrycznych i podukładów;

c. "technologie" projektowania dla wyznaczania kryteriów uodporniania w odniesieniu do technologii wymienionych powyżej w pozycjach 7E102.a i 7E102.b.

7E104 "Technologie" scalania danych z systemów sterowania lotem, naprowadzania i napędu w system zarządzania lotem w celu optymalizacji toru lotu rakiet.

KATEGORIA 8 - URZĄDZENIA OKRĘTOWE

8A Systemy, urządzenia i części składowe

8A001 Następujące pływające jednostki podwodne lub nawodne:

N.B. Poziom kontroli urządzeń do pojazdów podwodnych określono w następujących pozycjach:

- kategoria 6 - w zakresie czujników,

- kategoria 7 i 8 - w zakresie urządzeń nawigacyjnych,

- kategoria 8.A - w zakresie urządzeń podwodnych.

a. załogowe pojazdy podwodne na uwięzi, zaprojektowane do działania na głębokościach większych niż 1 000 m;

b. załogowe, swobodne pojazdy podwodne spełniające którekolwiek z poniższych kryteriów:

1. zaprojektowane do 'autonomicznego działania' i posiadające nośność stanowiącą jednocześnie:

a. 10 % lub więcej ich wagi w powietrzu; oraz

b. 15 kN lub więcej;

2. zaprojektowane do działania na głębokościach większych niż 1 000 m; lub

3. spełniające wszystkie z poniższych kryteriów:

a. zaprojektowane do ciągłego 'autonomicznego działania' przez 10 lub więcej godzin; oraz

b. o 'zasięgu' 25 lub więcej mil morskich;

Uwagi techniczne:

1. Na potrzeby pozycji 8A001.b termin 'działanie autonomiczne' dotyczy działań prowadzonych przez pojazd podwodny (mający układ napędowy pracujący pod wodą lub nad wodą) w całkowitym zanurzeniu, bez chrap, przy wszystkich systemach pracujących i krążeniu z minimalną prędkością, przy której pojazd podwodny może bezpiecznie regulować dynamicznie głębokość zanurzenia za pomocą wyłącznie sterów głębokości, bez korzystania z pomocy nawodnej jednostki pływającej ani bazy nawodnej, na dnie lub brzegu morza.

2. Na potrzeby pozycji 8A001.b 'zasięg' oznacza połowę maksymalnego dystansu, w jakim pojazd podwodny może 'działać autonomicznie'.

c. bezzałogowe pojazdy podwodne na uwięzi zaprojektowane do działania na głębokościach większych niż 1 000 m i spełniające którekolwiek z poniższych kryteriów:

1. przeznaczenie do manewrowania z własnym napędem za pomocą silników napędowych lub silników odrzutowych objętych kontrolą według pozycji 8A002.a.2; lub

2. światłowodowe kanały przesyłania danych;

d. bezzałogowe, swobodne pojazdy podwodne spełniające którekolwiek z poniższych kryteriów:

1. możliwość decydowania o kursie względem dowolnego systemu geograficznego bez bieżącej (w czasie rzeczywistym) pomocy człowieka;

2. akustyczne kanały przesyłania danych lub poleceń; lub

3. dłuższe niż 1 000 m optyczne kanały przesyłania danych lub poleceń;

e. oceaniczne urządzenia ratownicze o nośności powyżej 5 MN przeznaczone do ratowania obiektów z głębokości większych niż 250 m i spełniające którekolwiek z poniższych kryteriów:

1. dynamiczne systemy ustalania położenia zdolne do utrzymania położenia z dokładnością do 20 m względem danego punktu za pomocą systemu nawigacyjnego; lub

2. systemy nawigacyjne działające względem dna morza i zintegrowane systemy nawigacyjne, przeznaczone do działania na głębokościach większych niż 1 000 m i umożliwiające utrzymywanie położenia względem danego punktu z "dokładnością" do 10 m;

f. nieużywane;

g. nieużywane;

h. nieużywane;

i. nieużywane.

8A002 Następujące systemy okrętowe, urządzenia i elementy składowe:

Uwaga: Podwodne instalacje telekomunikacyjne ujęto w kategorii 5 część 1 - Telekomunikacja.

a. następujące systemy, urządzenia i elementy składowe, specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do pojazdów podwodnych i przeznaczone do działania na głębokościach większych niż 1 000 m:

1. obudowy ciśnieniowe lub kadłuby sztywne o maksymalnej średnicy wewnętrznej komory powyżej 1,5 m;

2. silniki napędowe na prąd stały lub silniki odrzutowe;

3. kable startowe i łączniki do nich, na bazie włókien optycznych i zaopatrzone w syntetyczne elementy wzmacniające;

4. elementy wyprodukowane z materiałów wyszczególnionych w pozycji 8C001;

Uwaga techniczna:

Cel kontrolowania pozycji 8A002.a.4 nie powinien być omijany przez eksportowanie 'pianki syntaktycznej' wymienionej w pozycji 8C001 po zakończeniu pośredniego etapu produkcji, kiedy pianka ta nie ma jeszcze formy ostatecznego elementu składowego.

b. systemy specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do automatycznego sterowania ruchem urządzeń do pojazdów podwodnych objętych kontrolą według pozycji 8A001, korzystające z danych nawigacyjnych, wyposażone w serwomechanizmy sterujące ze sprzężeniem zwrotnym i umożliwiające pojazdowi którekolwiek z poniższych działań:

1. poruszanie się w słupie wody w zasięgu 10 m od ściśle określonego punktu;

2. utrzymanie położenia w słupie wody w zasięgu 10 m od określonego punktu; lub

3. utrzymanie położenia w zasięgu do 10 m od kabla leżącego na dnie lub znajdującego się pod dnem morza;

c. ciśnieniowe penetratory światłowodowe do kadłubów;

d. podwodne systemy wizyjne specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do zdalnego kierowania z pojazdu podwodnego, w których zastosowano techniki umożliwiające minimalizację zjawiska rozpraszania wstecznego i zawierające iluminatory o regulowanym zakresie lub systemy "laserowe";

e. nieużywane;

f. nieużywane;

g. następujące instalacje oświetleniowe specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania pod wodą:

1. stroboskopowe instalacje oświetleniowe o energii strumienia świetlnego powyżej 300 J na jeden błysk i o szybkości powtarzania większej niż 5 błysków na sekundę;

2. instalacje oświetleniowe, w których światło wytwarza łuk argonowy, specjalnie zaprojektowane do działania na głębokościach większych niż 1 000 m;

h. "roboty" specjalnie zaprojektowane do pracy pod wodą, zarządzane za pomocą dedykowanego komputera i spełniające którekolwiek z poniższych kryteriów:

1. wyposażenie w układy sterujące "robotem" dzięki informacjom z czujników mierzących siły lub momenty działające na obiekty zewnętrzne lub odległość do zewnętrznego obiektu, lub czujników dotykowych "robota" wyczuwających obiekt zewnętrzny; lub

2. możliwość działania z siłą 250 N lub większą lub momentem 250 Nm lub większym, i do których budowy zastosowano stopy na osnowie tytanowej lub "kompozytowe" "materiały włókniste lub włókienkowe";

i. zdalnie sterowane manipulatory przegubowe specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w pojazdach podwodnych i spełniające którekolwiek z poniższych kryteriów:

1. wyposażenie w układy sterujące ruchem manipulatora na podstawie informacji z czujników mierzących którekolwiek z poniższych:

a. moment lub siłę działającą na obiekt zewnętrzny; lub

b. dotyk manipulatora do obiektu zewnętrznego; lub

2. sterowanie na zasadzie proporcjonalnego odtwarzania ruchów operatora oraz posiadanie 5 lub więcej stopni 'swobody ruchu';

Uwaga techniczna:

Przy określaniu liczby stopni 'swobody ruchu' bierze się pod uwagę wyłącznie te funkcje, w których wykorzystywane jest proporcjonalne sterowanie ruchem z wykorzystaniem pozycyjnego sprzężenia zwrotnego.

j. następujące układy napędowe niezależne od dopływu powietrza, specjalnie zaprojektowane do działania pod wodą:

1. niezależne od powietrza systemy napędowe z silnikami pracującymi według obiegu Braytona (Joula) lub Rankina, wyposażone w jeden z wymienionych poniżej układów:

a. chemiczne układy oczyszczające lub absorpcyjne specjalnie zaprojektowane do usuwania dwutlenku węgla, tlenku węgla i cząstek stałych zawieszonych w gazie wydechowym z silnika pracującego w obiegu z recyrkulacją;

b. specjalne układy przystosowane do pracy na gazach jednoatomowych;

c. urządzenia lub obudowy specjalnie zaprojektowane do tłumienia pod wodą szumów o częstotliwościach poniżej 10 kHz, lub specjalne urządzenia mocujące, osłabiające skutki wstrząsów; lub

d. systemy spełniające wszystkie poniższe kryteria:

1. specjalnie zaprojektowane do prasowania produktów reakcji lub do regeneracji paliw;

2. specjalnie zaprojektowane do składowania produktów reakcji; oraz

3. specjalnie zaprojektowane do usuwania produktów reakcji w warunkach ciśnienia zewnętrznego 100 kPa lub większego;

2. niezależne od powietrza systemy napędowe z silnikami wysokoprężnymi (obieg Diesla) wyposażone we wszystkie z wymienionych poniżej układów:

a. chemiczne układy oczyszczające lub absorpcyjne specjalnie zaprojektowane do usuwania dwutlenku węgla, tlenku węgla i cząstek stałych zawieszonych w gazie wydechowym z silnika pracującego w obiegu z recyrkulacją;

b. specjalne układy przystosowane do pracy na gazach jednoatomowych;

c. urządzenia lub obudowy specjalnie zaprojektowane do tłumienia pod wodą szumów o częstotliwościach poniżej 10 kHz, lub specjalne urządzenia mocujące, osłabiające skutki wstrząsów; oraz

d. specjalne układy wydechowe o nieciągłym odprowadzaniu produktów spalania;

3. niezależne od powietrza układy energetyczne na "ogniwach paliwowych" o mocy powyżej 2 kW i wyposażone w którekolwiek z poniższych:

a. urządzenia lub obudowy specjalnie zaprojektowane do tłumienia pod wodą szumów o częstotliwościach poniżej 10 kHz, lub specjalne urządzenia mocujące, osłabiające skutki wstrząsów; lub

b. systemy spełniające wszystkie poniższe kryteria:

1. specjalnie zaprojektowane do prasowania produktów reakcji lub do regeneracji paliw;

2. specjalnie zaprojektowane do składowania produktów reakcji; oraz

3. specjalnie zaprojektowane do usuwania produktów reakcji w warunkach ciśnienia zewnętrznego 100 kPa lub większego;

4. niezależne od powietrza systemy napędowe z silnikami pracującymi według obiegu Stirlinga, wyposażone we wszystkie z poniższych układów:

a. urządzenia lub obudowy specjalnie zaprojektowane do tłumienia pod wodą szumów o częstotliwościach poniżej 10 kHz, lub specjalne urządzenia mocujące, osłabiające skutki wstrząsów; oraz

b. specjalne układy wydechowe do usuwania produktów spalania w warunkach ciśnienia zewnętrznego 100 kPa lub większego;

k. nieużywane;

l. nieużywane;

m. nieużywane;

n. nieużywane;

o. następujące pędniki, układy przenoszenia napędu, generatory mocy i układy tłumienia szumów:

1. nieużywane;

2. następujące pędniki śrubowe, generatory mocy lub układy przenoszenia napędu zaprojektowane dla jednostek pływających:

a. śruby napędowe o regulowanym skoku oraz zespoły piast do śrub o mocy nominalnej powyżej 30 MW;

b. elektryczne silniki napędowe z wewnętrznym chłodzeniem cieczowym o mocy wyjściowej powyżej 2,5 MW;

c. "nadprzewodnikowe" silniki napędowe lub elektryczne silniki napędowe z magnesami stałymi, o mocy wyjściowej powyżej 0,1 MW;

d. wałowe układy przeniesienia napędu składające się z elementów wykonanych z materiałów "kompozytowych" i zdolne do przenoszenia mocy powyżej 2 MW;

e. wentylowane lub podobne napędy śrubowe o mocy nominalnej powyżej 2,5 MW;

3. następujące układy tłumienia szumów, opracowane do użytkowania na jednostkach pływających o wyporności 1 000 ton lub wyższej:

a. układy tłumienia szumów podwodnych o częstotliwościach poniżej 500 Hz, składające się ze złożonych systemów montażowych służących do izolacji akustycznej silników wysokoprężnych, zespołów generatorów wysokoprężnych, turbin gazowych, zespołów generatorów gazowych, silników napędowych lub napędowych przekładni redukcyjnych, specjalnie zaprojektowane do tłumienia dźwięków lub wibracji i mające masę stanowiącą ponad 30 % masy urządzeń, na których mają być zamontowane;

b. 'aktywne układy tłumienia lub eliminacji szumów' lub łożyska magnetyczne, specjalnie zaprojektowane do układów przenoszenia napędu;

Uwaga techniczna:

'Aktywne układy tłumienia lub eliminacji szumów' są wyposażone w elektroniczne układy sterowania umożliwiające aktywne zmniejszanie wibracji urządzeń poprzez bezpośrednie generowanie do źródła dźwięków sygnałów tłumiących dźwięki i wibracje.

p. strugowodne układy napędowe spełniające wszystkie z poniższych kryteriów:

1. moc wyjściowa powyżej 2,5 MW; oraz

2. w których, w celu poprawy sprawności napędu lub zmniejszenia rozchodzącego się pod wodą wytworzonego dźwięku, pochodzącego z układu napędowego, zastosowano dysze rozbieżne oraz łopatki kierujące przepływem;

q. następujące niezależne aparaty do nurkowania i pływania podwodnego:

1. aparaty o zamkniętym obiegu;

2. aparaty o półzamkniętym obiegu;

Uwaga: Pozycja 8A002.q nie obejmuje kontrolą aparatów indywidualnych, kiedy towarzyszą one użytkownikowi do jego osobistego użytku.

N.B. W przypadku sprzętu i urządzeń zaprojektowanych specjalnie do zastosowań wojskowych zob. wykaz uzbrojenia.

r. akustyczne systemy odstraszania nurków specjalnie zaprojektowane lub zmodyfikowane, by zakłócać pracę nurków i posiadające poziom ciśnienia akustycznego równy lub przekraczający 190 dB (poziom odniesienia 1 μΡa na 1 m) na częstotliwościach 200 Hz i niższych.

Uwaga 1: Pozycja 8A002.r nie obejmuje kontrolą systemów odstraszania nurków opartych na podwodnych urządzeniach wybuchowych, pistoletach powietrznych lub źródłach spalania.

Uwaga 2: Pozycja 8A002.r obejmuje akustyczne systemy odstraszania nurków korzystające z iskierników, znane również jako plazmowe źródła dźwięku.

8B Urządzenia testujące, kontrolne i produkcyjne

8B001 Tunele wodne o szumie tła poniżej 100 dB (odpowiednik 1 μΡa, 1 Hz) w paśmie częstotliwości od 0 do 500 Hz przeznaczone do pomiaru pól akustycznych wytwarzanych przez przepływy cieczy wokół modeli układów napędowych.

8C Materiały

8C001 'Pianka syntaktyczna' (porowata) do użytku pod wodą spełniająca wszystkie poniższe kryteria:

N.B. Zob. również pozycja 8A002.a.4.

a. przeznaczenie do stosowania na głębokościach większych niż 1 000 m; oraz

b. gęstość poniżej 561 kg/m3;

Uwaga techniczna:

'Pianka syntaktyczna' składa się z pustych w środku kuleczek z tworzywa sztucznego lub szkła osadzonych w "matrycy" z żywicy.

8D Oprogramowanie

8D001 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane z przeznaczeniem do "rozwoju", "produkcji" lub "użytkowania" urządzeń lub materiałów objętych kontrolą według pozycji 8 A, 8B lub 8C;

8D002 "Oprogramowanie" specjalne, zaprojektowane lub zmodyfikowane z przeznaczeniem do "rozwoju", "produkcji", napraw, remontów lub modernizacji (ponownej obróbki skrawaniem) śrub, specjalnie w celu tłumienia generowanych przez nie pod wodą szumów.

8E Technologia

8E001 "Technologia", zgodnie z uwagą ogólną do technologii, służąca do "rozwoju" lub "produkcji" sprzętu lub materiałów wyszczególnionych w pozycji 8 A, 8B lub 8C.

8E002 Inne "technologie", takie jak:

a. "technologie" do "rozwoju", "produkcji", napraw, remontów lub modernizacji (ponownej obróbki skrawaniem) śrub, specjalnie skonstruowanych w celu tłumienia generowanych przez nie pod wodą szumów.

b. "technologie" do remontów lub modernizacji urządzeń objętych kontrolą według pozycji 8A001 lub 8A002.b, 8A002.j, 8A002.o lub 8A002.p;

c. "technologia" stosownie do uwagi ogólnej do technologii w odniesieniu do "rozwoju" lub "produkcji" któregokolwiek z poniższych:

1. pojazdy na poduszce powietrznej (odmiana z pełnym fartuchem bocznym) spełniające wszystkie poniższe kryteria:

a. maksymalną prędkość projektową z pełnym obciążeniem przekraczającą 30 węzłów przy falach o wysokości 1,25 m lub wyższej;

b. ciśnienie powietrza w poduszce powyżej 3 830 Pa; oraz

c. stosunek masy pustej jednostki pływającej do całkowicie obciążonej poniżej 0,70;

2. pojazdy na poduszce powietrznej (odmiana ze sztywnymi burtami) o maksymalnej prędkości obliczeniowej z pełnym obciążeniem powyżej 40 węzłów przy falach o wysokości 3,25 m lub większej;

3. wodoloty wyposażone w aktywne systemy automatycznego sterowania położeniem płatów nośnych, o maksymalnej prędkości obliczeniowej z pełnym obciążeniem równej lub wyższej od 40 węzłów przy falach o wysokości 3,25 m lub większej; lub

4. 'jednostki pływające o małym polu przekroju wodnicowego' spełniające którekolwiek z poniższych kryteriów:

a. wyporność z pełnym obciążeniem powyżej 500 ton i maksymalna prędkość obliczeniową z pełnym obciążeniem powyżej 35 węzłów przy falach o wysokości 3,25 m lub większej; lub

b. wyporność z pełnym obciążeniem powyżej 1 500 ton i maksymalna prędkość obliczeniową z pełnym obciążeniem powyżej 25 węzłów przy falach o wysokości 4 m lub większej;

Uwaga techniczna:

'Jednostkę pływającą o małym polu przekroju wodnicowego' definiuje się według następującego wzoru: pole przekroju wodnicowego przy konstrukcyjnym zanurzeniu eksploatacyjnym mniejsze od 2 × (wyparta objętość przy konstrukcyjnym zanurzeniu eksploatacyjnym) 2/3.

KATEGORIA 9 - KOSMONAUTYKA, AERONAUTYKA I NAPĘD

9A Systemy, urządzenia i części składowe

N.B. Dla układów napędowych specjalnie zaprojektowanych lub zabezpieczonych przed promieniowaniem neutronowym lub przenikliwym promieniowaniem jonizującym zob. także wykaz uzbrojenia.

9A001 Następujące lotnicze silniki turbinowe spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJA 9A101.

a. silniki, w których zastosowano jedną z technologii objętych kontrolą według pozycji 9E003.a lub 9E003.h, lub 9E003.i; lub

Uwaga 1: Pozycja 9A001.a nie obejmuje kontrolą silników turbinowych spełniających wszystkie poniższe kryteria:

a. są certyfikowane przez organy lotnictwa cywilnego co najmniej jednego państwa członkowskiego UE lub państwa uczestniczącego w porozumieniu z Wassenaar; oraz

b. przeznaczenie do napędzania niewojskowych załogowych "statków powietrznych", dla których organy lotnictwa cywilnego co najmniej jednego państwa członkowskiego UE lub państwa uczestniczącego w porozumieniu z Wassenaar wydały którykolwiek z następujących dokumentów, odnoszących się do "statku powietrznego" wyposażonego w silnik tego właśnie typu:

1. certyfikat zezwalający na zastosowanie cywilne; lub

2. równoważny dokument uznawany przez Międzynarodową Organizację Lotnictwa Cywilnego (ICAO);

Uwaga 2: Pozycja 9A001.a. nie obejmuje kontrolą lotniczych silników turbinowych zaprojektowanych do pomocniczych jednostek mocy zatwierdzonych przez organy lotnictwa cywilnego co najmniej jednego państwa członkowskiego UE lub państwa uczestniczącego w porozumieniu z Wassenaar.

b. silniki zaprojektowane do napędzania "statków powietrznych" do lotów z prędkościami 1 Ma lub większymi przez ponad trzydzieści minut.

9A002 'Turbinowe silniki okrętowe' zaprojektowane do wykorzystywania paliwa ciekłego i spełniające wszystkie poniższe kryteria, oraz specjalnie do nich zaprojektowane zespoły i elementy:

a. maksymalna moc ciągła robocza w "trybie stanu ustalonego" w standardowych warunkach odniesienia określonych przez ISO 3977-2:1997 (lub jego krajowy odpowiednik) wynosząca 24 245 kW lub więcej; oraz

b. 'skorygowane jednostkowe zużycie paliwa' nieprzekraczające 0,219 kg/kWh przy 35 % maksymalnej mocy ciągłej i wykorzystaniu paliwa ciekłego.

Uwaga: Termin 'turbinowe silniki okrętowe' obejmuje również turbinowe silniki przemysłowe lub lotnicze, przystosowane do napędzania jednostek pływających lub wytwarzania energii elektrycznej na jednostkach pływających.

Uwaga techniczna:

Do celów pozycji 9A002 'skorygowane jednostkowe zużycie paliwa' oznacza jednostkowe zużycie paliwa przez silnik skorygowane do żeglugowego destylowanego paliwa ciekłego o wartości opałowej 42MJ/kg (ISO 3977-2:1997).

9A003 Następujące specjalne zespoły lub elementy, w których zastosowano jedną z technologii objętych kontrolą według pozycji 9E003.a, 9E003.h lub 9E003.i, przeznaczone do którychkolwiek z poniższych lotniczych silników turbinowych:

a. wyszczególnione w pozycji 9A001; lub

b. skonstruowane lub wyprodukowane w państwach innych niż państwa członkowskie UE lub państwa uczestniczące w porozumieniu z Wassenaar lub w państwie nieznanym producentowi.

9A004 Następujące kosmiczne pojazdy nośne, "statek kosmiczny", "moduły ładunkowe statku kosmicznego", "ładunki użyteczne statku kosmicznego", systemy pokładowe lub wyposażenie "statku kosmicznego", a także wyposażenie naziemne:

N.B. ZOB. TAKŻE POZYCJA 9A104.

a. kosmiczne pojazdy nośne;

b. "statek kosmiczny";

c. "moduły ładunkowe statku kosmicznego";

d. "ładunki użyteczne statku kosmicznego" obejmujące elementy określone w pozycjach 3A001.b.1.a.4., 3A002.g., 5A001.a.1., 5A001.b.3., 5A002.c., 5A002.e., 6A002.a.1., 6A002.a.2., 6A002.b., 6A002.d., 6A003.b., 6A004.c., 6A004.e., 6A008.d., 6A008.e., 6A008.k., 6A008.l. lub 9A010.c.;

e. systemy pokładowe lub wyposażenie specjalnie zaprojektowane do "statku kosmicznego" i posiadające którąkolwiek z następujących funkcji:

1. 'obsługa danych sterowania i telemetrii';

Uwaga: Do celów pozycji 9A004.e.1. 'obsługa danych sterowania i telemetrii' obejmuje zarządzanie, przechowywanie i przetwarzanie danych modułu ładunkowego.

2. 'obsługa danych ładunku użytecznego'; lub

Uwaga: Do celów pozycji 9A004.e.2. 'obsługa danych ładunku użytecznego' obejmuje zarządzanie, przechowywanie i przetwarzanie danych ładunku użytecznego.

3. 'sterowanie położeniem i kierunkiem orbitowania';

Uwaga: Do celów pozycji 9A004.e.3. 'sterowanie położeniem i kierunkiem orbitowania' obejmuje wykrywanie i wzbudzanie w celu określenia położenia i kierunku "statku kosmicznego" oraz sterowania nimi.

N.B. W przypadku urządzeń zaprojektowanych specjalnie do zastosowań wojskowych zob. wykaz uzbrojenia.

f. następujące wyposażenie naziemne, specjalnie zaprojektowane do "statku kosmicznego":

1. wyposażenie telemetryczne i do zdalnego sterowania specjalnie zaprojektowane do następujących funkcji przetwarzania danych:

a. telemetryczne przetwarzanie danych synchronizacji ramowej i korekty błędów do monitorowania statusu operacyjnego (zwanego też statusem zdrowia i bezpieczeństwa) "modułu ładunkowego statku kosmicznego"; lub

b. przetwarzanie danych sterowania do formatowania danych sterowania wysyłanych do "statku kosmicznego" do celów kontroli "modułu ładunkowego statku kosmicznego";

2. symulatory specjalnie zaprojektowane do 'weryfikacji procedur operacyjnych' "statku kosmicznego";

Uwaga techniczna:

Do celów pozycji 9A004.f.2. 'weryfikacja procedur operacyjnych' oznacza którekolwiek z poniższych:

1. potwierdzenie sekwencji sterowania;

2. szkolenie operacyjne;

3. ćwiczenia operacyjne; lub

4. analizę operacyjną.

9A005 Rakietowe systemy napędowe na paliwo ciekłe zawierające jeden z systemów lub elementów wyszczególnionych w pozycji 9A006.

N.B. ZOB. TAKŻE POZYCJE 9A105 I 9A119.

9A006 Następujące systemy lub elementy specjalnie zaprojektowane do rakietowych układów napędowych na paliwo ciekłe:

N.B. ZOB. TAKŻE POZYCJE 9A106, 9A108 I 9A120.

a. chłodziarki kriogeniczne, pokładowe pojemniki Dewara, kriogeniczne instalacje grzewcze lub urządzenia kriogeniczne specjalnie zaprojektowane do pojazdów kosmicznych, umożliwiające ograniczenie strat cieczy kriogenicznych do poziomu poniżej 30 % rocznie;

b. pojemniki kriogeniczne lub pracujące w obiegu zamkniętym układy chłodzenia umożliwiające utrzymanie temperatur na poziomie 100 K (- 173 °C) lub mniejszym, przeznaczone do "statków powietrznych" zdolnych do rozwijania prędkości powyżej Ma = 3, do rakiet nośnych lub "statków kosmicznych";

c. urządzenia do przechowywania lub transportu wodoru w formie mieszaniny fazy ciekłej ze stałą (zawiesiny);

d. wysokociśnieniowe (powyżej 17,5 MPa) pompy turbinowe, ich elementy lub towarzyszące im gazowe lub pracujące w cyklu rozprężnym napędy turbinowe;

e. wysokociśnieniowe (powyżej 10,6 MPa) komory ciągu silników rakietowych i dysze do nich;

f. urządzenia do przechowywania paliw napędowych na zasadzie kapilarnej lub wydmuchowej (tj. z elastycznymi przeponami);

g. wtryskiwacze ciekłych paliw napędowych, w których średnice pojedynczych otworków nie przekraczają 0,381 mm (pole powierzchni 1,14 × 10-3 cm2 lub mniejsze dla otworków niekolistych) i które są specjalnie zaprojektowane do silników rakietowych na paliwo ciekłe;

h. wykonane z jednego elementu materiału typu węgiel-węgiel komory ciągu lub wykonane z jednego elementu materiału typu węgiel-węgiel stożki wylotowe, których gęstości przekraczają 1,4 g/cm3, a wytrzymałości na rozciąganie są większe niż 48 MPa.

9A007 Systemy napędowe rakiet na paliwo stałe spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJE 9A107 I 9A119.

a. impuls całkowity powyżej 1,1 MNs;

b. impuls właściwy 2,4 kNs/kg lub większy w sytuacji wypływu z dyszy do otoczenia w warunkach istniejących na poziomie morza przy ciśnieniu w komorze wyregulowanym na poziomie 7 MPa;

c. udział masowy stopnia powyżej 88 % i procentowy udział składników stałych w paliwie powyżej 86 %;

d. posiadające elementy objęte kontrolą według pozycji 9A008; lub

e. wyposażone w układy izolacyjne i wiążące paliwo, w których zastosowano bezpośrednio połączone konstrukcje silnikowe zapewniające 'silne połączenia mechaniczne' lub elementy barierowe uniemożliwiające migrację chemiczną pomiędzy paliwem stałym a stanowiącym osłonę materiałem izolacyjnym.

Uwaga techniczna:

'Silne połączenie mechaniczne' oznacza wytrzymałość wiązania równą lub większą niż wytrzymałość paliwa.

9A008 Następujące elementy specjalnie zaprojektowane do rakietowych układów napędowych na paliwo stałe:

N.B. ZOB. TAKŻE POZYCJA 9A108.

a. układy izolacyjne i wiążące paliwo, w których zastosowano wykładziny zapewniające 'silne połączenia mechaniczne' lub elementy barierowe uniemożliwiające migrację chemiczną pomiędzy paliwem stałym a stanowiącym osłonę materiałem izolacyjnym;

Uwaga techniczna:

'Silne połączenie mechaniczne' oznacza wytrzymałość wiązania równą lub większą niż wytrzymałość paliwa.

b. wykonane z włókien nawojowych "kompozytowe" osłony silników o średnicy powyżej 0,61 m lub o 'wskaźnikach efektywności strukturalnej (PV/W)' powyżej 25 km;

Uwaga techniczna:

'Wskaźnik efektywności strukturalnej (PV/W)' jest iloczynem ciśnienia wybuchu (P) i pojemności zbiornika (V) podzielonym przez całkowitą wagę zbiornika ciśnieniowego (W).

c. dysze o ciągach powyżej 45 kN lub szybkości erozyjnego zużycia gardzieli poniżej 0,075 mm/s;

d. dysze ruchome lub systemy sterowania wektorem ciągu za pomocą pomocniczego wtrysku płynów o którychkolwiek z następujących parametrach:

1. ruch okrężny z odchyleniem kątowym powyżej ± 5°;

2. kątowy obrót wektora ciągu rzędu 20°/s lub więcej; lub

3. przyspieszenia kątowe wektora ciągu rzędu 40°/s2 lub większe.

9A009 Hybrydowe systemy napędowe rakiet spełniające którekolwiek z poniższych kryteriów:

N.B. ZOB. TAKŻE POZYCJE 9A109 I 9A119.

a. impuls całkowity powyżej 1,1 MNs; lub

b. ciąg powyżej 220 kN w warunkach próżni na wylocie.

9A010 Następujące specjalnie opracowane elementy, systemy lub struktury do rakiet nośnych lub systemów napędowych do rakiet nośnych lub "statków kosmicznych":

N.B. ZOB. TAKŻE POZYCJE 1A002 I 9A110.

a. elementy i konstrukcje, każda o masie przekraczającej 10 kg, specjalnie zaprojektowane do pojazdów nośnych, wyprodukowane przy użyciu któregokolwiek z następujących materiałów:

1. materiałów "kompozytowych" składających się z "materiałów włóknistych lub włókienkowych" określonych w pozycji 1C010.e. oraz żywic określonych w pozycji 1C008 lub 1C009.b.;

2. "materiałów kompozytowych" na "matrycy" metalowej wzmocnionych którymkolwiek z poniższych materiałów:

a. materiałami określonymi w pozycji 1C007;

b. "materiałami włóknistymi lub włókienkowymi" określonymi w pozycji 1C010; lub

c. glinkami określonymi w pozycji 1C002.a.; lub

3. "materiałów kompozytowych" na "matrycy" ceramicznej określonych w pozycji 1C007;

Uwaga: Podany limit masy nie dotyczy ochronnych stożków czołowych rakiet.

b. elementy i konstrukcje specjalnie zaprojektowane do układów napędowych pojazdów nośnych określonych w pozycjach od 9A005 do 9A009, wyprodukowane przy użyciu któregokolwiek z następujących materiałów:

1. "materiałów włóknistych lub włókienkowych" określonych w pozycji 1C010.e. oraz żywic określonych w pozycji 1C008 lub 1C009.b.;

2. "materiałów kompozytowych" na "matrycy" metalowej wzmocnionych którymkolwiek z poniższych materiałów:

a. materiałami określonymi w pozycji 1C007;

b. "materiałami włóknistymi lub włókienkowymi" określonymi w pozycji 1C010; lub

c. glinkami określonymi w pozycji 1C002.a.; lub

3. "materiałów kompozytowych" na "matrycy" ceramicznej określonych w pozycji 1C007;

c. części struktur i systemy izolacyjne specjalnie zaprojektowane w celu aktywnej kontroli odpowiedzi dynamicznej lub odkształceń struktur "statków kosmicznych";

d. pulsacyjne silniki rakietowe na paliwo ciekłe mające stosunek ciągu do masy równy lub większy niż 1 kN/kg i czas odpowiedzi (czas niezbędny do osiągnięcia 90 % całkowitego ciągu znamionowego od chwili rozruchu) mniejszy niż 30 ms.

9A011 Silniki strumieniowe, naddźwiękowe silniki strumieniowe lub silniki o cyklu kombinowanym oraz specjalnie do nich zaprojektowane elementy.

N.B. ZOB. TAKŻE POZYCJE 9A111 I 9A118.

9A012 Następujące "bezzałogowe statki powietrzne" ("UAV"), bezzałogowe "pojazdy powietrzne" związane z nimi sprzęt i komponenty:

N.B. ZOB. TAKŻE POZYCJA 9A112.

a. "UAV" lub bezzałogowe "pojazdy powietrzne" zaprojektowane tak, by możliwy był ich kontrolowany lot poza zasięgiem 'bezpośredniego widzenia' 'operatora' i spełniające którekolwiek z poniższych kryteriów:

1. spełniające wszystkie z poniższych kryteriów:

a. których maksymalna 'wytrzymałość' wynosi co najmniej 30 minut, lecz poniżej 1 godziny; oraz

b. zaprojektowane do startowania i utrzymywania stabilnego kontrolowanego lotu w porywach wiatru wynoszących co najmniej 46,3 km/h (25 węzłów); lub

2. których 'wytrzymałość' wynosi co najmniej 1 godzinę;

Uwagi techniczne:

1. Do celów pozycji 9A012.a. 'operatorem' jest osoba, która rozpoczyna lot "UAV" lub bezzałogowego "pojazdu powietrznego" lub steruje nim.

2. Do celów pozycji 9A012.a. 'wytrzymałość' należy obliczać dla warunków ISA (ISO 2533:1975) na poziomie morza przy zerowym wietrze.

3. Do celów pozycji 9A012.a. 'bezpośrednie widzenie' oznacza wzrok człowieka nieużywającego dodatkowych urządzeń, bez względu na to, czy używa soczewek korekcyjnych.

b. powiązane urządzenia i elementy składowe:

1. nieużywane;

2. nieużywane;

3. sprzęt lub elementy specjalnie zaprojektowane do przekształcania załogowego "statku powietrznego" lub załogowego "pojazdu powietrznego" w "UAV" lub bezzałogowy "pojazd powietrzny", wyszczególnione w pozycji 9A012.a;

4. tłokowe lub obrotowe silniki wewnętrznego spalania, które potrzebują powietrza do spalania, specjalnie zaprojektowane lub zmodyfikowane po to, by wynosić "UAV" lub bezzałogowe "pojazdy powietrzne" na wysokość większą niż 15 240 m (50 000 stóp).

9A101 Następujące silniki turboodrzutowe i turbowentylatorowe, inne niż wyszczególnione w pozycji 9A001:

a. silniki spełniające wszystkie poniższe kryteria:

1. 'wartość ciągu maksymalnego' powyżej 400 N (uzyskiwana przed zamontowaniem) z wyłączeniem silników certyfikowanych przez instytucje cywilne, mających 'wartość ciągu maksymalnego' powyżej 8 890 N (uzyskiwaną przed zamontowaniem silnika); oraz

2. jednostkowe zużycie paliwa 0,15 kg N-1 hr-1 lub mniejsze (przy maksymalnej mocy ciągłej na poziomie morza w warunkach statycznych i w standardowej atmosferze określonej przez ICAO);

3. 'sucha masa' mniejsza niż 750 kg; oraz

4. 'średnica wirnika pierwszego stopnia' mniejsza niż 1 m;

Uwagi techniczne:

1. Do celów pozycji 9A101.a.1. 'wartość ciągu maksymalnego' oznacza wykazany przez producenta maksymalny ciąg dla danego typu silnika przed zamontowaniem na poziomie morza w warunkach statycznych i w standardowej atmosferze określonej przez ICAO. Wartość ciągu certyfikowana dla zastosowań cywilnych będzie równa lub niższa niż wykazany przez producenta maksymalny ciąg dla danego typu silnika.

2. 'Sucha masa' oznacza masę silnika bez płynów (paliwa, cieczy hydraulicznej, oleju itp.) i nie obejmuje gondoli (obudowy).

3. 'Średnica wirnika pierwszego stopnia' oznacza średnicę pierwszego wirującego stopnia silnika, nawet wentylatora lub sprężarki, mierzoną na czołowej krawędzi końcówki łopatki.

b. silniki zaprojektowane do "pocisków rakietowych" lub zmodyfikowane w tym celu lub "bezzałogowe statki powietrzne" wyszczególnione w pozycji 9A012 lub 9A112.a.

9A102 'Systemy silników turbośmigłowych' specjalnie zaprojektowane do "bezzałogowych statków powietrznych" wyszczególnionych w pozycji 9A012 lub 9A112.a oraz specjalnie do nich zaprojektowane elementy o 'mocy maksymalnej' powyżej 10 kW.

Uwaga: Pozycja 9A102 nie obejmuje kontrolą silników certyfikowanych przez instytucje cywilne.

Uwagi techniczne:

1. Do celów pozycji 9A102 'system silników turbośmigłowych' obejmuje wszystkie poniższe elementy:

a. silnik turbowałowy; oraz

b. układy przenoszenia napędu służące do przenoszenia mocy na śmigło.

2. Do celów pozycji 9A102 'moc maksymalna' dla silnika niezainstalowanego osiągana jest na poziomie morza w warunkach statycznych i w standardowej atmosferze określonej przez ICAO.

9A104 Rakiety meteorologiczne (sondujące) o zasięgu co najmniej 300 km.

N.B. ZOB. TAKŻE POZYCJA 9A004.

9A105 Następujące silniki rakietowe na paliwo ciekłe lub silniki rakietowe na żelowe paliwa napędowe:

N.B. ZOB. TAKŻE POZYCJA 9A119.

a. silniki rakietowe na paliwo ciekłe lub silniki rakietowe na żelowe paliwa napędowe nadające się do "pocisków rakietowych", różne od wymienionych w pozycji 9A005 zintegrowane lub zaprojektowane lub zmodyfikowane w celu zintegrowania w układach napędowych na paliwo ciekłe lub paliwo żelowe mające impuls całkowity równy lub większy niż 1,1 MNs;

b. silniki rakietowe na paliwo ciekłe lub silniki rakietowe na żelowe paliwa napędowe nadające się do kompletnych systemów rakietowych lub bezzałogowych statków powietrznych o zasięgu co najmniej 300 km, różne od wymienionych w pozycji 9A005 lub 9A105.a zintegrowane lub zaprojektowane lub zmodyfikowane w celu zintegrowania w układach napędowych na paliwo ciekłe lub paliwo żelowe mające impuls całkowity równy lub większy niż 0,841 MNs.

9A106 Następujące systemy lub części składowe, inne niż wyszczególnione w pozycji 9A006, specjalnie zaprojektowane do układów napędowych rakiet na paliwo ciekłe lub na żelowe paliwa napędowe:

a. nieużywane;

b. osłony do silników rakietowych i ich części składowe służące do izolacji oraz dysze, nadające się do podsystemów napędowych do rakiet wyszczególnionych w pozycji 9A007 lub 9A107;

c. podzespoły do sterowania wektorem ciągu, nadające się do stosowania w "pociskach rakietowych";

Uwaga techniczna:

Do sposobów sterowania wektorem ciągu wyszczególnionych w pozycji 9A106.c należą np.:

1. dysza regulowana;

2. dodatkowy wtrysk cieczy lub gazu;

3. ruchoma komora silnika lub dysza wylotowa;

4. odchylanie strumienia gazów wylotowych za pomocą łopatek kierowniczych (nastawnych) lub systemów wtryskiwaczy; lub

5. używanie klapek oporowych.

d. zespoły do sterowania przepływem płynnych, zawiesinowych i żelowych paliw napędowych (w tym utleniaczy) oraz specjalnie zaprojektowane do nich elementy nadające się do stosowania w "pociskach rakietowych", skonstruowane lub zmodyfikowane pod kątem eksploatacji w środowiskach, w których występują drgania o średniej wartości kwadratowej większej niż 10 g i o częstotliwości od 20 Hz do 2 kHz.

Uwaga: Jedynymi objętymi kontrolą w pozycji 9A106.d serwozaworami, pompami i turbinami gazowymi są:

a. serwozawory o objętościowym natężeniu przepływu równym lub większym niż 24 litrów na minutę przy ciśnieniu absolutnym równym lub większym niż 7 MPa i czasie reakcji roboczej poniżej 100 ms;

b. pompy do paliw płynnych o prędkościach obrotowych na wale 8 000 lub więcej obrotów na minutę w maksymalnym trybie pracy lub o ciśnieniu wylotowym równym lub większym niż 7 MPa;

c. turbiny gazowe do pomp turbinowych do paliw płynnych o prędkościach obrotowych na wale 8 000 lub więcej obrotów na minutę w maksymalnym trybie pracy;

e. komory spalania i dysze do silników rakietowych na paliwo ciekłe lub silników rakietowych na żelowe paliwa napędowe wyszczególnionych w pozycji 9A005 lub 9A105.

9A107 Silniki rakietowe na paliwo stałe nadające się do kompletnych systemów rakietowych lub bezzałogowych statków powietrznych o zasięgu co najmniej 300 km, inne niż wyszczególnione w pozycji 9A007 i mające impuls całkowity równy lub większy niż 0,841 MNs.

N.B. ZOB. TAKŻE POZYCJA 9A119.

9A108 Następujące podzespoły, inne niż wyszczególnione w pozycji 9A008 specjalnie zaprojektowane do układów napędowych do rakiet na paliwo stałe:

a. osłony do silników rakietowych i ich części składowe służące do "izolacji", nadające się do podsystemów wyszczególnionych w pozycji 9A007 lub 9A107;

b. dysze do silników rakietowych, nadające się do podsystemów wyszczególnionych w pozycji 9A007 lub 9A107;

c. podzespoły do sterowania wektorem ciągu, nadające się do stosowania w "pociskach rakietowych";

Uwaga techniczna:

Do sposobów sterowania wektorem ciągu wyszczególnionych w pozycji 9A108.c należą np.:

1. dysza regulowana;

2. dodatkowy wtrysk cieczy lub gazu;

3. ruchoma komora silnika lub dysza wylotowa;

4. odchylanie strumienia gazów wylotowych za pomocą łopatek kierowniczych (nastawnych) lub systemów wtryskiwaczy; lub

5. używanie klapek oporowych.

9A109 Następujące hybrydowe silniki rakietowe oraz specjalnie do nich zaprojektowane elementy:

a. hybrydowe silniki rakietowe nadające się do wykorzystania w kompletnych systemach rakietowych lub systemach bezzałogowych statków powietrznych o zasięgu co najmniej 300 km, inne niż wyszczególnione w pozycji 9A009, mające impuls całkowity równy lub większy niż 0,841 MNs, oraz specjalnie do nich zaprojektowane elementy;

b. specjalnie zaprojektowane elementy składowe hybrydowych silników rakietowych wyszczególnione w pozycji 9A009 nadające się do "pocisków rakietowych".

N.B. ZOB. TAKŻE POZYCJE 9A009 I 9A119.

9A110 Materiały kompozytowe, laminaty i wyroby z nich, inne niż wyszczególnione w pozycji 9A010, specjalnie zaprojektowane do 'pocisków rakietowych' lub podsystemów wymienionych w pozycjach 9A005, 9A007, 9A105, 9A106.c, 9A107, 9A108.c, 9A116 lub 9A119.

N.B. ZOB. TAKŻE POZYCJA 1A002.

Uwaga techniczna:

W pozycji 9A110 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

9A111 Pulsacyjne silniki odrzutowe nadające się do "pocisków rakietowych" lub bezzałogowych statków powietrznych wyszczególnionych w pozycji 9A012 lub 9A112.a. oraz specjalnie do nich zaprojektowane podzespoły.

N.B. ZOB. TAKŻE POZYCJE 9A011 I 9A118.

9A112 Następujące "bezzałogowe statki powietrzne" ("UAV"), inne niż określone w pozycji 9A012:

a. "bezzałogowe statki powietrzne" ("UAV") o zasięgu co najmniej 300 km;

b. "bezzałogowe statki powietrzne" ("UAV"), spełniające wszystkie z poniższych kryteriów:

1. spełniające którekolwiek z poniższych kryteriów:

a. posiadające zdolność autonomicznego kontrolowania lotu i prowadzenia nawigacji; lub

b. posiadające zdolność kontrolowanego lotu poza zasięgiem bezpośredniego widzenia z udziałem operatora; oraz

2. spełniające którekolwiek z poniższych kryteriów:

a. z systemem/mechanizmem dozowania aerozolu o pojemności powyżej 20 l; lub

b. zaprojektowanie lub zmodyfikowane w taki sposób, by zawierały system/mechanizm dozowania aerozolu o pojemności powyżej 20 l.;

Uwagi techniczne:

1. Aerozol składa się z pyłu lub cieczy niebędących składnikami paliwa, produktami ubocznymi lub dodatkami, stanowiąc część "ładunku użytecznego" rozpraszanego do atmosfery. Przykładowymi aerozolami są pestycydy do opylania roślin oraz suche środki chemiczne rozpylane w chmurach w celu wywołania deszczu.

2. System/mechanizm dozowania aerozolu zawiera wszystkie urządzenia (mechaniczne, elektryczne, hydrauliczne itp.), które są niezbędne do magazynowania aerozolu i rozproszenia go w atmosferze. Obejmuje możliwość wstrzyknięcia aerozolu do gazów wydechowych i strumienia zaśmigłowego.

9A115 Następujące urządzenia do wspierania procedury startowej:

a. aparatura i urządzenia do manipulacji, sterowania, uruchamiania lub odpalania, zaprojektowane lub zmodyfikowane do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004, rakietach meteorologicznych wyszczególnionych w pozycji 9A104 lub w 'pociskach rakietowych';

Uwaga techniczna:

W pozycji 9A115.a 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

b. pojazdy do transportu, manipulacji, sterowania, uruchamiania i odpalania, zaprojektowane lub zmodyfikowane z przeznaczeniem do stosowania w kosmicznych pojazdach nośnych wyszczególnionych w pozycji 9A004, w rakietach meteorologicznych wyszczególnionych w pozycji 9A104 lub w 'pociskach rakietowych'.

9A116 Następujące statki kosmiczne zdolne do lądowania na ziemi nadające się do "pocisków rakietowych" oraz zaprojektowane lub zmodyfikowane z przeznaczeniem do nich podzespoły:

a. statki kosmiczne zdolne do lądowania na ziemi;

b. osłony ciepłochronne i elementy do nich wykonane z materiałów ceramicznych lub ablacyjnych;

c. urządzenia pochłaniające ciepło i elementy do nich wykonane z lekkich materiałów o wysokiej pojemności cieplnej;

d. urządzenia elektroniczne specjalnie zaprojektowane do statków kosmicznych zdolnych do lądowania na ziemi.

9A117 Mechanizmy do łączenia stopni, mechanizmy do rozłączania stopni oraz mechanizmy międzystopniowe, nadające się do wykorzystania w "pociskach rakietowych".

N.B. ZOB. TAKŻE POZYCJA 9A121.

9A118 Urządzenia do regulacji spalania w silnikach, nadające się do "pocisków rakietowych" lub bezzałogowych statków powietrznych wyszczególnionych w pozycji 9A012 lub 9A112.a., wymienionych w pozycjach 9A011 lub 9A111.

9A119 Pojedyncze stopnie do rakiet, nadające się do kompletnych systemów rakietowych lub bezzałogowych statków powietrznych o zasięgu co najmniej 300 km, inne niż wymienione w pozycjach 9A005, 9A007, 9A009, 9A105, 9A107 i 9A109.

9A120 Zbiorniki na paliwo ciekłe lub żelowe paliwa napędowe, poza wyszczególnionymi w pozycji 9A006, specjalnie zaprojektowane na paliwa wyszczególnione w pozycji 1C111 lub 'inne paliwa ciekłe lub żelowe paliwa napędowe', stosowane w systemach rakietowych o ładunku użytkowym co najmniej 500 kg i zasięgu co najmniej 300 km.

Uwaga: W pozycji 9A120 'inne paliwa ciekłe lub żelowe paliwa napędowe' obejmują paliwa wymienione w wykazie uzbrojenia, ale nie ograniczają się do nich.

9A121 Startowe i międzystopniowe łączniki elektryczne specjalnie przeznaczone do "pocisków rakietowych", pojazdów kosmicznych wyszczególnionych w pozycji 9A004 lub do rakiet meteorologicznych (sondujących) wyszczególnionych w poz. 9A104.

Uwaga techniczna:

Łączniki międzystopniowe, o których mowa w pozycji 9A121, obejmują również łączniki elektryczne zamontowane między "pociskiem rakietowym", pojazdem kosmicznym lub rakietą meteorologiczną a ich ładunkiem użytecznym.

9A350 Układy zraszania lub mgławienia, specjalnie zaprojektowane lub zmodyfikowane w taki sposób, aby nadawały się do samolotów i "pojazdów lżejszych od powietrza" lub bezzałogowych statków powietrznych, oraz specjalnie zaprojektowane ich komponenty, jak następuje:

a. kompletne układy zraszania lub mgławienia mogące zapewniać, z ciekłej zawiesiny, początkową kroplę o 'VMD' poniżej 50 μm przy natężeniu przepływu powyżej dwóch litrów na minutę;

b. rury rozdzielcze z rozpylaczami lub układy jednostek generujących aerozol mogące zapewniać, z ciekłej zawiesiny, początkową kroplę o 'VMD' poniżej 50 μm przy natężeniu przepływu powyżej dwóch litrów na minutę;

c. jednostki generujące aerozol specjalnie zaprojektowane w taki sposób, aby nadawały się do układów określonych w pozycji 9A350.a i b.

Uwaga: Jednostki generujące aerozol są urządzeniami specjalnie zaprojektowanymi lub zmodyfikowanymi w taki sposób, aby nadawały się do samolotów, takimi jak: dysze, rozpylacze bębnowe obrotowe i podobne urządzenia.

Uwaga: Pozycja 9A350 nie obejmuje kontrolą układów zraszania lub mgławienia oraz elementów, w przypadku których wykazano, że nie nadają się do przenoszenia środków biologicznych w postaci zakaźnych aerozoli.

Uwagi techniczne:

1. Wielkość kropli w przypadku urządzeń zraszających lub dysz specjalnie zaprojektowanych do stosowania w samolotach, "pojazdach lżejszych od powietrza" lub bezzałogowych statkach powietrznych powinna być mierzona z zastosowaniem jednej z następujących metod:

a. metoda lasera dopplerowskiego;

b. metoda dyfrakcji laserowej.

2. W pozycji 9A350 'VMD' oznacza Volume Median Diameter (objętościowa mediana średnicy), a dla układów wodnych jest równoznaczna z Mass Median Diameter (MMD).

9B Urządzenia testujące, kontrolne i produkcyjne

9B001 Następujące urządzenia, oprzyrządowanie lub osprzęt specjalnie zaprojektowane do produkcji odlewów łopatek wirujących do silników turbogazowych, łopatek kierowniczych lub "bandaży" do wirników:

N.B. ZOB. TAKŻE POZYCJA 2B226.

a. urządzenia umożliwiające kierunkowe krzepnięcie lub odlewanie pojedynczych kryształów;

b. następujące narzędzia do odlewu, wytwarzane z ognioodpornych metali lub ceramiki:

1. rdzenie;

2. powłoki (formy);

3. połączone jednostki zawierające rdzenie i powłoki (formy);

c. urządzenia umożliwiające kierunkowe krzepnięcie lub wytwarzanie przyrostowe pojedynczych kryształów.

9B002 Pracujące w trybie bezpośrednim (w czasie rzeczywistym) systemy sterowania, oprzyrządowanie (łącznie z czujnikami) lub automatyczne systemy do zbierania i przetwarzania danych, spełniające wszystkie z poniższych kryteriów:

a. specjalnie zaprojektowane do "rozwoju" silników turbogazowych, ich zespołów lub elementów; oraz

b. wykorzystujące dowolną "technologię" wymienioną w pozycjach 9E003.h lub 9E003.i.

9B003 Urządzenia specjalnie zaprojektowane do "produkcji" lub testowania uszczelnień szczotkowych w turbinach gazowych wirujących z prędkościami obrotowymi odpowiadającymi prędkości liniowej wierzchołka łopatki powyżej 335 m/s i przy temperaturach przekraczających 773 K (500 °C) oraz specjalnie do nich zaprojektowane części lub akcesoria.

9B004 Oprzyrządowanie, matryce lub uchwyty do zgrzewania dyfuzyjnego "nadstopu", tytanu lub międzymetalicznych połączeń profili łopatkowych z tarczą, opisanych w pozycjach 9E003.a.3 lub 9E003.a.6 dla turbin gazowych.

9B005 Pracujące w trybie bezpośrednim (w czasie rzeczywistym) systemy sterowania, oprzyrządowanie (łącznie z czujnikami) lub automatyczne systemy do zbierania i przetwarzania danych, specjalnie zaprojektowane do stosowania w którychkolwiek z poniższych:

N.B. ZOB. TAKŻE POZYCJA 9B105.

a. tunele aerodynamiczne do prędkości Ma = 1,2 lub wyższych;

Uwaga: Pozycja 9B005.a nie obejmuje kontrolą tuneli aerodynamicznych zaprojektowanych do celów edukacyjnych i mających 'wymiar przestrzeni pomiarowej' (mierzony w kierunku poprzecznym) o wielkości poniżej 250 mm.

Uwaga techniczna:

'Wymiar przestrzeni pomiarowej' oznacza średnicę okręgu lub bok kwadratu lub dłuższy bok prostokąta w najszerszym miejscu przestrzeni pomiarowej.

b. urządzenia symulujące warunki przepływu przy prędkościach powyżej Ma = 5, łącznie z impulsowymi tunelami hiperdźwiękowymi, tunelami plazmowymi, rurami uderzeniowymi, tunelami uderzeniowymi, tunelami gazowymi i rurami uderzeniowymi na gazy lekkie; lub

c. tunele lub urządzenia aerodynamiczne, różne od urządzeń z sekcjami dwuwymiarowymi, umożliwiające symulację przepływów, dla których wartość liczby Reynoldsa wynosi powyżej 25 × 106.

9B006 Sprzęt do badań akustycznych wibracji, w którym można wytwarzać ciśnienia akustyczne na poziomie 160 dB lub wyższe (przy poziomie odniesienia 20 μΡa) o mocy wyjściowej 4 kW lub większej przy temperaturze w komorze pomiarowej powyżej 1 273 K (1 000 °C) oraz specjalnie do niego zaprojektowane grzejniki kwarcowe.

N.B. ZOB. TAKŻE POZYCJA 9B106.

9B007 Urządzenia specjalnie zaprojektowane do kontroli stanu silników rakietowych metodami nieniszczącymi (NDT), z wyłączeniem urządzeń do dwuwymiarowych badań rentgenowskich i badań za pomocą podstawowych metod chemicznych lub fizycznych.

9B008 Przetworniki bezpośrednich pomiarów tarcia w warstwie przyściennej specjalnie zaprojektowane do działania w badanym przepływie przy całkowitej temperaturze (spiętrzenia) powyżej 833 K (560 °C).

9B009 Oprzyrządowanie specjalnie zaprojektowane do wytwarzania elementów wirników silników turbogazowych z proszków metali, spełniające wszystkie z poniższych kryteriów:

a. zaprojektowane do pracy przy poziomie naprężeń stanowiącym 60 % wytrzymałości na rozciąganie (UTS) lub wyższym, mierzonym przy temperaturze 873 K (600 °C); oraz

b. zaprojektowane do pracy przy temperaturach wynoszących 873 K (600 °C) lub wyższych.

Uwaga: Pozycja 9B009 nie obejmuje kontrolą oprzyrządowania do wytwarzania proszków.

9B010 Sprzęt zaprojektowany specjalnie do wytwarzania obiektów wyszczególnionych w pozycji 9A012.

9B105 'Instalacje do testów aerodynamicznych' do prędkości Ma = 0,9 lub wyższych, nadające się do 'pocisków rakietowych' oraz ich podzespołów.

N.B. ZOB. TAKŻE POZYCJA 9B005.

Uwaga: Pozycja 9B105 nie obejmuje kontrolą tuneli aerodynamicznych przeznaczonych do osiągania prędkości nie wyższych niż 3 machy, mających 'wymiar przestrzeni pomiarowej' (mierzony w kierunku poprzecznym) o wielkości równej lub mniejszej niż 250 mm.

Uwagi techniczne:

1. W pozycji 9B105 'instalacje do testów aerodynamicznych' obejmują tunele aerodynamiczne i rury uderzeniowe do badania przepływu strumieni powietrza wokół obiektów.

2. W pozycji 9B105 'wymiar przestrzeni pomiarowej' oznacza średnicę okręgu lub bok kwadratu lub dłuższy bok prostokąta lub główną oś elipsy w najszerszym miejscu 'przekroju przestrzeni pomiarowej'. 'Przekrój poprzeczny przestrzeni pomiarowej' oznacza przekrój prostopadły do kierunku przepływu powietrza.

3. W pozycji 9B105 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu powyżej 300 km.

9B106 Następujące komory klimatyczne i komory bezechowe:

a. komory klimatyczne, spełniające wszystkie poniższe kryteria:

1. umożliwiające symulowanie dowolnych następujących warunków lotu:

a. warunków na wysokościach równych lub większych niż 15 km; lub

b. temperatury w zakresie od poniżej 223 K (- 50 °C) do powyżej 398 K (+ 125 °C); oraz

2. wyposażone we wstrząsarkę lub inny sprzęt do badań wibracji lub 'zaprojektowane lub zmodyfikowane' z myślą o wyposażeniu we wstrząsarkę lub taki sprzęt w celu generowania środowiska wibracyjnego o średniej wartości kwadratowej (RMS) na poziomie równym lub wyższym od 10 g przy pomiarach na 'nagim stole', o częstotliwości między 20 Hz a 2 kHz i generującego siły równe 5 kN lub większe;

Uwagi techniczne:

1. Pozycja 9B106.a.2 określa układy zdolne generować środowisko wibracyjne poprzez pojedynczą falę (np. falę sinusoidalną) oraz układy zdolne generować szerokopasmowe wibracje nieuporządkowane (tj. widmo mocy).

2. W pozycji 9B106.a.2 'zaprojektowane lub zmodyfikowane' oznacza, że komora klimatyczna zapewnia odpowiednie interfejsy (np. uszczelnienia), by zostać wyposażona we wstrząsarkę lub inny sprzęt do badań wibracji wyszczególniony w pozycji 2B116.

3. W pozycji 9B106.a.2. pojęcie 'nagi stół' oznacza płaski stół lub powierzchnię, bez osprzętu i wyposażenia.

b. komory klimatyczne umożliwiające symulowanie następujących warunków lotu:

1. warunków akustycznych, w których całkowity poziom ciśnienia akustycznego wynosi 140 dB lub więcej (przy poziomie odniesienia 20 μΡa) lub o mocy wyjściowej 4 kW lub większej; oraz

2. warunków na wysokościach równych lub większych niż 15 km; lub

3. temperatury w zakresie od poniżej 223 K (- 50 °C) do powyżej 398 K (+ 125 °C);

9B107 'Instalacje do testów aerotermodynamicznych' nadające się do 'pocisków rakietowych', systemów napędu 'pocisków rakietowych' oraz statków kosmicznych zdolnych do lądowania na ziemi i ich podzespołów wyszczególnionych w pozycji 9A116, posiadające którąkolwiek z następujących cech:

a. zasilanie elektryczne o mocy równej lub większej niż 5 MW; lub

b. łączne ciśnienie zasilania gazem równe lub większe niż 3 MPa.

Uwagi techniczne:

1. 'Instalacje do testów aerodynamicznych' obejmują urządzenia generujące łuk plazmowy i plazmowe tunele aerodynamiczne do badania termicznych i mechanicznych skutków przepływu strumieni powietrza wokół obiektów.

2. W pozycji 9B107 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu powyżej 300 km.

9B115 Specjalne "urządzenia produkcyjne" do systemów, podsystemów i podzespołów wymienionych w pozycjach 9A005 do 9A009, 9A011, 9A101, 9A102, 9A105 do 9A109. 9A111, 9A116 do 9A120.

9B116 "Instalacje produkcyjne" specjalnie zaprojektowane do kosmicznych pojazdów nośnych wyszczególnionych w pozycji 9A004 lub systemów, podsystemów i elementów wymienionych w pozycjach 9A005 do 9A009, 9A011, 9A101, 9A102, 9A104 do 9A109, 9A111 lub 9A116 do 9A120 lub 'pocisków rakietowych'.

Uwaga techniczna:

W pozycji 9B116 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

9B117 Stoiska do prób i stoiska badawcze do rakiet na paliwo stałe lub ciekłe lub do silników rakietowych, mające jedną z następujących cech:

a. możliwość prowadzenia badań przy wielkościach ciągu powyżej 68 kN; lub

b. możliwość równoczesnego pomiaru składowych ciągu wzdłuż trzech osi.

9C Materiały

9C108 Materiały do "izolacji" luzem i "wykładziny wewnętrzne", poza wyszczególnionymi w pozycji 9A008, do osłon silników rakietowych, które można wykorzystać w "pociskach rakietowych" lub które specjalnie zaprojektowano do silników rakietowych na paliwo stałe wymienionych w pozycji 9A007 lub 9A107.

9C110 Maty z włókien, impregnowane żywicami, i materiały z włókien powlekanych metalem do tych mat, do produkcji struktur kompozytowych, laminatów i wyrobów wyszczególnionych w poz. 9A110, wytwarzane zarówno na matrycach organicznych, jak i metalowych wykorzystujących wzmocnienia włóknami lub materiałami włókienkowymi, mające "wytrzymałość właściwą na rozciąganie" większą niż 7,62 × 104 i "moduł właściwy" większy niż 3,18 × 106 m.

N.B. ZOB. TAKŻE POZYCJE 1C010 I 1C210.

Uwaga: Jedynymi matami z włókien impregnowanych żywicami, których dotyczy pozycja 9C110, są te, w których zastosowano żywice o temperaturze zeszklenia (Tg) po utwardzeniu przekraczającej 418 K (145 °C), jak określono w ASTM D4065 lub jej odpowiedniku.

9D Oprogramowanie

9D001 "Oprogramowanie", niewyszczególnione w pozycji 9D003 lub 9D004, specjalnie zaprojektowane lub zmodyfikowane do "rozwoju" sprzętu lub "technologii", wymienionych w 9A001 do 9A119, 9B lub 9E003.

9D002 "Oprogramowanie", niewyszczególnione w pozycji 9D003 lub 9D004, specjalnie opracowane lub zmodyfikowane do "produkcji" urządzeń objętych kontrolą według pozycji 9A001 do 9A119 lub 9B.

9D003 "Oprogramowanie" zawierające "technologię" objętą kontrolą według pozycji 9E003.h i wykorzystywane do "całkowicie autonomicznych systemów cyfrowego sterowania silnikami" ("systemów FADEC") objętych kontrolą według pozycji 9 A lub w urządzeniach objętych kontrolą według pozycji 9B.

9D004 Następujące inne "oprogramowanie":

a. "oprogramowanie" uwzględniające składowe sił lepkości w dwóch lub trzech wymiarach, zweryfikowane na podstawie badań w tunelach aerodynamicznych lub badań w locie, niezbędne do szczegółowego modelowania przepływu w silnikach;

b. "oprogramowanie" do badania turbogazowych silników lotniczych, zespołów lub elementów do nich, spełniające wszystkie poniższe kryteria:

1. specjalnie zaprojektowane do badania którychkolwiek z poniższych:

a. turbogazowych silników lotniczych, zespołów lub elementów do nich, obejmujących "technologie" określone w pozycjach 9E003.a., 9E003.h. lub 9E003.i.; lub

b. sprężarek wielostopniowych zapewniających przepływ zewnętrzny lub wewnętrzny, specjalnie zaprojektowanych do turbogazowych silników lotniczych obejmujących "technologie" określone w pozycjach 9E003.a. lub 9E003.h.; oraz

2. specjalnie zaprojektowane do wszystkich poniższych funkcji:

a. zbieranie i przetwarzanie danych w czasie rzeczywistym; oraz

b. sterowanie ze sprzężeniem zwrotnym elementami lub warunkami badań (np. temperaturą, ciśnieniem, natężeniem przepływu) w czasie trwania testów;

Uwaga: Pozycja 9D004.b. nie obejmuje kontrolą oprogramowania do eksploatacji instalacji do testów ani do zapewnienia bezpieczeństwa operatora (np. wyłączenia przy nadmiernej prędkości, wykrywania i zwalczania ognia) ani do testów odbiorczych dotyczących produkcji, naprawy lub konserwacji ograniczonych do stwierdzenia, czy element został odpowiednio złożony lub naprawiony.

c. "oprogramowanie" specjalnie zaprojektowane do sterowania ukierunkowanym krzepnięciem lub wytwarzaniem pojedynczych kryształów w urządzeniach wyszczególnionych w pozycji 9B001.a. lub 9B001.c.;

d. nieużywane;

e. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do obsługi obiektów wyszczególnionych w pozycji 9A012;

f. "oprogramowanie" specjalnie zaprojektowane do projektowania wewnętrznych kanałów chłodzących łopatek wirujących, łopatek kierowniczych i "bandaży" turbogazowych silników lotniczych;

g. "oprogramowanie" spełniające wszystkie poniższe kryteria:

1. specjalnie zaprojektowane do przewidywania warunków aerotermodynamicznych, aeromechanicznych oraz warunków spalania w turbogazowych silnikach lotniczych; oraz

2. umożliwiające teoretyczne prognozy modelowania warunków aerotermodynamicznych, aeromechanicznych oraz warunków spalania, które zostały potwierdzone przez rzeczywiste dane z osiągów (eksperymentalne lub produkcyjne) turbogazowego silnika lotniczego.

9D005 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do obsługi obiektów wymienionych w pozycji 9A004.e. lub 9A004.f.

9D101 "Oprogramowanie" specjalnie zaprojektowane do "użytkowania" wyrobów wymienionych w pozycjach 9B105, 9B106, 9B116 lub 9B117.

9D103 "Oprogramowanie" specjalnie zaprojektowane do modelowania, symulowania lub integrowania konstrukcyjnego kosmicznych pojazdów nośnych wyszczególnionych w pozycji 9A004, rakiet meteorologicznych wyszczególnionych w pozycji 9A104 lub "pocisków rakietowych" lub podsystemów wyszczególnionych w pozycjach 9A005, 9A007, 9A105, 9A106.c, 9A107, 9A108.c, 9A116 lub 9A119.

Uwaga: "Oprogramowanie" wyszczególnione w pozycji 9D103 podlega kontroli, jeśli jest specjalnie zaprojektowane do sprzętu wymienionego w pozycji 4A102.

9D104 Następujące "oprogramowanie":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do "użytkowania" towarów wyszczególnionych w pozycjach 9A001, 9A005, 9A006.d, 9A006.g, 9A007.a, 9A009.a, 9A010.d, 9A011, 9A101, 9A102, 9A105, 9A106.d, 9A107, 9A109, 9A111, 9A115.a, 9A117 lub 9A118;

b. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do celów obsługi lub konserwacji podsystemów lub urządzeń wyszczególnionych w pozycjach 9A008.d., 9A106.c., 9A108.c. lub 9A116.d.

9D105 "Oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do koordynowania funkcji więcej niż jednego podsystemu, inne niż określone w pozycji 9D004.e., w pojazdach kosmicznych określonych w pozycji 9A004 lub rakietach meteorologicznych wyszczególnionych w pozycji 9A104 lub w 'pociskach rakietowych'.

Uwaga: Pozycja 9D105 obejmuje następujące "oprogramowanie" specjalnie zaprojektowane do załogowych "statków powietrznych" przekształconych do funkcjonowania jako "bezzałogowe statki powietrzne":

a. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane w celu zintegrowania sprzętu służącego do przekształcenia z funkcjami systemowymi "statku powietrznego"; oraz

b. "oprogramowanie" specjalnie zaprojektowane lub zmodyfikowane do obsługi "statku powietrznego" jako "bezzałogowego statku powietrznego".

Uwaga techniczna:

W pozycji 9D105 'pocisk rakietowy' oznacza kompletne systemy rakietowe i systemy bezzałogowych statków powietrznych o zasięgu przekraczającym 300 km.

9E Technologia

Uwaga: "Technologie" do "rozwoju" lub "produkcji" wyszczególnione w pozycji 9E001 do 9E003 dotyczące silników turbogazowych podlegają kontroli, również w przypadku kiedy są stosowane do napraw lub remontów. Kontroli nie podlegają: dane techniczne, rysunki lub dokumentacja do czynności związanych z obsługą techniczną bezpośrednio dotyczącą wzorcowania, usuwania lub wymiany uszkodzonych lub niezdatnych do użytku elementów wymiennych, łącznie z całymi silnikami lub modułami silnikowymi.

9E001 "Technologie" według uwagi ogólnej do technologii do "rozwoju" urządzeń lub "oprogramowania" objętego kontrolą według pozycji 9A001.b, 9A004 do 9A012, 9A350, 9B lub 9D.

9E002 "Technologie" według uwagi ogólnej do technologii do "produkcji" urządzeń wymienionych w pozycjach 9A001.b, 9A004 do 9A011, 9A350 lub 9B.

N.B. Na potrzeby kontroli technologii napraw konstrukcji, laminatów lub materiałów zob. pozycję 1E002.f.

9E003 Inne "technologie", takie jak:

a. "technologie" niezbędne do "rozwoju" lub "produkcji" dowolnego z następujących elementów i zespołów do silników turbogazowych:

1. łopatek wirujących, łopatek kierowniczych lub "bandaży" do turbin gazowych, wytwarzanych techniką ukierunkowanego krzepnięcia (DS) lub ze stopów monokrystalicznych (SC) i mających (w kierunku 001 wskaźników Millera) czas życia do zerwania przy pełzaniu przekraczający 400 godzin przy 1 273 K (1 000 °C) i naprężeniu 200 MPa, oparty na średnich wartościach właściwości fizycznych;

Uwaga techniczna:

Do celów pozycji 9E003.a.1 badanie czasu życia do zerwania przy pełzaniu przeprowadza się na próbce do badań.

2. komór spalania spełniających którekolwiek z poniższych kryteriów:

a. 'izolowane termicznie wykładziny' zaprojektowane do pracy w 'temperaturze na wylocie komory spalania' przekraczającej 1 883 K (1 610 °C);

b. wykładziny niemetaliczne;

c. powłoki niemetaliczne; lub

d. wykładziny zaprojektowane do pracy w 'temperaturze na wylocie komory spalania' przekraczającej 1 883 K (1 610 °C), w których znajdują się otwory zgodne z parametrami określonymi w pozycji 9E003.c.;

Uwaga: "Technologia" wymagana w odniesieniu do otworów w pozycji 9E003.a.2. ograniczona jest do pochodzenia geometrii i rozmieszczenia otworów.

Uwagi techniczne:

1. 'Izolowane termicznie wykładziny' to wykładziny, które posiadają co najmniej strukturę wspierającą przeznaczoną do przenoszenia obciążeń mechanicznych i strukturę ochronną wobec spalania przeznaczoną do ochrony struktury wspierającej przed ciepłem pochodzącym ze spalania. Struktura ochronna i struktura wspierająca wykazują niezależne od siebie wielkości przemieszczenia wynikającego ze zmian termicznych (mechaniczne przemieszczenia z tytułu obciążenia termicznego), tj. są one termicznie izolowane.

2. 'Temperatura na wylocie komory spalania' jest średnią objętościową całkowitej temperatury (stagnacji) strumienia gazu między płaszczyzną wylotu komory spalania a krawędzią natarcia wlotowych łopatek kierowniczych turbiny (tj. mierzoną na stanowisku silnika T40 zgodnie z definicją w SAE ARP 755 A), gdy silnik działa w 'trybie stanu ustalonego' pracy w certyfikowanej maksymalnej ciągłej temperaturze roboczej.

N.B. Technologia wymagana do wytwarzania otworów chłodzących - zob. pozycja 9E003.c.

3. elementów wytwarzanych z któregokolwiek z poniższych:

a. wytwarzanych z organicznych materiałów "kompozytowych", zaprojektowanych do pracy w temperaturach powyżej 588 K (315 °C);

b. wytwarzanych z któregokolwiek z poniższych:

1. "materiałów kompozytowych" na "matrycy" metalowej wzmocnionych którymkolwiek z poniższych materiałów:

a. materiałami określonymi w pozycji 1C007;

b. "materiałami włóknistymi lub włókienkowymi" określonymi w pozycji 1C010; lub

c. glinkami określonymi w pozycji 1C002.a.; lub

2. "materiałów kompozytowych" na "matrycy" ceramicznej określonych w pozycji 1C007; lub

c. Stojany, łopatki kierownicze, łopatki, bandaże, obrotowe wieńce łopatkowe, obrotowe tarcze łopatkowe lub 'przewody rozdzielające', które spełniają wszystkie poniższe kryteria:

1. nie są wyszczególnione w pozycji 9E003.a.3.a.;

2. są zaprojektowane do sprężarek lub wentylatorów; oraz

3. są wytwarzane z materiału określonego w pozycji 1C010.e. z żywicami określonymi w pozycji 1C008;

Uwaga techniczna:

'Przewód rozdzielający' zapewnia wstępne rozdzielenie przepływu mas powietrza między kanałem zewnętrznym a kanałem wewnętrznym silnika.

4. niechłodzonych łopatek turbinowych, łopatek kierowniczych lub "bandaży" przeznaczonych do pracy w 'strumieniu gazu o temperaturze' 1 373 K (1 100 °C) lub wyższej;

5. chłodzonych łopatek wirujących, łopatek kierowniczych, "bandaży" innych niż opisane w pozycji 9E003.a.1., zaprojektowanych do pracy w 'strumieniu gazu o temperaturze' 1 693 K (1 420 °C) lub wyższej;

Uwaga techniczna:

'Temperatura strumienia gazu' jest średnią objętościową całkowitej temperatury (stagnacji) strumienia gazu na płaszczyźnie krawędzi wlotu części turbiny, gdy silnik działa w 'trybie stanu ustalonego' pracy w certyfikowanej lub określonej maksymalnej ciągłej temperaturze roboczej.

6. połączeń profili łopatkowych z tarczą techniką zgrzewania w stanie stałym;

7. elementów silników turbogazowych wytwarzanych techniką "zgrzewania dyfuzyjnego" objętą kontrolą według pozycji 2E003.b;

8. 'wytrzymałych na uszkodzenia' elementów wirników silników turbogazowych, wytwarzanych techniką metalurgii proszkowej objętą kontrolą według pozycji 1C002.b; lub

Uwaga techniczna:

'Wytrzymałe na uszkodzenia' elementy składowe są projektowane z użyciem metodologii i uzasadnień mających na celu przewidywanie i ograniczanie powstawania spękań.

9. nieużywane;

10. nieużywane;

11. drążonych (pustych w środku) łopatek wentylatorowych;

b. technologie wymagane do "rozwoju" lub "produkcji" któregokolwiek z poniższych:

1. modeli lotniczych do tuneli aerodynamicznych wyposażonych w czujniki nieinwazyjne zdolne do przenoszenia danych z czujników do systemu gromadzenia i przetwarzania danych; lub

2. wykonanych z materiałów "kompozytowych" łopat śmigieł lub śmigłowentylatorów zdolnych do rozwijania mocy 2 000 kW przy prędkościach lotu powyżej Ma = 0,55;

c. technologie wymagane do produkcji otworów chłodzących, w elementach silników turbogazowych wykorzystujących którekolwiek z technologii wymienionych w pozycjach 9E003.a.1., 9E003.a.2. lub 9E003.a.5., i spełniających którekolwiek z poniższych kryteriów:

1. spełniające wszystkie z poniższych kryteriów:

a. minimalne 'pole przekroju poprzecznego' mniejsze niż 0,45 mm2;

b. 'współczynnik kształtu otworu' większy niż 4,52; oraz

c. 'kąt osi otworu' równy lub mniejszy niż 25 o; lub

2. spełniające wszystkie z poniższych kryteriów:

a. minimalne 'pole przekroju poprzecznego' mniejsze niż 0,12 mm2;

b. 'współczynnik kształtu otworu' większy niż 5,65; oraz

c. 'kąt osi otworu' powyżej 25 o;

Uwaga: Pozycja 9E003.c. nie obejmuje kontrolą "technologii" wytwarzania otworów cylindrycznych o stałym promieniu, które są proste na całej długości oraz zaczynają się i kończą na zewnętrznych powierzchniach elementu.

Uwagi techniczne:

1. Do celów pozycji 9E003.c., 'pole przekroju poprzecznego' oznacza powierzchnię otworu w płaszczyźnie prostopadłej do osi otworu.

2. Do celów pozycji 9E003.c., 'współczynnik kształtu otworu' oznacza nominalną długość osi otworu podzieloną przez pierwiastek kwadratowy jego minimalnego 'pola przekroju poprzecznego'.

3. Dla celów pozycji 9E003.c 'kąt osi otworu' oznacza kąt ostry mierzony między płaszczyzną styczną do powierzchni profilu a osią otworu w punkcie, w którym oś otworu przebija powierzchnię profilu.

4. Do metod wytwarzania otworów, o których mowa w pozycji 9E003.c, należą obróbka wiązką "lasera", obróbka strumieniem wody, obróbka elektrochemiczna (ECM) i obróbka elektroiskrowa (EDM).

d. "technologie" "niezbędne" do "rozwoju" lub "produkcji" układów przenoszenia napędu w śmigłowcach lub układów przenoszenia napędu w "statkach powietrznych" z odchylanymi wirnikami lub skrzydłami;

e. "technologie" do "rozwoju" lub "produkcji" systemów napędowych pojazdów naziemnych wykorzystujących wysokoprężne silniki tłokowe spełniające wszystkie poniższe kryteria:

1. 'objętość komory silnikowej' 1,2 m3 lub mniejsza;

2. całkowita moc użyteczna powyżej 750 kW, określana według normy 80/1269/EEC, ISO 2534 lub ich krajowych odpowiedników; oraz

3. gęstość mocy powyżej 700 kW/m3 'objętości komory silnikowej';

Uwaga techniczna:

'Objętość komory silnikowej' w pozycji 9E003.e oznacza iloczyn trzech prostopadłych do siebie wymiarów mierzonych w następujący sposób:

Długość: długość wału korbowego od kołnierza przedniego do czoła koła zamachowego;

Szerokość: największy z następujących wymiarów:

a. odległość zewnętrzna od pokrywy zaworów do pokrywy zaworów;

b. wymiary zewnętrznych krawędzi głowic cylindrów; lub

c. średnica obudowy koła zamachowego;

Wysokość: największy z następujących wymiarów:

a. odległość od osi wału korbowego do górnej płaszczyzny pokrywy zaworów (lub głowicy cylindrów) plus podwójny skok; lub

b. średnica obudowy koła zamachowego.

f. następujące "technologie" "niezbędne" do "produkcji" elementów zaprojektowanych specjalnie do silników wysokoprężnych o wysokich osiągach:

1. "technologie" "niezbędne" do "produkcji" instalacji silnikowych wyposażonych we wszystkie następujące elementy wykonane z materiałów ceramicznych wyszczególnionych w pozycji 1C007:

a. wkładki do cylindrów;

b. tłoki;

c. głowice cylindrów; oraz

d. jeden lub więcej innych elementów (łącznie ze szczelinami wylotowymi, turbodoładowarkami, prowadnicami zaworów, zespołami zaworów lub izolowanymi wtryskiwaczami paliwa);

2. "technologie" "niezbędne" do "produkcji" układów do turbodoładowania wyposażonych w sprężarki jednostopniowe i spełniające wszystkie poniższe kryteria:

a. sprężanie (stopień sprężania) 4:1 lub wyższy;

b. wydatek (masowe natężenie przepływu) w zakresie od 30 do 130 kg na minutę; oraz

c. możliwość zmiany pola przep